body.mobile-agent * {
    /* Hide scrollbars for all elements */
    -ms-overflow-style: none; /* IE and Edge */
    scrollbar-width: none; /* Firefox */
}

body.mobile-agent *::-webkit-scrollbar {
    /* Hide scrollbars for Webkit browsers like Chrome and Safari */
    display: none;
}

body.mobile-agent {
    -webkit-overflow-scrolling: touch; /* Smooth scrolling on touch devices */
}

:root {
    --bs-blue: #0d6efd;
    --bs-indigo: #6610f2;
    --bs-purple: #6f42c1;
    --bs-pink: #d63384;
    --bs-red: #dc3545;
    --bs-orange: #fd7e14;
    --bs-yellow: #ffc107;
    --bs-green: #198754;
    --bs-teal: #20c997;
    --bs-cyan: #0dcaf0;
    --bs-black: #000;
    --bs-white: #fff;
    --bs-gray: #6c757d;
    --bs-gray-dark: #343a40;
    --bs-gray-100: #f8f9fa;
    --bs-gray-200: #e9ecef;
    --bs-gray-300: #dee2e6;
    --bs-gray-400: #ced4da;
    --bs-gray-500: #adb5bd;
    --bs-gray-600: #6c757d;
    --bs-gray-700: #495057;
    --bs-gray-800: #343a40;
    --bs-gray-900: #212529;
    --bs-primary: #0056B4;
    --bs-secondary: #6c757d;
    --bs-success: #198754;
    --bs-info: #0dcaf0;
    --bs-warning: #ffc107;
    --bs-danger: #dc3545;
    --bs-light: #f8f9fa;
    --bs-dark: #212529;
    --bs-primary-rgb: 8, 86, 180;
    --bs-secondary-rgb: 108, 117, 125;
    --bs-success-rgb: 25, 135, 84;
    --bs-info-rgb: 13, 202, 240;
    --bs-warning-rgb: 255, 193, 7;
    --bs-danger-rgb: 220, 53, 69;
    --bs-light-rgb: 248, 249, 250;
    --bs-dark-rgb: 33, 37, 41;
    --bs-white-rgb: 255, 255, 255;
    --bs-black-rgb: 0, 0, 0;
    --bs-body-color-rgb: 33, 37, 41;
    --bs-body-bg-rgb: 255, 255, 255;
    --bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
    --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
    --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
    --bs-body-font-family: var(--bs-font-sans-serif);
    --bs-body-font-size: 1rem;
    --bs-body-font-weight: 400;
    --bs-body-line-height: 1.5;
    --bs-body-color: #212529;
    --bs-body-bg: #fff;
    --bs-border-width: 1px;
    --bs-border-style: solid;
    --bs-border-color: #dee2e6;
    --bs-border-color-translucent: rgba(0, 0, 0, 0.175);
    --bs-border-radius: 0.375rem;
    --bs-border-radius-sm: 0.25rem;
    --bs-border-radius-lg: 0.5rem;
    --bs-border-radius-xl: 1rem;
    --bs-border-radius-2xl: 2rem;
    --bs-border-radius-pill: 50rem;
    --bs-link-color: #0d6efd;
    --bs-link-hover-color: #0a58ca;
    --bs-code-color: #d63384;
    --bs-highlight-bg: #fff3cd;

    --color-neutral-night: #1E2533;
    --color-neutral-dusk: #283245;
    --color-neutral-darker: #4F596B;
    --color-neutral-dark: #778090;
    --color-neutral-medium: #A0A7B4;
    --color-neutral-light: #CACFD7;
    --color-neutral-lighter: #F2F2F6;
    --color-neutral-day: #FFFFFF;

    --color-primary-darker: #082B52;
    --color-primary-dark: #064181;
    --color-primary-medium: #0056B4;
    --color-primary-light: #709FEE;
    --color-primary-lighter: #E0EAFF;

    --color-success-darker: #004931;
    --color-success-dark: #006848;
    --color-success-medium: #03845D;
    --color-success-light: #73CDAD;
    --color-success-lighter: #E6F9F1;

    --color-warning-darker: #6E4916;
    --color-warning-dark: #A06D26;
    --color-warning-medium: #CE903A;
    --color-warning-light: #F8C57E;
    --color-warning-lighter: #FFF5E6;
    --color-group: #ce9039;

    --color-danger-darker: #691212;
    --color-danger-dark: #982020;
    --color-danger-medium: #C33232;
    --color-danger-light: #F27A7A;
    --color-danger-lighter: #FFE6E6;

    --color-red-dark: #942630;
    --color-red-medium: #E84E5C;
    --color-red-light: #FFCCD2;

    --color-orange-dark: #953B15;
    --color-orange-medium: #E76935;
    --color-orange-light: #FFDACC;

    --color-yellow-dark: #997300;
    --color-yellow-medium: #E76935;
    --color-yellow-light: #FFFACC;

    --color-grass-dark: #5F8906;
    --color-grass-medium: #98D21C;
    --color-grass-light: #F1FFCC;

    --color-green-dark: #036E29;
    --color-green-medium: #E76935;

    --color-green-dark: #036E29;
    --color-green-medium: #E76935;
    --color-green-light: #CCFDD6;

    --color-teal-dark: #007978;
    --color-teal-medium: #0DB8B7;
    --color-teal-light: #CCFFFF;

    --color-blue-dark: #15588C;
    --color-blue-medium: #3390D9;
    --color-blue-light: #CCEBFF;

    --color-purple-dark: #503794;
    --color-purple-medium: #8B68E9;
    --color-purple-light: #E2D4FF;


    --mdb-card-spacer-y: 1.5rem;
    --mdb-card-spacer-x: 1.5rem;
    --mdb-card-title-spacer-y: 0.5rem;
    --mdb-card-border-width: 1px;
    --mdb-card-border-color: var(--mdb-border-color-translucent);
    --mdb-card-border-radius: 0.5rem;
    --mdb-card-box-shadow: 0 2px 15px -3px rgba(0, 0, 0, 0.07), 0 10px 20px -2px rgba(0, 0, 0, 0.04);
    --mdb-card-inner-border-radius: calc(0.5rem - 1px);
    --mdb-card-cap-padding-y: 0.75rem;
    --mdb-card-cap-padding-x: 1.5rem;
    --mdb-card-cap-bg: hsla(0, 0%, 100%, 0);
    --mdb-card-bg: var(--color-group);
    --mdb-card-img-overlay-padding: 1.5rem;
    --mdb-card-group-margin: 0.75rem;
}

/* Styles */
.title-extra-huge {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 48px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    font-variation-settings: 'slnt' 0;
}

.title-huge {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 32px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
}

.title-standard {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 24px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
}

.title-section {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 20px;
    line-height: 157%;
    font-feature-settings: 'liga' off;
}

.title-heading {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
}

.title-heading-sm {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 137%;
    font-feature-settings: 'liga' off;
}

.title-heading-xs {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 400;
    font-size: 14px;
    line-height: 138%;
    font-feature-settings: 'liga' off;
}

.title-subheading {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 12px;
    line-height: 129.5%;
    display: flex;
    align-items: center;
    letter-spacing: 0.1em;
    text-transform: uppercase;
    font-feature-settings: 'liga' off;
}

.paragraph-body {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 20px;
    line-height: 140%;
    display: flex;
    align-items: center;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
}

.paragraph-body-md {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
    display: flex;
    align-items: center;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
}

.paragraph-body-sm {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 140.5%;
    display: flex;
    align-items: center;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
}

.paragraph-caption {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 160%;
    display: flex;
    align-items: center;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
}

/* Colors */
.color-neutral-night { color: var(--color-neutral-night) }
.color-neutral-dusk { color: var(--color-neutral-dusk) }
.color-neutral-darker { color: var(--color-neutral-darker) }
.color-neutral-dark { color: var(--color-neutral-dark) }
.color-neutral-medium { color: var(--color-neutral-medium) }
.color-neutral-light { color: var(--color-neutral-light) }
.color-neutral-lighter { color: var(--color-neutral-lighter) }
.color-neutral-day { color: var(--color-neutral-day) }
.color-primary-darker { color: var(--color-primary-darker) }
.color-primary-dark { color: var(--color-primary-dark) }
.color-primary-medium { color: var(--color-primary-medium) }
.color-primary-light { color: var(--color-primary-light) }
.color-primary-lighter { color: var(--color-primary-lighter) }
.color-success-darker { color: var(--color-success-darker) }
.color-success-dark { color: var(--color-success-dark) }
.color-success-medium { color: var(--color-success-medium) }
.color-success-lighter { color: var(--color-success-lighter) }
.color-warning-darker { color: var(--color-warning-darker) }
.color-warning-dark { color: var(--color-warning-dark) }
.color-warning-medium { color: var(--color-warning-medium) }
.color-warning-light { color: var(--color-warning-light) }
.color-warning-lighter { color: var(--color-warning-lighter) }
.color-group { color: var(--color-group) }
.color-danger-darker { color: var(--color-danger-darker) }
.color-danger-dark { color: var(--color-danger-dark) }
.color-danger-medium { color: var(--color-danger-medium) }
.color-danger-light { color: var(--color-danger-light) }
.color-danger-lighter { color: var(--color-danger-lighter) }
.color-red-dark { color: var(--color-red-dark) }
.color-red-medium { color: var(--color-red-medium) }
.color-red-light { color: var(--color-red-light) }
.color-orange-dark { color: var(--color-orange-dark) }
.color-orange-medium { color: var(--color-orange-medium) }
.color-orange-light { color: var(--color-orange-light) }
.color-yellow-dark { color: var(--color-yellow-dark) }
.color-yellow-medium { color: var(--color-yellow-medium) }
.color-yellow-light { color: var(--color-yellow-light) }
.color-grass-dark { color: var(--color-grass-dark) }
.color-grass-medium { color: var(--color-grass-medium) }
.color-grass-light { color: var(--color-grass-light) }
.color-green-dark { color: var(--color-green-dark) }
.color-green-medium { color: var(--color-green-medium) }
.color-green-dark { color: var(--color-green-dark) }
.color-green-medium { color: var(--color-green-medium) }
.color-green-light { color: var(--color-green-light) }
.color-teal-dark { color: var(--color-teal-dark) }
.color-teal-medium { color: var(--color-teal-medium) }
.color-teal-light { color: var(--color-teal-light) }
.color-blue-dark { color: var(--color-blue-dark) }
.color-blue-medium { color: var(--color-blue-medium) }
.color-blue-medium { color: var(--color-blue-medium) }
.color-purple-dark { color: var(--color-purple-dark) }
.color-purple-medium { color: var(--color-purple-medium) }
.color-purple-medium { color: var(--color-purple-medium) }
.color-purple-light { color: var(--color-purple-light) }

/*.group-field-history-border {*/
/*    border-bottom: 1px solid var(--color-group);*/
/*}*/

.group-field-item {
    border-left: 1px solid var(--color-group);
    padding-left: 5px;
}

.group-field .card {
    position: relative;
    display: flex;
    flex-direction: column;
    min-width: 0;
    height: var(--mdb-card-height);
    word-wrap: break-word;
    background-color: var(--mdb-card-bg);
    background-clip: border-box;
    border: var(--mdb-card-border-width) solid var(--mdb-card-border-color);
    border-radius: var(--mdb-card-border-radius);
    box-shadow: var(--mdb-card-box-shadow);
}

.group-field-label.group-order {
    background: #d4ac74;
    padding: 3px 10px;
    border-radius: 50%;
}

.group-field .card .card-body {
    flex: 1 1 auto;
    padding: var(--mdb-card-spacer-y) var(--mdb-card-spacer-x);
    color: var(--bs-white);
}

.group-field .card .card-body .group-field-label {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
}

.form-group.field-in-a-group,
.field-in-a-group .form-field {
    border-left: 5px solid var(--mdb-card-bg) !important;
}

.form-business .field-in-a-group .form-field {
    padding-left: 5px;
}

.history-menu.dropdown {
    margin-left: 6% !important;
}

.history-menu a {
    border: 1px solid #CACFD7;
    border-radius: 4px;
}

.history-menu-content .tab-pane {
    padding-left: 7%;
    padding-top: 2.1rem;
}

.history-media-box {
    box-sizing: border-box;
    width: 90px;
    height: 90px;
    background: var(--color-neutral-lighter);
    border: 1px solid #CACFD7;
    border-radius: 4px;
    margin-right: 10px;
    margin-bottom: 10px;
    cursor: pointer;
}

.history-media-box img {
    max-width: 100%;
    max-height: 100%;
    display: block; /* remove extra space below image */
}

.history-media-overlay-text {
    position: absolute;
    top: 5px;
    left: 8px;
}

.bootbox.modal.bootbox-confirm.in {
    z-index: 10000;
}

.js-snackbar__message a {
    color: var(--bs-orange);
}

/* Drawer */

.drawer {
    display: none;
}

.drawer__overlay {
    position: fixed;
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    width: 100%;
    z-index: 200;
    opacity: 0;

    transition: opacity 0.3s;
    will-change: opacity;
    background-color: #000;

    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
}

.drawer__header {
    /* Optional */
    padding: 0.5rem 1.7rem;
    display: flex;
    justify-content: space-between;
    align-items: center;
    border-bottom: 1px solid #ddd;
}

.drawer__close {
    /* Optional */
    margin: 0;
    padding: 0;
    border: none;
    background-color: transparent;
    cursor: pointer;
    background-image: url("data:image/svg+xml,%0A%3Csvg width='15px' height='16px' viewBox='0 0 15 16' version='1.1' xmlns='http://www.w3.org/2000/svg' xmlns:xlink='http://www.w3.org/1999/xlink'%3E%3Cg id='Page-1' stroke='none' stroke-width='1' fill='none' fill-rule='evenodd'%3E%3Cg id='2.-Menu' transform='translate(-15.000000, -13.000000)' stroke='%23000000'%3E%3Cg id='Group' transform='translate(15.000000, 13.521000)'%3E%3Cpath d='M0,0.479000129 L15,14.2971819' id='Path-3'%3E%3C/path%3E%3Cpath d='M0,14.7761821 L15,-1.24344979e-14' id='Path-3'%3E%3C/path%3E%3C/g%3E%3C/g%3E%3C/g%3E%3C/svg%3E");
    width: 15px;
    height: 15px;
    flex-shrink: 0;
    margin-left: 1rem;
}

.drawer__wrapper {
    position: fixed;
    top: 0;
    right: 0;
    bottom: 0;
    height: 100%;
    width: 100%;
    max-width: 500px;
    z-index: 9999;
    overflow: auto;

    transition: transform 0.3s;
    will-change: transform;
    background-color: #fff;

    display: flex;
    flex-direction: column;

    -webkit-transform: translate3d(103%, 0, 0);
    transform: translate3d(103%, 0, 0); /* extra 3% because of box-shadow */

    -webkit-overflow-scrolling: touch; /* enables momentum scrolling in iOS overflow elements */

    /* Optional */
    box-shadow: 0 2px 6px #777;
}

.drawer__content {
    position: relative;
    overflow-x: hidden;
    overflow-y: auto;
    height: 100%;
    flex-grow: 1;
    /* Optional */
    padding: 1.5rem;
}

.drawer--left .drawer__wrapper {
    left: 0;
    right: auto;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
}

.drawer.is-active {
    display: block;
}

.drawer.is-visible .drawer__wrapper {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
}

.drawer.is-visible .drawer__overlay {
    opacity: 0.5;
}

.document-results.row > [class*="col-"] {
    padding: 0 5px;
}

.document-name-elipises {
    overflow: hidden;
    text-overflow: ellipsis;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
}

.card {
    --bs-card-spacer-y: 1rem;
    --bs-card-spacer-x: 1rem;
    --bs-card-title-spacer-y: 0.5rem;
    --bs-card-border-width: 1px;
    --bs-card-border-color: var(--bs-border-color-translucent);
    --bs-card-border-radius: 0.375rem;
    --bs-card-box-shadow: ;
    --bs-card-inner-border-radius: calc(0.375rem - 1px);
    --bs-card-cap-padding-y: 0.5rem;
    --bs-card-cap-padding-x: 1rem;
    --bs-card-cap-bg: rgba(0, 0, 0, 0.03);
    --bs-card-cap-color: ;
    --bs-card-height: ;
    --bs-card-color: ;
    --bs-card-bg: #fff;
    --bs-card-img-overlay-padding: 1rem;
    --bs-card-group-margin: 0.75rem;
    position: relative;
    display: flex;
    flex-direction: column;
    min-width: 0;
    height: var(--bs-card-height);
    word-wrap: break-word;
    background-color: var(--bs-card-bg);
    background-clip: border-box;
    border: var(--bs-card-border-width) solid var(--bs-card-border-color);
    border-radius: var(--bs-card-border-radius);
}
.card > hr {
    margin-right: 0;
    margin-left: 0;
}
.card > .list-group {
    border-top: inherit;
    border-bottom: inherit;
}
.card > .list-group:first-child {
    border-top-width: 0;
    border-top-left-radius: var(--bs-card-inner-border-radius);
    border-top-right-radius: var(--bs-card-inner-border-radius);
}
.card > .list-group:last-child {
    border-bottom-width: 0;
    border-bottom-right-radius: var(--bs-card-inner-border-radius);
    border-bottom-left-radius: var(--bs-card-inner-border-radius);
}
.card > .card-header + .list-group,
.card > .list-group + .card-footer {
    border-top: 0;
}

.card-body {
    flex: 1 1 auto;
    padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
    color: var(--bs-card-color);
}

.card-title {
    margin-bottom: var(--bs-card-title-spacer-y);
}

.card-subtitle {
    margin-top: calc(-0.5 * var(--bs-card-title-spacer-y));
    margin-bottom: 0;
}

.card-text:last-child {
    margin-bottom: 0;
}

.card-link + .card-link {
    margin-left: var(--bs-card-spacer-x);
}

.card-header {
    padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
    margin-bottom: 0;
    color: var(--bs-card-cap-color);
    background-color: var(--bs-card-cap-bg);
    border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-header:first-child {
    border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0;
}

.card-footer {
    padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
    color: var(--bs-card-cap-color);
    background-color: var(--bs-card-cap-bg);
    border-top: var(--bs-card-border-width) solid var(--bs-card-border-color);
}
.card-footer:last-child {
    border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius);
}

.card-header-tabs {
    margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
    margin-bottom: calc(-1 * var(--bs-card-cap-padding-y));
    margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
    border-bottom: 0;
}
.card-header-tabs .nav-link.active {
    background-color: var(--bs-card-bg);
    border-bottom-color: var(--bs-card-bg);
}

.card-header-pills {
    margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
    margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
}

.card-img-overlay {
    position: absolute;
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    padding: var(--bs-card-img-overlay-padding);
    border-radius: var(--bs-card-inner-border-radius);
}

.card-img,
.card-img-top,
.card-img-bottom {
    width: 100%;
}

.card-img,
.card-img-top {
    border-top-left-radius: var(--bs-card-inner-border-radius);
    border-top-right-radius: var(--bs-card-inner-border-radius);
}

.card-img,
.card-img-bottom {
    border-bottom-right-radius: var(--bs-card-inner-border-radius);
    border-bottom-left-radius: var(--bs-card-inner-border-radius);
}

.card-group > .card {
    margin-bottom: var(--bs-card-group-margin);
}
@media (min-width: 576px) {
    .card-group {
        display: flex;
        flex-flow: row wrap;
    }
    .card-group > .card {
        flex: 1 0 0%;
        margin-bottom: 0;
    }
    .card-group > .card + .card {
        margin-left: 0;
        border-left: 0;
    }
    .card-group > .card:not(:last-child) {
        border-top-right-radius: 0;
        border-bottom-right-radius: 0;
    }
    .card-group > .card:not(:last-child) .card-img-top,
    .card-group > .card:not(:last-child) .card-header {
        border-top-right-radius: 0;
    }
    .card-group > .card:not(:last-child) .card-img-bottom,
    .card-group > .card:not(:last-child) .card-footer {
        border-bottom-right-radius: 0;
    }
    .card-group > .card:not(:first-child) {
        border-top-left-radius: 0;
        border-bottom-left-radius: 0;
    }
    .card-group > .card:not(:first-child) .card-img-top,
    .card-group > .card:not(:first-child) .card-header {
        border-top-left-radius: 0;
    }
    .card-group > .card:not(:first-child) .card-img-bottom,
    .card-group > .card:not(:first-child) .card-footer {
        border-bottom-left-radius: 0;
    }
}

/* Rules for sizing the icon. */
.material-icons-outlined.md-16 {
    font-size: 16px;
}

.material-icons-outlined.md-18 {
    font-size: 18px;
}

.material-icons-outlined.md-24 {
    font-size: 24px;
}

.material-icons-outlined.md-36 {
    font-size: 36px;
}

.material-icons-outlined.md-48 {
    font-size: 48px;
}

/* Rules for using icons as black on a light background. */
.material-icons-outlined.md-dark {
    color: rgba(0, 0, 0, 0.54);
}

.material-icons-outlined.md-dark.md-inactive {
    color: rgba(0, 0, 0, 0.26);
}

/* Rules for using icons as white on a dark background. */
.material-icons-outlined.md-light {
    color: rgba(255, 255, 255, 1);
}

.material-icons-outlined.md-light.md-inactive {
    color: rgba(255, 255, 255, 0.3);
}

/*!
 * Bootstrap Grid v5.1.3 (https://getbootstrap.com/)
 * Copyright 2011-2021 The Bootstrap Authors
 * Copyright 2011-2021 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
:root {
    --bs-blue: #0d6efd;
    --bs-indigo: #6610f2;
    --bs-purple: #6f42c1;
    --bs-pink: #d63384;
    --bs-red: #dc3545;
    --bs-orange: #fd7e14;
    --bs-yellow: #ffc107;
    --bs-green: #198754;
    --bs-teal: #20c997;
    --bs-cyan: #0dcaf0;
    --bs-white: #fff;
    --bs-gray: #6c757d;
    --bs-gray-dark: #343a40;
    --bs-gray-100: #f8f9fa;
    --bs-gray-200: #e9ecef;
    --bs-gray-300: #dee2e6;
    --bs-gray-400: #ced4da;
    --bs-gray-500: #adb5bd;
    --bs-gray-600: #6c757d;
    --bs-gray-700: #495057;
    --bs-gray-800: #343a40;
    --bs-gray-900: #212529;
    --bs-secondary: #6c757d;
    --bs-success: #198754;
    --bs-info: #0dcaf0;
    --bs-warning: #ffc107;
    --bs-danger: #dc3545;
    --bs-light: #f8f9fa;
    --bs-dark: #212529;
    --bs-secondary-rgb: 108, 117, 125;
    --bs-success-rgb: 25, 135, 84;
    --bs-info-rgb: 13, 202, 240;
    --bs-warning-rgb: 255, 193, 7;
    --bs-danger-rgb: 220, 53, 69;
    --bs-light-rgb: 248, 249, 250;
    --bs-dark-rgb: 33, 37, 41;
    --bs-white-rgb: 255, 255, 255;
    --bs-black-rgb: 0, 0, 0;
    --bs-body-color-rgb: 33, 37, 41;
    --bs-body-bg-rgb: 255, 255, 255;
    --bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
    --bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
    --bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
    --bs-body-font-family: var(--bs-font-sans-serif);
    --bs-body-font-size: 1rem;
    --bs-body-font-weight: 400;
    --bs-body-line-height: 1.5;
    --bs-body-color: #212529;
    --bs-body-bg: #fff;

    --sidebar-width: 240px;
}

.form-checklist {
    max-width: 1036px;
    margin: auto;
    padding: 0px;
    background: #F2F2F6;
}

.form-checklist .form-field {
    padding: 12px;
    border: solid 1px #ccd0d4;
    border-radius: 5px;
    background: white;
}
.form-checklist .media-btn {
    text-decoration: none;
}
.form-checklist .media-btn:hover {
    background-color: #167ac62b;
}
.form-checklist .form-edit-note {
    cursor: pointer;
}
.form-checklist .form-edit-note:hover {
    background-color: #167ac60d;
}
.form-checklist .btn.note-btn {
    width: auto !important;
}

.form-checklist .media {
    width: auto !important;
}

.container,
.container-fluid,
.container-xxl,
.container-xl,
.container-lg,
.container-md,
.container-sm {
    width: 100%;
    padding-right: var(--bs-gutter-x, 0.75rem);
    padding-left: var(--bs-gutter-x, 0.75rem);
    margin-right: auto;
    margin-left: auto;
}

@media (min-width: 576px) {
    .container-sm,
    .container {
        max-width: 540px;
    }
}

@media (min-width: 768px) {
    .container-md,
    .container-sm,
    .container {
        max-width: 720px;
    }
}

@media (min-width: 992px) {
    .container-lg,
    .container-md,
    .container-sm,
    .container {
        max-width: 960px;
    }

    .task_list .task_list_item {
        height: 200px;
    }
}

@media (min-width: 1200px) {
    .container-xl,
    .container-lg,
    .container-md,
    .container-sm,
    .container {
        max-width: 1140px;
    }
}

@media (min-width: 1400px) {
    .container-xxl,
    .container-xl,
    .container-lg,
    .container-md,
    .container-sm,
    .container {
        max-width: 1320px;
    }
}

.row {
    --bs-gutter-x: 1.5rem;
    --bs-gutter-y: 0;
    display: flex;
    flex-wrap: wrap;
    margin-top: calc(-1 * var(--bs-gutter-y));
    margin-right: calc(-0.5 * var(--bs-gutter-x));
    margin-left: calc(-0.5 * var(--bs-gutter-x));
}

.row>* {
    box-sizing: border-box;
    flex-shrink: 0;
    width: 100%;
    max-width: 100%;
    padding-right: calc(var(--bs-gutter-x) * 0.5);
    padding-left: calc(var(--bs-gutter-x) * 0.5);
    margin-top: var(--bs-gutter-y);
}

.col {
    flex: 1 0 0%;
}

.row-cols-auto>* {
    flex: 0 0 auto;
    width: auto;
}

.row-cols-1>* {
    flex: 0 0 auto;
    width: 100%;
}

.row-cols-2>* {
    flex: 0 0 auto;
    width: 50%;
}

.row-cols-3>* {
    flex: 0 0 auto;
    width: 33.3333333333%;
}

.row-cols-4>* {
    flex: 0 0 auto;
    width: 25%;
}

.row-cols-5>* {
    flex: 0 0 auto;
    width: 20%;
}

.row-cols-6>* {
    flex: 0 0 auto;
    width: 16.6666666667%;
}

.col-auto {
    flex: 0 0 auto;
    width: auto;
}

.col-1 {
    flex: 0 0 auto;
    width: 8.33333333%;
}

.col-2 {
    flex: 0 0 auto;
    width: 16.66666667%;
}

.col-3 {
    flex: 0 0 auto;
    width: 25%;
}

.col-4 {
    flex: 0 0 auto;
    width: 33.33333333%;
}

.col-5 {
    flex: 0 0 auto;
    width: 41.66666667%;
}

.col-6 {
    flex: 0 0 auto;
    width: 50%;
}

.col-7 {
    flex: 0 0 auto;
    width: 58.33333333%;
}

.col-8 {
    flex: 0 0 auto;
    width: 66.66666667%;
}

.col-9 {
    flex: 0 0 auto;
    width: 75%;
}

.col-10 {
    flex: 0 0 auto;
    width: 83.33333333%;
}

.col-11 {
    flex: 0 0 auto;
    width: 91.66666667%;
}

.col-12 {
    flex: 0 0 auto;
    width: 100%;
}

.offset-1 {
    margin-left: 8.33333333%;
}

.offset-2 {
    margin-left: 16.66666667%;
}

.offset-3 {
    margin-left: 25%;
}

.offset-4 {
    margin-left: 33.33333333%;
}

.offset-5 {
    margin-left: 41.66666667%;
}

.offset-6 {
    margin-left: 50%;
}

.offset-7 {
    margin-left: 58.33333333%;
}

.offset-8 {
    margin-left: 66.66666667%;
}

.offset-9 {
    margin-left: 75%;
}

.offset-10 {
    margin-left: 83.33333333%;
}

.offset-11 {
    margin-left: 91.66666667%;
}

.g-0,
.gx-0 {
    --bs-gutter-x: 0;
}

.g-0,
.gy-0 {
    --bs-gutter-y: 0;
}

.g-1,
.gx-1 {
    --bs-gutter-x: 0.25rem;
}

.g-1,
.gy-1 {
    --bs-gutter-y: 0.25rem;
}

.g-2,
.gx-2 {
    --bs-gutter-x: 0.5rem;
}

.g-2,
.gy-2 {
    --bs-gutter-y: 0.5rem;
}

.g-3,
.gx-3 {
    --bs-gutter-x: 1rem;
}

.g-3,
.gy-3 {
    --bs-gutter-y: 1rem;
}

.g-4,
.gx-4 {
    --bs-gutter-x: 1.5rem;
}

.g-4,
.gy-4 {
    --bs-gutter-y: 1.5rem;
}

.g-5,
.gx-5 {
    --bs-gutter-x: 3rem;
}

.g-5,
.gy-5 {
    --bs-gutter-y: 3rem;
}

@media (min-width: 576px) {
    .col-sm {
        flex: 1 0 0%;
    }

    .row-cols-sm-auto>* {
        flex: 0 0 auto;
        width: auto;
    }

    .row-cols-sm-1>* {
        flex: 0 0 auto;
        width: 100%;
    }

    .row-cols-sm-2>* {
        flex: 0 0 auto;
        width: 50%;
    }

    .row-cols-sm-3>* {
        flex: 0 0 auto;
        width: 33.3333333333%;
    }

    .row-cols-sm-4>* {
        flex: 0 0 auto;
        width: 25%;
    }

    .row-cols-sm-5>* {
        flex: 0 0 auto;
        width: 20%;
    }

    .row-cols-sm-6>* {
        flex: 0 0 auto;
        width: 16.6666666667%;
    }

    .col-sm-auto {
        flex: 0 0 auto;
        width: auto;
    }

    .col-sm-1 {
        flex: 0 0 auto;
        width: 8.33333333%;
    }

    .col-sm-2 {
        flex: 0 0 auto;
        width: 16.66666667%;
    }

    .col-sm-3 {
        flex: 0 0 auto;
        width: 25%;
    }

    .col-sm-4 {
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-sm-5 {
        flex: 0 0 auto;
        width: 41.66666667%;
    }

    .col-sm-6 {
        flex: 0 0 auto;
        width: 50%;
    }

    .col-sm-7 {
        flex: 0 0 auto;
        width: 58.33333333%;
    }

    .col-sm-8 {
        flex: 0 0 auto;
        width: 66.66666667%;
    }

    .col-sm-9 {
        flex: 0 0 auto;
        width: 75%;
    }

    .col-sm-10 {
        flex: 0 0 auto;
        width: 83.33333333%;
    }

    .col-sm-11 {
        flex: 0 0 auto;
        width: 91.66666667%;
    }

    .col-sm-12 {
        flex: 0 0 auto;
        width: 100%;
    }

    .offset-sm-0 {
        margin-left: 0;
    }

    .offset-sm-1 {
        margin-left: 8.33333333%;
    }

    .offset-sm-2 {
        margin-left: 16.66666667%;
    }

    .offset-sm-3 {
        margin-left: 25%;
    }

    .offset-sm-4 {
        margin-left: 33.33333333%;
    }

    .offset-sm-5 {
        margin-left: 41.66666667%;
    }

    .offset-sm-6 {
        margin-left: 50%;
    }

    .offset-sm-7 {
        margin-left: 58.33333333%;
    }

    .offset-sm-8 {
        margin-left: 66.66666667%;
    }

    .offset-sm-9 {
        margin-left: 75%;
    }

    .offset-sm-10 {
        margin-left: 83.33333333%;
    }

    .offset-sm-11 {
        margin-left: 91.66666667%;
    }

    .g-sm-0,
    .gx-sm-0 {
        --bs-gutter-x: 0;
    }

    .g-sm-0,
    .gy-sm-0 {
        --bs-gutter-y: 0;
    }

    .g-sm-1,
    .gx-sm-1 {
        --bs-gutter-x: 0.25rem;
    }

    .g-sm-1,
    .gy-sm-1 {
        --bs-gutter-y: 0.25rem;
    }

    .g-sm-2,
    .gx-sm-2 {
        --bs-gutter-x: 0.5rem;
    }

    .g-sm-2,
    .gy-sm-2 {
        --bs-gutter-y: 0.5rem;
    }

    .g-sm-3,
    .gx-sm-3 {
        --bs-gutter-x: 1rem;
    }

    .g-sm-3,
    .gy-sm-3 {
        --bs-gutter-y: 1rem;
    }

    .g-sm-4,
    .gx-sm-4 {
        --bs-gutter-x: 1.5rem;
    }

    .g-sm-4,
    .gy-sm-4 {
        --bs-gutter-y: 1.5rem;
    }

    .g-sm-5,
    .gx-sm-5 {
        --bs-gutter-x: 3rem;
    }

    .g-sm-5,
    .gy-sm-5 {
        --bs-gutter-y: 3rem;
    }
}

@media (min-width: 768px) {
    .col-responsive {
        flex: 0 0 auto;
        width: 33.33333333%;
    }
    .responsive-col-mobile{
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-md {
        flex: 1 0 0%;
    }

    .row-cols-md-auto>* {
        flex: 0 0 auto;
        width: auto;
    }

    .row-cols-md-1>* {
        flex: 0 0 auto;
        width: 100%;
    }

    .row-cols-md-2>* {
        flex: 0 0 auto;
        width: 50%;
    }

    .row-cols-md-3>* {
        flex: 0 0 auto;
        width: 33.3333333333%;
    }

    .row-cols-md-4>* {
        flex: 0 0 auto;
        width: 25%;
    }

    .row-cols-md-5>* {
        flex: 0 0 auto;
        width: 20%;
    }

    .row-cols-md-6>* {
        flex: 0 0 auto;
        width: 16.6666666667%;
    }

    .col-md-auto {
        flex: 0 0 auto;
        width: auto;
    }

    .col-md-1 {
        flex: 0 0 auto;
        width: 8.33333333%;
    }

    .col-md-2 {
        flex: 0 0 auto;
        width: 16.66666667%;
    }

    .col-md-3 {
        flex: 0 0 auto;
        width: 25%;
    }

    .col-md-4 {
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-md-5 {
        flex: 0 0 auto;
        width: 41.66666667%;
    }

    .col-md-6 {
        flex: 0 0 auto;
        width: 50%;
    }

    .col-md-7 {
        flex: 0 0 auto;
        width: 58.33333333%;
    }

    .col-md-8 {
        flex: 0 0 auto;
        width: 66.66666667%;
    }

    .col-md-9 {
        flex: 0 0 auto;
        width: 75%;
    }

    .col-md-10 {
        flex: 0 0 auto;
        width: 83.33333333%;
    }

    .col-md-11 {
        flex: 0 0 auto;
        width: 91.66666667%;
    }

    .col-md-12 {
        flex: 0 0 auto;
        width: 100%;
    }

    .offset-md-0 {
        margin-left: 0;
    }

    .offset-md-1 {
        margin-left: 8.33333333%;
    }

    .offset-md-2 {
        margin-left: 16.66666667%;
    }

    .offset-md-3 {
        margin-left: 25%;
    }

    .offset-md-4 {
        margin-left: 33.33333333%;
    }

    .offset-md-5 {
        margin-left: 41.66666667%;
    }

    .offset-md-6 {
        margin-left: 50%;
    }

    .offset-md-7 {
        margin-left: 58.33333333%;
    }

    .offset-md-8 {
        margin-left: 66.66666667%;
    }

    .offset-md-9 {
        margin-left: 75%;
    }

    .offset-md-10 {
        margin-left: 83.33333333%;
    }

    .offset-md-11 {
        margin-left: 91.66666667%;
    }

    .g-md-0,
    .gx-md-0 {
        --bs-gutter-x: 0;
    }

    .g-md-0,
    .gy-md-0 {
        --bs-gutter-y: 0;
    }

    .g-md-1,
    .gx-md-1 {
        --bs-gutter-x: 0.25rem;
    }

    .g-md-1,
    .gy-md-1 {
        --bs-gutter-y: 0.25rem;
    }

    .g-md-2,
    .gx-md-2 {
        --bs-gutter-x: 0.5rem;
    }

    .g-md-2,
    .gy-md-2 {
        --bs-gutter-y: 0.5rem;
    }

    .g-md-3,
    .gx-md-3 {
        --bs-gutter-x: 1rem;
    }

    .g-md-3,
    .gy-md-3 {
        --bs-gutter-y: 1rem;
    }

    .g-md-4,
    .gx-md-4 {
        --bs-gutter-x: 1.5rem;
    }

    .g-md-4,
    .gy-md-4 {
        --bs-gutter-y: 1.5rem;
    }

    .g-md-5,
    .gx-md-5 {
        --bs-gutter-x: 3rem;
    }

    .g-md-5,
    .gy-md-5 {
        --bs-gutter-y: 3rem;
    }
}

@media (min-width: 992px) {
    .col-lg {
        flex: 1 0 0%;
    }

    .row-cols-lg-auto>* {
        flex: 0 0 auto;
        width: auto;
    }

    .row-cols-lg-1>* {
        flex: 0 0 auto;
        width: 100%;
    }

    .row-cols-lg-2>* {
        flex: 0 0 auto;
        width: 50%;
    }

    .row-cols-lg-3>* {
        flex: 0 0 auto;
        width: 33.3333333333%;
    }

    .row-cols-lg-4>* {
        flex: 0 0 auto;
        width: 25%;
    }

    .row-cols-lg-5>* {
        flex: 0 0 auto;
        width: 20%;
    }

    .row-cols-lg-6>* {
        flex: 0 0 auto;
        width: 16.6666666667%;
    }

    .col-lg-auto {
        flex: 0 0 auto;
        width: auto;
    }

    .col-lg-1 {
        flex: 0 0 auto;
        width: 8.33333333%;
    }

    .col-lg-2 {
        flex: 0 0 auto;
        width: 16.66666667%;
    }

    .col-lg-3 {
        flex: 0 0 auto;
        width: 25%;
    }

    .col-lg-4 {
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-lg-5 {
        flex: 0 0 auto;
        width: 41.66666667%;
    }

    .col-lg-6 {
        flex: 0 0 auto;
        width: 50%;
    }

    .col-lg-7 {
        flex: 0 0 auto;
        width: 58.33333333%;
    }

    .col-lg-8 {
        flex: 0 0 auto;
        width: 66.66666667%;
    }

    .col-lg-9 {
        flex: 0 0 auto;
        width: 75%;
    }

    .col-lg-10 {
        flex: 0 0 auto;
        width: 83.33333333%;
    }

    .col-lg-11 {
        flex: 0 0 auto;
        width: 91.66666667%;
    }

    .col-lg-12 {
        flex: 0 0 auto;
        width: 100%;
    }

    .offset-lg-0 {
        margin-left: 0;
    }

    .offset-lg-1 {
        margin-left: 8.33333333%;
    }

    .offset-lg-2 {
        margin-left: 16.66666667%;
    }

    .offset-lg-3 {
        margin-left: 25%;
    }

    .offset-lg-4 {
        margin-left: 33.33333333%;
    }

    .offset-lg-5 {
        margin-left: 41.66666667%;
    }

    .offset-lg-6 {
        margin-left: 50%;
    }

    .offset-lg-7 {
        margin-left: 58.33333333%;
    }

    .offset-lg-8 {
        margin-left: 66.66666667%;
    }

    .offset-lg-9 {
        margin-left: 75%;
    }

    .offset-lg-10 {
        margin-left: 83.33333333%;
    }

    .offset-lg-11 {
        margin-left: 91.66666667%;
    }

    .g-lg-0,
    .gx-lg-0 {
        --bs-gutter-x: 0;
    }

    .g-lg-0,
    .gy-lg-0 {
        --bs-gutter-y: 0;
    }

    .g-lg-1,
    .gx-lg-1 {
        --bs-gutter-x: 0.25rem;
    }

    .g-lg-1,
    .gy-lg-1 {
        --bs-gutter-y: 0.25rem;
    }

    .g-lg-2,
    .gx-lg-2 {
        --bs-gutter-x: 0.5rem;
    }

    .g-lg-2,
    .gy-lg-2 {
        --bs-gutter-y: 0.5rem;
    }

    .g-lg-3,
    .gx-lg-3 {
        --bs-gutter-x: 1rem;
    }

    .g-lg-3,
    .gy-lg-3 {
        --bs-gutter-y: 1rem;
    }

    .g-lg-4,
    .gx-lg-4 {
        --bs-gutter-x: 1.5rem;
    }

    .g-lg-4,
    .gy-lg-4 {
        --bs-gutter-y: 1.5rem;
    }

    .g-lg-5,
    .gx-lg-5 {
        --bs-gutter-x: 3rem;
    }

    .g-lg-5,
    .gy-lg-5 {
        --bs-gutter-y: 3rem;
    }
}

@media (min-width: 1200px) {
    .col-xl {
        flex: 1 0 0%;
    }

    .row-cols-xl-auto>* {
        flex: 0 0 auto;
        width: auto;
    }

    .row-cols-xl-1>* {
        flex: 0 0 auto;
        width: 100%;
    }

    .row-cols-xl-2>* {
        flex: 0 0 auto;
        width: 50%;
    }

    .row-cols-xl-3>* {
        flex: 0 0 auto;
        width: 33.3333333333%;
    }

    .row-cols-xl-4>* {
        flex: 0 0 auto;
        width: 25%;
    }

    .row-cols-xl-5>* {
        flex: 0 0 auto;
        width: 20%;
    }

    .row-cols-xl-6>* {
        flex: 0 0 auto;
        width: 16.6666666667%;
    }

    .col-xl-auto {
        flex: 0 0 auto;
        width: auto;
    }

    .col-xl-1 {
        flex: 0 0 auto;
        width: 8.33333333%;
    }

    .col-xl-2 {
        flex: 0 0 auto;
        width: 16.66666667%;
    }

    .col-xl-3 {
        flex: 0 0 auto;
        width: 25%;
    }

    .col-xl-4 {
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-xl-5 {
        flex: 0 0 auto;
        width: 41.66666667%;
    }

    .col-xl-6 {
        flex: 0 0 auto;
        width: 50%;
    }

    .col-xl-7 {
        flex: 0 0 auto;
        width: 58.33333333%;
    }

    .col-xl-8 {
        flex: 0 0 auto;
        width: 66.66666667%;
    }

    .col-xl-9 {
        flex: 0 0 auto;
        width: 75%;
    }

    .col-xl-10 {
        flex: 0 0 auto;
        width: 83.33333333%;
    }

    .col-xl-11 {
        flex: 0 0 auto;
        width: 91.66666667%;
    }

    .col-xl-12 {
        flex: 0 0 auto;
        width: 100%;
    }

    .offset-xl-0 {
        margin-left: 0;
    }

    .offset-xl-1 {
        margin-left: 8.33333333%;
    }

    .offset-xl-2 {
        margin-left: 16.66666667%;
    }

    .offset-xl-3 {
        margin-left: 25%;
    }

    .offset-xl-4 {
        margin-left: 33.33333333%;
    }

    .offset-xl-5 {
        margin-left: 41.66666667%;
    }

    .offset-xl-6 {
        margin-left: 50%;
    }

    .offset-xl-7 {
        margin-left: 58.33333333%;
    }

    .offset-xl-8 {
        margin-left: 66.66666667%;
    }

    .offset-xl-9 {
        margin-left: 75%;
    }

    .offset-xl-10 {
        margin-left: 83.33333333%;
    }

    .offset-xl-11 {
        margin-left: 91.66666667%;
    }

    .g-xl-0,
    .gx-xl-0 {
        --bs-gutter-x: 0;
    }

    .g-xl-0,
    .gy-xl-0 {
        --bs-gutter-y: 0;
    }

    .g-xl-1,
    .gx-xl-1 {
        --bs-gutter-x: 0.25rem;
    }

    .g-xl-1,
    .gy-xl-1 {
        --bs-gutter-y: 0.25rem;
    }

    .g-xl-2,
    .gx-xl-2 {
        --bs-gutter-x: 0.5rem;
    }

    .g-xl-2,
    .gy-xl-2 {
        --bs-gutter-y: 0.5rem;
    }

    .g-xl-3,
    .gx-xl-3 {
        --bs-gutter-x: 1rem;
    }

    .g-xl-3,
    .gy-xl-3 {
        --bs-gutter-y: 1rem;
    }

    .g-xl-4,
    .gx-xl-4 {
        --bs-gutter-x: 1.5rem;
    }

    .g-xl-4,
    .gy-xl-4 {
        --bs-gutter-y: 1.5rem;
    }

    .g-xl-5,
    .gx-xl-5 {
        --bs-gutter-x: 3rem;
    }

    .g-xl-5,
    .gy-xl-5 {
        --bs-gutter-y: 3rem;
    }
}

@media (min-width: 1400px) {
    .col-xxl {
        flex: 1 0 0%;
    }

    .row-cols-xxl-auto>* {
        flex: 0 0 auto;
        width: auto;
    }

    .row-cols-xxl-1>* {
        flex: 0 0 auto;
        width: 100%;
    }

    .row-cols-xxl-2>* {
        flex: 0 0 auto;
        width: 50%;
    }

    .row-cols-xxl-3>* {
        flex: 0 0 auto;
        width: 33.3333333333%;
    }

    .row-cols-xxl-4>* {
        flex: 0 0 auto;
        width: 25%;
    }

    .row-cols-xxl-5>* {
        flex: 0 0 auto;
        width: 20%;
    }

    .row-cols-xxl-6>* {
        flex: 0 0 auto;
        width: 16.6666666667%;
    }

    .col-xxl-auto {
        flex: 0 0 auto;
        width: auto;
    }

    .col-xxl-1 {
        flex: 0 0 auto;
        width: 8.33333333%;
    }

    .col-xxl-2 {
        flex: 0 0 auto;
        width: 16.66666667%;
    }

    .col-xxl-3 {
        flex: 0 0 auto;
        width: 25%;
    }

    .col-xxl-4 {
        flex: 0 0 auto;
        width: 33.33333333%;
    }

    .col-xxl-5 {
        flex: 0 0 auto;
        width: 41.66666667%;
    }

    .col-xxl-6 {
        flex: 0 0 auto;
        width: 50%;
    }

    .col-xxl-7 {
        flex: 0 0 auto;
        width: 58.33333333%;
    }

    .col-xxl-8 {
        flex: 0 0 auto;
        width: 66.66666667%;
    }

    .col-xxl-9 {
        flex: 0 0 auto;
        width: 75%;
    }

    .col-xxl-10 {
        flex: 0 0 auto;
        width: 83.33333333%;
    }

    .col-xxl-11 {
        flex: 0 0 auto;
        width: 91.66666667%;
    }

    .col-xxl-12 {
        flex: 0 0 auto;
        width: 100%;
    }

    .offset-xxl-0 {
        margin-left: 0;
    }

    .offset-xxl-1 {
        margin-left: 8.33333333%;
    }

    .offset-xxl-2 {
        margin-left: 16.66666667%;
    }

    .offset-xxl-3 {
        margin-left: 25%;
    }

    .offset-xxl-4 {
        margin-left: 33.33333333%;
    }

    .offset-xxl-5 {
        margin-left: 41.66666667%;
    }

    .offset-xxl-6 {
        margin-left: 50%;
    }

    .offset-xxl-7 {
        margin-left: 58.33333333%;
    }

    .offset-xxl-8 {
        margin-left: 66.66666667%;
    }

    .offset-xxl-9 {
        margin-left: 75%;
    }

    .offset-xxl-10 {
        margin-left: 83.33333333%;
    }

    .offset-xxl-11 {
        margin-left: 91.66666667%;
    }

    .g-xxl-0,
    .gx-xxl-0 {
        --bs-gutter-x: 0;
    }

    .g-xxl-0,
    .gy-xxl-0 {
        --bs-gutter-y: 0;
    }

    .g-xxl-1,
    .gx-xxl-1 {
        --bs-gutter-x: 0.25rem;
    }

    .g-xxl-1,
    .gy-xxl-1 {
        --bs-gutter-y: 0.25rem;
    }

    .g-xxl-2,
    .gx-xxl-2 {
        --bs-gutter-x: 0.5rem;
    }

    .g-xxl-2,
    .gy-xxl-2 {
        --bs-gutter-y: 0.5rem;
    }

    .g-xxl-3,
    .gx-xxl-3 {
        --bs-gutter-x: 1rem;
    }

    .g-xxl-3,
    .gy-xxl-3 {
        --bs-gutter-y: 1rem;
    }

    .g-xxl-4,
    .gx-xxl-4 {
        --bs-gutter-x: 1.5rem;
    }

    .g-xxl-4,
    .gy-xxl-4 {
        --bs-gutter-y: 1.5rem;
    }

    .g-xxl-5,
    .gx-xxl-5 {
        --bs-gutter-x: 3rem;
    }

    .g-xxl-5,
    .gy-xxl-5 {
        --bs-gutter-y: 3rem;
    }
}

.d-inline {
    display: inline !important;
}

.d-inline-block {
    display: inline-block !important;
}

.d-block {
    display: block !important;
}

.d-grid {
    display: grid !important;
}

.d-table {
    display: table !important;
}

.d-table-row {
    display: table-row !important;
}

.d-table-cell {
    display: table-cell !important;
}

.d-flex {
    display: flex !important;
}

.d-inline-flex {
    display: inline-flex !important;
}

.d-none {
    display: none !important;
}

.flex-fill {
    flex: 1 1 auto !important;
}

.flex-row {
    flex-direction: row !important;
}

.flex-column {
    flex-direction: column !important;
}

.flex-row-reverse {
    flex-direction: row-reverse !important;
}

.flex-column-reverse {
    flex-direction: column-reverse !important;
}

.flex-grow-0 {
    flex-grow: 0 !important;
}

.flex-grow-1 {
    flex-grow: 1 !important;
}

.flex-shrink-0 {
    flex-shrink: 0 !important;
}

.flex-shrink-1 {
    flex-shrink: 1 !important;
}

.flex-wrap {
    flex-wrap: wrap !important;
}

.flex-nowrap {
    flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
}

.justify-content-start {
    justify-content: flex-start !important;
}

.justify-content-end {
    justify-content: flex-end !important;
}

.justify-content-center {
    justify-content: center !important;
}

.justify-content-between {
    justify-content: space-between !important;
}

.justify-content-around {
    justify-content: space-around !important;
}

.justify-content-evenly {
    justify-content: space-evenly !important;
}

.align-items-start {
    align-items: flex-start !important;
}

.align-items-end {
    align-items: flex-end !important;
}

.align-items-center {
    align-items: center !important;
}

.align-items-baseline {
    align-items: baseline !important;
}

.align-items-stretch {
    align-items: stretch !important;
}

.align-content-start {
    align-content: flex-start !important;
}

.align-content-end {
    align-content: flex-end !important;
}

.align-content-center {
    align-content: center !important;
}

.align-content-between {
    align-content: space-between !important;
}

.align-content-around {
    align-content: space-around !important;
}

.align-content-stretch {
    align-content: stretch !important;
}

.align-self-auto {
    align-self: auto !important;
}

.align-self-start {
    align-self: flex-start !important;
}

.align-self-end {
    align-self: flex-end !important;
}

.align-self-center {
    align-self: center !important;
}

.align-self-baseline {
    align-self: baseline !important;
}

.align-self-stretch {
    align-self: stretch !important;
}

.order-first {
    order: -1 !important;
}

.order-0 {
    order: 0 !important;
}

.order-1 {
    order: 1 !important;
}

.order-2 {
    order: 2 !important;
}

.order-3 {
    order: 3 !important;
}

.order-4 {
    order: 4 !important;
}

.order-5 {
    order: 5 !important;
}

.order-last {
    order: 6 !important;
}

.m-0 {
    margin: 0 !important;
}

.m-1 {
    margin: 0.25rem !important;
}

.m-2 {
    margin: 0.5rem !important;
}

.m-3 {
    margin: 1rem !important;
}

.m-4 {
    margin: 1.5rem !important;
}

.m-5 {
    margin: 3rem !important;
}

.m-auto {
    margin: auto !important;
}

.mx-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
}

.mx-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
}

.mx-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
}

.mx-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
}

.mx-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
}

.mx-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
}

.mx-auto {
    margin-right: auto !important;
    margin-left: auto !important;
}

.my-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
}

.my-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
}

.my-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
}

.my-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
}

.my-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
}

.my-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
}

.my-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
}

.mt-0 {
    margin-top: 0 !important;
}

.mt-1 {
    margin-top: 0.25rem !important;
}

.mt-2 {
    margin-top: 0.5rem !important;
}

.mt-3 {
    margin-top: 1rem !important;
}

.mt-4 {
    margin-top: 1.5rem !important;
}

.mt-5 {
    margin-top: 3rem !important;
}

.mt-auto {
    margin-top: auto !important;
}

.me-0 {
    margin-right: 0 !important;
}

.me-1 {
    margin-right: 0.25rem !important;
}

.me-2 {
    margin-right: 0.5rem !important;
}

.me-3 {
    margin-right: 1rem !important;
}

.me-4 {
    margin-right: 1.5rem !important;
}

.me-5 {
    margin-right: 3rem !important;
}

.me-auto {
    margin-right: auto !important;
}

.mb-0 {
    margin-bottom: 0 !important;
}

.mb-1 {
    margin-bottom: 0.25rem !important;
}

.mb-2 {
    margin-bottom: 0.5rem !important;
}

.mb-3 {
    margin-bottom: 1rem !important;
}

.mb-4 {
    margin-bottom: 1.5rem !important;
}

.mb-5 {
    margin-bottom: 3rem !important;
}

.mb-auto {
    margin-bottom: auto !important;
}

.ms-0 {
    margin-left: 0 !important;
}

.ms-1 {
    margin-left: 0.25rem !important;
}

.ms-2 {
    margin-left: 0.5rem !important;
}

.ms-3 {
    margin-left: 1rem !important;
}

.ms-4 {
    margin-left: 1.5rem !important;
}

.ms-5 {
    margin-left: 3rem !important;
}

.ms-auto {
    margin-left: auto !important;
}

.p-0 {
    padding: 0 !important;
}

.p-1 {
    padding: 0.25rem !important;
}

.p-2 {
    padding: 0.5rem !important;
}

.p-3 {
    padding: 1rem !important;
}

.p-4 {
    padding: 1.5rem !important;
}

.p-5 {
    padding: 3rem !important;
}

.px-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
}

.px-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
}

.px-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
}

.px-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
}

.px-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
}

.px-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
}

.py-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
}

.py-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
}

.py-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
}

.py-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
}

.py-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
}

.py-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
}

.pt-0 {
    padding-top: 0 !important;
}

.pt-1 {
    padding-top: 0.25rem !important;
}

.pt-2 {
    padding-top: 0.5rem !important;
}

.pt-3 {
    padding-top: 1rem !important;
}

.pt-4 {
    padding-top: 1.5rem !important;
}

.pt-5 {
    padding-top: 3rem !important;
}

.pe-0 {
    padding-right: 0 !important;
}

.pe-1 {
    padding-right: 0.25rem !important;
}

.pe-2 {
    padding-right: 0.5rem !important;
}

.pe-3 {
    padding-right: 1rem !important;
}

.pe-4 {
    padding-right: 1.5rem !important;
}

.pe-5 {
    padding-right: 3rem !important;
}

.pe-6 {
    padding-right: 4rem !important;
}

.pe-7 {
    padding-right: 5rem !important;
}

.pe-8 {
    padding-right: 6rem !important;
}

.pe-10 {
    padding-right: 8rem !important;
}

.pb-0 {
    padding-bottom: 0 !important;
}

.pb-1 {
    padding-bottom: 0.25rem !important;
}

.pb-2 {
    padding-bottom: 0.5rem !important;
}

.pb-3 {
    padding-bottom: 1rem !important;
}

.pb-4 {
    padding-bottom: 1.5rem !important;
}

.pb-5 {
    padding-bottom: 3rem !important;
}

.ps-0 {
    padding-left: 0 !important;
}

.ps-1 {
    padding-left: 0.25rem !important;
}

.ps-2 {
    padding-left: 0.5rem !important;
}

.ps-3 {
    padding-left: 1rem !important;
}

.ps-4 {
    padding-left: 1.5rem !important;
}

.ps-5 {
    padding-left: 3rem !important;
}

@media (min-width: 576px) {

    .document-name-width {
        max-width: 200px;
    }

    .d-sm-inline {
        display: inline !important;
    }

    .d-sm-inline-block {
        display: inline-block !important;
    }

    .d-sm-block {
        display: block !important;
    }

    .d-sm-grid {
        display: grid !important;
    }

    .d-sm-table {
        display: table !important;
    }

    .d-sm-table-row {
        display: table-row !important;
    }

    .d-sm-table-cell {
        display: table-cell !important;
    }

    .d-sm-flex {
        display: flex !important;
    }

    .d-sm-inline-flex {
        display: inline-flex !important;
    }

    .d-sm-none {
        display: none !important;
    }

    .flex-sm-fill {
        flex: 1 1 auto !important;
    }

    .flex-sm-row {
        flex-direction: row !important;
    }

    .flex-sm-column {
        flex-direction: column !important;
    }

    .flex-sm-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-sm-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-sm-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-sm-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-sm-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-sm-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-sm-wrap {
        flex-wrap: wrap !important;
    }

    .flex-sm-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-sm-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .justify-content-sm-start {
        justify-content: flex-start !important;
    }

    .justify-content-sm-end {
        justify-content: flex-end !important;
    }

    .justify-content-sm-center {
        justify-content: center !important;
    }

    .justify-content-sm-between {
        justify-content: space-between !important;
    }

    .justify-content-sm-around {
        justify-content: space-around !important;
    }

    .justify-content-sm-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-sm-start {
        align-items: flex-start !important;
    }

    .align-items-sm-end {
        align-items: flex-end !important;
    }

    .align-items-sm-center {
        align-items: center !important;
    }

    .align-items-sm-baseline {
        align-items: baseline !important;
    }

    .align-items-sm-stretch {
        align-items: stretch !important;
    }

    .align-content-sm-start {
        align-content: flex-start !important;
    }

    .align-content-sm-end {
        align-content: flex-end !important;
    }

    .align-content-sm-center {
        align-content: center !important;
    }

    .align-content-sm-between {
        align-content: space-between !important;
    }

    .align-content-sm-around {
        align-content: space-around !important;
    }

    .align-content-sm-stretch {
        align-content: stretch !important;
    }

    .align-self-sm-auto {
        align-self: auto !important;
    }

    .align-self-sm-start {
        align-self: flex-start !important;
    }

    .align-self-sm-end {
        align-self: flex-end !important;
    }

    .align-self-sm-center {
        align-self: center !important;
    }

    .align-self-sm-baseline {
        align-self: baseline !important;
    }

    .align-self-sm-stretch {
        align-self: stretch !important;
    }

    .order-sm-first {
        order: -1 !important;
    }

    .order-sm-0 {
        order: 0 !important;
    }

    .order-sm-1 {
        order: 1 !important;
    }

    .order-sm-2 {
        order: 2 !important;
    }

    .order-sm-3 {
        order: 3 !important;
    }

    .order-sm-4 {
        order: 4 !important;
    }

    .order-sm-5 {
        order: 5 !important;
    }

    .order-sm-last {
        order: 6 !important;
    }

    .m-sm-0 {
        margin: 0 !important;
    }

    .m-sm-1 {
        margin: 0.25rem !important;
    }

    .m-sm-2 {
        margin: 0.5rem !important;
    }

    .m-sm-3 {
        margin: 1rem !important;
    }

    .m-sm-4 {
        margin: 1.5rem !important;
    }

    .m-sm-5 {
        margin: 3rem !important;
    }

    .m-sm-auto {
        margin: auto !important;
    }

    .mx-sm-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-sm-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-sm-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-sm-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-sm-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-sm-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-sm-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-sm-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-sm-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-sm-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-sm-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-sm-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-sm-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-sm-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-sm-0 {
        margin-top: 0 !important;
    }

    .mt-sm-1 {
        margin-top: 0.25rem !important;
    }

    .mt-sm-2 {
        margin-top: 0.5rem !important;
    }

    .mt-sm-3 {
        margin-top: 1rem !important;
    }

    .mt-sm-4 {
        margin-top: 1.5rem !important;
    }

    .mt-sm-5 {
        margin-top: 3rem !important;
    }

    .mt-sm-auto {
        margin-top: auto !important;
    }

    .me-sm-0 {
        margin-right: 0 !important;
    }

    .me-sm-1 {
        margin-right: 0.25rem !important;
    }

    .me-sm-2 {
        margin-right: 0.5rem !important;
    }

    .me-sm-3 {
        margin-right: 1rem !important;
    }

    .me-sm-4 {
        margin-right: 1.5rem !important;
    }

    .me-sm-5 {
        margin-right: 3rem !important;
    }

    .me-sm-auto {
        margin-right: auto !important;
    }

    .mb-sm-0 {
        margin-bottom: 0 !important;
    }

    .mb-sm-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-sm-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-sm-3 {
        margin-bottom: 1rem !important;
    }

    .mb-sm-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-sm-5 {
        margin-bottom: 3rem !important;
    }

    .mb-sm-auto {
        margin-bottom: auto !important;
    }

    .ms-sm-0 {
        margin-left: 0 !important;
    }

    .ms-sm-1 {
        margin-left: 0.25rem !important;
    }

    .ms-sm-2 {
        margin-left: 0.5rem !important;
    }

    .ms-sm-3 {
        margin-left: 1rem !important;
    }

    .ms-sm-4 {
        margin-left: 1.5rem !important;
    }

    .ms-sm-5 {
        margin-left: 3rem !important;
    }

    .ms-sm-auto {
        margin-left: auto !important;
    }

    .p-sm-0 {
        padding: 0 !important;
    }

    .p-sm-1 {
        padding: 0.25rem !important;
    }

    .p-sm-2 {
        padding: 0.5rem !important;
    }

    .p-sm-3 {
        padding: 1rem !important;
    }

    .p-sm-4 {
        padding: 1.5rem !important;
    }

    .p-sm-5 {
        padding: 3rem !important;
    }

    .px-sm-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-sm-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-sm-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-sm-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-sm-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-sm-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-sm-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-sm-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-sm-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-sm-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-sm-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-sm-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-sm-0 {
        padding-top: 0 !important;
    }

    .pt-sm-1 {
        padding-top: 0.25rem !important;
    }

    .pt-sm-2 {
        padding-top: 0.5rem !important;
    }

    .pt-sm-3 {
        padding-top: 1rem !important;
    }

    .pt-sm-4 {
        padding-top: 1.5rem !important;
    }

    .pt-sm-5 {
        padding-top: 3rem !important;
    }

    .pe-sm-0 {
        padding-right: 0 !important;
    }

    .pe-sm-1 {
        padding-right: 0.25rem !important;
    }

    .pe-sm-2 {
        padding-right: 0.5rem !important;
    }

    .pe-sm-3 {
        padding-right: 1rem !important;
    }

    .pe-sm-4 {
        padding-right: 1.5rem !important;
    }

    .pe-sm-5 {
        padding-right: 3rem !important;
    }

    .pb-sm-0 {
        padding-bottom: 0 !important;
    }

    .pb-sm-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-sm-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-sm-3 {
        padding-bottom: 1rem !important;
    }

    .pb-sm-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-sm-5 {
        padding-bottom: 3rem !important;
    }

    .ps-sm-0 {
        padding-left: 0 !important;
    }

    .ps-sm-1 {
        padding-left: 0.25rem !important;
    }

    .ps-sm-2 {
        padding-left: 0.5rem !important;
    }

    .ps-sm-3 {
        padding-left: 1rem !important;
    }

    .ps-sm-4 {
        padding-left: 1.5rem !important;
    }

    .ps-sm-5 {
        padding-left: 3rem !important;
    }
}

@media (min-width: 768px) {
    .document-name-width {
        max-width: 200px;
    }

    .d-md-inline {
        display: inline !important;
    }

    .d-md-inline-block {
        display: inline-block !important;
    }

    .d-md-block {
        display: block !important;
    }

    .d-md-grid {
        display: grid !important;
    }

    .d-md-table {
        display: table !important;
    }

    .d-md-table-row {
        display: table-row !important;
    }

    .d-md-table-cell {
        display: table-cell !important;
    }

    .d-md-flex {
        display: flex !important;
    }

    .d-md-inline-flex {
        display: inline-flex !important;
    }

    .d-md-none {
        display: none !important;
    }

    .flex-md-fill {
        flex: 1 1 auto !important;
    }

    .flex-md-row {
        flex-direction: row !important;
    }

    .flex-md-column {
        flex-direction: column !important;
    }

    .flex-md-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-md-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-md-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-md-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-md-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-md-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-md-wrap {
        flex-wrap: wrap !important;
    }

    .flex-md-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-md-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .justify-content-md-start {
        justify-content: flex-start !important;
    }

    .justify-content-md-end {
        justify-content: flex-end !important;
    }

    .justify-content-md-center {
        justify-content: center !important;
    }

    .justify-content-md-between {
        justify-content: space-between !important;
    }

    .justify-content-md-around {
        justify-content: space-around !important;
    }

    .justify-content-md-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-md-start {
        align-items: flex-start !important;
    }

    .align-items-md-end {
        align-items: flex-end !important;
    }

    .align-items-md-center {
        align-items: center !important;
    }

    .align-items-md-baseline {
        align-items: baseline !important;
    }

    .align-items-md-stretch {
        align-items: stretch !important;
    }

    .align-content-md-start {
        align-content: flex-start !important;
    }

    .align-content-md-end {
        align-content: flex-end !important;
    }

    .align-content-md-center {
        align-content: center !important;
    }

    .align-content-md-between {
        align-content: space-between !important;
    }

    .align-content-md-around {
        align-content: space-around !important;
    }

    .align-content-md-stretch {
        align-content: stretch !important;
    }

    .align-self-md-auto {
        align-self: auto !important;
    }

    .align-self-md-start {
        align-self: flex-start !important;
    }

    .align-self-md-end {
        align-self: flex-end !important;
    }

    .align-self-md-center {
        align-self: center !important;
    }

    .align-self-md-baseline {
        align-self: baseline !important;
    }

    .align-self-md-stretch {
        align-self: stretch !important;
    }

    .order-md-first {
        order: -1 !important;
    }

    .order-md-0 {
        order: 0 !important;
    }

    .order-md-1 {
        order: 1 !important;
    }

    .order-md-2 {
        order: 2 !important;
    }

    .order-md-3 {
        order: 3 !important;
    }

    .order-md-4 {
        order: 4 !important;
    }

    .order-md-5 {
        order: 5 !important;
    }

    .order-md-last {
        order: 6 !important;
    }

    .m-md-0 {
        margin: 0 !important;
    }

    .m-md-1 {
        margin: 0.25rem !important;
    }

    .m-md-2 {
        margin: 0.5rem !important;
    }

    .m-md-3 {
        margin: 1rem !important;
    }

    .m-md-4 {
        margin: 1.5rem !important;
    }

    .m-md-5 {
        margin: 3rem !important;
    }

    .m-md-auto {
        margin: auto !important;
    }

    .mx-md-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-md-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-md-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-md-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-md-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-md-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-md-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-md-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-md-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-md-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-md-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-md-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-md-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-md-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-md-0 {
        margin-top: 0 !important;
    }

    .mt-md-1 {
        margin-top: 0.25rem !important;
    }

    .mt-md-2 {
        margin-top: 0.5rem !important;
    }

    .mt-md-3 {
        margin-top: 1rem !important;
    }

    .mt-md-4 {
        margin-top: 1.5rem !important;
    }

    .mt-md-5 {
        margin-top: 3rem !important;
    }

    .mt-md-auto {
        margin-top: auto !important;
    }

    .me-md-0 {
        margin-right: 0 !important;
    }

    .me-md-1 {
        margin-right: 0.25rem !important;
    }

    .me-md-2 {
        margin-right: 0.5rem !important;
    }

    .me-md-3 {
        margin-right: 1rem !important;
    }

    .me-md-4 {
        margin-right: 1.5rem !important;
    }

    .me-md-5 {
        margin-right: 3rem !important;
    }

    .me-md-auto {
        margin-right: auto !important;
    }

    .mb-md-0 {
        margin-bottom: 0 !important;
    }

    .mb-md-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-md-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-md-3 {
        margin-bottom: 1rem !important;
    }

    .mb-md-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-md-5 {
        margin-bottom: 3rem !important;
    }

    .mb-md-auto {
        margin-bottom: auto !important;
    }

    .ms-md-0 {
        margin-left: 0 !important;
    }

    .ms-md-1 {
        margin-left: 0.25rem !important;
    }

    .ms-md-2 {
        margin-left: 0.5rem !important;
    }

    .ms-md-3 {
        margin-left: 1rem !important;
    }

    .ms-md-4 {
        margin-left: 1.5rem !important;
    }

    .ms-md-5 {
        margin-left: 3rem !important;
    }

    .ms-md-auto {
        margin-left: auto !important;
    }

    .p-md-0 {
        padding: 0 !important;
    }

    .p-md-1 {
        padding: 0.25rem !important;
    }

    .p-md-2 {
        padding: 0.5rem !important;
    }

    .p-md-3 {
        padding: 1rem !important;
    }

    .p-md-4 {
        padding: 1.5rem !important;
    }

    .p-md-5 {
        padding: 3rem !important;
    }

    .px-md-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-md-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-md-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-md-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-md-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-md-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-md-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-md-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-md-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-md-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-md-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-md-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-md-0 {
        padding-top: 0 !important;
    }

    .pt-md-1 {
        padding-top: 0.25rem !important;
    }

    .pt-md-2 {
        padding-top: 0.5rem !important;
    }

    .pt-md-3 {
        padding-top: 1rem !important;
    }

    .pt-md-4 {
        padding-top: 1.5rem !important;
    }

    .pt-md-5 {
        padding-top: 3rem !important;
    }

    .pe-md-0 {
        padding-right: 0 !important;
    }

    .pe-md-1 {
        padding-right: 0.25rem !important;
    }

    .pe-md-2 {
        padding-right: 0.5rem !important;
    }

    .pe-md-3 {
        padding-right: 1rem !important;
    }

    .pe-md-4 {
        padding-right: 1.5rem !important;
    }

    .pe-md-5 {
        padding-right: 3rem !important;
    }

    .pb-md-0 {
        padding-bottom: 0 !important;
    }

    .pb-md-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-md-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-md-3 {
        padding-bottom: 1rem !important;
    }

    .pb-md-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-md-5 {
        padding-bottom: 3rem !important;
    }

    .ps-md-0 {
        padding-left: 0 !important;
    }

    .ps-md-1 {
        padding-left: 0.25rem !important;
    }

    .ps-md-2 {
        padding-left: 0.5rem !important;
    }

    .ps-md-3 {
        padding-left: 1rem !important;
    }

    .ps-md-4 {
        padding-left: 1.5rem !important;
    }

    .ps-md-5 {
        padding-left: 3rem !important;
    }
}

@media (min-width: 992px) {

    .document-name-width {
        max-width: 250px;
    }

    .d-lg-inline {
        display: inline !important;
    }

    .d-lg-inline-block {
        display: inline-block !important;
    }

    .d-lg-block {
        display: block !important;
    }

    .d-lg-grid {
        display: grid !important;
    }

    .d-lg-table {
        display: table !important;
    }

    .d-lg-table-row {
        display: table-row !important;
    }

    .d-lg-table-cell {
        display: table-cell !important;
    }

    .d-lg-flex {
        display: flex !important;
    }

    .d-lg-inline-flex {
        display: inline-flex !important;
    }

    .d-lg-none {
        display: none !important;
    }

    .flex-lg-fill {
        flex: 1 1 auto !important;
    }

    .flex-lg-row {
        flex-direction: row !important;
    }

    .flex-lg-column {
        flex-direction: column !important;
    }

    .flex-lg-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-lg-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-lg-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-lg-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-lg-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-lg-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-lg-wrap {
        flex-wrap: wrap !important;
    }

    .flex-lg-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-lg-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .justify-content-lg-start {
        justify-content: flex-start !important;
    }

    .justify-content-lg-end {
        justify-content: flex-end !important;
    }

    .justify-content-lg-center {
        justify-content: center !important;
    }

    .justify-content-lg-between {
        justify-content: space-between !important;
    }

    .justify-content-lg-around {
        justify-content: space-around !important;
    }

    .justify-content-lg-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-lg-start {
        align-items: flex-start !important;
    }

    .align-items-lg-end {
        align-items: flex-end !important;
    }

    .align-items-lg-center {
        align-items: center !important;
    }

    .align-items-lg-baseline {
        align-items: baseline !important;
    }

    .align-items-lg-stretch {
        align-items: stretch !important;
    }

    .align-content-lg-start {
        align-content: flex-start !important;
    }

    .align-content-lg-end {
        align-content: flex-end !important;
    }

    .align-content-lg-center {
        align-content: center !important;
    }

    .align-content-lg-between {
        align-content: space-between !important;
    }

    .align-content-lg-around {
        align-content: space-around !important;
    }

    .align-content-lg-stretch {
        align-content: stretch !important;
    }

    .align-self-lg-auto {
        align-self: auto !important;
    }

    .align-self-lg-start {
        align-self: flex-start !important;
    }

    .align-self-lg-end {
        align-self: flex-end !important;
    }

    .align-self-lg-center {
        align-self: center !important;
    }

    .align-self-lg-baseline {
        align-self: baseline !important;
    }

    .align-self-lg-stretch {
        align-self: stretch !important;
    }

    .order-lg-first {
        order: -1 !important;
    }

    .order-lg-0 {
        order: 0 !important;
    }

    .order-lg-1 {
        order: 1 !important;
    }

    .order-lg-2 {
        order: 2 !important;
    }

    .order-lg-3 {
        order: 3 !important;
    }

    .order-lg-4 {
        order: 4 !important;
    }

    .order-lg-5 {
        order: 5 !important;
    }

    .order-lg-last {
        order: 6 !important;
    }

    .m-lg-0 {
        margin: 0 !important;
    }

    .m-lg-1 {
        margin: 0.25rem !important;
    }

    .m-lg-2 {
        margin: 0.5rem !important;
    }

    .m-lg-3 {
        margin: 1rem !important;
    }

    .m-lg-4 {
        margin: 1.5rem !important;
    }

    .m-lg-5 {
        margin: 3rem !important;
    }

    .m-lg-auto {
        margin: auto !important;
    }

    .mx-lg-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-lg-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-lg-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-lg-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-lg-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-lg-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-lg-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-lg-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-lg-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-lg-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-lg-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-lg-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-lg-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-lg-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-lg-0 {
        margin-top: 0 !important;
    }

    .mt-lg-1 {
        margin-top: 0.25rem !important;
    }

    .mt-lg-2 {
        margin-top: 0.5rem !important;
    }

    .mt-lg-3 {
        margin-top: 1rem !important;
    }

    .mt-lg-4 {
        margin-top: 1.5rem !important;
    }

    .mt-lg-5 {
        margin-top: 3rem !important;
    }

    .mt-lg-auto {
        margin-top: auto !important;
    }

    .me-lg-0 {
        margin-right: 0 !important;
    }

    .me-lg-1 {
        margin-right: 0.25rem !important;
    }

    .me-lg-2 {
        margin-right: 0.5rem !important;
    }

    .me-lg-3 {
        margin-right: 1rem !important;
    }

    .me-lg-4 {
        margin-right: 1.5rem !important;
    }

    .me-lg-5 {
        margin-right: 3rem !important;
    }

    .me-lg-auto {
        margin-right: auto !important;
    }

    .mb-lg-0 {
        margin-bottom: 0 !important;
    }

    .mb-lg-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-lg-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-lg-3 {
        margin-bottom: 1rem !important;
    }

    .mb-lg-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-lg-5 {
        margin-bottom: 3rem !important;
    }

    .mb-lg-auto {
        margin-bottom: auto !important;
    }

    .ms-lg-0 {
        margin-left: 0 !important;
    }

    .ms-lg-1 {
        margin-left: 0.25rem !important;
    }

    .ms-lg-2 {
        margin-left: 0.5rem !important;
    }

    .ms-lg-3 {
        margin-left: 1rem !important;
    }

    .ms-lg-4 {
        margin-left: 1.5rem !important;
    }

    .ms-lg-5 {
        margin-left: 3rem !important;
    }

    .ms-lg-auto {
        margin-left: auto !important;
    }

    .p-lg-0 {
        padding: 0 !important;
    }

    .p-lg-1 {
        padding: 0.25rem !important;
    }

    .p-lg-2 {
        padding: 0.5rem !important;
    }

    .p-lg-3 {
        padding: 1rem !important;
    }

    .p-lg-4 {
        padding: 1.5rem !important;
    }

    .p-lg-5 {
        padding: 3rem !important;
    }

    .px-lg-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-lg-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-lg-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-lg-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-lg-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-lg-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-lg-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-lg-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-lg-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-lg-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-lg-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-lg-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-lg-0 {
        padding-top: 0 !important;
    }

    .pt-lg-1 {
        padding-top: 0.25rem !important;
    }

    .pt-lg-2 {
        padding-top: 0.5rem !important;
    }

    .pt-lg-3 {
        padding-top: 1rem !important;
    }

    .pt-lg-4 {
        padding-top: 1.5rem !important;
    }

    .pt-lg-5 {
        padding-top: 3rem !important;
    }

    .pe-lg-0 {
        padding-right: 0 !important;
    }

    .pe-lg-1 {
        padding-right: 0.25rem !important;
    }

    .pe-lg-2 {
        padding-right: 0.5rem !important;
    }

    .pe-lg-3 {
        padding-right: 1rem !important;
    }

    .pe-lg-4 {
        padding-right: 1.5rem !important;
    }

    .pe-lg-5 {
        padding-right: 3rem !important;
    }

    .pb-lg-0 {
        padding-bottom: 0 !important;
    }

    .pb-lg-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-lg-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-lg-3 {
        padding-bottom: 1rem !important;
    }

    .pb-lg-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-lg-5 {
        padding-bottom: 3rem !important;
    }

    .ps-lg-0 {
        padding-left: 0 !important;
    }

    .ps-lg-1 {
        padding-left: 0.25rem !important;
    }

    .ps-lg-2 {
        padding-left: 0.5rem !important;
    }

    .ps-lg-3 {
        padding-left: 1rem !important;
    }

    .ps-lg-4 {
        padding-left: 1.5rem !important;
    }

    .ps-lg-5 {
        padding-left: 3rem !important;
    }
}

@media (min-width: 1200px) {

    .document-name-width {
        max-width: 250px;
    }

    .d-xl-inline {
        display: inline !important;
    }

    .d-xl-inline-block {
        display: inline-block !important;
    }

    .d-xl-block {
        display: block !important;
    }

    .d-xl-grid {
        display: grid !important;
    }

    .d-xl-table {
        display: table !important;
    }

    .d-xl-table-row {
        display: table-row !important;
    }

    .d-xl-table-cell {
        display: table-cell !important;
    }

    .d-xl-flex {
        display: flex !important;
    }

    .d-xl-inline-flex {
        display: inline-flex !important;
    }

    .d-xl-none {
        display: none !important;
    }

    .flex-xl-fill {
        flex: 1 1 auto !important;
    }

    .flex-xl-row {
        flex-direction: row !important;
    }

    .flex-xl-column {
        flex-direction: column !important;
    }

    .flex-xl-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-xl-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-xl-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-xl-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-xl-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-xl-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-xl-wrap {
        flex-wrap: wrap !important;
    }

    .flex-xl-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-xl-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .justify-content-xl-start {
        justify-content: flex-start !important;
    }

    .justify-content-xl-end {
        justify-content: flex-end !important;
    }

    .justify-content-xl-center {
        justify-content: center !important;
    }

    .justify-content-xl-between {
        justify-content: space-between !important;
    }

    .justify-content-xl-around {
        justify-content: space-around !important;
    }

    .justify-content-xl-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-xl-start {
        align-items: flex-start !important;
    }

    .align-items-xl-end {
        align-items: flex-end !important;
    }

    .align-items-xl-center {
        align-items: center !important;
    }

    .align-items-xl-baseline {
        align-items: baseline !important;
    }

    .align-items-xl-stretch {
        align-items: stretch !important;
    }

    .align-content-xl-start {
        align-content: flex-start !important;
    }

    .align-content-xl-end {
        align-content: flex-end !important;
    }

    .align-content-xl-center {
        align-content: center !important;
    }

    .align-content-xl-between {
        align-content: space-between !important;
    }

    .align-content-xl-around {
        align-content: space-around !important;
    }

    .align-content-xl-stretch {
        align-content: stretch !important;
    }

    .align-self-xl-auto {
        align-self: auto !important;
    }

    .align-self-xl-start {
        align-self: flex-start !important;
    }

    .align-self-xl-end {
        align-self: flex-end !important;
    }

    .align-self-xl-center {
        align-self: center !important;
    }

    .align-self-xl-baseline {
        align-self: baseline !important;
    }

    .align-self-xl-stretch {
        align-self: stretch !important;
    }

    .order-xl-first {
        order: -1 !important;
    }

    .order-xl-0 {
        order: 0 !important;
    }

    .order-xl-1 {
        order: 1 !important;
    }

    .order-xl-2 {
        order: 2 !important;
    }

    .order-xl-3 {
        order: 3 !important;
    }

    .order-xl-4 {
        order: 4 !important;
    }

    .order-xl-5 {
        order: 5 !important;
    }

    .order-xl-last {
        order: 6 !important;
    }

    .m-xl-0 {
        margin: 0 !important;
    }

    .m-xl-1 {
        margin: 0.25rem !important;
    }

    .m-xl-2 {
        margin: 0.5rem !important;
    }

    .m-xl-3 {
        margin: 1rem !important;
    }

    .m-xl-4 {
        margin: 1.5rem !important;
    }

    .m-xl-5 {
        margin: 3rem !important;
    }

    .m-xl-auto {
        margin: auto !important;
    }

    .mx-xl-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-xl-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-xl-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-xl-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-xl-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-xl-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-xl-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-xl-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-xl-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-xl-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-xl-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-xl-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-xl-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-xl-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-xl-0 {
        margin-top: 0 !important;
    }

    .mt-xl-1 {
        margin-top: 0.25rem !important;
    }

    .mt-xl-2 {
        margin-top: 0.5rem !important;
    }

    .mt-xl-3 {
        margin-top: 1rem !important;
    }

    .mt-xl-4 {
        margin-top: 1.5rem !important;
    }

    .mt-xl-5 {
        margin-top: 3rem !important;
    }

    .mt-xl-auto {
        margin-top: auto !important;
    }

    .me-xl-0 {
        margin-right: 0 !important;
    }

    .me-xl-1 {
        margin-right: 0.25rem !important;
    }

    .me-xl-2 {
        margin-right: 0.5rem !important;
    }

    .me-xl-3 {
        margin-right: 1rem !important;
    }

    .me-xl-4 {
        margin-right: 1.5rem !important;
    }

    .me-xl-5 {
        margin-right: 3rem !important;
    }

    .me-xl-auto {
        margin-right: auto !important;
    }

    .mb-xl-0 {
        margin-bottom: 0 !important;
    }

    .mb-xl-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-xl-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-xl-3 {
        margin-bottom: 1rem !important;
    }

    .mb-xl-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-xl-5 {
        margin-bottom: 3rem !important;
    }

    .mb-xl-auto {
        margin-bottom: auto !important;
    }

    .ms-xl-0 {
        margin-left: 0 !important;
    }

    .ms-xl-1 {
        margin-left: 0.25rem !important;
    }

    .ms-xl-2 {
        margin-left: 0.5rem !important;
    }

    .ms-xl-3 {
        margin-left: 1rem !important;
    }

    .ms-xl-4 {
        margin-left: 1.5rem !important;
    }

    .ms-xl-5 {
        margin-left: 3rem !important;
    }

    .ms-xl-auto {
        margin-left: auto !important;
    }

    .p-xl-0 {
        padding: 0 !important;
    }

    .p-xl-1 {
        padding: 0.25rem !important;
    }

    .p-xl-2 {
        padding: 0.5rem !important;
    }

    .p-xl-3 {
        padding: 1rem !important;
    }

    .p-xl-4 {
        padding: 1.5rem !important;
    }

    .p-xl-5 {
        padding: 3rem !important;
    }

    .px-xl-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-xl-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-xl-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-xl-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-xl-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-xl-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-xl-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-xl-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-xl-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-xl-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-xl-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-xl-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-xl-0 {
        padding-top: 0 !important;
    }

    .pt-xl-1 {
        padding-top: 0.25rem !important;
    }

    .pt-xl-2 {
        padding-top: 0.5rem !important;
    }

    .pt-xl-3 {
        padding-top: 1rem !important;
    }

    .pt-xl-4 {
        padding-top: 1.5rem !important;
    }

    .pt-xl-5 {
        padding-top: 3rem !important;
    }

    .pe-xl-0 {
        padding-right: 0 !important;
    }

    .pe-xl-1 {
        padding-right: 0.25rem !important;
    }

    .pe-xl-2 {
        padding-right: 0.5rem !important;
    }

    .pe-xl-3 {
        padding-right: 1rem !important;
    }

    .pe-xl-4 {
        padding-right: 1.5rem !important;
    }

    .pe-xl-5 {
        padding-right: 3rem !important;
    }

    .pb-xl-0 {
        padding-bottom: 0 !important;
    }

    .pb-xl-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-xl-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-xl-3 {
        padding-bottom: 1rem !important;
    }

    .pb-xl-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-xl-5 {
        padding-bottom: 3rem !important;
    }

    .ps-xl-0 {
        padding-left: 0 !important;
    }

    .ps-xl-1 {
        padding-left: 0.25rem !important;
    }

    .ps-xl-2 {
        padding-left: 0.5rem !important;
    }

    .ps-xl-3 {
        padding-left: 1rem !important;
    }

    .ps-xl-4 {
        padding-left: 1.5rem !important;
    }

    .ps-xl-5 {
        padding-left: 3rem !important;
    }
}

@media (min-width: 1400px) {
    .d-xxl-inline {
        display: inline !important;
    }

    .d-xxl-inline-block {
        display: inline-block !important;
    }

    .d-xxl-block {
        display: block !important;
    }

    .d-xxl-grid {
        display: grid !important;
    }

    .d-xxl-table {
        display: table !important;
    }

    .d-xxl-table-row {
        display: table-row !important;
    }

    .d-xxl-table-cell {
        display: table-cell !important;
    }

    .d-xxl-flex {
        display: flex !important;
    }

    .d-xxl-inline-flex {
        display: inline-flex !important;
    }

    .d-xxl-none {
        display: none !important;
    }

    .flex-xxl-fill {
        flex: 1 1 auto !important;
    }

    .flex-xxl-row {
        flex-direction: row !important;
    }

    .flex-xxl-column {
        flex-direction: column !important;
    }

    .flex-xxl-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-xxl-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-xxl-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-xxl-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-xxl-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-xxl-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-xxl-wrap {
        flex-wrap: wrap !important;
    }

    .flex-xxl-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-xxl-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .justify-content-xxl-start {
        justify-content: flex-start !important;
    }

    .justify-content-xxl-end {
        justify-content: flex-end !important;
    }

    .justify-content-xxl-center {
        justify-content: center !important;
    }

    .justify-content-xxl-between {
        justify-content: space-between !important;
    }

    .justify-content-xxl-around {
        justify-content: space-around !important;
    }

    .justify-content-xxl-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-xxl-start {
        align-items: flex-start !important;
    }

    .align-items-xxl-end {
        align-items: flex-end !important;
    }

    .align-items-xxl-center {
        align-items: center !important;
    }

    .align-items-xxl-baseline {
        align-items: baseline !important;
    }

    .align-items-xxl-stretch {
        align-items: stretch !important;
    }

    .align-content-xxl-start {
        align-content: flex-start !important;
    }

    .align-content-xxl-end {
        align-content: flex-end !important;
    }

    .align-content-xxl-center {
        align-content: center !important;
    }

    .align-content-xxl-between {
        align-content: space-between !important;
    }

    .align-content-xxl-around {
        align-content: space-around !important;
    }

    .align-content-xxl-stretch {
        align-content: stretch !important;
    }

    .align-self-xxl-auto {
        align-self: auto !important;
    }

    .align-self-xxl-start {
        align-self: flex-start !important;
    }

    .align-self-xxl-end {
        align-self: flex-end !important;
    }

    .align-self-xxl-center {
        align-self: center !important;
    }

    .align-self-xxl-baseline {
        align-self: baseline !important;
    }

    .align-self-xxl-stretch {
        align-self: stretch !important;
    }

    .order-xxl-first {
        order: -1 !important;
    }

    .order-xxl-0 {
        order: 0 !important;
    }

    .order-xxl-1 {
        order: 1 !important;
    }

    .order-xxl-2 {
        order: 2 !important;
    }

    .order-xxl-3 {
        order: 3 !important;
    }

    .order-xxl-4 {
        order: 4 !important;
    }

    .order-xxl-5 {
        order: 5 !important;
    }

    .order-xxl-last {
        order: 6 !important;
    }

    .m-xxl-0 {
        margin: 0 !important;
    }

    .m-xxl-1 {
        margin: 0.25rem !important;
    }

    .m-xxl-2 {
        margin: 0.5rem !important;
    }

    .m-xxl-3 {
        margin: 1rem !important;
    }

    .m-xxl-4 {
        margin: 1.5rem !important;
    }

    .m-xxl-5 {
        margin: 3rem !important;
    }

    .m-xxl-auto {
        margin: auto !important;
    }

    .mx-xxl-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-xxl-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-xxl-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-xxl-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-xxl-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-xxl-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-xxl-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-xxl-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-xxl-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-xxl-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-xxl-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-xxl-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-xxl-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-xxl-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-xxl-0 {
        margin-top: 0 !important;
    }

    .mt-xxl-1 {
        margin-top: 0.25rem !important;
    }

    .mt-xxl-2 {
        margin-top: 0.5rem !important;
    }

    .mt-xxl-3 {
        margin-top: 1rem !important;
    }

    .mt-xxl-4 {
        margin-top: 1.5rem !important;
    }

    .mt-xxl-5 {
        margin-top: 3rem !important;
    }

    .mt-xxl-auto {
        margin-top: auto !important;
    }

    .me-xxl-0 {
        margin-right: 0 !important;
    }

    .me-xxl-1 {
        margin-right: 0.25rem !important;
    }

    .me-xxl-2 {
        margin-right: 0.5rem !important;
    }

    .me-xxl-3 {
        margin-right: 1rem !important;
    }

    .me-xxl-4 {
        margin-right: 1.5rem !important;
    }

    .me-xxl-5 {
        margin-right: 3rem !important;
    }

    .me-xxl-auto {
        margin-right: auto !important;
    }

    .mb-xxl-0 {
        margin-bottom: 0 !important;
    }

    .mb-xxl-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-xxl-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-xxl-3 {
        margin-bottom: 1rem !important;
    }

    .mb-xxl-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-xxl-5 {
        margin-bottom: 3rem !important;
    }

    .mb-xxl-auto {
        margin-bottom: auto !important;
    }

    .ms-xxl-0 {
        margin-left: 0 !important;
    }

    .ms-xxl-1 {
        margin-left: 0.25rem !important;
    }

    .ms-xxl-2 {
        margin-left: 0.5rem !important;
    }

    .ms-xxl-3 {
        margin-left: 1rem !important;
    }

    .ms-xxl-4 {
        margin-left: 1.5rem !important;
    }

    .ms-xxl-5 {
        margin-left: 3rem !important;
    }

    .ms-xxl-auto {
        margin-left: auto !important;
    }

    .p-xxl-0 {
        padding: 0 !important;
    }

    .p-xxl-1 {
        padding: 0.25rem !important;
    }

    .p-xxl-2 {
        padding: 0.5rem !important;
    }

    .p-xxl-3 {
        padding: 1rem !important;
    }

    .p-xxl-4 {
        padding: 1.5rem !important;
    }

    .p-xxl-5 {
        padding: 3rem !important;
    }

    .px-xxl-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-xxl-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-xxl-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-xxl-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-xxl-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-xxl-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-xxl-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-xxl-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-xxl-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-xxl-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-xxl-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-xxl-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-xxl-0 {
        padding-top: 0 !important;
    }

    .pt-xxl-1 {
        padding-top: 0.25rem !important;
    }

    .pt-xxl-2 {
        padding-top: 0.5rem !important;
    }

    .pt-xxl-3 {
        padding-top: 1rem !important;
    }

    .pt-xxl-4 {
        padding-top: 1.5rem !important;
    }

    .pt-xxl-5 {
        padding-top: 3rem !important;
    }

    .pe-xxl-0 {
        padding-right: 0 !important;
    }

    .pe-xxl-1 {
        padding-right: 0.25rem !important;
    }

    .pe-xxl-2 {
        padding-right: 0.5rem !important;
    }

    .pe-xxl-3 {
        padding-right: 1rem !important;
    }

    .pe-xxl-4 {
        padding-right: 1.5rem !important;
    }

    .pe-xxl-5 {
        padding-right: 3rem !important;
    }

    .pb-xxl-0 {
        padding-bottom: 0 !important;
    }

    .pb-xxl-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-xxl-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-xxl-3 {
        padding-bottom: 1rem !important;
    }

    .pb-xxl-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-xxl-5 {
        padding-bottom: 3rem !important;
    }

    .ps-xxl-0 {
        padding-left: 0 !important;
    }

    .ps-xxl-1 {
        padding-left: 0.25rem !important;
    }

    .ps-xxl-2 {
        padding-left: 0.5rem !important;
    }

    .ps-xxl-3 {
        padding-left: 1rem !important;
    }

    .ps-xxl-4 {
        padding-left: 1.5rem !important;
    }

    .ps-xxl-5 {
        padding-left: 3rem !important;
    }
}

@media print {
    .d-print-inline {
        display: inline !important;
    }

    .d-print-inline-block {
        display: inline-block !important;
    }

    .d-print-block {
        display: block !important;
    }

    .d-print-grid {
        display: grid !important;
    }

    .d-print-table {
        display: table !important;
    }

    .d-print-table-row {
        display: table-row !important;
    }

    .d-print-table-cell {
        display: table-cell !important;
    }

    .d-print-flex {
        display: flex !important;
    }

    .d-print-inline-flex {
        display: inline-flex !important;
    }

    .d-print-none {
        display: none !important;
    }
}

/*!
 * Bootstrap Utilities v5.1.3 (https://getbootstrap.com/)
 * Copyright 2011-2021 The Bootstrap Authors
 * Copyright 2011-2021 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
.clearfix::after {
    display: block;
    clear: both;
    content: "";
}

.link-primary {
    color: #0d6efd;
}

.link-primary:hover,
.link-primary:focus {
    color: #0a58ca;
}

.link-secondary {
    color: #6c757d;
}

.link-secondary:hover,
.link-secondary:focus {
    color: #565e64;
}

.link-success {
    color: #198754;
}

.link-success:hover,
.link-success:focus {
    color: #146c43;
}

.link-info {
    color: #0dcaf0;
}

.link-info:hover,
.link-info:focus {
    color: #3dd5f3;
}

.link-warning {
    color: #ffc107;
}

.link-warning:hover,
.link-warning:focus {
    color: #ffcd39;
}

.link-danger {
    color: #dc3545;
}

.link-danger:hover,
.link-danger:focus {
    color: #b02a37;
}

.link-light {
    color: #f8f9fa;
}

.link-light:hover,
.link-light:focus {
    color: #f9fafb;
}

.link-dark {
    color: #212529;
}

.link-dark:hover,
.link-dark:focus {
    color: #1a1e21;
}

.ratio {
    position: relative;
    width: 100%;
}

.ratio::before {
    display: block;
    padding-top: var(--bs-aspect-ratio);
    content: "";
}

.ratio>* {
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
}

.ratio-1x1 {
    --bs-aspect-ratio: 100%;
}

.ratio-4x3 {
    --bs-aspect-ratio: 75%;
}

.ratio-16x9 {
    --bs-aspect-ratio: 56.25%;
}

.ratio-21x9 {
    --bs-aspect-ratio: 42.8571428571%;
}

.fixed-top {
    position: fixed;
    top: 0;
    right: 0;
    left: 0;
    z-index: 1030;
}

.fixed-bottom {
    position: fixed;
    right: 0;
    bottom: 0;
    left: 0;
    z-index: 1030;
}

.sticky-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020;
}

@media (min-width: 576px) {
    .sticky-sm-top {
        position: -webkit-sticky;
        position: sticky;
        top: 0;
        z-index: 1020;
    }
}

@media (min-width: 768px) {
    .sticky-md-top {
        position: -webkit-sticky;
        position: sticky;
        top: 0;
        z-index: 1020;
    }
}

@media (min-width: 992px) {
    .sticky-lg-top {
        position: -webkit-sticky;
        position: sticky;
        top: 0;
        z-index: 1020;
    }
}

@media (min-width: 1200px) {
    .sticky-xl-top {
        position: -webkit-sticky;
        position: sticky;
        top: 0;
        z-index: 1020;
    }
}

@media (min-width: 1400px) {
    .sticky-xxl-top {
        position: -webkit-sticky;
        position: sticky;
        top: 0;
        z-index: 1020;
    }
}

.hstack {
    display: flex;
    flex-direction: row;
    align-items: center;
    align-self: stretch;
}

.vstack {
    display: flex;
    flex: 1 1 auto;
    flex-direction: column;
    align-self: stretch;
}

.visually-hidden,
.visually-hidden-focusable:not(:focus):not(:focus-within) {
    position: absolute !important;
    width: 1px !important;
    height: 1px !important;
    padding: 0 !important;
    margin: -1px !important;
    overflow: hidden !important;
    clip: rect(0, 0, 0, 0) !important;
    white-space: nowrap !important;
    border: 0 !important;
}

.stretched-link::after {
    position: absolute;
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    z-index: 1;
    content: "";
}

.text-truncate {
    overflow: hidden;
    text-overflow: ellipsis;
    white-space: nowrap;
}

.vr {
    display: inline-block;
    align-self: stretch;
    width: 1px;
    min-height: 1em;
    background-color: currentColor;
    opacity: 0.25;
}

.align-baseline {
    vertical-align: baseline !important;
}

.align-top {
    vertical-align: top !important;
}

.align-middle {
    vertical-align: middle !important;
}

.align-bottom {
    vertical-align: bottom !important;
}

.align-text-bottom {
    vertical-align: text-bottom !important;
}

.align-text-top {
    vertical-align: text-top !important;
}

.float-start {
    float: left !important;
}

.float-end {
    float: right !important;
}

.float-none {
    float: none !important;
}

.opacity-0 {
    opacity: 0 !important;
}

.opacity-25 {
    opacity: 0.25 !important;
}

.opacity-50 {
    opacity: 0.5 !important;
}

.opacity-75 {
    opacity: 0.75 !important;
}

.opacity-100 {
    opacity: 1 !important;
}

.overflow-auto {
    overflow: auto !important;
}

.overflow-hidden {
    overflow: hidden !important;
}

.overflow-visible {
    overflow: visible !important;
}

.overflow-scroll {
    overflow: scroll !important;
}

.d-inline {
    display: inline !important;
}

.d-inline-block {
    display: inline-block !important;
}

.d-block {
    display: block !important;
}

.d-grid {
    display: grid !important;
}

.d-table {
    display: table !important;
}

.d-table-row {
    display: table-row !important;
}

.d-table-cell {
    display: table-cell !important;
}

.d-flex {
    display: flex !important;
}

.d-inline-flex {
    display: inline-flex !important;
}

.d-none {
    display: none !important;
}

.shadow {
    box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important;
}

.shadow-sm {
    box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important;
}

.shadow-lg {
    box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important;
}

.shadow-none {
    box-shadow: none !important;
}

.position-static {
    position: static !important;
}

.position-relative {
    position: relative !important;
}

.position-absolute {
    position: absolute !important;
}

.position-fixed {
    position: fixed !important;
}

.position-sticky {
    position: -webkit-sticky !important;
    position: sticky !important;
}

.top-0 {
    top: 0 !important;
}

.top-50 {
    top: 50% !important;
}

.top-100 {
    top: 100% !important;
}

.bottom-0 {
    bottom: 0 !important;
}

.bottom-50 {
    bottom: 50% !important;
}

.bottom-100 {
    bottom: 100% !important;
}

.start-0 {
    left: 0 !important;
}

.start-50 {
    left: 50% !important;
}

.start-100 {
    left: 100% !important;
}

.end-0 {
    right: 0 !important;
}

.end-50 {
    right: 50% !important;
}

.end-100 {
    right: 100% !important;
}

.translate-middle {
    transform: translate(-50%, -50%) !important;
}

.translate-middle-x {
    transform: translateX(-50%) !important;
}

.translate-middle-y {
    transform: translateY(-50%) !important;
}

.border {
    border: 1px solid #dee2e6 !important;
}

.border-0 {
    border: 0 !important;
}

.border-top {
    border-top: 1px solid #dee2e6 !important;
}

.border-top-0 {
    border-top: 0 !important;
}

.border-end {
    border-right: 1px solid #dee2e6 !important;
}

.border-end-0 {
    border-right: 0 !important;
}

.border-bottom {
    border-bottom: 1px solid #dee2e6 !important;
}

.border-bottom-0 {
    border-bottom: 0 !important;
}

.border-start {
    border-left: 1px solid #dee2e6 !important;
}

.border-start-0 {
    border-left: 0 !important;
}

.border-primary {
    border-color: #0d6efd !important;
}

.border-secondary {
    border-color: #6c757d !important;
}

.border-success {
    border-color: #198754 !important;
}

.border-info {
    border-color: #0dcaf0 !important;
}

.border-warning {
    border-color: #ffc107 !important;
}

.border-danger {
    border-color: #dc3545 !important;
}

.border-light {
    border-color: #f8f9fa !important;
}

.border-dark {
    border-color: #212529 !important;
}

.border-white {
    border-color: #fff !important;
}

.border-1 {
    border-width: 1px !important;
}

.border-2 {
    border-width: 2px !important;
}

.border-3 {
    border-width: 3px !important;
}

.border-4 {
    border-width: 4px !important;
}

.border-5 {
    border-width: 5px !important;
}

.w-25 {
    width: 25% !important;
}

.w-50 {
    width: 50% !important;
}

.w-75 {
    width: 75% !important;
}

.w-100 {
    width: 100% !important;
}

.w-auto {
    width: auto !important;
}

.mw-100 {
    max-width: 100% !important;
}

.vw-100 {
    width: 100vw !important;
}

.min-vw-100 {
    min-width: 100vw !important;
}

.h-25 {
    height: 25% !important;
}

.h-50 {
    height: 50% !important;
}

.h-75 {
    height: 75% !important;
}

.h-100 {
    height: 100% !important;
}

.h-auto {
    height: auto !important;
}

.mh-100 {
    max-height: 100% !important;
}

.vh-100 {
    height: 100vh !important;
}

.min-vh-100 {
    min-height: 100vh !important;
}

.flex-fill {
    flex: 1 1 auto !important;
}

.flex-row {
    flex-direction: row !important;
}

.flex-column {
    flex-direction: column !important;
}

.flex-row-reverse {
    flex-direction: row-reverse !important;
}

.flex-column-reverse {
    flex-direction: column-reverse !important;
}

.flex-grow-0 {
    flex-grow: 0 !important;
}

.flex-grow-1 {
    flex-grow: 1 !important;
}

.flex-shrink-0 {
    flex-shrink: 0 !important;
}

.flex-shrink-1 {
    flex-shrink: 1 !important;
}

.flex-wrap {
    flex-wrap: wrap !important;
}

.flex-nowrap {
    flex-wrap: nowrap !important;
}

.flex-wrap-reverse {
    flex-wrap: wrap-reverse !important;
}

.gap-0 {
    gap: 0 !important;
}

.gap-1 {
    gap: 0.25rem !important;
}

.gap-2 {
    gap: 0.5rem !important;
}

.gap-3 {
    gap: 1rem !important;
}

.gap-4 {
    gap: 1.5rem !important;
}

.gap-5 {
    gap: 3rem !important;
}

.justify-content-start {
    justify-content: flex-start !important;
}

.justify-content-end {
    justify-content: flex-end !important;
}

.justify-content-center {
    justify-content: center !important;
}

.justify-content-between {
    justify-content: space-between !important;
}

.justify-content-around {
    justify-content: space-around !important;
}

.justify-content-evenly {
    justify-content: space-evenly !important;
}

.align-items-start {
    align-items: flex-start !important;
}

.align-items-end {
    align-items: flex-end !important;
}

.align-items-center {
    align-items: center !important;
}

.align-items-baseline {
    align-items: baseline !important;
}

.align-items-stretch {
    align-items: stretch !important;
}

.align-content-start {
    align-content: flex-start !important;
}

.align-content-end {
    align-content: flex-end !important;
}

.align-content-center {
    align-content: center !important;
}

.align-content-between {
    align-content: space-between !important;
}

.align-content-around {
    align-content: space-around !important;
}

.align-content-stretch {
    align-content: stretch !important;
}

.align-self-auto {
    align-self: auto !important;
}

.align-self-start {
    align-self: flex-start !important;
}

.align-self-end {
    align-self: flex-end !important;
}

.align-self-center {
    align-self: center !important;
}

.align-self-baseline {
    align-self: baseline !important;
}

.align-self-stretch {
    align-self: stretch !important;
}

.order-first {
    order: -1 !important;
}

.order-0 {
    order: 0 !important;
}

.order-1 {
    order: 1 !important;
}

.order-2 {
    order: 2 !important;
}

.order-3 {
    order: 3 !important;
}

.order-4 {
    order: 4 !important;
}

.order-5 {
    order: 5 !important;
}

.order-last {
    order: 6 !important;
}

.m-0 {
    margin: 0 !important;
}

.m-1 {
    margin: 0.25rem !important;
}

.m-2 {
    margin: 0.5rem !important;
}

.m-3 {
    margin: 1rem !important;
}

.m-4 {
    margin: 1.5rem !important;
}

.m-5 {
    margin: 3rem !important;
}

.m-auto {
    margin: auto !important;
}

.mx-0 {
    margin-right: 0 !important;
    margin-left: 0 !important;
}

.mx-1 {
    margin-right: 0.25rem !important;
    margin-left: 0.25rem !important;
}

.mx-2 {
    margin-right: 0.5rem !important;
    margin-left: 0.5rem !important;
}

.mx-3 {
    margin-right: 1rem !important;
    margin-left: 1rem !important;
}

.mx-4 {
    margin-right: 1.5rem !important;
    margin-left: 1.5rem !important;
}

.mx-5 {
    margin-right: 3rem !important;
    margin-left: 3rem !important;
}

.mx-auto {
    margin-right: auto !important;
    margin-left: auto !important;
}

.my-0 {
    margin-top: 0 !important;
    margin-bottom: 0 !important;
}

.my-1 {
    margin-top: 0.25rem !important;
    margin-bottom: 0.25rem !important;
}

.my-2 {
    margin-top: 0.5rem !important;
    margin-bottom: 0.5rem !important;
}

.my-3 {
    margin-top: 1rem !important;
    margin-bottom: 1rem !important;
}

.my-4 {
    margin-top: 1.5rem !important;
    margin-bottom: 1.5rem !important;
}

.my-5 {
    margin-top: 3rem !important;
    margin-bottom: 3rem !important;
}

.my-auto {
    margin-top: auto !important;
    margin-bottom: auto !important;
}

.mt-0 {
    margin-top: 0 !important;
}

.mt-1 {
    margin-top: 0.25rem !important;
}

.mt-2 {
    margin-top: 0.5rem !important;
}

.mt-3 {
    margin-top: 1rem !important;
}

.mt-4 {
    margin-top: 1.5rem !important;
}

.mt-5 {
    margin-top: 3rem !important;
}

.mt-auto {
    margin-top: auto !important;
}

.me-0 {
    margin-right: 0 !important;
}

.me-1 {
    margin-right: 0.25rem !important;
}

.me-2 {
    margin-right: 0.5rem !important;
}

.me-3 {
    margin-right: 1rem !important;
}

.me-4 {
    margin-right: 1.5rem !important;
}

.me-5 {
    margin-right: 3rem !important;
}

.me-auto {
    margin-right: auto !important;
}

.mb-0 {
    margin-bottom: 0 !important;
}

.mb-1 {
    margin-bottom: 0.25rem !important;
}

.mb-2 {
    margin-bottom: 0.5rem !important;
}

.mb-3 {
    margin-bottom: 1rem !important;
}

.mb-4 {
    margin-bottom: 1.5rem !important;
}

.mb-5 {
    margin-bottom: 3rem !important;
}

.mb-auto {
    margin-bottom: auto !important;
}

.ms-0 {
    margin-left: 0 !important;
}

.ms-1 {
    margin-left: 0.25rem !important;
}

.ms-2 {
    margin-left: 0.5rem !important;
}

.ms-3 {
    margin-left: 1rem !important;
}

.ms-4 {
    margin-left: 1.5rem !important;
}

.ms-5 {
    margin-left: 3rem !important;
}

.ms-auto {
    margin-left: auto !important;
}

.p-0 {
    padding: 0 !important;
}

.p-1 {
    padding: 0.25rem !important;
}

.p-2 {
    padding: 0.5rem !important;
}

.p-3 {
    padding: 1rem !important;
}

.p-4 {
    padding: 1.5rem !important;
}

.p-5 {
    padding: 3rem !important;
}

.px-0 {
    padding-right: 0 !important;
    padding-left: 0 !important;
}

.px-1 {
    padding-right: 0.25rem !important;
    padding-left: 0.25rem !important;
}

.px-2 {
    padding-right: 0.5rem !important;
    padding-left: 0.5rem !important;
}

.px-3 {
    padding-right: 1rem !important;
    padding-left: 1rem !important;
}

.px-4 {
    padding-right: 1.5rem !important;
    padding-left: 1.5rem !important;
}

.px-5 {
    padding-right: 3rem !important;
    padding-left: 3rem !important;
}

.py-0 {
    padding-top: 0 !important;
    padding-bottom: 0 !important;
}

.py-1 {
    padding-top: 0.25rem !important;
    padding-bottom: 0.25rem !important;
}

.py-2 {
    padding-top: 0.5rem !important;
    padding-bottom: 0.5rem !important;
}

.py-3 {
    padding-top: 1rem !important;
    padding-bottom: 1rem !important;
}

.py-4 {
    padding-top: 1.5rem !important;
    padding-bottom: 1.5rem !important;
}

.py-5 {
    padding-top: 3rem !important;
    padding-bottom: 3rem !important;
}

.pt-0 {
    padding-top: 0 !important;
}

.pt-1 {
    padding-top: 0.25rem !important;
}

.pt-2 {
    padding-top: 0.5rem !important;
}

.pt-3 {
    padding-top: 1rem !important;
}

.pt-4 {
    padding-top: 1.5rem !important;
}

.pt-5 {
    padding-top: 3rem !important;
}

.pe-0 {
    padding-right: 0 !important;
}

.pe-1 {
    padding-right: 0.25rem !important;
}

.pe-2 {
    padding-right: 0.5rem !important;
}

.pe-3 {
    padding-right: 1rem !important;
}

.pe-4 {
    padding-right: 1.5rem !important;
}

.pe-5 {
    padding-right: 3rem !important;
}

.pb-0 {
    padding-bottom: 0 !important;
}

.pb-1 {
    padding-bottom: 0.25rem !important;
}

.pb-2 {
    padding-bottom: 0.5rem !important;
}

.pb-3 {
    padding-bottom: 1rem !important;
}

.pb-4 {
    padding-bottom: 1.5rem !important;
}

.pb-5 {
    padding-bottom: 3rem !important;
}

.ps-0 {
    padding-left: 0 !important;
}

.ps-1 {
    padding-left: 0.25rem !important;
}

.ps-2 {
    padding-left: 0.5rem !important;
}

.ps-3 {
    padding-left: 1rem !important;
}

.ps-4 {
    padding-left: 1.5rem !important;
}

.ps-5 {
    padding-left: 3rem !important;
}

.font-monospace {
    font-family: var(--bs-font-monospace) !important;
}

.fs-1 {
    font-size: calc(1.375rem + 1.5vw) !important;
}

.fs-2 {
    font-size: calc(1.325rem + 0.9vw) !important;
}

.fs-3 {
    font-size: calc(1.3rem + 0.6vw) !important;
}

.fs-4 {
    font-size: calc(1.275rem + 0.3vw) !important;
}

.fs-5 {
    font-size: 1.25rem !important;
}

.fs-6 {
    font-size: 1rem !important;
}

.fst-italic {
    font-style: italic !important;
}

.fst-normal {
    font-style: normal !important;
}

.fw-light {
    font-weight: 300 !important;
}

.fw-lighter {
    font-weight: lighter !important;
}

.fw-normal {
    font-weight: 400 !important;
}

.fw-bold {
    font-weight: 700 !important;
}

.fw-bolder {
    font-weight: bolder !important;
}

.lh-1 {
    line-height: 1 !important;
}

.lh-sm {
    line-height: 1.25 !important;
}

.lh-base {
    line-height: 1.5 !important;
}

.lh-lg {
    line-height: 2 !important;
}

.text-start {
    text-align: left !important;
}

.text-end {
    text-align: right !important;
}

.text-center {
    text-align: center !important;
}

.text-decoration-none {
    text-decoration: none !important;
}

.text-decoration-underline {
    text-decoration: underline !important;
}

.text-decoration-line-through {
    text-decoration: line-through !important;
}

.text-lowercase {
    text-transform: lowercase !important;
}

.text-uppercase {
    text-transform: uppercase !important;
}

.text-capitalize {
    text-transform: capitalize !important;
}

.text-wrap {
    white-space: normal !important;
}

.text-nowrap {
    white-space: nowrap !important;
}

/* rtl:begin:remove */
.text-break {
    word-wrap: break-word !important;
    word-break: break-word !important;
}

/* rtl:end:remove */
.text-primary {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important;
}

.text-secondary {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important;
}

.text-success {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important;
}

.text-info {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important;
}

.text-warning {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important;
}

.text-danger {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important;
}

.text-light {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important;
}

.text-dark {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important;
}

.text-black {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important;
}

.text-white {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important;
}

.text-body {
    --bs-text-opacity: 1;
    color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important;
}

.text-muted {
    --bs-text-opacity: 1;
    color: #6c757d !important;
}

.text-black-50 {
    --bs-text-opacity: 1;
    color: rgba(0, 0, 0, 0.5) !important;
}

.text-white-50 {
    --bs-text-opacity: 1;
    color: rgba(255, 255, 255, 0.5) !important;
}

.text-reset {
    --bs-text-opacity: 1;
    color: inherit !important;
}

.text-opacity-25 {
    --bs-text-opacity: 0.25;
}

.text-opacity-50 {
    --bs-text-opacity: 0.5;
}

.text-opacity-75 {
    --bs-text-opacity: 0.75;
}

.text-opacity-100 {
    --bs-text-opacity: 1;
}

.bg-primary {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important;
}

.bg-secondary {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important;
}

.bg-success {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important;
}

.bg-info {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important;
}

.bg-warning {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important;
}

.bg-danger {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important;
}

.bg-light {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important;
}

.bg-dark {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important;
}

.bg-black {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important;
}

.bg-white {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important;
}

.bg-body {
    --bs-bg-opacity: 1;
    background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important;
}

.bg-transparent {
    --bs-bg-opacity: 1;
    background-color: transparent !important;
}

.bg-opacity-10 {
    --bs-bg-opacity: 0.1;
}

.bg-opacity-25 {
    --bs-bg-opacity: 0.25;
}

.bg-opacity-50 {
    --bs-bg-opacity: 0.5;
}

.bg-opacity-75 {
    --bs-bg-opacity: 0.75;
}

.bg-opacity-100 {
    --bs-bg-opacity: 1;
}

.bg-gradient {
    background-image: var(--bs-gradient) !important;
}

.user-select-all {
    -webkit-user-select: all !important;
    -moz-user-select: all !important;
    user-select: all !important;
}

.user-select-auto {
    -webkit-user-select: auto !important;
    -moz-user-select: auto !important;
    user-select: auto !important;
}

.user-select-none {
    -webkit-user-select: none !important;
    -moz-user-select: none !important;
    user-select: none !important;
}

.pe-none {
    pointer-events: none !important;
}

.pe-auto {
    pointer-events: auto !important;
}

.rounded {
    border-radius: 0.25rem !important;
}

.rounded-0 {
    border-radius: 0 !important;
}

.rounded-1 {
    border-radius: 0.2rem !important;
}

.rounded-2 {
    border-radius: 0.25rem !important;
}

.rounded-3 {
    border-radius: 0.3rem !important;
}

.rounded-4 {
    border-radius: 0.5rem !important;
}

.rounded-5 {
    border-radius: 0.5rem !important;
}

.rounded-circle {
    border-radius: 50% !important;
}

.rounded-pill {
    border-radius: 50rem !important;
    text-decoration: #4F596B;
    background-color: #F2F2F6;
}

.rounded-category {
    border-radius: 50rem !important;
    text-decoration: #4F596B;
    background-color: white;
    border-style: solid;
    border-width: 1px;
    border-color: #CACFD7;
}

.rounded-top {
    border-top-left-radius: 0.25rem !important;
    border-top-right-radius: 0.25rem !important;
}

.rounded-end {
    border-top-right-radius: 0.25rem !important;
    border-bottom-right-radius: 0.25rem !important;
}

.rounded-bottom {
    border-bottom-right-radius: 0.25rem !important;
    border-bottom-left-radius: 0.25rem !important;
}

.rounded-start {
    border-bottom-left-radius: 0.25rem !important;
    border-top-left-radius: 0.25rem !important;
}

.visible {
    visibility: visible !important;
}

.invisible {
    visibility: hidden !important;
}

@media (min-width: 576px) {
    .float-sm-start {
        float: left !important;
    }

    .float-sm-end {
        float: right !important;
    }

    .float-sm-none {
        float: none !important;
    }

    .d-sm-inline {
        display: inline !important;
    }

    .d-sm-inline-block {
        display: inline-block !important;
    }

    .d-sm-block {
        display: block !important;
    }

    .d-sm-grid {
        display: grid !important;
    }

    .d-sm-table {
        display: table !important;
    }

    .d-sm-table-row {
        display: table-row !important;
    }

    .d-sm-table-cell {
        display: table-cell !important;
    }

    .d-sm-flex {
        display: flex !important;
    }

    .d-sm-inline-flex {
        display: inline-flex !important;
    }

    .d-sm-none {
        display: none !important;
    }

    .flex-sm-fill {
        flex: 1 1 auto !important;
    }

    .flex-sm-row {
        flex-direction: row !important;
    }

    .flex-sm-column {
        flex-direction: column !important;
    }

    .flex-sm-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-sm-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-sm-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-sm-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-sm-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-sm-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-sm-wrap {
        flex-wrap: wrap !important;
    }

    .flex-sm-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-sm-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .gap-sm-0 {
        gap: 0 !important;
    }

    .gap-sm-1 {
        gap: 0.25rem !important;
    }

    .gap-sm-2 {
        gap: 0.5rem !important;
    }

    .gap-sm-3 {
        gap: 1rem !important;
    }

    .gap-sm-4 {
        gap: 1.5rem !important;
    }

    .gap-sm-5 {
        gap: 3rem !important;
    }

    .justify-content-sm-start {
        justify-content: flex-start !important;
    }

    .justify-content-sm-end {
        justify-content: flex-end !important;
    }

    .justify-content-sm-center {
        justify-content: center !important;
    }

    .justify-content-sm-between {
        justify-content: space-between !important;
    }

    .justify-content-sm-around {
        justify-content: space-around !important;
    }

    .justify-content-sm-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-sm-start {
        align-items: flex-start !important;
    }

    .align-items-sm-end {
        align-items: flex-end !important;
    }

    .align-items-sm-center {
        align-items: center !important;
    }

    .align-items-sm-baseline {
        align-items: baseline !important;
    }

    .align-items-sm-stretch {
        align-items: stretch !important;
    }

    .align-content-sm-start {
        align-content: flex-start !important;
    }

    .align-content-sm-end {
        align-content: flex-end !important;
    }

    .align-content-sm-center {
        align-content: center !important;
    }

    .align-content-sm-between {
        align-content: space-between !important;
    }

    .align-content-sm-around {
        align-content: space-around !important;
    }

    .align-content-sm-stretch {
        align-content: stretch !important;
    }

    .align-self-sm-auto {
        align-self: auto !important;
    }

    .align-self-sm-start {
        align-self: flex-start !important;
    }

    .align-self-sm-end {
        align-self: flex-end !important;
    }

    .align-self-sm-center {
        align-self: center !important;
    }

    .align-self-sm-baseline {
        align-self: baseline !important;
    }

    .align-self-sm-stretch {
        align-self: stretch !important;
    }

    .order-sm-first {
        order: -1 !important;
    }

    .order-sm-0 {
        order: 0 !important;
    }

    .order-sm-1 {
        order: 1 !important;
    }

    .order-sm-2 {
        order: 2 !important;
    }

    .order-sm-3 {
        order: 3 !important;
    }

    .order-sm-4 {
        order: 4 !important;
    }

    .order-sm-5 {
        order: 5 !important;
    }

    .order-sm-last {
        order: 6 !important;
    }

    .m-sm-0 {
        margin: 0 !important;
    }

    .m-sm-1 {
        margin: 0.25rem !important;
    }

    .m-sm-2 {
        margin: 0.5rem !important;
    }

    .m-sm-3 {
        margin: 1rem !important;
    }

    .m-sm-4 {
        margin: 1.5rem !important;
    }

    .m-sm-5 {
        margin: 3rem !important;
    }

    .m-sm-auto {
        margin: auto !important;
    }

    .mx-sm-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-sm-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-sm-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-sm-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-sm-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-sm-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-sm-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-sm-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-sm-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-sm-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-sm-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-sm-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-sm-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-sm-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-sm-0 {
        margin-top: 0 !important;
    }

    .mt-sm-1 {
        margin-top: 0.25rem !important;
    }

    .mt-sm-2 {
        margin-top: 0.5rem !important;
    }

    .mt-sm-3 {
        margin-top: 1rem !important;
    }

    .mt-sm-4 {
        margin-top: 1.5rem !important;
    }

    .mt-sm-5 {
        margin-top: 3rem !important;
    }

    .mt-sm-auto {
        margin-top: auto !important;
    }

    .me-sm-0 {
        margin-right: 0 !important;
    }

    .me-sm-1 {
        margin-right: 0.25rem !important;
    }

    .me-sm-2 {
        margin-right: 0.5rem !important;
    }

    .me-sm-3 {
        margin-right: 1rem !important;
    }

    .me-sm-4 {
        margin-right: 1.5rem !important;
    }

    .me-sm-5 {
        margin-right: 3rem !important;
    }

    .me-sm-auto {
        margin-right: auto !important;
    }

    .mb-sm-0 {
        margin-bottom: 0 !important;
    }

    .mb-sm-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-sm-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-sm-3 {
        margin-bottom: 1rem !important;
    }

    .mb-sm-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-sm-5 {
        margin-bottom: 3rem !important;
    }

    .mb-sm-auto {
        margin-bottom: auto !important;
    }

    .ms-sm-0 {
        margin-left: 0 !important;
    }

    .ms-sm-1 {
        margin-left: 0.25rem !important;
    }

    .ms-sm-2 {
        margin-left: 0.5rem !important;
    }

    .ms-sm-3 {
        margin-left: 1rem !important;
    }

    .ms-sm-4 {
        margin-left: 1.5rem !important;
    }

    .ms-sm-5 {
        margin-left: 3rem !important;
    }

    .ms-sm-auto {
        margin-left: auto !important;
    }

    .p-sm-0 {
        padding: 0 !important;
    }

    .p-sm-1 {
        padding: 0.25rem !important;
    }

    .p-sm-2 {
        padding: 0.5rem !important;
    }

    .p-sm-3 {
        padding: 1rem !important;
    }

    .p-sm-4 {
        padding: 1.5rem !important;
    }

    .p-sm-5 {
        padding: 3rem !important;
    }

    .px-sm-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-sm-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-sm-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-sm-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-sm-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-sm-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-sm-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-sm-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-sm-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-sm-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-sm-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-sm-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-sm-0 {
        padding-top: 0 !important;
    }

    .pt-sm-1 {
        padding-top: 0.25rem !important;
    }

    .pt-sm-2 {
        padding-top: 0.5rem !important;
    }

    .pt-sm-3 {
        padding-top: 1rem !important;
    }

    .pt-sm-4 {
        padding-top: 1.5rem !important;
    }

    .pt-sm-5 {
        padding-top: 3rem !important;
    }

    .pe-sm-0 {
        padding-right: 0 !important;
    }

    .pe-sm-1 {
        padding-right: 0.25rem !important;
    }

    .pe-sm-2 {
        padding-right: 0.5rem !important;
    }

    .pe-sm-3 {
        padding-right: 1rem !important;
    }

    .pe-sm-4 {
        padding-right: 1.5rem !important;
    }

    .pe-sm-5 {
        padding-right: 3rem !important;
    }

    .pb-sm-0 {
        padding-bottom: 0 !important;
    }

    .pb-sm-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-sm-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-sm-3 {
        padding-bottom: 1rem !important;
    }

    .pb-sm-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-sm-5 {
        padding-bottom: 3rem !important;
    }

    .ps-sm-0 {
        padding-left: 0 !important;
    }

    .ps-sm-1 {
        padding-left: 0.25rem !important;
    }

    .ps-sm-2 {
        padding-left: 0.5rem !important;
    }

    .ps-sm-3 {
        padding-left: 1rem !important;
    }

    .ps-sm-4 {
        padding-left: 1.5rem !important;
    }

    .ps-sm-5 {
        padding-left: 3rem !important;
    }

    .text-sm-start {
        text-align: left !important;
    }

    .text-sm-end {
        text-align: right !important;
    }

    .text-sm-center {
        text-align: center !important;
    }
}

@media (min-width: 768px) {
    .float-md-start {
        float: left !important;
    }

    .float-md-end {
        float: right !important;
    }

    .float-md-none {
        float: none !important;
    }

    .d-md-inline {
        display: inline !important;
    }

    .d-md-inline-block {
        display: inline-block !important;
    }

    .d-md-block {
        display: block !important;
    }

    .d-md-grid {
        display: grid !important;
    }

    .d-md-table {
        display: table !important;
    }

    .d-md-table-row {
        display: table-row !important;
    }

    .d-md-table-cell {
        display: table-cell !important;
    }

    .d-md-flex {
        display: flex !important;
    }

    .d-md-inline-flex {
        display: inline-flex !important;
    }

    .d-md-none {
        display: none !important;
    }

    .flex-md-fill {
        flex: 1 1 auto !important;
    }

    .flex-md-row {
        flex-direction: row !important;
    }

    .flex-md-column {
        flex-direction: column !important;
    }

    .flex-md-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-md-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-md-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-md-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-md-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-md-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-md-wrap {
        flex-wrap: wrap !important;
    }

    .flex-md-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-md-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .gap-md-0 {
        gap: 0 !important;
    }

    .gap-md-1 {
        gap: 0.25rem !important;
    }

    .gap-md-2 {
        gap: 0.5rem !important;
    }

    .gap-md-3 {
        gap: 1rem !important;
    }

    .gap-md-4 {
        gap: 1.5rem !important;
    }

    .gap-md-5 {
        gap: 3rem !important;
    }

    .justify-content-md-start {
        justify-content: flex-start !important;
    }

    .justify-content-md-end {
        justify-content: flex-end !important;
    }

    .justify-content-md-center {
        justify-content: center !important;
    }

    .justify-content-md-between {
        justify-content: space-between !important;
    }

    .justify-content-md-around {
        justify-content: space-around !important;
    }

    .justify-content-md-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-md-start {
        align-items: flex-start !important;
    }

    .align-items-md-end {
        align-items: flex-end !important;
    }

    .align-items-md-center {
        align-items: center !important;
    }

    .align-items-md-baseline {
        align-items: baseline !important;
    }

    .align-items-md-stretch {
        align-items: stretch !important;
    }

    .align-content-md-start {
        align-content: flex-start !important;
    }

    .align-content-md-end {
        align-content: flex-end !important;
    }

    .align-content-md-center {
        align-content: center !important;
    }

    .align-content-md-between {
        align-content: space-between !important;
    }

    .align-content-md-around {
        align-content: space-around !important;
    }

    .align-content-md-stretch {
        align-content: stretch !important;
    }

    .align-self-md-auto {
        align-self: auto !important;
    }

    .align-self-md-start {
        align-self: flex-start !important;
    }

    .align-self-md-end {
        align-self: flex-end !important;
    }

    .align-self-md-center {
        align-self: center !important;
    }

    .align-self-md-baseline {
        align-self: baseline !important;
    }

    .align-self-md-stretch {
        align-self: stretch !important;
    }

    .order-md-first {
        order: -1 !important;
    }

    .order-md-0 {
        order: 0 !important;
    }

    .order-md-1 {
        order: 1 !important;
    }

    .order-md-2 {
        order: 2 !important;
    }

    .order-md-3 {
        order: 3 !important;
    }

    .order-md-4 {
        order: 4 !important;
    }

    .order-md-5 {
        order: 5 !important;
    }

    .order-md-last {
        order: 6 !important;
    }

    .m-md-0 {
        margin: 0 !important;
    }

    .m-md-1 {
        margin: 0.25rem !important;
    }

    .m-md-2 {
        margin: 0.5rem !important;
    }

    .m-md-3 {
        margin: 1rem !important;
    }

    .m-md-4 {
        margin: 1.5rem !important;
    }

    .m-md-5 {
        margin: 3rem !important;
    }

    .m-md-auto {
        margin: auto !important;
    }

    .mx-md-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-md-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-md-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-md-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-md-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-md-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-md-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-md-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-md-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-md-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-md-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-md-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-md-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-md-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-md-0 {
        margin-top: 0 !important;
    }

    .mt-md-1 {
        margin-top: 0.25rem !important;
    }

    .mt-md-2 {
        margin-top: 0.5rem !important;
    }

    .mt-md-3 {
        margin-top: 1rem !important;
    }

    .mt-md-4 {
        margin-top: 1.5rem !important;
    }

    .mt-md-5 {
        margin-top: 3rem !important;
    }

    .mt-md-auto {
        margin-top: auto !important;
    }

    .me-md-0 {
        margin-right: 0 !important;
    }

    .me-md-1 {
        margin-right: 0.25rem !important;
    }

    .me-md-2 {
        margin-right: 0.5rem !important;
    }

    .me-md-3 {
        margin-right: 1rem !important;
    }

    .me-md-4 {
        margin-right: 1.5rem !important;
    }

    .me-md-5 {
        margin-right: 3rem !important;
    }

    .me-md-auto {
        margin-right: auto !important;
    }

    .mb-md-0 {
        margin-bottom: 0 !important;
    }

    .mb-md-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-md-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-md-3 {
        margin-bottom: 1rem !important;
    }

    .mb-md-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-md-5 {
        margin-bottom: 3rem !important;
    }

    .mb-md-auto {
        margin-bottom: auto !important;
    }

    .ms-md-0 {
        margin-left: 0 !important;
    }

    .ms-md-1 {
        margin-left: 0.25rem !important;
    }

    .ms-md-2 {
        margin-left: 0.5rem !important;
    }

    .ms-md-3 {
        margin-left: 1rem !important;
    }

    .ms-md-4 {
        margin-left: 1.5rem !important;
    }

    .ms-md-5 {
        margin-left: 3rem !important;
    }

    .ms-md-auto {
        margin-left: auto !important;
    }

    .p-md-0 {
        padding: 0 !important;
    }

    .p-md-1 {
        padding: 0.25rem !important;
    }

    .p-md-2 {
        padding: 0.5rem !important;
    }

    .p-md-3 {
        padding: 1rem !important;
    }

    .p-md-4 {
        padding: 1.5rem !important;
    }

    .p-md-5 {
        padding: 3rem !important;
    }

    .px-md-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-md-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-md-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-md-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-md-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-md-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-md-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-md-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-md-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-md-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-md-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-md-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-md-0 {
        padding-top: 0 !important;
    }

    .pt-md-1 {
        padding-top: 0.25rem !important;
    }

    .pt-md-2 {
        padding-top: 0.5rem !important;
    }

    .pt-md-3 {
        padding-top: 1rem !important;
    }

    .pt-md-4 {
        padding-top: 1.5rem !important;
    }

    .pt-md-5 {
        padding-top: 3rem !important;
    }

    .pe-md-0 {
        padding-right: 0 !important;
    }

    .pe-md-1 {
        padding-right: 0.25rem !important;
    }

    .pe-md-2 {
        padding-right: 0.5rem !important;
    }

    .pe-md-3 {
        padding-right: 1rem !important;
    }

    .pe-md-4 {
        padding-right: 1.5rem !important;
    }

    .pe-md-5 {
        padding-right: 3rem !important;
    }

    .pb-md-0 {
        padding-bottom: 0 !important;
    }

    .pb-md-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-md-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-md-3 {
        padding-bottom: 1rem !important;
    }

    .pb-md-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-md-5 {
        padding-bottom: 3rem !important;
    }

    .ps-md-0 {
        padding-left: 0 !important;
    }

    .ps-md-1 {
        padding-left: 0.25rem !important;
    }

    .ps-md-2 {
        padding-left: 0.5rem !important;
    }

    .ps-md-3 {
        padding-left: 1rem !important;
    }

    .ps-md-4 {
        padding-left: 1.5rem !important;
    }

    .ps-md-5 {
        padding-left: 3rem !important;
    }

    .text-md-start {
        text-align: left !important;
    }

    .text-md-end {
        text-align: right !important;
    }

    .text-md-center {
        text-align: center !important;
    }
}

@media (min-width: 992px) {
    .float-lg-start {
        float: left !important;
    }

    .float-lg-end {
        float: right !important;
    }

    .float-lg-none {
        float: none !important;
    }

    .d-lg-inline {
        display: inline !important;
    }

    .d-lg-inline-block {
        display: inline-block !important;
    }

    .d-lg-block {
        display: block !important;
    }

    .d-lg-grid {
        display: grid !important;
    }

    .d-lg-table {
        display: table !important;
    }

    .d-lg-table-row {
        display: table-row !important;
    }

    .d-lg-table-cell {
        display: table-cell !important;
    }

    .d-lg-flex {
        display: flex !important;
    }

    .d-lg-inline-flex {
        display: inline-flex !important;
    }

    .d-lg-none {
        display: none !important;
    }

    .flex-lg-fill {
        flex: 1 1 auto !important;
    }

    .flex-lg-row {
        flex-direction: row !important;
    }

    .flex-lg-column {
        flex-direction: column !important;
    }

    .flex-lg-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-lg-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-lg-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-lg-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-lg-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-lg-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-lg-wrap {
        flex-wrap: wrap !important;
    }

    .flex-lg-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-lg-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .gap-lg-0 {
        gap: 0 !important;
    }

    .gap-lg-1 {
        gap: 0.25rem !important;
    }

    .gap-lg-2 {
        gap: 0.5rem !important;
    }

    .gap-lg-3 {
        gap: 1rem !important;
    }

    .gap-lg-4 {
        gap: 1.5rem !important;
    }

    .gap-lg-5 {
        gap: 3rem !important;
    }

    .justify-content-lg-start {
        justify-content: flex-start !important;
    }

    .justify-content-lg-end {
        justify-content: flex-end !important;
    }

    .justify-content-lg-center {
        justify-content: center !important;
    }

    .justify-content-lg-between {
        justify-content: space-between !important;
    }

    .justify-content-lg-around {
        justify-content: space-around !important;
    }

    .justify-content-lg-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-lg-start {
        align-items: flex-start !important;
    }

    .align-items-lg-end {
        align-items: flex-end !important;
    }

    .align-items-lg-center {
        align-items: center !important;
    }

    .align-items-lg-baseline {
        align-items: baseline !important;
    }

    .align-items-lg-stretch {
        align-items: stretch !important;
    }

    .align-content-lg-start {
        align-content: flex-start !important;
    }

    .align-content-lg-end {
        align-content: flex-end !important;
    }

    .align-content-lg-center {
        align-content: center !important;
    }

    .align-content-lg-between {
        align-content: space-between !important;
    }

    .align-content-lg-around {
        align-content: space-around !important;
    }

    .align-content-lg-stretch {
        align-content: stretch !important;
    }

    .align-self-lg-auto {
        align-self: auto !important;
    }

    .align-self-lg-start {
        align-self: flex-start !important;
    }

    .align-self-lg-end {
        align-self: flex-end !important;
    }

    .align-self-lg-center {
        align-self: center !important;
    }

    .align-self-lg-baseline {
        align-self: baseline !important;
    }

    .align-self-lg-stretch {
        align-self: stretch !important;
    }

    .order-lg-first {
        order: -1 !important;
    }

    .order-lg-0 {
        order: 0 !important;
    }

    .order-lg-1 {
        order: 1 !important;
    }

    .order-lg-2 {
        order: 2 !important;
    }

    .order-lg-3 {
        order: 3 !important;
    }

    .order-lg-4 {
        order: 4 !important;
    }

    .order-lg-5 {
        order: 5 !important;
    }

    .order-lg-last {
        order: 6 !important;
    }

    .m-lg-0 {
        margin: 0 !important;
    }

    .m-lg-1 {
        margin: 0.25rem !important;
    }

    .m-lg-2 {
        margin: 0.5rem !important;
    }

    .m-lg-3 {
        margin: 1rem !important;
    }

    .m-lg-4 {
        margin: 1.5rem !important;
    }

    .m-lg-5 {
        margin: 3rem !important;
    }

    .m-lg-auto {
        margin: auto !important;
    }

    .mx-lg-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-lg-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-lg-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-lg-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-lg-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-lg-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-lg-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-lg-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-lg-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-lg-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-lg-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-lg-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-lg-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-lg-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-lg-0 {
        margin-top: 0 !important;
    }

    .mt-lg-1 {
        margin-top: 0.25rem !important;
    }

    .mt-lg-2 {
        margin-top: 0.5rem !important;
    }

    .mt-lg-3 {
        margin-top: 1rem !important;
    }

    .mt-lg-4 {
        margin-top: 1.5rem !important;
    }

    .mt-lg-5 {
        margin-top: 3rem !important;
    }

    .mt-lg-auto {
        margin-top: auto !important;
    }

    .me-lg-0 {
        margin-right: 0 !important;
    }

    .me-lg-1 {
        margin-right: 0.25rem !important;
    }

    .me-lg-2 {
        margin-right: 0.5rem !important;
    }

    .me-lg-3 {
        margin-right: 1rem !important;
    }

    .me-lg-4 {
        margin-right: 1.5rem !important;
    }

    .me-lg-5 {
        margin-right: 3rem !important;
    }

    .me-lg-auto {
        margin-right: auto !important;
    }

    .mb-lg-0 {
        margin-bottom: 0 !important;
    }

    .mb-lg-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-lg-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-lg-3 {
        margin-bottom: 1rem !important;
    }

    .mb-lg-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-lg-5 {
        margin-bottom: 3rem !important;
    }

    .mb-lg-auto {
        margin-bottom: auto !important;
    }

    .ms-lg-0 {
        margin-left: 0 !important;
    }

    .ms-lg-1 {
        margin-left: 0.25rem !important;
    }

    .ms-lg-2 {
        margin-left: 0.5rem !important;
    }

    .ms-lg-3 {
        margin-left: 1rem !important;
    }

    .ms-lg-4 {
        margin-left: 1.5rem !important;
    }

    .ms-lg-5 {
        margin-left: 3rem !important;
    }

    .ms-lg-auto {
        margin-left: auto !important;
    }

    .p-lg-0 {
        padding: 0 !important;
    }

    .p-lg-1 {
        padding: 0.25rem !important;
    }

    .p-lg-2 {
        padding: 0.5rem !important;
    }

    .p-lg-3 {
        padding: 1rem !important;
    }

    .p-lg-4 {
        padding: 1.5rem !important;
    }

    .p-lg-5 {
        padding: 3rem !important;
    }

    .px-lg-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-lg-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-lg-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-lg-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-lg-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-lg-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-lg-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-lg-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-lg-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-lg-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-lg-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-lg-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-lg-0 {
        padding-top: 0 !important;
    }

    .pt-lg-1 {
        padding-top: 0.25rem !important;
    }

    .pt-lg-2 {
        padding-top: 0.5rem !important;
    }

    .pt-lg-3 {
        padding-top: 1rem !important;
    }

    .pt-lg-4 {
        padding-top: 1.5rem !important;
    }

    .pt-lg-5 {
        padding-top: 3rem !important;
    }

    .pe-lg-0 {
        padding-right: 0 !important;
    }

    .pe-lg-1 {
        padding-right: 0.25rem !important;
    }

    .pe-lg-2 {
        padding-right: 0.5rem !important;
    }

    .pe-lg-3 {
        padding-right: 1rem !important;
    }

    .pe-lg-4 {
        padding-right: 1.5rem !important;
    }

    .pe-lg-5 {
        padding-right: 3rem !important;
    }

    .pb-lg-0 {
        padding-bottom: 0 !important;
    }

    .pb-lg-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-lg-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-lg-3 {
        padding-bottom: 1rem !important;
    }

    .pb-lg-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-lg-5 {
        padding-bottom: 3rem !important;
    }

    .ps-lg-0 {
        padding-left: 0 !important;
    }

    .ps-lg-1 {
        padding-left: 0.25rem !important;
    }

    .ps-lg-2 {
        padding-left: 0.5rem !important;
    }

    .ps-lg-3 {
        padding-left: 1rem !important;
    }

    .ps-lg-4 {
        padding-left: 1.5rem !important;
    }

    .ps-lg-5 {
        padding-left: 3rem !important;
    }

    .text-lg-start {
        text-align: left !important;
    }

    .text-lg-end {
        text-align: right !important;
    }

    .text-lg-center {
        text-align: center !important;
    }
}

@media (min-width: 1200px) {
    .float-xl-start {
        float: left !important;
    }

    .float-xl-end {
        float: right !important;
    }

    .float-xl-none {
        float: none !important;
    }

    .d-xl-inline {
        display: inline !important;
    }

    .d-xl-inline-block {
        display: inline-block !important;
    }

    .d-xl-block {
        display: block !important;
    }

    .d-xl-grid {
        display: grid !important;
    }

    .d-xl-table {
        display: table !important;
    }

    .d-xl-table-row {
        display: table-row !important;
    }

    .d-xl-table-cell {
        display: table-cell !important;
    }

    .d-xl-flex {
        display: flex !important;
    }

    .d-xl-inline-flex {
        display: inline-flex !important;
    }

    .d-xl-none {
        display: none !important;
    }

    .flex-xl-fill {
        flex: 1 1 auto !important;
    }

    .flex-xl-row {
        flex-direction: row !important;
    }

    .flex-xl-column {
        flex-direction: column !important;
    }

    .flex-xl-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-xl-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-xl-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-xl-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-xl-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-xl-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-xl-wrap {
        flex-wrap: wrap !important;
    }

    .flex-xl-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-xl-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .gap-xl-0 {
        gap: 0 !important;
    }

    .gap-xl-1 {
        gap: 0.25rem !important;
    }

    .gap-xl-2 {
        gap: 0.5rem !important;
    }

    .gap-xl-3 {
        gap: 1rem !important;
    }

    .gap-xl-4 {
        gap: 1.5rem !important;
    }

    .gap-xl-5 {
        gap: 3rem !important;
    }

    .justify-content-xl-start {
        justify-content: flex-start !important;
    }

    .justify-content-xl-end {
        justify-content: flex-end !important;
    }

    .justify-content-xl-center {
        justify-content: center !important;
    }

    .justify-content-xl-between {
        justify-content: space-between !important;
    }

    .justify-content-xl-around {
        justify-content: space-around !important;
    }

    .justify-content-xl-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-xl-start {
        align-items: flex-start !important;
    }

    .align-items-xl-end {
        align-items: flex-end !important;
    }

    .align-items-xl-center {
        align-items: center !important;
    }

    .align-items-xl-baseline {
        align-items: baseline !important;
    }

    .align-items-xl-stretch {
        align-items: stretch !important;
    }

    .align-content-xl-start {
        align-content: flex-start !important;
    }

    .align-content-xl-end {
        align-content: flex-end !important;
    }

    .align-content-xl-center {
        align-content: center !important;
    }

    .align-content-xl-between {
        align-content: space-between !important;
    }

    .align-content-xl-around {
        align-content: space-around !important;
    }

    .align-content-xl-stretch {
        align-content: stretch !important;
    }

    .align-self-xl-auto {
        align-self: auto !important;
    }

    .align-self-xl-start {
        align-self: flex-start !important;
    }

    .align-self-xl-end {
        align-self: flex-end !important;
    }

    .align-self-xl-center {
        align-self: center !important;
    }

    .align-self-xl-baseline {
        align-self: baseline !important;
    }

    .align-self-xl-stretch {
        align-self: stretch !important;
    }

    .order-xl-first {
        order: -1 !important;
    }

    .order-xl-0 {
        order: 0 !important;
    }

    .order-xl-1 {
        order: 1 !important;
    }

    .order-xl-2 {
        order: 2 !important;
    }

    .order-xl-3 {
        order: 3 !important;
    }

    .order-xl-4 {
        order: 4 !important;
    }

    .order-xl-5 {
        order: 5 !important;
    }

    .order-xl-last {
        order: 6 !important;
    }

    .m-xl-0 {
        margin: 0 !important;
    }

    .m-xl-1 {
        margin: 0.25rem !important;
    }

    .m-xl-2 {
        margin: 0.5rem !important;
    }

    .m-xl-3 {
        margin: 1rem !important;
    }

    .m-xl-4 {
        margin: 1.5rem !important;
    }

    .m-xl-5 {
        margin: 3rem !important;
    }

    .m-xl-auto {
        margin: auto !important;
    }

    .mx-xl-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-xl-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-xl-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-xl-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-xl-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-xl-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-xl-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-xl-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-xl-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-xl-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-xl-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-xl-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-xl-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-xl-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-xl-0 {
        margin-top: 0 !important;
    }

    .mt-xl-1 {
        margin-top: 0.25rem !important;
    }

    .mt-xl-2 {
        margin-top: 0.5rem !important;
    }

    .mt-xl-3 {
        margin-top: 1rem !important;
    }

    .mt-xl-4 {
        margin-top: 1.5rem !important;
    }

    .mt-xl-5 {
        margin-top: 3rem !important;
    }

    .mt-xl-auto {
        margin-top: auto !important;
    }

    .me-xl-0 {
        margin-right: 0 !important;
    }

    .me-xl-1 {
        margin-right: 0.25rem !important;
    }

    .me-xl-2 {
        margin-right: 0.5rem !important;
    }

    .me-xl-3 {
        margin-right: 1rem !important;
    }

    .me-xl-4 {
        margin-right: 1.5rem !important;
    }

    .me-xl-5 {
        margin-right: 3rem !important;
    }

    .me-xl-auto {
        margin-right: auto !important;
    }

    .mb-xl-0 {
        margin-bottom: 0 !important;
    }

    .mb-xl-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-xl-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-xl-3 {
        margin-bottom: 1rem !important;
    }

    .mb-xl-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-xl-5 {
        margin-bottom: 3rem !important;
    }

    .mb-xl-auto {
        margin-bottom: auto !important;
    }

    .ms-xl-0 {
        margin-left: 0 !important;
    }

    .ms-xl-1 {
        margin-left: 0.25rem !important;
    }

    .ms-xl-2 {
        margin-left: 0.5rem !important;
    }

    .ms-xl-3 {
        margin-left: 1rem !important;
    }

    .ms-xl-4 {
        margin-left: 1.5rem !important;
    }

    .ms-xl-5 {
        margin-left: 3rem !important;
    }

    .ms-xl-auto {
        margin-left: auto !important;
    }

    .p-xl-0 {
        padding: 0 !important;
    }

    .p-xl-1 {
        padding: 0.25rem !important;
    }

    .p-xl-2 {
        padding: 0.5rem !important;
    }

    .p-xl-3 {
        padding: 1rem !important;
    }

    .p-xl-4 {
        padding: 1.5rem !important;
    }

    .p-xl-5 {
        padding: 3rem !important;
    }

    .px-xl-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-xl-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-xl-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-xl-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-xl-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-xl-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-xl-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-xl-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-xl-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-xl-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-xl-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-xl-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-xl-0 {
        padding-top: 0 !important;
    }

    .pt-xl-1 {
        padding-top: 0.25rem !important;
    }

    .pt-xl-2 {
        padding-top: 0.5rem !important;
    }

    .pt-xl-3 {
        padding-top: 1rem !important;
    }

    .pt-xl-4 {
        padding-top: 1.5rem !important;
    }

    .pt-xl-5 {
        padding-top: 3rem !important;
    }

    .pe-xl-0 {
        padding-right: 0 !important;
    }

    .pe-xl-1 {
        padding-right: 0.25rem !important;
    }

    .pe-xl-2 {
        padding-right: 0.5rem !important;
    }

    .pe-xl-3 {
        padding-right: 1rem !important;
    }

    .pe-xl-4 {
        padding-right: 1.5rem !important;
    }

    .pe-xl-5 {
        padding-right: 3rem !important;
    }

    .pb-xl-0 {
        padding-bottom: 0 !important;
    }

    .pb-xl-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-xl-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-xl-3 {
        padding-bottom: 1rem !important;
    }

    .pb-xl-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-xl-5 {
        padding-bottom: 3rem !important;
    }

    .ps-xl-0 {
        padding-left: 0 !important;
    }

    .ps-xl-1 {
        padding-left: 0.25rem !important;
    }

    .ps-xl-2 {
        padding-left: 0.5rem !important;
    }

    .ps-xl-3 {
        padding-left: 1rem !important;
    }

    .ps-xl-4 {
        padding-left: 1.5rem !important;
    }

    .ps-xl-5 {
        padding-left: 3rem !important;
    }

    .text-xl-start {
        text-align: left !important;
    }

    .text-xl-end {
        text-align: right !important;
    }

    .text-xl-center {
        text-align: center !important;
    }
}

@media (min-width: 1400px) {
    .float-xxl-start {
        float: left !important;
    }

    .float-xxl-end {
        float: right !important;
    }

    .float-xxl-none {
        float: none !important;
    }

    .d-xxl-inline {
        display: inline !important;
    }

    .d-xxl-inline-block {
        display: inline-block !important;
    }

    .d-xxl-block {
        display: block !important;
    }

    .d-xxl-grid {
        display: grid !important;
    }

    .d-xxl-table {
        display: table !important;
    }

    .d-xxl-table-row {
        display: table-row !important;
    }

    .d-xxl-table-cell {
        display: table-cell !important;
    }

    .d-xxl-flex {
        display: flex !important;
    }

    .d-xxl-inline-flex {
        display: inline-flex !important;
    }

    .d-xxl-none {
        display: none !important;
    }

    .flex-xxl-fill {
        flex: 1 1 auto !important;
    }

    .flex-xxl-row {
        flex-direction: row !important;
    }

    .flex-xxl-column {
        flex-direction: column !important;
    }

    .flex-xxl-row-reverse {
        flex-direction: row-reverse !important;
    }

    .flex-xxl-column-reverse {
        flex-direction: column-reverse !important;
    }

    .flex-xxl-grow-0 {
        flex-grow: 0 !important;
    }

    .flex-xxl-grow-1 {
        flex-grow: 1 !important;
    }

    .flex-xxl-shrink-0 {
        flex-shrink: 0 !important;
    }

    .flex-xxl-shrink-1 {
        flex-shrink: 1 !important;
    }

    .flex-xxl-wrap {
        flex-wrap: wrap !important;
    }

    .flex-xxl-nowrap {
        flex-wrap: nowrap !important;
    }

    .flex-xxl-wrap-reverse {
        flex-wrap: wrap-reverse !important;
    }

    .gap-xxl-0 {
        gap: 0 !important;
    }

    .gap-xxl-1 {
        gap: 0.25rem !important;
    }

    .gap-xxl-2 {
        gap: 0.5rem !important;
    }

    .gap-xxl-3 {
        gap: 1rem !important;
    }

    .gap-xxl-4 {
        gap: 1.5rem !important;
    }

    .gap-xxl-5 {
        gap: 3rem !important;
    }

    .justify-content-xxl-start {
        justify-content: flex-start !important;
    }

    .justify-content-xxl-end {
        justify-content: flex-end !important;
    }

    .justify-content-xxl-center {
        justify-content: center !important;
    }

    .justify-content-xxl-between {
        justify-content: space-between !important;
    }

    .justify-content-xxl-around {
        justify-content: space-around !important;
    }

    .justify-content-xxl-evenly {
        justify-content: space-evenly !important;
    }

    .align-items-xxl-start {
        align-items: flex-start !important;
    }

    .align-items-xxl-end {
        align-items: flex-end !important;
    }

    .align-items-xxl-center {
        align-items: center !important;
    }

    .align-items-xxl-baseline {
        align-items: baseline !important;
    }

    .align-items-xxl-stretch {
        align-items: stretch !important;
    }

    .align-content-xxl-start {
        align-content: flex-start !important;
    }

    .align-content-xxl-end {
        align-content: flex-end !important;
    }

    .align-content-xxl-center {
        align-content: center !important;
    }

    .align-content-xxl-between {
        align-content: space-between !important;
    }

    .align-content-xxl-around {
        align-content: space-around !important;
    }

    .align-content-xxl-stretch {
        align-content: stretch !important;
    }

    .align-self-xxl-auto {
        align-self: auto !important;
    }

    .align-self-xxl-start {
        align-self: flex-start !important;
    }

    .align-self-xxl-end {
        align-self: flex-end !important;
    }

    .align-self-xxl-center {
        align-self: center !important;
    }

    .align-self-xxl-baseline {
        align-self: baseline !important;
    }

    .align-self-xxl-stretch {
        align-self: stretch !important;
    }

    .order-xxl-first {
        order: -1 !important;
    }

    .order-xxl-0 {
        order: 0 !important;
    }

    .order-xxl-1 {
        order: 1 !important;
    }

    .order-xxl-2 {
        order: 2 !important;
    }

    .order-xxl-3 {
        order: 3 !important;
    }

    .order-xxl-4 {
        order: 4 !important;
    }

    .order-xxl-5 {
        order: 5 !important;
    }

    .order-xxl-last {
        order: 6 !important;
    }

    .m-xxl-0 {
        margin: 0 !important;
    }

    .m-xxl-1 {
        margin: 0.25rem !important;
    }

    .m-xxl-2 {
        margin: 0.5rem !important;
    }

    .m-xxl-3 {
        margin: 1rem !important;
    }

    .m-xxl-4 {
        margin: 1.5rem !important;
    }

    .m-xxl-5 {
        margin: 3rem !important;
    }

    .m-xxl-auto {
        margin: auto !important;
    }

    .mx-xxl-0 {
        margin-right: 0 !important;
        margin-left: 0 !important;
    }

    .mx-xxl-1 {
        margin-right: 0.25rem !important;
        margin-left: 0.25rem !important;
    }

    .mx-xxl-2 {
        margin-right: 0.5rem !important;
        margin-left: 0.5rem !important;
    }

    .mx-xxl-3 {
        margin-right: 1rem !important;
        margin-left: 1rem !important;
    }

    .mx-xxl-4 {
        margin-right: 1.5rem !important;
        margin-left: 1.5rem !important;
    }

    .mx-xxl-5 {
        margin-right: 3rem !important;
        margin-left: 3rem !important;
    }

    .mx-xxl-auto {
        margin-right: auto !important;
        margin-left: auto !important;
    }

    .my-xxl-0 {
        margin-top: 0 !important;
        margin-bottom: 0 !important;
    }

    .my-xxl-1 {
        margin-top: 0.25rem !important;
        margin-bottom: 0.25rem !important;
    }

    .my-xxl-2 {
        margin-top: 0.5rem !important;
        margin-bottom: 0.5rem !important;
    }

    .my-xxl-3 {
        margin-top: 1rem !important;
        margin-bottom: 1rem !important;
    }

    .my-xxl-4 {
        margin-top: 1.5rem !important;
        margin-bottom: 1.5rem !important;
    }

    .my-xxl-5 {
        margin-top: 3rem !important;
        margin-bottom: 3rem !important;
    }

    .my-xxl-auto {
        margin-top: auto !important;
        margin-bottom: auto !important;
    }

    .mt-xxl-0 {
        margin-top: 0 !important;
    }

    .mt-xxl-1 {
        margin-top: 0.25rem !important;
    }

    .mt-xxl-2 {
        margin-top: 0.5rem !important;
    }

    .mt-xxl-3 {
        margin-top: 1rem !important;
    }

    .mt-xxl-4 {
        margin-top: 1.5rem !important;
    }

    .mt-xxl-5 {
        margin-top: 3rem !important;
    }

    .mt-xxl-auto {
        margin-top: auto !important;
    }

    .me-xxl-0 {
        margin-right: 0 !important;
    }

    .me-xxl-1 {
        margin-right: 0.25rem !important;
    }

    .me-xxl-2 {
        margin-right: 0.5rem !important;
    }

    .me-xxl-3 {
        margin-right: 1rem !important;
    }

    .me-xxl-4 {
        margin-right: 1.5rem !important;
    }

    .me-xxl-5 {
        margin-right: 3rem !important;
    }

    .me-xxl-auto {
        margin-right: auto !important;
    }

    .mb-xxl-0 {
        margin-bottom: 0 !important;
    }

    .mb-xxl-1 {
        margin-bottom: 0.25rem !important;
    }

    .mb-xxl-2 {
        margin-bottom: 0.5rem !important;
    }

    .mb-xxl-3 {
        margin-bottom: 1rem !important;
    }

    .mb-xxl-4 {
        margin-bottom: 1.5rem !important;
    }

    .mb-xxl-5 {
        margin-bottom: 3rem !important;
    }

    .mb-xxl-auto {
        margin-bottom: auto !important;
    }

    .ms-xxl-0 {
        margin-left: 0 !important;
    }

    .ms-xxl-1 {
        margin-left: 0.25rem !important;
    }

    .ms-xxl-2 {
        margin-left: 0.5rem !important;
    }

    .ms-xxl-3 {
        margin-left: 1rem !important;
    }

    .ms-xxl-4 {
        margin-left: 1.5rem !important;
    }

    .ms-xxl-5 {
        margin-left: 3rem !important;
    }

    .ms-xxl-auto {
        margin-left: auto !important;
    }

    .p-xxl-0 {
        padding: 0 !important;
    }

    .p-xxl-1 {
        padding: 0.25rem !important;
    }

    .p-xxl-2 {
        padding: 0.5rem !important;
    }

    .p-xxl-3 {
        padding: 1rem !important;
    }

    .p-xxl-4 {
        padding: 1.5rem !important;
    }

    .p-xxl-5 {
        padding: 3rem !important;
    }

    .px-xxl-0 {
        padding-right: 0 !important;
        padding-left: 0 !important;
    }

    .px-xxl-1 {
        padding-right: 0.25rem !important;
        padding-left: 0.25rem !important;
    }

    .px-xxl-2 {
        padding-right: 0.5rem !important;
        padding-left: 0.5rem !important;
    }

    .px-xxl-3 {
        padding-right: 1rem !important;
        padding-left: 1rem !important;
    }

    .px-xxl-4 {
        padding-right: 1.5rem !important;
        padding-left: 1.5rem !important;
    }

    .px-xxl-5 {
        padding-right: 3rem !important;
        padding-left: 3rem !important;
    }

    .py-xxl-0 {
        padding-top: 0 !important;
        padding-bottom: 0 !important;
    }

    .py-xxl-1 {
        padding-top: 0.25rem !important;
        padding-bottom: 0.25rem !important;
    }

    .py-xxl-2 {
        padding-top: 0.5rem !important;
        padding-bottom: 0.5rem !important;
    }

    .py-xxl-3 {
        padding-top: 1rem !important;
        padding-bottom: 1rem !important;
    }

    .py-xxl-4 {
        padding-top: 1.5rem !important;
        padding-bottom: 1.5rem !important;
    }

    .py-xxl-5 {
        padding-top: 3rem !important;
        padding-bottom: 3rem !important;
    }

    .pt-xxl-0 {
        padding-top: 0 !important;
    }

    .pt-xxl-1 {
        padding-top: 0.25rem !important;
    }

    .pt-xxl-2 {
        padding-top: 0.5rem !important;
    }

    .pt-xxl-3 {
        padding-top: 1rem !important;
    }

    .pt-xxl-4 {
        padding-top: 1.5rem !important;
    }

    .pt-xxl-5 {
        padding-top: 3rem !important;
    }

    .pe-xxl-0 {
        padding-right: 0 !important;
    }

    .pe-xxl-1 {
        padding-right: 0.25rem !important;
    }

    .pe-xxl-2 {
        padding-right: 0.5rem !important;
    }

    .pe-xxl-3 {
        padding-right: 1rem !important;
    }

    .pe-xxl-4 {
        padding-right: 1.5rem !important;
    }

    .pe-xxl-5 {
        padding-right: 3rem !important;
    }

    .pb-xxl-0 {
        padding-bottom: 0 !important;
    }

    .pb-xxl-1 {
        padding-bottom: 0.25rem !important;
    }

    .pb-xxl-2 {
        padding-bottom: 0.5rem !important;
    }

    .pb-xxl-3 {
        padding-bottom: 1rem !important;
    }

    .pb-xxl-4 {
        padding-bottom: 1.5rem !important;
    }

    .pb-xxl-5 {
        padding-bottom: 3rem !important;
    }

    .ps-xxl-0 {
        padding-left: 0 !important;
    }

    .ps-xxl-1 {
        padding-left: 0.25rem !important;
    }

    .ps-xxl-2 {
        padding-left: 0.5rem !important;
    }

    .ps-xxl-3 {
        padding-left: 1rem !important;
    }

    .ps-xxl-4 {
        padding-left: 1.5rem !important;
    }

    .ps-xxl-5 {
        padding-left: 3rem !important;
    }

    .text-xxl-start {
        text-align: left !important;
    }

    .text-xxl-end {
        text-align: right !important;
    }

    .text-xxl-center {
        text-align: center !important;
    }
}

@media (min-width: 1200px) {
    .fs-1 {
        font-size: 2.5rem !important;
    }

    .fs-2 {
        font-size: 2rem !important;
    }

    .fs-3 {
        font-size: 1.75rem !important;
    }

    .fs-4 {
        font-size: 1.5rem !important;
    }
}

@media print {
    .d-print-inline {
        display: inline !important;
    }

    .d-print-inline-block {
        display: inline-block !important;
    }

    .d-print-block {
        display: block !important;
    }

    .d-print-grid {
        display: grid !important;
    }

    .d-print-table {
        display: table !important;
    }

    .d-print-table-row {
        display: table-row !important;
    }

    .d-print-table-cell {
        display: table-cell !important;
    }

    .d-print-flex {
        display: flex !important;
    }

    .d-print-inline-flex {
        display: inline-flex !important;
    }

    .d-print-none {
        display: none !important;
    }
}

.ss-main .ss-single-selected {
    display: flex;
    cursor: pointer;
    width: 100%;
    height: 34px;
    padding: 6px;
    border: 1px solid #dcdee2;
    border-radius: 4px;
    background-color: #fff;
    outline: 0;
    box-sizing: border-box;
    transition: background-color .2s;
}


.login .ss-main .ss-single-selected {
    display: flex;
    cursor: pointer;
    width: 100%;
    height: 46px;
    padding: 6px;
    border: 1px solid #dcdee2;
    border-radius: 4px;
    background-color: #fff;
    outline: 0;
    box-sizing: border-box;
    transition: background-color .2s;
}

.parsley-error .ss-single-selected {
    background: #ffdedd !important;
    border-color: #ff5b57 !important;
}

.parsley-success .ss-single-selected {
    background: #cceeee !important;
    border-color: #00a7ba !important;
}

.select-input-field {
    display: flex;
    flex-direction: column-reverse;
}

.pnl_quicky.panel-default>.panel-body {
    height: fit-content;
    max-height: 490px;

    overflow-x: hidden;
    overflow-y: auto;
}

.content-center {
    max-width: 991px;
    /*margin: 0 auto;*/
}

@media screen and (max-width: 991px) {
    #process_fieldsTabContent .btn {
        width: 100%;
    }
}

/*.signatory-container {
    border: dashed 1px #49b6d6;
}*/

.loading-more {
    width: 100%;
    display: flex;
    flex-direction: row;
    flex-wrap: wrap;
    justify-content: center;
    align-items: center;
}

.loading-more-loader {
    border: 7px solid #ffffff;
    border-radius: 50%;
    border-top: 7px solid #3498db;
    width: 120px;
    height: 120px;
    -webkit-animation: spin 2s linear infinite;
    /* Safari */
    animation: spin 2s linear infinite;
}

/* Safari */
@-webkit-keyframes spin {
    0% {
        -webkit-transform: rotate(0deg);
    }

    100% {
        -webkit-transform: rotate(360deg);
    }
}

@keyframes spin {
    0% {
        transform: rotate(0deg);
    }

    100% {
        transform: rotate(360deg);
    }
}

@-webkit-keyframes ssc-loading {
    0% {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%)
    }

    to {
        -webkit-transform: translateX(100%);
        transform: translateX(100%)
    }
}

@keyframes ssc-loading {
    0% {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%)
    }

    to {
        -webkit-transform: translateX(100%);
        transform: translateX(100%)
    }
}

.ssc-circle,
.ssc-head-line,
.ssc-line,
.ssc-square {
    position: relative;
    overflow: hidden
}

.ssc-circle:after,
.ssc-head-line:after,
.ssc-line:after,
.ssc-square:after {
    content: "";
    -webkit-animation: ssc-loading 1.3s infinite;
    animation: ssc-loading 1.3s infinite;
    height: 100%;
    left: 0;
    position: absolute;
    right: 0;
    top: 0;
    -webkit-transform: translateX(-100%);
    transform: translateX(-100%);
    z-index: 1;
    background: -webkit-gradient(linear, left top, right top, from(transparent), color-stop(hsla(0, 0%, 100%, .3)), to(transparent));
    background: linear-gradient(90deg, transparent, hsla(0, 0%, 100%, .3), transparent)
}

.ssc {
    cursor: progress;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none
}

.ssc .mb {
    margin-bottom: 16px
}

.ssc .mt {
    margin-top: 16px
}

.ssc .mr {
    margin-right: 16px
}

.ssc .ml {
    margin-left: 16px
}

.ssc .mbs {
    margin-bottom: 8px
}

.ssc .mts {
    margin-top: 8px
}

.ssc .mrs {
    margin-right: 8px
}

.ssc .mls {
    margin-left: 8px
}

.ssc .w-10 {
    width: 10%
}

.ssc .w-20 {
    width: 20%
}

.ssc .w-30 {
    width: 30%
}

.ssc .w-40 {
    width: 40%
}

.ssc .w-50 {
    width: 50%
}

.ssc .w-60 {
    width: 60%
}

.ssc .w-70 {
    width: 70%
}

.ssc .w-80 {
    width: 80%
}

.ssc .w-90 {
    width: 90%
}

.ssc .w-100 {
    width: 100%
}

.ssc .flex {
    display: -webkit-box;
    display: flex
}

.ssc .inline-flex {
    display: -webkit-inline-box;
    display: inline-flex
}

.ssc .align-center {
    -webkit-box-align: center;
    align-items: center
}

.ssc .align-start {
    -webkit-box-align: start;
    align-items: flex-start
}

.ssc .align-end {
    -webkit-box-align: end;
    align-items: flex-end
}

.ssc .align-stretch {
    -webkit-box-align: stretch;
    align-items: stretch
}

.ssc .justify-start {
    -webkit-box-pack: start;
    justify-content: start
}

.ssc .justify-end {
    -webkit-box-pack: end;
    justify-content: end
}

.ssc .justify-between {
    -webkit-box-pack: justify;
    justify-content: space-between
}

.ssc .justify-center {
    -webkit-box-pack: center;
    justify-content: center
}

.ssc .justify-around {
    justify-content: space-around
}

.ssc-wrapper {
    padding: 16px
}

.ssc-card {
    display: block;
    width: 100%;
    height: 100%;
    border-radius: 5px;
    box-shadow: 0 2px 4px 1px rgba(0, 0, 0, .17);
    background-color: #fff
}

.ssc-circle {
    border-radius: 50%;
    width: 50px;
    height: 50px
}

.ssc-circle,
.ssc-hr {
    display: block;
    background-color: rgba(0, 0, 0, .17)
}

.ssc-hr {
    width: 100%;
    height: 2px
}

.ssc-line {
    display: block;
    background-color: rgba(0, 0, 0, .17);
    border-radius: 15px;
    margin-bottom: 8px;
    width: 100%;
    height: 12px
}

.ssc-line:last-child {
    margin-bottom: unset
}

.ssc-head-line {
    border-radius: 15px;
    height: 24px
}

.ssc-head-line,
.ssc-square {
    display: block;
    background-color: rgba(0, 0, 0, .17);
    width: 100%
}

.ssc-square {
    height: 150px
}

.w-10 {
    width: 10%;
}

.w-20 {
    width: 20%;
}

.w-30 {
    width: 30%;
}

.w-40 {
    width: 40%;
}

.w-50 {
    width: 50%;
}

.w-60 {
    width: 60%;
}

.w-70 {
    width: 70%;
}

.w-80 {
    width: 80%;
}

.w-90 {
    width: 90%;
}

.w-100 {
    width: 100%;
}

.userautocomplete.tt-hint {
    margin-left: 2px;
}

@-webkit-keyframes introjspulse {
    0% {
        -webkit-transform: scale(0);
        transform: scale(0);
        opacity: 0
    }

    25% {
        -webkit-transform: scale(0);
        transform: scale(0);
        opacity: .1
    }

    50% {
        -webkit-transform: scale(.1);
        transform: scale(.1);
        opacity: .3
    }

    75% {
        -webkit-transform: scale(.5);
        transform: scale(.5);
        opacity: .5
    }

    100% {
        -webkit-transform: scale(1);
        transform: scale(1);
        opacity: 0
    }
}

@keyframes introjspulse {
    0% {
        -webkit-transform: scale(0);
        transform: scale(0);
        opacity: 0
    }

    25% {
        -webkit-transform: scale(0);
        transform: scale(0);
        opacity: .1
    }

    50% {
        -webkit-transform: scale(.1);
        transform: scale(.1);
        opacity: .3
    }

    75% {
        -webkit-transform: scale(.5);
        transform: scale(.5);
        opacity: .5
    }

    100% {
        -webkit-transform: scale(1);
        transform: scale(1);
        opacity: 0
    }
}

.introjs-overlay {
    position: absolute;
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    z-index: 999999;
    opacity: 0;
    -webkit-transition: all .3s ease-out;
    -o-transition: all .3s ease-out;
    transition: all .3s ease-out
}

.introjs-showElement {
    z-index: 9999999 !important
}

tr.introjs-showElement>td {
    z-index: 9999999 !important;
    position: relative
}

tr.introjs-showElement>th {
    z-index: 9999999 !important;
    position: relative
}

.introjs-disableInteraction {
    z-index: 99999999 !important;
    position: absolute;
    background-color: #fff;
    opacity: 0
}

.introjs-relativePosition {
    position: relative
}

.introjs-helperLayer {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    position: absolute;
    z-index: 9999998;
    border-radius: 4px;
    -webkit-transition: all .3s ease-out;
    -o-transition: all .3s ease-out;
    transition: all .3s ease-out
}

.introjs-helperLayer * {
    -webkit-box-sizing: content-box;
    box-sizing: content-box
}

.introjs-helperLayer :before {
    -webkit-box-sizing: content-box;
    box-sizing: content-box
}

.introjs-helperLayer :after {
    -webkit-box-sizing: content-box;
    box-sizing: content-box
}

.introjs-tooltipReferenceLayer {
    font-family: "Helvetica Neue", Inter, ui-sans-serif, "Apple Color Emoji", Helvetica, Arial, sans-serif;
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    position: absolute;
    visibility: hidden;
    z-index: 100000000;
    background-color: transparent;
    -webkit-transition: all .3s ease-out;
    -o-transition: all .3s ease-out;
    transition: all .3s ease-out
}

.introjs-tooltipReferenceLayer * {
    font-family: "Helvetica Neue", Inter, ui-sans-serif, "Apple Color Emoji", Helvetica, Arial, sans-serif
}

.introjs-helperNumberLayer {
    font-family: "Helvetica Neue", Inter, ui-sans-serif, "Apple Color Emoji", Helvetica, Arial, sans-serif;
    color: #9e9e9e;
    text-align: center;
    padding-top: 10px;
    padding-bottom: 10px
}

.introjs-arrow {
    border: 5px solid transparent;
    content: "";
    position: absolute
}

.introjs-arrow.top {
    top: -10px;
    left: 10px;
    border-bottom-color: #fff
}

.introjs-arrow.top-right {
    top: -10px;
    right: 10px;
    border-bottom-color: #fff
}

.introjs-arrow.top-middle {
    top: -10px;
    left: 50%;
    margin-left: -5px;
    border-bottom-color: #fff
}

.introjs-arrow.right {
    right: -10px;
    top: 10px;
    border-left-color: #fff
}

.introjs-arrow.right-bottom {
    bottom: 10px;
    right: -10px;
    border-left-color: #fff
}

.introjs-arrow.bottom {
    bottom: -10px;
    left: 10px;
    border-top-color: #fff
}

.introjs-arrow.bottom-right {
    bottom: -10px;
    right: 10px;
    border-top-color: #fff
}

.introjs-arrow.bottom-middle {
    bottom: -10px;
    left: 50%;
    margin-left: -5px;
    border-top-color: #fff
}

.introjs-arrow.left {
    left: -10px;
    top: 10px;
    border-right-color: #fff
}

.introjs-arrow.left-bottom {
    left: -10px;
    bottom: 10px;
    border-right-color: #fff
}

.introjs-tooltip {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    position: absolute;
    visibility: visible;
    background-color: #fff;
    min-width: 250px;
    max-width: 300px;
    border-radius: 5px;
    -webkit-box-shadow: 0 3px 30px rgba(33, 33, 33, .3);
    box-shadow: 0 3px 30px rgba(33, 33, 33, .3);
    -webkit-transition: opacity .1s ease-out;
    -o-transition: opacity .1s ease-out;
    transition: opacity .1s ease-out
}

.introjs-tooltiptext {
    padding: 20px
}

.introjs-tooltip-title {
    font-size: 18px;
    margin: 0;
    padding: 0;
    font-weight: 700;
    float: left;
    line-height: 32px
}

.introjs-tooltip-header {
    padding-left: 20px;
    padding-right: 20px;
    padding-top: 10px
}

.introjs-tooltip-header:after {
    content: ".";
    visibility: hidden;
    display: block;
    height: 0;
    clear: both
}

.introjs-tooltipbuttons {
    border-top: 1px solid #e0e0e0;
    padding: 10px;
    text-align: right;
    white-space: nowrap
}

.introjs-tooltipbuttons:after {
    content: "";
    visibility: hidden;
    display: block;
    height: 0;
    clear: both
}

.introjs-button {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    position: relative;
    overflow: visible;
    display: inline-block;
    padding: .5rem 1rem;
    border: 1px solid #bdbdbd;
    text-decoration: none;
    text-shadow: 1px 1px 0 #fff;
    font-size: 14px;
    color: #424242;
    white-space: nowrap;
    cursor: pointer;
    outline: 0;
    background-color: #f4f4f4;
    border-radius: .2em;
    zoom: 1
}

.introjs-button:hover {
    outline: 0;
    text-decoration: none;
    border-color: #9e9e9e;
    background-color: #e0e0e0;
    color: #212121
}

.introjs-button:focus {
    outline: 0;
    text-decoration: none;
    background-color: #eee;
    -webkit-box-shadow: 0 0 0 .2rem rgba(158, 158, 158, .5);
    box-shadow: 0 0 0 .2rem rgba(158, 158, 158, .5);
    border: 1px solid #616161;
    color: #212121
}

.introjs-button:active {
    outline: 0;
    text-decoration: none;
    background-color: #e0e0e0;
    border-color: #9e9e9e;
    color: #212121
}

.introjs-button::-moz-focus-inner {
    padding: 0;
    border: 0
}

.introjs-skipbutton {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    color: #616161;
    float: right;
    font-size: 20px;
    cursor: pointer;
    font-weight: 700;
    line-height: 1;
    text-align: center;
    padding: 7px 10px
}

.introjs-skipbutton:focus,
.introjs-skipbutton:hover {
    color: #212121;
    outline: 0;
    text-decoration: none
}

.introjs-prevbutton {
    float: left
}

.introjs-nextbutton {
    float: right
}

.introjs-disabled {
    color: #9e9e9e;
    border-color: #bdbdbd;
    -webkit-box-shadow: none;
    box-shadow: none;
    cursor: default;
    background-color: #f4f4f4;
    background-image: none;
    text-decoration: none
}

.introjs-disabled:focus,
.introjs-disabled:hover {
    color: #9e9e9e;
    border-color: #bdbdbd;
    -webkit-box-shadow: none;
    box-shadow: none;
    cursor: default;
    background-color: #f4f4f4;
    background-image: none;
    text-decoration: none
}

.introjs-hidden {
    display: none
}

.introjs-bullets {
    text-align: center;
    padding-top: 10px;
    padding-bottom: 10px
}

.introjs-bullets ul {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    clear: both;
    margin: 0 auto 0;
    padding: 0;
    display: inline-block
}

.introjs-bullets ul li {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    list-style: none;
    float: left;
    margin: 0 2px
}

.introjs-bullets ul li a {
    -webkit-transition: width .1s ease-in;
    -o-transition: width .1s ease-in;
    transition: width .1s ease-in;
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    display: block;
    width: 6px;
    height: 6px;
    background: #ccc;
    border-radius: 10px;
    text-decoration: none;
    cursor: pointer
}

.introjs-bullets ul li a:focus,
.introjs-bullets ul li a:hover {
    width: 15px;
    background: #999;
    text-decoration: none;
    outline: 0
}

.introjs-bullets ul li a.active {
    width: 15px;
    background: #999
}

.introjs-progress {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    overflow: hidden;
    height: 10px;
    margin: 10px;
    border-radius: 4px;
    background-color: #e0e0e0
}

.introjs-progressbar {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    float: left;
    width: 0%;
    height: 100%;
    font-size: 10px;
    line-height: 10px;
    text-align: center;
    background-color: #08c
}

.introjsFloatingElement {
    position: absolute;
    height: 0;
    width: 0;
    left: 50%;
    top: 50%
}

.introjs-fixedTooltip {
    position: fixed
}

.introjs-hint {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    position: absolute;
    background: 0 0;
    width: 20px;
    height: 15px;
    cursor: pointer
}

.introjs-hint:focus {
    border: 0;
    outline: 0
}

.introjs-hint:hover>.introjs-hint-pulse {
    border: 5px solid rgba(60, 60, 60, .57)
}

.introjs-hidehint {
    display: none
}

.introjs-fixedhint {
    position: fixed
}

.introjs-hint-pulse {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    width: 10px;
    height: 10px;
    border: 5px solid rgba(60, 60, 60, .27);
    border-radius: 30px;
    background-color: rgba(136, 136, 136, .24);
    z-index: 10;
    position: absolute;
    -webkit-transition: all .2s ease-out;
    -o-transition: all .2s ease-out;
    transition: all .2s ease-out
}

.introjs-hint-no-anim .introjs-hint-dot {
    -webkit-animation: none;
    animation: none
}

.introjs-hint-dot {
    -webkit-box-sizing: content-box;
    box-sizing: content-box;
    border: 10px solid rgba(146, 146, 146, .36);
    background: 0 0;
    border-radius: 60px;
    height: 50px;
    width: 50px;
    -webkit-animation: introjspulse 3s ease-out;
    animation: introjspulse 3s ease-out;
    -webkit-animation-iteration-count: infinite;
    animation-iteration-count: infinite;
    position: absolute;
    top: -25px;
    left: -25px;
    z-index: 1;
    opacity: 0
}

.user_count_badge {
    margin-top: 10px;
    margin-left: -5px;
}

.mark_text_ai {
    background-color: yellow;
}

.mark_txtailow {
    background-color: #c6e5e6;
}

.box {
    -webkit-box-shadow: 0 2px 2px -2px #cccccc;
    -moz-box-shadow: 0 2px 2px -2px #cccccc;
    box-shadow: 0 2px 2px -2px #cccccc;
    background: #fbfbfb;
    border: 1px solid #cdcdcd;
    -webkit-border-radius: 3px;
    -moz-border-radius: 3px;
    -ms-border-radius: 3px;
    -o-border-radius: 3px;
    border-radius: 3px;
    margin-bottom: 20px;
}

/* --------------------------------*/
/* The switch - the box around the slider */
/* Google Fonts - Poppins */
@import url('https://fonts.googleapis.com/css2?family=Inter:wght@300;400;500;600&display=swap');

*{
    margin: 0;
    padding: 0;
    box-sizing: border-box;
    font-family: 'Inter', sans-serif;
}
body{
    background-color: #e3f2fd;
}
.container{
    position: relative;
    max-width: 320px;
    width: 100%;
    margin: 80px auto 30px;
}
.select-btn{

}
.select-btn .btn-text{

}
.select-btn .arrow-dwn{
    float: right;
    /* height: 10px; */
    /* width: 10px; */
    font-size: 10px;
    transition: 0.3s;
    margin-right: -8px;
    padding-right: 1;
}
.select-btn.open .arrow-dwn{
    transform: rotate(-180deg);
}
.list-items{
    list-style-type: none;
    position: relative;
    margin-top: 15px;
    border-radius: 8px;
    padding: 16px;
    background-color: #fff;
    box-shadow: 0 5px 10px rgba(0, 0, 0, 0.1);
    display: none;
}
.select-btn.open ~ .list-items{
    display: block;
    position: absolute;

}
.list-items .item{
    display: flex;
    align-items: center;
    list-style: none;
    height: 50px;
    cursor: pointer;
    transition: 0.3s;
    padding: 0 15px;
    border-radius: 8px;
}
.list-items .item:hover{
    background-color: #e7edfe;
}
.item .item-text{
    font-size: 14px;
    font-weight: 300;
    color: #333;
}
.item .checkbox{
    display: flex;
    align-items: center;
    justify-content: center;
    height: 16px;
    width: 16px;
    border-radius: 4px;
    margin-right: 12px;
    border: 1.5px solid #c0c0c0;
    transition: all 0.3s ease-in-out;
}

.item.checked .checkbox{
    background-color: #4070f4;
    border-color: #4070f4;
}
.checkbox .check-icon{
    color: #fff;
    font-size: 11px;
    transform: scale(0);
    transition: all 0.2s ease-in-out;
}
.item.checked .check-icon{
    transform: scale(1);
}


.switch {
    position: relative;
    display: inline-block;
    width: 60px;
    height: 34px;
}

/* Hide default HTML checkbox */
.switch input {
    opacity: 0;
    width: 0;
    height: 0;
}

/* The slider */
.slider {
    position: absolute;
    cursor: pointer;
    top: 0;
    left: 0;
    right: 0;
    bottom: 0;
    background-color: #ccc;
    -webkit-transition: .4s;
    transition: .4s;
}

.slider:before {
    position: absolute;
    content: "";
    height: 26px;
    width: 26px;
    left: 4px;
    bottom: 4px;
    background-color: white;
    -webkit-transition: .4s;
    transition: .4s;
}

input:checked + .slider {
    background-color: #2196F3;
}

input.on + .slider {
    background-color: #2196F3;
}

input:focus + .slider {
    box-shadow: 0 0 1px #2196F3;
}

input:checked + .slider:before {
    -webkit-transform: translateX(26px);
    -ms-transform: translateX(26px);
    transform: translateX(26px);
}

input.on + .slider:before {
    -webkit-transform: translateX(14px);
    -ms-transform: translateX(14px);
    transform: translateX(14px);
}

/* Rounded sliders */
.slider.round {
    border-radius: 34px;
}

.slider.round:before {
    border-radius: 50%;
}

.open>.dropdown-menu {
    display: block;
    left: auto;
}

.sidebar .open>.dropdown-menu {
    margin-left: 20px;
}

.f-s-24 {
    font-size: 24px !important
}

.group_title {
    margin-left: 20px;
    display: inline-flex;
    padding-left: 0 !important;
}

.group_title p {
    margin-left: 5px;
}

.group_title span {
    margin-top: 3px;
    color: #808080;
    font-variant: small-caps;
}

.task_panel {
    border-radius: 5px;
}

.task_list .task_list_item {
    overflow-y: auto;
    user-select: auto;
    padding: 15px !important;
    margin: 5px 15px 15px;
    border-radius: 3px;
    border-left: solid 1px #ccc;
    border-right: solid 1px #ccc;
    border-bottom: solid 3px #ccc;
}

.task_list .task_list_item.primary {
    border-top: solid 3px #2a70b3;
}

.task_list .task_list_item.warning {
    border-top: solid 3px #f59c1a;
}

.task_list .task_list_item.inverse {
    border-top: solid 3px #ccc;
;
}

.task_list .task_list_item.danger {
    border-top: solid 3px #ff5b57;
}

.task_list .task_list_item h4 {
    color: #707373;
    font-size: 20px;
}

.task_list .task_list_item h5 {
    color: #707373;
    font-size: 16px;
    margin-bottom: 3px;
}

.task_list .task_list_item .lead {
    color: #707373;
    font-size: 14px;
}

.bgSizeContain {
    background-size: contain;
    width: 200px;
    height: 40px;
    resize: none;
    background-repeat: no-repeat;
}

.bgSizeContain {
    margin-top: 5px;
}

@media (max-width: 480px) {
    .bgSizeContain {
        background-position: center;
        margin-top: 0px;
    }
}

@media (min-width: 768px) {
    .task_list .task_list_item .lead {
        font-size: 14px;
    }
}

.task_list .task_list_item h6 {
    color: #707373;
}

.task_list .btn-group.open .dropdown-toggle {
    -webkit-box-shadow: none;
    box-shadow: none;
}

/* document list */
.document-list--normal {
    width: 20%;
    /* breakpoints may fix that */
    height: 100%;
    overflow-x: hidden;
}

.document-list--mini {
    width: 65px;
    height: auto;
    overflow-x: hidden;
}

@media screen and (max-width: 991px) {
    .document-list--normal {
        width: 100%;
    }
}


.document-list-item {
    display: flex;
    justify-content: space-between;
    align-items: center;
    min-height: 50px;
    height: 50px;
    padding: 3px 15px;
    border: none;
    position: relative;
}

.document-list-item>.remove-btn {
    position: absolute;
    top: 0;
    right: 0;
    margin: 4px 4px 0 0;
}

.document-list-item>div[name="item-info"] {
    width: 94%;
    overflow-x: hidden;
}

.document-list-item>div[name="item-info"]>h6>div {
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}

.document-list-item>div[name="item-info"]>h6>div:hover {
    text-decoration: underline;
    cursor: pointer;
}

.document-list-item>div[name="item-info"]>p {
    margin-bottom: 3px;
}

.document-list-item>div[name="item-info"]>.progress {
    margin-bottom: 8px;
}

.document-list-item>div[name="item-actions"] {
    display: flex;
    justify-content: flex-end;
}

.document-list-item>div[name="item-actions"]>div {
    padding: 0 4px;
}

.document-list-item>div[name="item-actions"]>div:last-child {
    padding: 0px 0px 0px 4px;
}

/* document panel */
.panel-default>.panel-heading {
    display: flex;
    align-items: center;
    justify-content: space-between;

    border: none;
}

.panel-default>.panel-heading>.panel-heading-btn {
    display: flex;
    align-items: center;
    justify-content: center;
    width: fit-content;
}

.panel-default>.panel-heading>.panel-heading-btn>.btn-icon {
    width: 24px;
    height: 24px;
}

.panel-default>.panel-heading>.panel-heading-btn>a>i.fa,
label>i.fa {
    display: block;
    margin-top: 4px;
}

.panel-default>.panel-body {
    height: fit-content;
    overflow-x: hidden;
    overflow-y: auto;
}

.panel-default>.panel-body[name="doc-type"] {
    min-height: 0;
}

.panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section {
    display: flex;
    flex-direction: row;
    margin-bottom: 10px;
    padding: 0 10px;
}

.panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section:first-child {
    margin-top: 0;
}

.panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section>.form-field {
    width: 50%;
    margin-right: 10px;
}

.panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section>.form-field:last-child {
    margin-right: 0;
}

.panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section>.form-field-single {
    width: calc(50% - 5px);
}

.panel-body-content {
    display: flex;
    flex-direction: column;

    width: 100%;
    height: 100%;

    margin: 0;
    padding: 0 10px;
    border: none;
}

.panel-body-content[name="doc-list"] {
    padding: 0;
}

.panel-body-content>.form-extra-fields {
    border-bottom: 1px solid #00000022;
    margin-bottom: 15px;

    display: flex;
    flex-direction: column;
    padding-top: 10px;
}

@media screen and (max-width: 991px) {


    .panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section {
        flex-direction: column;
        margin-bottom: 0;
    }

    .panel-default>.panel-body[name="doc-type"]>.doc-type-form>.input-section>.form-field {
        width: 100%;
        margin-right: 10px;
        margin-bottom: 10px;
    }
}

.panel-back-btn {
    margin-right: 4px;
}

.dropdown-menu {
    padding: 4px;
    margin: 0;
    right: 0;
    text-overflow: ellipsis;
    white-space: nowrap;
}

.balloon {
    position: absolute;
    z-index: 6;
    display: none;
    width: 270px;
    padding: 10px;
    background-color: #f9f9f9;
    border-radius: 10px;
    margin-top: 60px;
    box-shadow: 0 2px 5px rgba(0, 0, 0, 0.3);
}
.balloon > ul {
    padding: 10px 20px 0;
}
@media (max-width: 991px) {
    .balloon {
        position: absolute;
        z-index: 6;
        display: none;
        width: 230px;
        padding: 10px;
        background-color: #f9f9f9;
        border-radius: 10px;
        margin-top: 235px;
        box-shadow: 0 2px 5px rgba(0, 0, 0, 0.3);
    }

    .iframe.adhoctramitar .balloon {
        margin-top: 230px !important;
        margin-left: 9vh !important;
    }
}

.balloon::before {
    content: '';
    position: absolute;
    bottom: 100%;
    left: 20%;
    transform: translateX(-50%);
    border-width: 10px;
    border-style: solid;
    border-color: transparent transparent #f9f9f9 transparent;
}

.dropdown-menu-acordeon {
    padding: 4px;
    margin: 0;
    right: 0;
    min-width: 100%;
    text-overflow: ellipsis;
    white-space: nowrap;
}

.dropdown-menu>.btn-group-vertical>div {
    margin: 4px;
}

.dropdown-menu>.btn-group-vertical>div:last-child {
    margin: 0px 4px 0 4px;
}

.dropdown-menu>.btn-group-vertical>button {
    width: 100%;
}

.fixed-toolbar {
    position: fixed;
    top: 0;
    z-index: 10;
    display: flex;
    justify-content: space-between;
    max-width: 1036px;
}

.fixed-toolbar > .page-header {
    margin: 0;
}

.fixed-toolbar > .sticky-text-hiden {
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    max-width: 20ch;
}

.fixed-toolbar .adhoc-dropdown-info {
    display: none;
}

sticky-progress {
    display: none !important;
}

.fixed-toolbar sticky-progress {
    display: block;
}



.toolbar-docdet {
    top: 2px;
}

.form-horizontal {
    display: flex;
    flex-direction: column;
}

.info-container {
    width: 100%;
    padding: 0 4px 10px 4px;
    margin-bottom: 20px;

    display: flex;
    justify-content: flex-end;
    align-items: center;
}

.info-container>.pull-right {
    text-align: end;
}

/* info balloon */
.info-balloon-container {
    width: 300px;
    height: fit-content;
    max-width: 400px;
    max-height: 400px;
    padding: 14px;
    overflow: hidden;

    position: absolute;
    top: 25px;
    right: 0;
    z-index: 1033;

    background: rgba(255, 255, 255, 0.624);
    box-shadow: 0 4px 4px 0 rgba(0, 0, 0, 0.25);
    border-radius: 6px;
    backdrop-filter: blur(4px);
}

.info-balloon-container>.info-balloon-content {
    color: #424242;
    overflow: hidden;
    text-align: start;
    text-overflow: ellipsis;
    word-wrap: break-word;
    font-size: 1.05em;
    user-select: none;
}

@media screen and (max-width: 375px) {
    .info-balloon-container {
        width: 235px;
    }
}


/* misc */
.btn-text-danger {
    background: none;
    border: 1px solid #ff5a57b5;
    color: #ff5b57;
    transition: all 0.2s ease-in-out;
}

.btn-text-danger:hover {
    background: rgba(255, 90, 87, 0.2);
    border: 1px solid #ff6d6ab5;
    color: #ff6d6a;
}

.item-text-danger {
    background: none;
    color: #ff5b57;
    transition: all 0.2s ease-in-out;
}

.item-text-danger:hover {
    background: rgba(255, 148, 146, 0.2);
    color: #ff6d6a;
}

.btn-text-warning {
    background: none;
    border: 1px solid #f09c1db5;
    color: #f09c1d;
    transition: all 0.2s ease-in-out;
}

.btn-text-warning:hover {
    background: rgba(245, 157, 26, 0.2);
    border: 1px solid #faae3bb5;
    color: #faae3b;
}

.item-text-warning {
    background: none;
    color: #f09c1d;
    transition: all 0.2s ease-in-out;
}

.item-text-warning:hover {
    background: rgba(245, 157, 26, 0.2);
    color: #faae3b;
}

.btn-text-primary {
    background: none;
    border: 1px solid #348fe2b5;
    color: #348fe2;
    transition: all 0.2s ease-in-out;
}

.btn-text-primary:hover {
    background: rgba(51, 181, 229, 0.2);
    border: 1px solid #4e98deb5;
    color: #4e98de;
}

.btn-block {
    width: 100%;
}

.item-text-primary {
    background: none;
    color: #348fe2;
    transition: all 0.2s ease-in-out;
}

.item-text-primary:hover {
    background: rgba(151, 205, 255, 0.2);
    color: #4e98de;
}

.btn-text-inverse {
    background: none;
    border: 1px solid #2d353cb5;
    color: #2d353c;
    transition: all 0.2s ease-in-out;
}

.btn-text-inverse:hover {
    background: rgba(45, 53, 60, 0.1);
    border: 1px solid #37414ab5;
    color: #37414a;
}

.btn-text-inverse-dark {
    background: none;
    border: 1px solid #FFFFFFb5;
    color: #FFFFFFb5;
    transition: all 0.2s ease-in-out;
}

.btn-text-inverse-dark:hover {
    background: rgba(255, 255, 255, 0.1);
    border: 1px solid #FFFFFFFF;
    color: #FFFFFFFF;
}

.item-text-inverse {
    background: none;
    color: #2d353c;
}

.item-text-inverse:hover {
    background: rgba(199, 199, 199, 0.4);
    color: #363c41;
}

.item-text-warning {
    background: none;
    color: #f59c1a;
}

.item-text-warning:hover {
    background: #f59d1a66;
    color: #feab2e;
}

.flex-row {
    display: flex;
}

.flex-column {
    display: flex;
    flex-direction: column;
}

.justify-start {
    justify-content: flex-start;
}

.justify-between {
    justify-content: space-between;
}

.justify-end {
    justify-content: flex-end;
}

.items-center {
    align-items: center;
}

.text-start {
    text-align: start;
}

.text-center {
    text-align: center;

}

.text-end {
    text-align: end;
}

.col-12 {
    width: 100%;
}

.ml-10 {
    margin-left: 10px;
}

.ml-20 {
    margin-left: 20px;
}

.mr-10 {
    margin-right: 10px;
}

.mr-20 {
    margin-right: 20px;
}

.v-separator {
    width: 1px;
    height: auto;
    border-right: 1px solid #00000022;
}

.h-separator {
    width: 100%;
    height: 1px;
    border-top: 1px solid #00000022;
}

.slimScrollDiv {
    z-index: 0;
}


/* Variables */
/* Animation */
@-webkit-keyframes ssc-loading {
    from {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%);
    }

    to {
        -webkit-transform: translateX(100%);
        transform: translateX(100%);
    }
}

@keyframes ssc-loading {
    from {
        -webkit-transform: translateX(-100%);
        transform: translateX(-100%);
    }

    to {
        -webkit-transform: translateX(100%);
        transform: translateX(100%);
    }
}

/* Animation partial */
.ssc-square,
.ssc-head-line,
.ssc-line,
.ssc-circle {
    position: relative;
    overflow: hidden;
}

.ssc-square:after,
.ssc-head-line:after,
.ssc-line:after,
.ssc-circle:after {
    content: "";
    -webkit-animation: ssc-loading 1.3s infinite;
    animation: ssc-loading 1.3s infinite;
    height: 100%;
    left: 0;
    position: absolute;
    right: 0;
    top: 0;
    -webkit-transform: translateX(-100%);
    transform: translateX(-100%);
    z-index: 1;
    background: -webkit-gradient(linear, left top, right top, from(transparent), color-stop(rgba(255, 255, 255, 0.3)), to(transparent));
    background: linear-gradient(90deg, transparent, rgba(255, 255, 255, 0.3), transparent);
}

/** Main class */
.ssc {
    cursor: progress;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
}

/** Helpers classes */
.ssc .mb {
    margin-bottom: 16px;
}

.ssc .mt {
    margin-top: 16px;
}

.ssc .mr {
    margin-right: 16px;
}

.ssc .ml {
    margin-left: 16px;
}

.ssc .mbs {
    margin-bottom: 8px;
}

.ssc .mts {
    margin-top: 8px;
}

.ssc .mrs {
    margin-right: 8px;
}

.ssc .mls {
    margin-left: 8px;
}

.ssc .w-10 {
    width: 10%;
}

.ssc .w-20 {
    width: 20%;
}

.ssc .w-30 {
    width: 30%;
}

.ssc .w-40 {
    width: 40%;
}

.ssc .w-50 {
    width: 50%;
}

.ssc .w-60 {
    width: 60%;
}

.ssc .w-70 {
    width: 70%;
}

.ssc .w-80 {
    width: 80%;
}

.ssc .w-90 {
    width: 90%;
}

.ssc .w-100 {
    width: 100%;
}

.ssc .flex {
    display: -webkit-box;
    display: flex;
}

.ssc .inline-flex {
    display: -webkit-inline-box;
    display: inline-flex;
}

.ssc .align-center {
    -webkit-box-align: center;
    align-items: center;
}

.ssc .align-start {
    -webkit-box-align: start;
    align-items: flex-start;
}

.ssc .align-end {
    -webkit-box-align: end;
    align-items: flex-end;
}

.ssc .align-stretch {
    -webkit-box-align: stretch;
    align-items: stretch;
}

.ssc .justify-start {
    -webkit-box-pack: start;
    justify-content: start;
}

.ssc .justify-end {
    -webkit-box-pack: end;
    justify-content: end;
}

.ssc .justify-between {
    -webkit-box-pack: justify;
    justify-content: space-between;
}

.ssc .justify-center {
    -webkit-box-pack: center;
    justify-content: center;
}

.ssc .justify-around {
    justify-content: space-around;
}

/** Wrapper class */
.ssc-wrapper {
    padding: 16px;
}

/* Figures, Objects */
.ssc-card {
    display: block;
    width: 100%;
    height: 100%;
    border-radius: 5px;
    box-shadow: 0 2px 4px 1px rgba(0, 0, 0, 0.17);
    background-color: #ffffff;
}

.ssc-circle {
    display: block;
    background-color: rgba(0, 0, 0, 0.17);
    border-radius: 50%;
    width: 50px;
    height: 50px;
}

.ssc-hr {
    display: block;
    width: 100%;
    background-color: rgba(0, 0, 0, 0.17);
    height: 2px;
}

.ssc-line {
    display: block;
    background-color: rgba(0, 0, 0, 0.17);
    border-radius: 15px;
    margin-bottom: 8px;
    width: 100%;
    height: 12px;
}

.ssc-line:last-child {
    margin-bottom: unset;
}

.ssc-head-line {
    display: block;
    background-color: rgba(0, 0, 0, 0.17);
    border-radius: 15px;
    width: 100%;
    height: 24px;
}

.ssc-square {
    display: block;
    background-color: rgba(0, 0, 0, 0.17);
    width: 100%;
    height: 150px;
}

span.twitter-typeahead .tt-menu,
span.twitter-typeahead .tt-dropdown-menu {
    cursor: pointer;
    position: absolute;
    top: 100%;
    left: 0;
    z-index: 9;
    display: none;
    float: left;
    min-width: 160px;
    padding: 5px 0;
    margin: 2px 0 0;
    list-style: none;
    font-size: 14px;
    text-align: left;
    background-color: #ffffff;
    border: 1px solid #cccccc;
    border: 1px solid rgba(0, 0, 0, 0.15);
    border-radius: 4px;
    -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
    box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
    background-clip: padding-box;
}

span.twitter-typeahead .tt-suggestion {
    display: block;
    padding: 3px 20px;
    clear: both;
    font-weight: normal;
    line-height: 1.42857143;
    color: #333333;
    white-space: nowrap;
}

span.twitter-typeahead .tt-suggestion.tt-cursor,
span.twitter-typeahead .tt-suggestion:hover,
span.twitter-typeahead .tt-suggestion:focus {
    color: #ffffff;
    text-decoration: none;
    outline: 0;
    background-color: #337ab7;
}

.input-group.input-group-lg span.twitter-typeahead .form-control {
    height: 46px;
    padding: 10px 16px;
    font-size: 18px;
    line-height: 1.3333333;
    border-radius: 6px;
}

.input-group.input-group-sm span.twitter-typeahead .form-control {
    height: 30px;
    padding: 5px 10px;
    font-size: 12px;
    line-height: 1.5;
    border-radius: 3px;
}

span.twitter-typeahead {
    width: 100%;
}

.input-group span.twitter-typeahead {
    display: block !important;
    height: 34px;
}

.input-group span.twitter-typeahead .tt-menu,
.input-group span.twitter-typeahead .tt-dropdown-menu {
    top: 32px !important;
}

.input-group span.twitter-typeahead:not(:first-child):not(:last-child) .form-control {
    border-radius: 0;
}

.input-group span.twitter-typeahead:first-child .form-control {
    border-top-left-radius: 4px;
    border-bottom-left-radius: 4px;
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
}

.input-group span.twitter-typeahead:last-child .form-control {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
    border-top-right-radius: 4px;
    border-bottom-right-radius: 4px;
}

.input-group.input-group-sm span.twitter-typeahead {
    height: 30px;
}

.input-group.input-group-sm span.twitter-typeahead .tt-menu,
.input-group.input-group-sm span.twitter-typeahead .tt-dropdown-menu {
    top: 30px !important;
}

.input-group.input-group-lg span.twitter-typeahead {
    height: 46px;
}

.input-group.input-group-lg span.twitter-typeahead .tt-menu,
.input-group.input-group-lg span.twitter-typeahead .tt-dropdown-menu {
    top: 46px !important;
}

/* required styles */

.leaflet-pane,
.leaflet-tile,
.leaflet-marker-icon,
.leaflet-marker-shadow,
.leaflet-tile-container,
.leaflet-pane>svg,
.leaflet-pane>canvas,
.leaflet-zoom-box,
.leaflet-image-layer,
.leaflet-layer {
    position: absolute;
    left: 0;
    top: 0;
}

.leaflet-container {
    overflow: hidden;
}

.leaflet-tile,
.leaflet-marker-icon,
.leaflet-marker-shadow {
    -webkit-user-select: none;
    -moz-user-select: none;
    user-select: none;
    -webkit-user-drag: none;
}

/* Prevents IE11 from highlighting tiles in blue */
.leaflet-tile::selection {
    background: transparent;
}

/* Safari renders non-retina tile on retina better with this, but Chrome is worse */
.leaflet-safari .leaflet-tile {
    image-rendering: -webkit-optimize-contrast;
}

/* hack that prevents hw layers "stretching" when loading new tiles */
.leaflet-safari .leaflet-tile-container {
    width: 1600px;
    height: 1600px;
    -webkit-transform-origin: 0 0;
}

.leaflet-marker-icon,
.leaflet-marker-shadow {
    display: block;
}

/* .leaflet-container svg: reset svg max-width decleration shipped in Joomla! (joomla.org) 3.x */
/* .leaflet-container img: map is broken in FF if you have max-width: 100% on tiles */
.leaflet-container .leaflet-overlay-pane svg,
.leaflet-container .leaflet-marker-pane img,
.leaflet-container .leaflet-shadow-pane img,
.leaflet-container .leaflet-tile-pane img,
.leaflet-container img.leaflet-image-layer,
.leaflet-container .leaflet-tile {
    max-width: none !important;
    max-height: none !important;
}

.leaflet-container.leaflet-touch-zoom {
    -ms-touch-action: pan-x pan-y;
    touch-action: pan-x pan-y;
}

.leaflet-container.leaflet-touch-drag {
    -ms-touch-action: pinch-zoom;
    /* Fallback for FF which doesn't support pinch-zoom */
    touch-action: none;
    touch-action: pinch-zoom;
}

.leaflet-container.leaflet-touch-drag.leaflet-touch-zoom {
    -ms-touch-action: none;
    touch-action: none;
}

.leaflet-container {
    -webkit-tap-highlight-color: transparent;
}

.leaflet-container a {
    -webkit-tap-highlight-color: rgba(51, 181, 229, 0.4);
}

.leaflet-tile {
    filter: inherit;
    visibility: hidden;
}

.leaflet-tile-loaded {
    visibility: inherit;
}

.leaflet-zoom-box {
    width: 0;
    height: 0;
    -moz-box-sizing: border-box;
    box-sizing: border-box;
    z-index: 8;
}

/* workaround for https://bugzilla.mozilla.org/show_bug.cgi?id=888319 */
.leaflet-overlay-pane svg {
    -moz-user-select: none;
}

.leaflet-pane {
    z-index: 4;
}

.leaflet-tile-pane {
    z-index: 2;
}

.leaflet-overlay-pane {
    z-index: 4;
}

.leaflet-shadow-pane {
    z-index: 5;
}

.leaflet-marker-pane {
    z-index: 6;
}

.leaflet-tooltip-pane {
    z-index: 7;
}

.leaflet-popup-pane {
    z-index: 8;
}

.leaflet-map-pane canvas {
    z-index: 1;
}

.leaflet-map-pane svg {
    z-index: 2;
}

.leaflet-vml-shape {
    width: 1px;
    height: 1px;
}

.lvml {
    behavior: url(#default#VML);
    display: inline-block;
    position: absolute;
}


/* control positioning */

.leaflet-control {
    position: relative;
    z-index: 8;
    pointer-events: visiblePainted;
    /* IE 9-10 doesn't have auto */
    pointer-events: auto;
}

.leaflet-top,
.leaflet-bottom {
    position: absolute;
    z-index: 10;
    pointer-events: none;
}

.leaflet-top {
    top: 0;
}

.leaflet-right {
    right: 0;
}

.leaflet-bottom {
    bottom: 0;
}

.leaflet-left {
    left: 0;
}

.leaflet-control {
    float: left;
    clear: both;
}

.leaflet-right .leaflet-control {
    float: right;
}

.leaflet-top .leaflet-control {
    margin-top: 10px;
}

.leaflet-bottom .leaflet-control {
    margin-bottom: 10px;
}

.leaflet-left .leaflet-control {
    margin-left: 10px;
}

.leaflet-right .leaflet-control {
    margin-right: 10px;
}


/* zoom and fade animations */

.leaflet-fade-anim .leaflet-tile {
    will-change: opacity;
}

.leaflet-fade-anim .leaflet-popup {
    opacity: 0;
    -webkit-transition: opacity 0.2s linear;
    -moz-transition: opacity 0.2s linear;
    transition: opacity 0.2s linear;
}

.leaflet-fade-anim .leaflet-map-pane .leaflet-popup {
    opacity: 1;
}

.leaflet-zoom-animated {
    -webkit-transform-origin: 0 0;
    -ms-transform-origin: 0 0;
    transform-origin: 0 0;
}

.leaflet-zoom-anim .leaflet-zoom-animated {
    will-change: transform;
}

.leaflet-zoom-anim .leaflet-zoom-animated {
    -webkit-transition: -webkit-transform 0.25s cubic-bezier(0, 0, 0.25, 1);
    -moz-transition: -moz-transform 0.25s cubic-bezier(0, 0, 0.25, 1);
    transition: transform 0.25s cubic-bezier(0, 0, 0.25, 1);
}

.leaflet-zoom-anim .leaflet-tile,
.leaflet-pan-anim .leaflet-tile {
    -webkit-transition: none;
    -moz-transition: none;
    transition: none;
}

.leaflet-zoom-anim .leaflet-zoom-hide {
    visibility: hidden;
}


/* cursors */

.leaflet-interactive {
    cursor: pointer;
}

.leaflet-grab {
    cursor: -webkit-grab;
    cursor: -moz-grab;
    cursor: grab;
}

.leaflet-crosshair,
.leaflet-crosshair .leaflet-interactive {
    cursor: crosshair;
}

.leaflet-popup-pane,
.leaflet-control {
    cursor: auto;
}

.leaflet-dragging .leaflet-grab,
.leaflet-dragging .leaflet-grab .leaflet-interactive,
.leaflet-dragging .leaflet-marker-draggable {
    cursor: move;
    cursor: -webkit-grabbing;
    cursor: -moz-grabbing;
    cursor: grabbing;
}

/* marker & overlays interactivity */
.leaflet-marker-icon,
.leaflet-marker-shadow,
.leaflet-image-layer,
.leaflet-pane>svg path,
.leaflet-tile-container {
    pointer-events: none;
}

.leaflet-marker-icon.leaflet-interactive,
.leaflet-image-layer.leaflet-interactive,
.leaflet-pane>svg path.leaflet-interactive,
svg.leaflet-image-layer.leaflet-interactive path {
    pointer-events: visiblePainted;
    /* IE 9-10 doesn't have auto */
    pointer-events: auto;
}

/* visual tweaks */

.leaflet-container {
    background: #ddd;
    outline: 0;
}

.leaflet-container a {
    color: #0078A8;
}

.leaflet-container a.leaflet-active {
    outline: 2px solid orange;
}

.leaflet-zoom-box {
    border: 2px dotted #38f;
    background: rgba(255, 255, 255, 0.5);
}


/* general typography */
.leaflet-container {
    font: 12px/1.5 "Helvetica Neue", Arial, Helvetica, sans-serif;
}


/* general toolbar styles */

.leaflet-bar {
    box-shadow: 0 1px 5px rgba(0, 0, 0, 0.65);
    border-radius: 4px;
}

.leaflet-bar a,
.leaflet-bar a:hover {
    background-color: #fff;
    border-bottom: 1px solid #ccc;
    width: 26px;
    height: 26px;
    line-height: 26px;
    display: block;
    text-align: center;
    text-decoration: none;
    color: black;
}

.leaflet-bar a,
.leaflet-control-layers-toggle {
    background-position: 50% 50%;
    background-repeat: no-repeat;
    display: block;
}

.leaflet-bar a:hover {
    background-color: #f4f4f4;
}

.leaflet-bar a:first-child {
    border-top-left-radius: 4px;
    border-top-right-radius: 4px;
}

.leaflet-bar a:last-child {
    border-bottom-left-radius: 4px;
    border-bottom-right-radius: 4px;
    border-bottom: none;
}

.leaflet-bar a.leaflet-disabled {
    cursor: default;
    background-color: #f4f4f4;
    color: #bbb;
}

.leaflet-touch .leaflet-bar a {
    width: 30px;
    height: 30px;
    line-height: 30px;
}

.leaflet-touch .leaflet-bar a:first-child {
    border-top-left-radius: 2px;
    border-top-right-radius: 2px;
}

.leaflet-touch .leaflet-bar a:last-child {
    border-bottom-left-radius: 2px;
    border-bottom-right-radius: 2px;
}

/* zoom control */

.leaflet-control-zoom-in,
.leaflet-control-zoom-out {
    font: bold 18px 'Lucida Console', Monaco, monospace;
    text-indent: 1px;
}

.leaflet-touch .leaflet-control-zoom-in,
.leaflet-touch .leaflet-control-zoom-out {
    font-size: 22px;
}


/* layers control */

.leaflet-control-layers {
    box-shadow: 0 1px 5px rgba(0, 0, 0, 0.4);
    background: #fff;
    border-radius: 5px;
}

.leaflet-control-layers-toggle {
    background-image: url(images/layers.png);
    width: 36px;
    height: 36px;
}

.leaflet-retina .leaflet-control-layers-toggle {
    background-image: url(images/layers-2x.png);
    background-size: 26px 26px;
}

.leaflet-touch .leaflet-control-layers-toggle {
    width: 44px;
    height: 44px;
}

.leaflet-control-layers .leaflet-control-layers-list,
.leaflet-control-layers-expanded .leaflet-control-layers-toggle {
    display: none;
}

.leaflet-control-layers-expanded .leaflet-control-layers-list {
    display: block;
    position: relative;
}

.leaflet-control-layers-expanded {
    padding: 6px 10px 6px 6px;
    color: #333;
    background: #fff;
}

.leaflet-control-layers-scrollbar {
    overflow-y: scroll;
    overflow-x: hidden;
    padding-right: 5px;
}

.leaflet-control-layers-selector {
    margin-top: 2px;
    position: relative;
    top: 1px;
}

.leaflet-control-layers label {
    display: block;
}

.leaflet-control-layers-separator {
    height: 0;
    border-top: 1px solid #ddd;
    margin: 5px -10px 5px -6px;
}

/* Default icon URLs */
.leaflet-default-icon-path {
    background-image: url(images/marker-icon.png);
}


/* attribution and scale controls */

.leaflet-container .leaflet-control-attribution {
    background: #fff;
    background: rgba(255, 255, 255, 0.7);
    margin: 0;
}

.leaflet-control-attribution,
.leaflet-control-scale-line {
    padding: 0 5px;
    color: #333;
}

.leaflet-control-attribution a {
    text-decoration: none;
}

.leaflet-control-attribution a:hover {
    text-decoration: underline;
}

.leaflet-container .leaflet-control-attribution,
.leaflet-container .leaflet-control-scale {
    font-size: 11px;
}

.leaflet-left .leaflet-control-scale {
    margin-left: 5px;
}

.leaflet-bottom .leaflet-control-scale {
    margin-bottom: 5px;
}

.leaflet-control-scale-line {
    border: 2px solid #777;
    border-top: none;
    line-height: 1.1;
    padding: 2px 5px 1px;
    font-size: 11px;
    white-space: nowrap;
    overflow: hidden;
    -moz-box-sizing: border-box;
    box-sizing: border-box;

    background: #fff;
    background: rgba(255, 255, 255, 0.5);
}

.leaflet-control-scale-line:not(:first-child) {
    border-top: 2px solid #777;
    border-bottom: none;
    margin-top: -2px;
}

.leaflet-control-scale-line:not(:first-child):not(:last-child) {
    border-bottom: 2px solid #777;
}

.leaflet-touch .leaflet-control-attribution,
.leaflet-touch .leaflet-control-layers,
.leaflet-touch .leaflet-bar {
    box-shadow: none;
}

.leaflet-touch .leaflet-control-layers,
.leaflet-touch .leaflet-bar {
    border: 2px solid rgba(0, 0, 0, 0.2);
    background-clip: padding-box;
}


/* popup */

.leaflet-popup {
    position: absolute;
    text-align: center;
    margin-bottom: 20px;
}

.leaflet-popup-content-wrapper {
    padding: 1px;
    text-align: left;
    border-radius: 12px;
}

.leaflet-popup-content {
    margin: 13px 19px;
    line-height: 1.4;
}

.leaflet-popup-content p {
    margin: 18px 0;
}

.leaflet-popup-tip-container {
    width: 40px;
    height: 20px;
    position: absolute;
    left: 50%;
    margin-left: -20px;
    overflow: hidden;
    pointer-events: none;
}

.leaflet-popup-tip {
    width: 17px;
    height: 17px;
    padding: 1px;

    margin: -10px auto 0;

    -webkit-transform: rotate(45deg);
    -moz-transform: rotate(45deg);
    -ms-transform: rotate(45deg);
    transform: rotate(45deg);
}

.leaflet-popup-content-wrapper,
.leaflet-popup-tip {
    background: white;
    color: #333;
    box-shadow: 0 3px 14px rgba(0, 0, 0, 0.4);
}

.leaflet-container a.leaflet-popup-close-button {
    position: absolute;
    top: 0;
    right: 0;
    padding: 4px 4px 0 0;
    border: none;
    text-align: center;
    width: 18px;
    height: 14px;
    font: 16px/14px Tahoma, Verdana, sans-serif;
    color: #c3c3c3;
    text-decoration: none;
    font-weight: bold;
    background: transparent;
}

.leaflet-container a.leaflet-popup-close-button:hover {
    color: #999;
}

.leaflet-popup-scrolled {
    overflow: auto;
    border-bottom: 1px solid #ddd;
    border-top: 1px solid #ddd;
}

.leaflet-oldie .leaflet-popup-content-wrapper {
    -ms-zoom: 1;
}

.leaflet-oldie .leaflet-popup-tip {
    width: 24px;
    margin: 0 auto;

    -ms-filter: "progid:DXImageTransform.Microsoft.Matrix(M11=0.70710678, M12=0.70710678, M21=-0.70710678, M22=0.70710678)";
    filter: progid:DXImageTransform.Microsoft.Matrix(M11=0.70710678, M12=0.70710678, M21=-0.70710678, M22=0.70710678);
}

.leaflet-oldie .leaflet-popup-tip-container {
    margin-top: -1px;
}

.leaflet-oldie .leaflet-control-zoom,
.leaflet-oldie .leaflet-control-layers,
.leaflet-oldie .leaflet-popup-content-wrapper,
.leaflet-oldie .leaflet-popup-tip {
    border: 1px solid #999;
}


/* div icon */

.leaflet-div-icon {
    background: #fff;
    border: 1px solid #666;
}


/* Tooltip */
/* Base styles for the element that has a tooltip */
.leaflet-tooltip {
    position: absolute;
    padding: 6px;
    background-color: #fff;
    border: 1px solid #fff;
    border-radius: 3px;
    color: #222;
    white-space: nowrap;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none;
    pointer-events: none;
    box-shadow: 0 1px 3px rgba(0, 0, 0, 0.4);
}

.leaflet-tooltip.leaflet-clickable {
    cursor: pointer;
    pointer-events: auto;
}

.leaflet-tooltip-top:before,
.leaflet-tooltip-bottom:before,
.leaflet-tooltip-left:before,
.leaflet-tooltip-right:before {
    position: absolute;
    pointer-events: none;
    border: 6px solid transparent;
    background: transparent;
    content: "";
}

/* Directions */

.leaflet-tooltip-bottom {
    margin-top: 6px;
}

.leaflet-tooltip-top {
    margin-top: -6px;
}

.leaflet-tooltip-bottom:before,
.leaflet-tooltip-top:before {
    left: 50%;
    margin-left: -6px;
}

.leaflet-tooltip-top:before {
    bottom: 0;
    margin-bottom: -12px;
    border-top-color: #fff;
}

.leaflet-tooltip-bottom:before {
    top: 0;
    margin-top: -12px;
    margin-left: -6px;
    border-bottom-color: #fff;
}

.leaflet-tooltip-left {
    margin-left: -6px;
}

.leaflet-tooltip-right {
    margin-left: 6px;
}

.leaflet-tooltip-left:before,
.leaflet-tooltip-right:before {
    top: 50%;
    margin-top: -6px;
}

.leaflet-tooltip-left:before {
    right: 0;
    margin-right: -12px;
    border-left-color: #fff;
}

.leaflet-tooltip-right:before {
    left: 0;
    margin-left: -12px;
    border-right-color: #fff;
}

.geocoder-control-input {
    position: absolute;
    left: 0;
    top: 0;
    background-color: white;
    background-repeat: no-repeat;
    background-image: url("img/search.png");
    background-size: 26px;
    border: none;
    padding: 0;
    text-indent: 6px;
    font-size: 13px;
    line-height: normal;
    height: auto;
    padding-top: 5px;
    padding-bottom: 5px;
    width: 100%;
    background-position: right center;
    cursor: pointer;
    box-sizing: border-box
}

.geocoder-control-input-disabled {
    background-color: #f4f4f4;
    background-image: url("img/search-disabled.png")
}

.geocoder-control {
    width: 26px;
    height: 26px;
    -webkit-transition: width .175s ease-in;
    -moz-transition: width .175s ease-in;
    -ms-transition: width .175s ease-in;
    -o-transition: width .175s ease-in;
    transition: width .175s ease-in
}

.geocoder-control-expanded,
.leaflet-touch .geocoder-control-expanded {
    width: 275px
}

.geocoder-control-input.geocoder-control-loading {
    background-image: url("img/loading.gif");
    background-size: 26px
}

.buttonStyle:focus{
    background-color: #2196F3;
    color:white;
}
.buttonStyle:active{
    background-color: #2196F3;
    color:white;
}
.checkButton:checked ~ .box {
    display: inline-block;
    font-weight: normal;
    text-align: center;
    white-space: nowrap;
    background-color: #0056B4;
    color:white;
    text-align: justify;

}



.checkButtonGreen:checked ~ .box {
    display: inline-block;
    font-weight: normal;
    text-align: center;
    white-space: nowrap;
    background-color:#03845D;
    color:white;
    text-align: justify;
}

.checkButtonRed:checked ~ .box {
    display: inline-block;
    font-weight: normal;
    text-align: center;
    white-space: nowrap;
    background-color: #C33232;
    /*border-color: #dc3545 !important;*/
    color:white;
    text-align: justify;
}

.checkButtonYellow:checked ~ .box {
    display: inline-block;
    font-weight: normal;
    text-align: center;
    white-space: nowrap;
    background-color: #CE903A;
    color:white;
    text-align: justify;
}



@media only screen and (min--moz-device-pixel-ratio: 2),
only screen and (-o-min-device-pixel-ratio: 2 / 1),
only screen and (-webkit-min-device-pixel-ratio: 2),
only screen and (min-device-pixel-ratio: 2) {
    .geocoder-control-input {
        background-image: url("img/search@2x.png")
    }

    .geocoder-control-input-disabled {
        background-image: url("img/search@2x-disabled.png")
    }

    .geocoder-control-input.geocoder-control-loading {
        background-image: url("img/loading@2x.gif")
    }
}

.geocoder-control-input:focus {
    outline: none;
    cursor: text
}

.geocoder-control-input::-ms-clear {
    display: none
}

.geocoder-control-suggestions {
    width: 100%;
    position: absolute;
    top: 26px;
    left: 0;
    margin-top: 10px;
    overflow: auto;
    display: none
}

.geocoder-control-list+.geocoder-control-header {
    border-top: 1px solid #d5d5d5
}

.geocoder-control-header {
    font-size: 10px;
    font-weight: 700;
    text-transform: uppercase;
    letter-spacing: 0.05em;
    color: #444;
    background: #F2F2F2;
    border-bottom: 1px solid #d5d5d5;
    display: block;
    padding: .5em
}

.geocoder-control-list {
    list-style: none;
    margin: 0;
    padding: 0
}

.geocoder-control-suggestions .geocoder-control-suggestion {
    font-size: 13px;
    padding: 7px;
    background: white;
    border-top: 1px solid #f1f1f1;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    cursor: pointer
}

.geocoder-control-suggestions .geocoder-control-suggestion:first-child {
    border: none
}

.geocoder-control-suggestions .geocoder-control-suggestion.geocoder-control-selected,
.geocoder-control-suggestions .geocoder-control-suggestion:hover {
    background: #7FDFFF;
    border-color: #7FDFFF
}

.leaflet-right .geocoder-control-suggestions {
    left: auto;
    right: 0
}

.leaflet-right .geocoder-control-input {
    left: auto;
    right: 0
}

.leaflet-touch .geocoder-control {
    width: 34px
}

.leaflet-touch .geocoder-control.geocoder-control-expanded {
    width: 275px
}

.leaflet-touch .geocoder-control-input {
    height: 34px;
    line-height: 30px;
    background-size: 30px
}

.leaflet-touch .geocoder-control-suggestions {
    top: 30px;
    width: 271px
}

.leaflet-oldie .geocoder-control-input {
    width: 28px;
    height: 28px
}

.leaflet-oldie .geocoder-control-expanded .geocoder-control-input {
    width: auto
}

.leaflet-oldie .geocoder-control-input,
.leaflet-oldie .geocoder-control-suggestions {
    border: 1px solid #999
}

.js-signature {
    text-align: center;
}

.js-signature .jSignature {
    border-style: dotted !important;
}

.signature_box {
    background-image: url("/resources/img/gen_user.png");
    margin-bottom: 10px;
    background-size: cover;
    background-position: 50% 50%;
    background-repeat: no-repeat;
    width: 500px;
    height: 200px;
}

.signature_box img {
    width: 100%;
    height: auto;
}

@media (max-width: 500px) {
    .signature_box {
        width: 100%;
        height: auto;
        padding: 40px;
    }

    .signature_box img {
        width: 100%;
        height: auto;
    }

    .signature_box_menu .btn-get-signature {
        width: 100%;
    }

    .signature_box_menu .btn-remove-signature {
        width: 100%;
    }
}

@media (max-width: 1024px) {
    .signature_box {
        width: 100%;
        height: auto;
        padding: 40px;
    }

    .signature_box_menu .btn-get-signature {
        width: 100%;
        margin-bottom: 10px;
    }

    .signature_box_menu .btn-remove-signature {
        width: 100%;
    }
}


.signature_show {
    background-repeat: no-repeat;
    background-size: 200px 100px;
    width: 200px;
    height: 100px;
}

.search_top {
    margin-top: -25px;
}

.search_top .btn.btn-success {
    background: #00a7ba !important;
    border-color: #00a7ba !important;
}

span.multiselect-native-select {
    position: relative
}

span.multiselect-native-select select {
    border: 0 !important;
    clip: rect(0 0 0 0) !important;
    height: 1px !important;
    margin: -1px -1px -1px -3px !important;
    overflow: hidden !important;
    padding: 0 !important;
    position: absolute !important;
    width: 1px !important;
    left: 50%;
    top: 30px
}

.multiselect-container {
    position: absolute;
    list-style-type: none;
    margin: 0;
    padding: 0;
    z-index: 5;
}

.multiselect-container .input-group {
    margin: 5px;
}

.multiselect-container .multiselect-reset .input-group {
    width: 93%;
}

.multiselect-container>li {
    padding: 0;
}

.multiselect-container>li.multiselect-group label {
    margin: 0;
    padding: 3px 20px;
    height: 100%;
    font-weight: 700;
}

.multiselect-container>li.multiselect-group-clickable label {
    cursor: pointer;
}

.multiselect-container>li>a {
    padding: 0;
}

.multiselect-container>li>a>label {
    margin: 0;
    height: 100%;
    cursor: pointer;
    font-weight: 4;
    padding: 3px 20px 3px 40px;
}

.multiselect-container>li>a>label.checkbox,
.multiselect-container>li>a>label.radio {
    margin: 0;
    font-weight: 400;
}

.multiselect-container>li>a.multiselect-all label {
    font-weight: 700;
}

.multiselect-container>li>a>label>input[type=checkbox] {
    margin-bottom: 5px;
}

.btn-group>.btn-group:nth-child(2)>.multiselect.btn {
    border-top-left-radius: 4px;
    border-bottom-left-radius: 4px;
}

.form-inline .multiselect-container label.checkbox,
.form-inline .multiselect-container label.radio {
    padding: 3px 20px 3px 40px;
}

.form-inline .multiselect-container li a label.checkbox input[type=checkbox],
.form-inline .multiselect-container li a label.radio input[type=radio] {
    margin-left: -20px;
    margin-right: 0;
}

.multiselect-container>li>a>label {
    padding: 3px 20px 3px 20px;
}

/* ------- CloudBrasil - DocBrasil ------- */

.btn-default.active,
.btn-default:active,
.btn-default:focus,
.btn-default:hover,
.open .dropdown-toggle.btn-default {
    color: #fff;
    background: #3ebdca;
    border-color: #3ebdca;
}

.btn-default.active.focus,
.btn-default.active:focus,
.btn-default.active:hover,
.btn-default:active.focus,
.btn-default:active:focus,
.btn-default:active:hover,
.open>.dropdown-toggle.btn-default.focus,
.open>.dropdown-toggle.btn-default:focus,
.open>.dropdown-toggle.btn-default:hover {
    color: #0056B4;
    background: transparent;
    border: none;
}

.multiselect.btn.btn-default {
    color: #fff;
    background: #0056B4;
    border-color: #0056B4;
}

.open>.multiselect.btn.btn-default,
.open>.multiselect.btn.btn-default.focus,
.open>.multiselect.btn.btn-default:focus,
.open>.multiselect.btn.btn-default:hover  {
    color: #fff;
    background: #0056B4;
    border-color: #0056B4;
}

.btn.btn-default {
    color: #0056B4;
    background: transparent;
    border: none;

}


/* - Negate/Copy to Main Style - */

body {
    background: #ffffff00
    /*url(/resources/img/bg.png)*/
}


a {
    cursor: pointer
}

.navbar-form {
    margin: 25px 0 0;
}

.navbar-form .btn-search-desktop {
    top: 25px;
}

.navbar-form .btn-search-mobile {
    top: 37px;
}

.navbar-nav>li>a {
    padding: 30px 15px 0;
}

.navbar-nav>li>a .label {
    top: 20px;
}

.panel-inverse>.panel-heading {
    background: #005f69;
}

.panel-default>.panel-heading {
    background: #ffffff;
}



.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn,
.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn:focus,
.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn:hover,
.page-with-light-sidebar .sidebar .nav>li.active.expand>a,
.page-with-light-sidebar .sidebar .nav>li.active>a,
.page-with-light-sidebar .sidebar .nav>li.active>a:focus,
.page-with-light-sidebar .sidebar .nav>li.active>a:hover,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active:focus>a,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active:hover>a,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active>a {
    background: #005f69;
}

.navbar.navbar-inverse .navbar-brand,
.sidebar .nav>li.active>a,
.sidebar .nav>li.active>a:focus,
.sidebar .nav>li.active>a:hover,
.page-sidebar-minified .sidebar .nav>li.has-sub.active:focus>a,
.page-sidebar-minified .sidebar .nav>li.has-sub.active:hover>a,
.page-sidebar-minified .sidebar .nav>li.has-sub.active>a,
.label.label-theme,
.btn.btn-scroll-to-top {
    background: #0073E5;
}

.sidebar .nav>li>a {
    color: #fff;
}

.sidebar .nav>li>a:hover,
.sidebar .nav>li>a:focus {
    color: #fff;
    background-color: #0073E5;
}

.sidebar .nav>li.active>a,
.sidebar .nav>li.active>a:hover,
.sidebar .nav>li.active>a:focus {
    color: #fff;
    background-color: #0073E5;
}

.sidebar .nav>li>a {
    padding: 10px 20px;
    line-height: 20px;
    color: #a8acb1;
}

.sidebar .nav>li.navbar-user>a {
    color: #fff;
}

.navbar-user .sidebar .nav>li.navbar-user>a:hover,
.sidebar .nav>li.navbar-user>a:focus {
    color: #fff;
    background-color: rgb(255 255 255 / 15%);
}

.sidebar .nav>li.navbar-user>a:hover,
.sidebar .nav>li.navbar-user>a:focus {
    color: #fff;
    background-color: rgb(255 255 255 / 15%);
}

.navbar-user .sidebar .nav>li.navbar-user.active>a,
.sidebar .nav>li.navbar-user.active>a:hover,
.sidebar .nav>li.navbar-user.active>a:focus {
    color: #fff;
}

.navbar-user .sidebar .nav>li.navbar-user>a {
    padding: 10px 20px;
    line-height: 20px;
    color: #a8acb1;
}

.sidebar .nav>li.navbar-user>a {
    padding: 25px 20px 20px;
    line-height: 20px;
    color: #a8acb1;
}

.btn.btn-success {
    background: #0056B4;
    border-color: #0056B4;
}

.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn,
.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn:focus,
.page-with-light-sidebar .sidebar .nav>li .sidebar-minify-btn:hover,
.page-with-light-sidebar .sidebar .nav>li.active.expand>a,
.page-with-light-sidebar .sidebar .nav>li.active>a,
.page-with-light-sidebar .sidebar .nav>li.active>a:focus,
.page-with-light-sidebar .sidebar .nav>li.active>a:hover,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active:focus>a,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active:hover>a,
.page-with-light-sidebar.page-sidebar-minified .sidebar .nav>li.active>a {
    background: #005f69;
}

.page-with-light-sidebar .sidebar .nav>li.active>a>i {
    color: #3fbdcb;
}

.sidebar .nav>li>a .badge {
    background: #005f69;
}

.login.login-with-news-feed .login-header,
.register.register-with-news-feed .register-header {
    padding: 80px 60px 0;
}

.login.login-with-news-feed .login-header .icon {
    top: 76px;
}

/* .btn-group .btn.btn-success:not(.active)+.btn.btn-success,
.input-group-btn .btn.btn-success:not(.active)+.btn.btn-success {
    border-left-color: #00a7ba;
} */

.panel-heading-btn>a {
    margin-left: 0;
}

.dropdown-menu>li>a {
    padding: 5px 10px;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 400;
    font-size: 14px;
    line-height: 150%;
}

.multiselect-container {
    left: 0 !important;
}

.dropdown-menu>li>a>i {
    --bs-text-opacity: 1;
    color: #3390D9 !important;
}

.form-control[disabled],
.form-control[readonly],
fieldset[disabled] .form-control {
    background: #f0f3f4;
    border-color: #e0e0f0;
}

.form-control[disabled],
.form-control[readonly],
fieldset[disabled] .form-control {
    opacity: .8;
    filter: alpha(opacity=80);
}

label.control-label {
    padding-left: 15px;
}

b,
strong {
    font-weight: 600;
}

/* - */


th,
td {
    letter-spacing: -.5px;
}

th {
    white-space: nowrap;
}

.t-a-c {
    text-align: center;
}

.page-container {
    height: 100%;
}

.panel-inverse .panel-heading [class*="btn-"] {
    background: transparent;
    border-color: transparent;
}

.navbar-brand.client {
    height: auto;
}

.navbar-brand.client .navbar-logo {
    border: 0;
    margin: 0;
}

.panel-title>i:first-child,
.dropdown-menu i,
h4 i {
    margin-right: 8px !important;
}

.panel-heading-btn>.btn-icon.btn-sm,
.panel-heading-btn>.btn-group>.btn-icon.btn-sm {
    width: 18px;
}

.panel-heading-btn>.btn-group {
    vertical-align: bottom;
}

.panel-title {
    font-weight: 600;
}

/*span.required {*/
/*    font-family:FontAwesome;font-weight:4;font-style:normal;text-decoration:inherit;color:#C00;*/
/*    display:inline;width:auto;height:auto;line-height:normal;vertical-align:baseline;*/
/*    background-image:none;background-position:0px 0px;background-repeat:repeat;margin:0px 5px 0px 1px;*/
/*}*/

/*span.required::before {content:"\f0da";}*/

.optional_field,
.form_field_optional {
    color: #8b9987;
}

.form_field_optional {
    margin-lef: 3px;
}

/* - Footer - */

.db_logo_footer a {
    display: table;
    margin: 0 auto;
}

.db_copy_footer a {
    display: table;
    margin: 15px auto 0;
    color: #fff;
}

.db_copy_footer a:hover,
.db_copy_footer a:focus {
    color: #3fbdcb;
    text-decoration: none;
}

.cb_copy_bottom {
    position: fixed;
    bottom: 20px;
    left: 90px;
}

@media (max-width:767px) {
    .cb_copy_bottom {
        display: none;
    }

    .db_logo_footer img {
        max-height: 25px;
        width: auto;
    }

    .db_copy_footer a {
        display: table;
        margin: 8px auto 0;
        color: #fff;
        font-size: 10px
    }

    .sidebar .nav>li.nav-profile {
        padding: 8px;
    }
}

/* .sidebar > .slimScrollDiv {padding-bottom:130px;} */
.sidebar.sidebar-right>.slimScrollDiv {
    padding-bottom: 0;
}

.cb_footer {
    position: absolute;
    bottom: 0;
    width: 100%;
}

/* - */


/* - Login */

.login.login-with-news-feed .news-image {
    background: url("/resources/img/login-bg/bg-7.jpg") 0 0 no-repeat;
    background-size: cover;
    background-position: 50% 50%;
}

.cb_news_stats h4 {
    text-transform: uppercase;
}

.login .widget-stats {
    opacity: .8;
}

.login .widget {
    margin: 0;
}

/* - */


/* - Dashboard - */

.adv_srch_lnk {
    display: block;
    margin-top: 9px;
}

.adv_srch_lnk:after {
    content: "Fechar Busca Avançada";
}

.adv_srch_lnk.collapsed:after {
    content: "Busca Avançada";
}

.adv_srch_lnk i {
    color: #337ab7;
}

.adv_srch_lnk.collapsed i {
    color: #ddd;
}

.adv_srch_lnk i:before {
    content: "\f205";
}

.adv_srch_lnk.collapsed i:before {
    content: "\f204";
}

.pnl_activity .panel-body {
    padding: 5px;
}

.pnl_activity .table {
    margin-bottom: 0;
}

.pnl_activity .table>tbody>tr:last-child>td {
    border-bottom: 1px solid #e2e7eb;
}

.pnl_activity .table>tbody>tr>td,
.pnl_activity .table>tbody>tr>th,
.pnl_activity .table>tfoot>tr>td,
.pnl_activity .table>tfoot>tr>th,
.pnl_activity .table>thead>tr>td,
.pnl_activity .table>thead>tr>th {
    padding: 3px 6px;
}

.pnl_activity .table i {
    color: #3fbdcb;
    width: 18px;
    font-size: 16px;
    text-align: center;
    vertical-align: middle;
}

.pnl_activity .table i.fa-flag {
    color: inherit;
}

.pnl_activity .table i.publish {
    font-size: 10px;
}

.pnl_activity i.active,
.doc_status i.active {
    color: #49b6d6;
}

.pnl_activity i.active.wme,
.doc_status i.active.wme {
    color: #ff5b57;
}

.pnl_activity i.publish.active,
.doc_status i.publish.active {
    color: #00d4b4;
}

.pnl_activity.ac_main .c_btn button {
    float: right;
    width: 18px;
    height: 18px;
    text-align: center;
    border: 0;
    padding: 0;
    color: #ff5b57;
    background: transparent;
    line-height: 1;
}

/*@media (max-width:1199px) {.c_stt {display:none;}}*/

/*@media (max-width:979px) {.c_dcr {display:none;}}*/

.navbar-user {
    margin-left: -7px;
}

.navbar-user img {
    width: 36px;
    height: 36px;
    margin: -8px 10px 0 0;
    -webkit-border-radius: 3px;
    -moz-border-radius: 3px;
    border-radius: 3px;
}

.breadcrumb li i {
    margin-right: 8px;
}

.pnl_activity table tr td:not(:first-child),
.pnl_activity table tr th:not(:first-child) {
    text-align: center;
}

.pnl_activity.proc_tasks table tr td:last-child,
.pnl_activity.proc_tasks table tr th:last-child {
    text-align: left;
}



.pnl_activity table tr td {
    vertical-align: middle;
}

.pnl_activity .panel-footer {
    padding: 0 15px 5px 5px;
    border-top: 0;
}

.caret {
    border-top: 4px dashed;
}

.doc_tools {
    display: table;
    width: 100%;
}

.doc_tools .pnl_search {
    float: left;
    width: 100%;
}

.pg_dashboard .doc_tools .pnl_search {
    width: 85%;
}

.doc_tools .new_doc {
    width: 15%;
    float: left;
    padding-bottom: 15px;
}

.doc_tools .new_doc a {
    display: block;
    margin: 0 0 0 20px;
    font-weight: 600;
    white-space: normal;
    padding: 6px 0;
    line-height: 1.2;
}

.doc_tools .new_doc a i {
    margin: 20px 0 10px;
}

@media (max-width:979px) {
    .doc_tools .new_doc span {
        display: none;
    }

    .doc_tools .new_doc a {
        height: 130px;
    }

    .doc_tools .new_doc a i {
        margin-top: 50px;
    }
}

/* - */


/* - Profile - */

form [class*="col-"]>h4,
.doc_title {
    margin-top: 0;
    margin-bottom: 15px;
    border-bottom: 1px solid #ddd;
    padding-bottom: 10px;
}

form [class*="col-"]>h4:not(:first-of-type) {
    margin-top: 34px;
}

.dates {
    padding: 10px;
    border-radius: 3px;
    background: #2d353c;
    color: #fff;
}

.dates .text-info {
    color: #c2ecf8 !important
}

.profile-right {
    padding-right: 0;
}

.profile-right ul:last-child,
.dates ul:last-child {
    margin-bottom: 0;
}

@media (min-width:768px) {
    label.control-label {
        padding-left: 0;
    }
}

.avatar_box {
    background-image: url("/resources/img/gen_user.png");
    margin-bottom: 10px;
    border: 2px solid #e2e7eb;
    border-radius: 4px;
    background-size: cover;
    background-position: 50% 50%;
    background-repeat: no-repeat;
    width: 100%;
}

.avatar_box img {
    width: 100%;
    height: auto;
}

.menu_avatar_box {
    width: 36px;
    height: 36px;
    float: left;

    background-image: url("/resources/img/gen_user.png");
    border-radius: 3px;
    background-size: cover;
    background-position: 50% 50%;
    background-repeat: no-repeat;
    margin: -8px 10px 0 0;
}

.menu_avatar_box img {
    width: 100%;
    height: auto;
}

.docnew_name h4 {
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    line-height: normal;
    letter-spacing: -.5px;
}

@media screen and (max-device-width : 991px) {
    .mobile_hide {
        display: none;
    }

    .breadcrumb>li.mobile_hide {
        display: none;
    }

    .panel-default>.panel-heading>.panel-heading-btn>.mobile_hide {
        display: none;
    }
}

@media screen and (min-device-width : 992px) {
    .mobile_show {
        display: none;
    }

    .breadcrumb>li.mobile_show {
        display: none;
    }

    .panel-default>.panel-heading>.panel-heading-btn>.mobile_show {
        display: none;
    }
}

/* - */


/* - Page Menu - */

.page_menu {
    /*border-bottom:1px solid #ddd;*/
    width: 100%;
    height: 50px;
    padding: 0 10px 10px 10px;
    margin-bottom: 20px;
}

.page-menu {
    /* margin-bottom: 10px;
    min-width: 100%;
    min-height: 40px; */
}

.page-menu-fixed {
    position: fixed;
    top: 7px;
    right: 0;
    min-height: 40px;
    min-width: 100%;
    z-index: 10;
    padding: 10px;
    display: none;
}

/* - */


/* - docdet - */

.doc_type {
    font-size: 12px;
    font-style: italic;
    color: #ccc;
    margin: -10px 0 16px;
    cursor: default;
}

.doc_status {
    float: right;
}

.content_widget .panel-title .label.label-success {
    background: #007784;
}

.content_widget .panel-toolbar {
    overflow: auto;
    background: #f0f3f4 !important;
    border-bottom-color: #e0e0f0;
}

.content_widget .panel-body {
    padding: 0 0 15px;
}

.content_widget .panel-body .alert,
.content_widget .panel-body .content_window {
    margin: 15px 15px 0;
}

.content_widget textarea {
    width: 100% !important;
    border: 0;
    font-size: 14px;
}

.content_widget>button.collapsed span:before,
.content_widget .panel-toolbar button.b_show.collapsed i:before {
    content: "\f06e";
}

.content_widget>button span:before,
.content_widget .panel-toolbar button.b_show i:before {
    content: "\f070";
}

.docdet .pager.bwizard-buttons {
    display: none;
}

.alert .hd_alert_message {
    border: 1px solid #e0e0f0;
    border-top-right-radius: 4px;
    border-bottom-right-radius: 4px;
    border-left: 0;
    background: #f3f6f7;
}

.content_widget .panel-body .alert .hd_alert_message {
    background: #fff;
    border: 0;
    border-radius: 0;
}

.content_widget .alert h4 {
    border: 0;
    margin: 0;
}

.content_widget .alert p {
    margin: 0;
}

.content_widget .alert button {
    float: right;
}

.content_widget [class^="col-"]:first-child {
    text-align: right;
}

.content_window {
    background: #fff;
    padding: 0;
    margin: 0;
    border-radius: 4px;
    font-size: 14px;
}

.doc_highlight {
    float: none;
    overflow: auto;
    width: 100%;
    margin-bottom: 15px;
    padding: 30px;
    color: #fff;
    border-radius: 3px;
    background: #242a30;
}

.doc_highlight ul {
    margin-bottom: 5px;
}

.doc_highlight .text-info {
    color: #c2ecf8 !important;
}

@media (min-width:992px) {
    .doc_highlight {
        float: right;
        width: 22%;
    }
}

@media (min-width:1200px) {
    .doc_highlight {
        float: right;
        width: 15%;
    }
}

.doc_thmb {
    margin: 0 -10px -10px;
    float: right;
    width: 20%;
}

.thmb_box {
    width: 100%;
    margin-bottom: 10px;
    background-image: url("/resources/img/gen_doc.png");
    background-size: cover;
    background-position: 50% 50%;
    background-repeat: no-repeat;
}

.thmb_box img {
    width: 100%;
    height: auto;
}

.doc_data {
    float: left;
    width: 50%;
}

@media (min-width:992px) {
    .doc_thmb {
        margin: 0;
        float: none;
        width: 100%;
    }

    .doc_highlight {
        padding: 10px;
    }

    .doc_data {
        float: none;
        width: 100%;
    }

    .thmb_box {
        margin-bottom: 10px;
    }

    .thmb_box img {
        width: 100%;
        height: auto;
    }
}


/* - */

.pg_docdet .btn-get-signature {
    width: 100%;
}

.pg_docdet .btn-signature {
    width: 100%;
}





/* new docdet classes */
.doc-screen {
    position: fixed;
    top: 0;
    left: 0;
    width: 100vw;
    height: 100vh;
    overflow: auto;
    display: flex;
    flex-direction: column;
    background: white;
    color: #424242;
    z-index: 1030;
}

.doc-screen.desktop {
    position: relative;
    width: 100%;
    height: 100%;
    z-index: inherit;
}

.doc-header {
    display: flex;
    justify-content: space-between;
    align-items: center;
    min-width: 100%;
    max-width: 100%;
    padding: 8px 14px;
}

.doc-header>div.flex-row>div {
    font-size: 18px;
    cursor: pointer;
}

.doc-header>div.flex-row>span {
    font-size: 16px;
    user-select: none;
    margin-left: 14px;
}

.doc-content {
    display: flex;
    flex-direction: column;
    min-width: 100%;
    min-height: 100%;
    max-height: 100%;
}

.doc-previewer {
    position: fixed;
    top: 0;
    left: 0;
    width: 100vw;
    height: 100vh;

    display: flex;
    flex-direction: column;
    background: white;
    color: #424242;
    z-index: 1051;
}

.doc-previewer.desktop {
    position: relative;
    width: 100%;
    height: 100%;
    z-index: inherit;
}

.doc-previewer-header {
    display: flex;
    align-items: center;
    justify-content: space-between;
    min-width: 100%;
    max-width: 100%;
    padding: 8px 14px;
    border-bottom: 1px solid #e2e7eb;
}

.doc-previewer-header>div {
    font-size: 18px;
    cursor: pointer;
}

.doc-previewer-header>span {
    font-size: 16px;
    user-select: none;
}

.doc-previewer-content {
    height: 100vh;
    max-height: 100vh;
}

.doc-previewer-content>div {
    height: 100%;
    max-height: 100%;
}


/* - docnew - */

/* .pg_docnew .bwizard-steps li,
.pg_docdet .bwizard-steps li
{
    width: 25%;
} */

.bwizard-steps .label {
    padding: 5px !important;
    height: 30px !important;
    width: 30px !important;
    font-size: 18px;
}

.bwizard-steps li a {
    margin-left: 42px !important;
}

.bwizard-steps {
    width: 30px;
    height: 50px;
    border-radius: 8px !important;
    overflow: hidden !important;
}

.bwizard .well {
    border-radius: 8px;
}

.docnew_wizard .w_step_2 a>i {
    line-height: 1.2;
}

.docnew_wizard .w_step_2 .note {
    margin: 10px 0 0;
    padding: 10px;
    background: #f0f3f4;
    border-radius: 0 4px 4px 0;
}

.pager li>a,
.pager li>span,
.pagination>li>a {
    color: #A0A7B4;
}

.pager li>a,
.pager li>span {
    border-radius: 8px;
    text-transform: uppercase;
    font-weight: 700;
    font-size: 11px;
}

@media (max-width:991px) {
    .pg_docnew .bwizard-steps li {
        width: 100% !important;
        float: left !important;
    }

    .pg_docdet .bwizard-steps li {
        width: 100% !important;
        float: left !important;
    }
}

/* - */


/* - HD Alert Box - */

.hd_alert {
    border-radius: 0 4px 4px 0;
    border-left: 3px solid;
}

.hd_alert_box.hd_danger .hd_alert_type {
    background: #ff5b57;
}

.hd_alert_box.hd_danger h4 {
    color: #ff5b57;
}

.hd_alert_box.hd_warning .hd_alert_type {
    background: #f59c1a;
}

.hd_alert_box.hd_warning h4 {
    color: #f59c1a;
}

.hd_alert_box.hd_success .hd_alert_type {
    background: #00acac;
}

.hd_alert_box.hd_success h4 {
    color: #00acac;
}

.hd_alert_box.hd_info .hd_alert_type {
    background: #49b6d6;
}

.hd_alert_box.hd_info h4 {
    color: #49b6d6;
}

.hd_alert_box {
    padding: 0;
    overflow: hidden;
}

.hd_alert_type {
    display: table-cell;
    vertical-align: top;
    padding: 10px 8px;
    background: #49b6d6;
}

.hd_alert_type i {
    color: #fff;
}

.hd_alert_message {
    display: table-cell;
    vertical-align: top;
    padding: 12px;
}

.hd_alert_message_docviewer {
    display: table-cell;
    vertical-align: top;
}


.hd_alert_message h4 {
    color: #49b6d6;
}

.hd_alert_message .close {
    margin: -12px -8px 0 0;
}

/* - */


/* HD - Option Box - */

.opt_check {
    border: 1px solid #ccd0d4;
    border-radius: 4px;
    display: table;
    width: 100%;
    overflow: hidden;
}

.opt_check>* {
    display: table-cell;
    vertical-align: middle;
    height: 40px;
}

.opt_check .opt_input {
    width: 45px;
    text-align: center;
    border-right: 1px solid #ddd;
    background: #f0f3f4;
    user-select: none;
    cursor: pointer;
}

.opt_check .opt_input input {
    margin: 4px auto 0;
}

.opt_check .opt_content {
    padding: 10px;
    font-size: 14px;
    color: #333;
    line-height: 1;
    user-select: none;
    cursor: pointer;
}

.opt_check .opt_content small {
    color: #999;
}

.opt_check .opt_code {
    border-left: 1px solid #ddd;
    background: #f0f3f4;
    text-align: center;
    font-weight: 600;
}

.opt_check .opt_code span {
    font-size: 16px;
    white-space: nowrap;
    text-align: center;
    padding: 0 5px;
}

/* - */


/* - Search Sidebar- */

.extended {
    color: #000000 !important;
}

.extended * {
    color: #000000 !important;
}

.sidebar.search_filters {
    color: #fff;
}

.sidebar.search_filters input[type="text"] {
    color: #333;
}

.sidebar.search_filters .nav>li.nav-widget {
    padding: 0;
}

.sidebar.search_filters .nav>li .panel,
.sidebar.search_filters .nav>li .panel-heading {
    border-radius: 0;
    background-color: transparent;
}

.sidebar.search_filters .nav>li .panel {
    margin: 0;
}

.sidebar.search_filters .nav>li .panel .panel-body {
    padding: 5px;
}

/*.search_filters .slimScrollDiv > div:first-child {padding-top:68px;}*/
.search_filters .panel-group .panel-heading+.panel-collapse>.panel-body {
    border: 0;
}

.filters_list {
    list-style-type: none;
    padding: 0;
}

.filters_list>li {
    padding: 3px 5px;
}

.filters_list>li>label {
    margin: 0;
    letter-spacing: -.5px;
    font-weight: 300;
}

.filters_list>li:not(:last-of-type) {
    border-bottom: 1px solid #cbd6e0;
}

.filters_list>li>input[type="checkbox"] {
    width: auto;
    float: left;
    margin: 3px 6px 0px 4px;
}

/* - */


/* - Search Page - */

.panel-title .accordion-toggle.accordion-toggle-styled .fa:before {
    content: '\f068';
}

.panel-title .accordion-toggle.accordion-toggle-styled.collapsed .fa:before {
    content: '\f067';
}

.pnl_activity.ac_results .panel-footer {
    padding: 0 5px 5px;
}

.ac_results .results_info {
    float: left;

}

/* - */


[class*="pg_"]>.row:last-child>[class*="col-"]>.panel:last-child {
    margin-bottom: 0;
}

.pagination-sm>li>a,
.pagination-sm>li>span {
    margin-left: 20px;
    font-weight: 600;
    padding: 0px 8px;
}

.dropdown_narrow {
    min-width: 3em;
}


/* - Tags & Criteria - */

.search_info {
    border: 0;
}

.search_info>div {
    display: table;
    width: 100%;
}

.search_info>div:last-child {
    padding-top: 10px;
    margin-top: 10px;
    border-top: 1px solid #ccc;
}

.search_info>div>div {
    display: table-cell;
    vertical-align: top;
}

.search_info>div>div:first-child {
    width: 30px;
}

.search_info>div>div i,
.search_info>div>div strong {
    color: #3fbdcb;
}


/* - Select2 Tags - Just for test */

.hdselect2-container-multi .hdselect2-search-choice-close:after {
    content: "\f00d";
    top: -3px;
    right: -2px;
    font-family: FontAwesome;
    font-weight: 4;
    font-style: normal;
    display: inline-block;
    text-decoration: inherit;
    position: absolute;
    width: 18px;
    height: 18px;
    pointer-events: none;
    text-align: center;
    line-height: 18px;
    font-size: 14px;
    color: #B6B2B2;
}

/*.hdselect2-search-choice-close {*/
/*display:block;width:12px;height:13px;position:absolute;right:3px;top:4px;*/
/*font-size:1px;outline:0;background:url(/resources/img/hdselect2.png) right top no-repeat;*/
/*}*/

.hdselect2-search-choice-close {
    display: block;
    width: 12px;
    height: 13px;
    position: absolute;
    right: 3px;
    top: 4px;
    font-size: 1px;
    outline: 0;
}

.hdselect2-container-multi .hdselect2-choices li {
    float: left;
    list-style: none;
}

.hdselect2-container-multi .hdselect2-choices .hdselect2-search-choice {
    padding: 3px 5px 3px 18px;
    margin: 3px 0 3px 5px;
    position: relative;
    line-height: 13px;
    color: #7379cb;
    cursor: default;
    -webkit-touch-callout: none;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
}

.hdselect2-container-multi .hdselect2-choices {
    height: auto !important;
    height: 1%;
    margin: 0;
    padding: 0;
    position: relative;
    cursor: text;
    overflow: hidden;
}

.hdselect2-container-multi .hdselect2-choices {
    min-height: 26px;
}

/* - */

.hdselect2-container-multi .hdselect2-search-choice-close:after {
    font-size: 10px;
    color: #fff;
}

.hdselect2-container-multi .hdselect2-choices .hdselect2-search-choice {
    padding: 3px 20px 3px 5px;
    background: #3fbdcb;
    color: #fff;
    border-radius: 3px;
    font-weight: 600;
}

.ac-tags .tags_bar {
    padding: 0;
}

.select2-container--default .select2-selection--single .select2-selection__rendered {
    line-height: 34px !important;
    font-size: 12px;
}

/* - */

.inputfile {
    width: 0.1px;
    height: 0.1px;
    opacity: 0;
    overflow: hidden;
    position: absolute;
    z-index: -1;
}

.inputfile+label {
    max-width: 80%;
    white-space: nowrap;
    cursor: pointer;
    color: #fff;
    display: inline-block;
    overflow: hidden;
    font-weight: 100;
}

.inputfile+label:focus {
    outline-width: 0;
}

.btn.inputfile_btn {
    height: 34px;
}

.add-linebreak {
    word-break: break-all;
}

.pager li.next.disabled,
.pager li.previous.disabled {
    display: none;
}

/* .select2-container {width:100% !important;} */
.pnl_stats .progress-bar {
    color: #000;
    text-align: center;
}

.pnl_stats .progress {
    margin-bottom: 0;
}

.pnl_stats .table>tbody>tr>td,
.pnl_stats .table>tbody>tr>th,
.pnl_stats .table>tfoot>tr>td,
.pnl_stats .table>tfoot>tr>th,
.pnl_stats .table>thead>tr>td,
.pnl_stats .table>thead>tr>th {
    padding: 5px;
}

.pnl_activity i.active.late,
.doc_status i.active.late {
    color: #ff5b57;
}

.pnl_activity i.active.executed,
.doc_status i.active.executed {
    color: #00a7ba;
}

.pnl_activity i.active.pending,
.doc_status i.active.pending {
    color: #f59c1a;
}

/*Dialog History Process*/

.bpm-executed:not(.djs-connection) .djs-visual> :nth-child(1) {
    stroke: rgba(66, 180, 21, 0.7) !important;
    /* color elements as red */
}

.bpm-executing:not(.djs-connection) .djs-visual> :nth-child(1) {
    stroke: #f59c1a !important;
}

#processhistory .modal-dialog {
    margin-left: 10px;
}

.hist_pagecontainer {
    position: relative;
}

.hist_pagecontainer .hist_canvas {
    position: fixed;
    width: 100%;
    height: 100%;
    background: rgba(0, 0, 0, .6);
    z-index: 1039;
    top: 0;
}

.hist_pagecontainer .hist_canvas .modal-header .close {
    margin-top: 4px;
    font-size: 18px;
}

.hist_pagecontainer .hist_canvas>div {
    background: #fff;
    height: 1500px;
    box-shadow: 0 5px 15px rgba(0, 0, 0, .7);
}

.hist_pagecontainer .hist_canvas>div>.row {
    margin: 0;
}

.hist_pagecontainer .hist_canvas>div>.row:last-child {
    overflow: auto;
    background: #fff;
}

.hist_pagecontainer .hist_canvas .modal-header {
    background: #fff;
}

.hist_pagecontainer .hist_canvas .modal-header>* {
    color: #fff;
}

.hist_pagecontainer .hist_canvas .modal-header .close {
    opacity: .6;
}

.hist_pagecontainer .hist_canvas .bjs-container {
    height: 500px;
}

.hist_pagecontainer .hist_canvas .bjs-powered-by {
    display: none;
}

.hist_pagecontainer .hist_canvas .djs-container {
    height: 100%;
}

.docviewer_pagecontainer {
    position: relative;
    z-index: 10000;
}

.docviewer_pagecontainer .modal-title {
    text-overflow: ellipsis;
    overflow: hidden;
    white-space: nowrap;
}

@media only screen and (max-device-width : 996px) {
    .docviewer_pagecontainer .docviewer_content {
        overflow: scroll;
        max-height: 90vh;
        padding-left: 10px;
        padding-right: 10px;
    }
}

@media only screen and (min-device-width : 997px) {
    .docviewer_pagecontainer .docviewer_content {
        overflow: scroll;
        max-height: 90vh;
        padding-left: 50px;
        padding-right: 50px;
    }
}

.docviewer_pagecontainer .docviewer_canvas {
    position: fixed;
    width: 100%;
    height: 100%;
    background: rgba(0, 0, 0, .6);
    z-index: 1040;
    top: 0;
}

.docviewer_pagecontainer .docviewer_canvas .modal-header .close {
    margin-top: 4px;
    font-size: 18px;
}

.docviewer_pagecontainer .docviewer_canvas>div {
    background: #fff;
    height: 1500px;
    box-shadow: 0 5px 15px rgba(0, 0, 0, .7);
}

.docviewer_pagecontainer .docviewer_canvas>div>.row {
    margin: 0;
}

.docviewer_pagecontainer .docviewer_canvas>div>.row:last-child {
    background: #fff;
}

.docviewer_pagecontainer .docviewer_canvas .modal-header {
    background: #fff;
    /*color: #fff;*/
    /*background: #348fe2;*/
    /*border-color: #348fe2;*/
}

.docviewer_pagecontainer .docviewer_canvas .modal-header>* {
    color: #fff;
}

.docviewer_pagecontainer .docviewer_canvas .modal-header .close {
    opacity: .6;
}

.docviewer_pagecontainer .docviewer_canvas .bjs-container {
    height: 500px;
}

.docviewer_pagecontainer .docviewer_canvas .bjs-powered-by {
    display: none;
}

.docviewer_pagecontainer .docviewer_canvas .djs-container {
    height: 100%;
}

.docviewer_pagecontainer .docviewer_canvas .docviewer_img {}

.docviewer_content .modal-backdrop {
    z-index: 9 !important;
}

@media (min-device-width : 996px) {
    .docviewer_content .modal-dialog {
        position: fixed;
        top: 20%;
        left: 50%;
        transform: translate(-50%, -45%);
        z-index: 1045 !important;
    }
}

@media (max-width: 996px) {
    .docviewer_content .modal-dialog {
        position: fixed;
        top: 20%;
        left: 50%;
        transform: translate(-50%, -23%);
        z-index: 1045 !important;
    }
}

/******************/
/*Editor OrgChart*/
/******************/

/*.ui-menu-item {*/
/*background: #008a8a;*/
/*background-color: #008a8a;*/
/*}*/

.ui-state-hover,
.ui-widget-content .ui-state-hover,
.ui-widget-header .ui-state-hover,
.ui-state-focus,
.ui-widget-content .ui-state-focus,
.ui-widget-header .ui-state-focus {
    background: #008a8a;
}

.bporgviewer .search_area {
    margin-top: -15px;
}

.bporgviewer .form-control.search_area_input.ui-autocomplete-input {
    width: 350px;
}

.org_panel {
    margin-top: 50px;
}

.bporgviewer .search_area .search_area_label {
    font-size: 14px;
}

.ui-dialog .ui-dialog-buttonpane button {
    margin: .5em .4em .5em 0;
    cursor: pointer;
    padding: 5px;
}

.bp-item.bp-photo-frame,
.bp-item.bp-photo-frame img {
    width: 32px !important;
    height: 32px !important;
}

.bp-item.bp-description {
    left: 40px !important;
    width: 72px !important;
}

.ui-dialog-buttonpane .ui-dialog-buttonset .ui-button {
    color: rgba(32, 41, 47, 0.8);
}

.ui-dialog-buttonpane .ui-dialog-buttonset .ui-button.ui-state-hover {
    color: rgba(101, 101, 101, 0.51);
}

.ui-button-icon-only .ui-icon {
    left: 50%;
    margin-top: -5px;
    margin-left: -4px;
    margin-right: -6px;
}

.ui-button,
.ui-dialog-buttonpane .ui-dialog-buttonset .ui-button {
    text-shadow: 0 0;
}


.ui-button-primary,
.ui-dialog-buttonset .ui-button:not(:first-child) {
    text-shadow: 0 1px 0 #fff;
    background-image: -webkit-gradient(linear, left 0%, left 100%, from(#ffffff), to(#e6e6e6));
    background-image: -webkit-linear-gradient(top, #ffffff, 0%, #e6e6e6, 100%);
    background-image: -moz-linear-gradient(top, #ffffff 0%, #e6e6e6 100%);
    background-image: linear-gradient(to bottom, #ffffff 0%, #e6e6e6 100%);
    background-repeat: repeat-x;
    border-color: #e0e0e0;
    border-color: #ccc;
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe6e6e6', GradientType=0);
    filter: progid:DXImageTransform.Microsoft.gradient(enabled=false);
}

.bp-selectiontext {
    font-size: 12px;
    line-height: 8px;
    vertical-align: text-bottom;
}

.dialog-form .sortable li {
    height: 28px;
}

.dragged {
    height: 28px !important;
}

.group_pres {
    color: #0dc56e;
}

.group_sindico {
    color: rgba(212, 201, 26, 0.79);
}

.group_admin {
    color: rgba(0, 0, 0, 0.79);
}

.bp-item.bp-photo-frame.top_level,
.bp-item.bp-photo-frame.top_level img {
    width: 169px !important;
    height: 56px !important;
}

.c_action .btn,
.c_action .btn:hover {
    background: none;
    border: none;
}

.pnl_activity .table .c_action .btn i {
    color: #3fbdcb;
}

.pnl_activity .table .c_action .btn i:hover {
    color: #008a8a;
}

.c_action.c_action_single {
    width: 42px;
}

.search_area_input {
    width: 350px;
}

.users_area_list ul li {
    padding-left: 15px;
}

.highlight {
    background-color: #000;
    padding: 0;
    color: #fff;
}

.users_area_list .panel-inverse>.panel-heading {
    background: #00a7ba;
}

.users_area_list .fa.fa-remove {
    color: #fff;
}

.users_area_list .fa.fa-remove:hover {
    color: #00a7ba;
}

.users_area_list .fa.fa-arrow-circle-left {
    color: #fff;
}

.users_area_list .fa.fa-arrow-circle-left:hover {
    color: #00a7ba;
}

.user_detail_panel ul li .detail_text {
    padding-left: 0;
    word-wrap: break-word;
}

.orgchart_page.page-with-two-sidebar.page-sidebar-minified .sidebar-bg.sidebar-right,
.orgchart_page.page-with-two-sidebar.page-sidebar-minified .sidebar.sidebar-right,
.orgchart_page .users_content.sidebar,
.orgchart_page .users_content.sidebar-bg {
    width: 320px;
}

.jstree-node.color_1,
.orgchart_page .jstree-node.color_1>.jstree-icon {
    color: #d000b3;
}

.jstree-node.color_2,
.orgchart_page .jstree-node.color_2>.jstree-icon {
    color: #4675d7;
}

.jstree-node.color_3,
.orgchart_page .jstree-node.color_3>.jstree-icon {
    color: #2fc1c3;
}

.jstree-node.color_4,
.orgchart_page .jstree-node.color_4>.jstree-icon {
    color: #53a913;
}

.jstree-node.color_5,
.orgchart_page .jstree-node.color_5>.jstree-icon {
    color: #edbd00;
}

.jstree-node.color_6,
.orgchart_page .jstree-node.color_6>.jstree-icon {
    color: #e13737;
}

/*
.color_1 .jstree-wholerow {background: #ebeef3;}
.color_2 .jstree-wholerow {background: #edf2eb;}
.color_3 .jstree-wholerow {background: #ebf3f4;}
.color_4 .jstree-wholerow {background: #f3e9e9;}
.color_5 .jstree-wholerow {background: #f0edf2;}
.color_6 .jstree-wholerow {background: #f5eee3;}
*/

.orgchart_page .jstree {
    padding: 18px;
}

.jstree-font-mobile {
    font-size: 12px;
}

.jstree-font-desktop {
    font-size: 14px;
}

.orgchart_page .jstree-default .jstree-wholerow-hovered {
    background: #f0f3f5;
}

.orgchart_page .jstree-default .jstree-wholerow-clicked {
    background: #f0f3f5;
}

.orgchart_page .jstree-default .jstree-wholerow-clicked.jstree-wholerow-hovered {
    background: #e8ebed;
}

.orgchart_page .jstree-default .jstree-wholerow {
    border-radius: 4px;
}

.orgchart_page .jstree-default .jstree-node,
.orgchart_page .jstree-default .jstree-icon {
    background-image: none;
}

.orgchart_page .jstree-default .jstree-icon {
    font-family: FontAwesome;
    font-weight: normal;
    font-style: normal;
    -webkit-font-smoothing: antialiased;
    vertical-align: baseline;
}

.orgchart_page .jstree-icon {
    color: #ccc;
}

.orgchart_page .jstree-default>.jstree-no-dots .jstree-closed>.jstree-ocl:before {
    content: "\f0fe";
}

.orgchart_page .jstree-default>.jstree-no-dots .jstree-open>.jstree-ocl:before {
    content: "\f146";
}

.tree_item_detail {
    padding-left: 0;
}

.org_users .org_users_add {
    padding: 10px;
    background: #f0f3f5;
}

.org_users .org_users_add .select2-container {
    border: 1px solid #cccccc;
}

.org_users .org_users_add .select2-container .select2-choice {
    width: 250px;
    border: none;
}

.org_users .org_users_add .input-group .input-group-addon button.btn {
    padding: 0 7px;
    line-height: normal;
    width: 28px;
    text-align: center;
    height: 22px;
    margin-top: 2px;
}

.org_users .org_users_add .input-group .input-group-addon button.btn i {
    line-height: normal;
    vertical-align: middle;
}

.org_users .org_users_add .select2-container-active {
    box-shadow: 0 0 5px rgba(0, 0, 0, 0.3)
}

.org_users .org_users_add .select2-container-active .select2-choice {
    box-shadow: none;
}

.org_users .org_users_add .select2-dropdown-open.select2-drop-above .select2-choice {
    background: none;
    background-image: none;
}

.orgchart_page .vakata-context li>a>i[class*="t_cor"] {
    width: 16px;
    height: 16px;
    margin: 9px 9px 9px -20px;
}

.orgchart_page .vakata-context li>a>i.t_cor1 {
    background: #d000b3;
}

.orgchart_page .vakata-context li>a>i.t_cor2 {
    background: #4675d7;
}

.orgchart_page .vakata-context li>a>i.t_cor3 {
    background: #2fc1c3;
}

.orgchart_page .vakata-context li>a>i.t_cor4 {
    background: #53a913;
}

.orgchart_page .vakata-context li>a>i.t_cor5 {
    background: #edbd00;
}

.orgchart_page .vakata-context li>a>i.t_cor6 {
    background: #e13737;
}

.box-section.org_users_list {
    padding: 0;
}

.box-section.org_users_list>label {
    margin: 10px 0 10px 10px;
}

.box-section.org_users_list table {
    margin: 0;
    font-size: 12px;
}

.box-section.org_users_list .table>thead>tr>th,
.box-section.org_users_list .table>thead>tr>td,
.box-section.org_users_list .table>tbody>tr>th,
.box-section.org_users_list .table>tbody>tr>td,
.box-section.org_users_list .table>tfoot>tr>th,
.box-section.org_users_list .table>tfoot>tr>td,
.box-section.org_users_list .table-normal thead td {
    padding: 3px;
    vertical-align: middle;
}

.box-section.org_users_list .icon-sort {
    cursor: ns-resize;
    color: #ccc;
}

.box-section.org_users_list .table>thead:first-child>tr:first-child>td {
    border-top: 1px solid #ddd;
}

.box-section.org_users_list .table-normal thead td {
    font-weight: 4;
}

.box-section.org_users_list .icon-shield {
    margin-left: 8px;
    color: #daa520;
}

.icon-shield:before {
    content: "\f132";
}

.box-section.org_users_list .table-normal tbody tr:nth-child(even) {
    background: transparent;
}

.box-section.org_users_list .table-normal tbody td.gboss {
    border-left: 3px solid #daa520;
}

.box-section.org_users_list .table-normal tbody td:first-child {
    text-align: center;
}

.box-section.org_users_list .btn-group {
    float: right;
    min-width: 42px;
}

.box-section.org_users_list .btn-group button {
    border: none;
    background: none;
    box-shadow: none;
    text-shadow: none;
    padding: 0 4px;
    line-height: 1;
}

.box-section.org_users_list .btn-group .hd_red {
    color: #c00;
}

.box-section.org_users_list .btn-group .hd_red:hover {
    color: #ee0000;
}

.box-section.org_users_list .table-normal tbody td,
.box-section.org_users_list .table-normal thead td {
    border: none;
}

.orgchart_page .jstree-default .jstree-anchor {
    margin: 0 0 2px;
}

.orgchart_page .jstree-default .jstree-search {
    color: inherit;
    font-weight: normal;
    background: #f9ff54 !important;
    border-radius: 5px;
    padding: 0 5px;
}

.tab_organograma .crud_menu_container .input-with-submit .search_text {
    width: 250px;
    margin-top: 0;
}

.tab_organograma .crud_menu_container .input-with-submit button {
    right: 6px;
    top: 0;
}

.organizationsdet .core_content .box-header .nav>li>a {
    padding: 10px;
}

.box .box-header,
.box .box-footer {
    font-weight: 4;
    text-shadow: none;
}

.breadcrumbs {
    font-size: 12px;
}

.container.alert_area {
    padding: 0;
}

.alert-warning code {
    background-color: #f9f2de;
    color: #6d5817;
}

.crud_menu_container .from_to>[class*="col-"] {
    float: left;
}

.crud_menu_container .from_to>[class*="col-"]:nth-child(1) {
    padding: 4px 0 0 15px;
    width: 110px;
}

.crud_menu_container .from_to>[class*="col-"]:nth-child(2) {
    padding: 0 0 0 15px;
    width: 332px;
    margin-left: 0;
}

.crud_menu_container .from_to>[class*="col-"]:nth-child(3) {
    padding: 4px 0 0 15px;
    width: 56px;
    text-align: center;
}

.crud_menu_container .from_to>[class*="col-"]:nth-child(4) {
    padding: 0 0 0 15px;
    width: 332px;
}

.crud_menu_container .from_to>[class*="col-"]:nth-child(5) {
    padding: 0 0 0 15px;
    width: 96px;
    text-align: right;
}

.crud_menu_container .btn-toolbar .from_to:first-child {
    margin-bottom: 5px;
}


.box.proc_table {
    border-top: 0;
}

.orgchart_page.page-with-two-sidebar .content {
    margin-right: 320px;
}


.users_dismiss {
    background: #1a2229;
}


.sidebar .nav>li.users_dismiss>a {
    padding: 0;
}

.sidebar .nav>li.users_dismiss>a:not(:first-child) i {
    font-size: 20px;
}

.users_area_list .sidebar_header h4 {
    color: #889097;
    font-size: 12px;
    margin: 0;
}

.users_area_list .sidebar_header h2 {
    font-size: 16px;
    color: #fff;
    margin-top: 5px;
}


.user_info h2 .fa-shield {
    margin-left: 8px;
    color: #daa520;
}

.user_detail_panel .filters_list .detail_icon {
    color: #3fbdcb;
}


.user_detail_panel .filters_list>li {
    padding: 10px;
    overflow: auto;
}


.user_detail_panel .filters_list>li i {
    width: 24px;
    float: left;
    display: block;
    text-align: right;
    margin-top: 3px;
    color: #3FBDCB;
    margin-right: 8px !important;
}


.user_detail_panel .filters_list>li span {
    display: block;
    float: left;
    /* clear: right; */
    max-width: 230px;
}





.user_info .panel {
    background: #f0f3f4;
}


.orgchart_page .page_menu .navbar-right {
    margin-right: 0;
}

.orgchart_page .page_menu .navbar-form {
    padding: 0;
}


.orgchart_page .page_menu .navbar-form .form-group {
    position: relative;
}

.orgchart_page .page_menu .navbar-form .btn-search {
    top: 0;
    right: 0;
}


.orgchart_page .page_menu .navbar-form .form-group .form-control {
    border-color: #d7d7d7;
}


/*History Top*/
.history_top {
    padding-top: 4px;
}

.history_top .widget.widget-stats {
    margin-bottom: 9px;
}

.cb_proc_modal>h4 {
    color: #3fbdcb;
    margin-top: 0;
    border-bottom: 1px solid #3fbdcb;
    padding-bottom: 2px;
}

.cb_proc_modal dl dt {
    display: inline-block;
    width: 30%;
    text-align: right;
    padding: 2px;
    color: #3fbdcb;
}

.cb_proc_modal dl dd {
    display: inline-block;
    width: 68%;
    padding: 2px;
}

.cb_proc_modal .box {
    border: 1px solid #ddd;
    ackground: #f0f3f4;
    padding: 10px;
    border-radius: 4px;
}

.cb_proc_modal .hist_title {
    background: #3fbdcb;
    font-weight: 600;
    margin: -11px -11px 10px;
    color: #fff;
    padding: 10px;
    border: 1px solid #3fbdcb;
    border-radius: 4px 4px 0 0;
}

.cb_proc_modal .hist_desc {
    margin-bottom: 10px;
}

.cb_proc_modal .hist_list {
    padding-left: 30px;
    list-style-type: square;
}

.cb_proc_modal .hist_list li {
    margin-bottom: 5px;
}

.cb_proc_modal_2>h4 {
    color: #3fbdcb;
    margin-top: 0;
    border-bottom: 1px solid #3fbdcb;
    padding-bottom: 2px;
}

.cb_proc_modal_2 dl dt {
    display: inline-block;
    width: 30%;
    text-align: right;
    padding: 2px;
    color: #3fbdcb;
}

.cb_proc_modal_2>.box {
    border: 1px solid #ddd;
    padding: 10px;
    background: #f0f3f5;
}

.cb_proc_modal_2>.box:first-child {
    margin-top: 15px;
}

.cb_proc_modal_2>.box:not(:last-child) {
    margin-bottom: 15px;
}

.cb_proc_modal_2>.box>.box-content {
    padding-top: 5px;
}

.cb_proc_modal_2 dl {
    margin-bottom: 5px;
}

.cb_proc_modal_2 dl dt {
    display: inline-block;
    width: 40%;
    text-align: right;
    padding: 2px;
    color: #3fbdcb;
}

.cb_proc_modal_2 dl dd {
    display: inline-block;
    width: 58%;
    padding: 2px;
}

.cb_proc_modal_2 .hist_list {
    padding-left: 30px;
    list-style-type: square;
}

.cb_proc_modal_2 .hist_list li {
    margin-bottom: 5px;
}

.cb_proc_modal_2>.box>.box-content>.box {
    border: 1px solid #ddd;
    background: #fff;
}

.cb_proc_modal_2>.box>.box-content>.box>.box-header {
    padding: 5px 10px;
    background: #3fbdcb;
    color: #fff;
    margin: -1px;
}

.cb_proc_modal_2>.box>.box-content>.box>.box-content {
    padding: 10px;
}

.cb_proc_modal_2>.box>.box-content>.box>.box-content .table>thead>tr>th {
    border-bottom: 2px solid #3fbdcb !important;
}



.row.add_row {
    padding: 10px;
}

.row.add_row .btn.btn-success {
    width: 35px;
}

.row.add_row .add_text,
.row.add_row .add_number {
    padding-right: 15px;
}

.select2-selection__clear {
    font-size: 20px;
    color: #cc3e44;
}

.small_font {
    font-size: 12px;
}

.progress_doc_load {
    padding-top: 50px;
}

.m-r-50 {
    margin-right: 50px !important;
}

.m-r-60 {
    margin-right: 60px !important;
}

.m-r-70 {
    margin-right: 70px !important;
}

.m-r-80 {
    margin-right: 80px !important;
}

.m-r-90 {
    margin-right: 90px !important;
}

.m-r-100 {
    margin-right: 100px !important;
}

.m-r-110 {
    margin-right: 110px !important;
}

.m-r-120 {
    margin-right: 120px !important;
}

.m-r-130 {
    margin-right: 130px !important;
}

.extend_search .form-group {
    margin-bottom: 0;
}

.perc_1 {
    width: 1%
}

.perc_2 {
    width: 2%
}

.perc_3 {
    width: 3%
}

.perc_4 {
    width: 4%
}

.perc_5 {
    width: 5%
}

.perc_10 {
    width: 10%
}

.perc_15 {
    width: 15%
}

.perc_20 {
    width: 20%
}

.perc_25 {
    width: 25%
}

.perc_30 {
    width: 30%
}

.perc_33 {
    width: 33%
}

.perc_35 {
    width: 35%
}

.perc_40 {
    width: 40%
}

.perc_45 {
    width: 45%
}

.perc_50 {
    width: 50%
}

.perc_55 {
    width: 55%
}

.widget_small {
    border-radius: 3px;
    color: #fff;
    padding: 10px;
    overflow: hidden;
    margin-left: 10px;
}

.docsnew .nav-tabs.nav-tabs-inverse {
    background: #00606a;
}

/*ul[name="subtab"].nav > li.active > a {
    font-weight: bold;
}*/

/* nav tabs scrollbar */
/*ul[name="subtab"].nav-tabs::-webkit-scrollbar {
    height: 2px;
    border-radius: 20px;
}
ul[name="subtab"].nav-tabs::-webkit-scrollbar-track {
    box-shadow: inset 0 0 5px rgba(0, 0, 0, 0.05);
    border-radius: 10px;
}
ul[name="subtab"].nav-tabs::-webkit-scrollbar-thumb {
    background: rgba(0, 0, 0, 0.15);
    border-radius: 10px;
}
ul[name="subtab"].nav-tabs::-webkit-scrollbar-thumb:hover {
    background: rgba(0, 0, 0, 0.20);
}*/

/* nav tab override */
/*ul[name="subtab"].nav-tabs {
    background: none;
    border-bottom: 1px solid rgba(0, 0, 0, 0.2);
    border-radius: 0;
    overflow-x: auto;
}
ul[name="subtab"].nav-tabs > li.active > a,
ul[name="subtab"].nav-tabs > li > a,
ul[name="subtab"].nav-tabs > li.active > a:hover,
ul[name="subtab"].nav-tabs > li > a:hover,
ul[name="subtab"].nav-tabs > li.active > a:focus,
ul[name="subtab"].nav-tabs > li > a:focus {
    border: none;
    border-radius: 0;
    background-color: transparent;
    width: 100%;
    text-align: center;
    font-size: 13px;
    cursor: pointer;
}
ul[name="subtab"].nav-tabs > li > a,
ul[name="subtab"].nav-tabs > li > a:hover,
ul[name="subtab"].nav-tabs > li > a:focus {
    color: #242a30;
}
ul[name="subtab"].nav-tabs > li.active > a,
ul[name="subtab"].nav-tabs > li.active > a:hover,
ul[name="subtab"].nav-tabs > li.active > a:focus {
    color: white;
}*/

/*ul[name="subtab"].nav-tabs {*/
/*    background: none;*/
/*    border-top: 1px solid rgba(0, 0, 0, 0.2);*/
/*    border-bottom: 1px solid rgba(0, 0, 0, 0.2);*/
/*    border-radius: 0;*/
/*    overflow-x: auto;*/
/*}*/
/*ul[name="subtab"].nav-tabs > li.active > a,*/
/*ul[name="subtab"].nav-tabs > li > a,*/
/*ul[name="subtab"].nav-tabs > li.active > a:hover,*/
/*ul[name="subtab"].nav-tabs > li > a:hover,*/
/*ul[name="subtab"].nav-tabs > li.active > a:focus,*/
/*ul[name="subtab"].nav-tabs > li > a:focus {*/
/*    border: none;*/
/*    border-radius: 0;*/
/*    background-color: transparent;*/
/*    width: 100%;*/
/*    text-align: center;*/
/*    font-size: 13px;*/
/*    cursor: pointer;*/
/*}*/
/*ul[name="subtab"].nav-tabs > li > a,*/
/*ul[name="subtab"].nav-tabs > li > a:hover,*/
/*ul[name="subtab"].nav-tabs > li > a:focus {*/
/*    color: #242a30;*/
/*}*/
/*ul[name="subtab"].nav-tabs > li.active > a,*/
/*ul[name="subtab"].nav-tabs > li.active > a:hover,*/
/*ul[name="subtab"].nav-tabs > li.active > a:focus {*/
/*    color: white;*/
/*}*/

/*ul[name="subtab"].nav-tabs > li.active {*/
/*    background: #00A7BA;*/
/*}*/
/*ul[name="subtab"].nav-tabs > li.active > a {*/
/*    color: white;*/
/*}*/

/*ul[name="subtab"].nav-tabs > li {*/
/*    background: #E5E5E5;*/
/*    max-width: 148px;*/
/*    max-height: 40px;*/
/*}*/
/*ul[name="subtab"].nav-tabs > li > a {*/
/*    overflow: hidden;*/
/*    white-space: nowrap;*/
/*    text-overflow: ellipsis;*/
/*}*/


/*.nav.nav-tabs.nav-tabs-inverse>li>a,
.nav.nav-tabs.nav-tabs-inverse>li>a:focus,
.nav.nav-tabs.nav-tabs-inverse>li>a:hover,
.tab-overflow .nav-tabs-inverse .next-button>a,
.tab-overflow .nav-tabs-inverse .prev-button>a {
    background: #00606a;
}*/

.tab-pane-header {
    display: flex;
    justify-content: space-between;
    align-items: center;
    margin-bottom: 14px;
}

.tab-pane-header>h5 {
    margin: 0;
}

.tab-pane-header>div>i,
.tab-pane-header>div>i:hover {
    border: none;
    background: none;
    font-size: 18px;
    cursor: pointer;
}


.docsnew .form-horizontal .form-group {
    margin-right: -15px;
    margin-left: 0;
}

fieldset.form-group {
    padding: 0 16px;
}

.docsnew .doc-area {
    margin: 0;
}

.tiff_viewer canvas {
    max-width: 100%;
}

/*
 * qTip2 - Pretty powerful tooltips - v3.0.3
 * http://qtip2.com
 *
 * Copyright (c) 2017
 * Released under the MIT licenses
 * http://jquery.org/license
 *
 * Date: Mon Aug 28 2017 01:19 EDT-0400
 * Plugins: None
 * Styles: core css3
 */
.qtip {
    position: absolute;
    left: -28000px;
    top: -28000px;
    display: none;

    max-width: 280px;
    min-width: 50px;

    font-size: 10.5px;
    line-height: 12px;

    direction: ltr;

    box-shadow: none;
    padding: 0;
}

.qtip-content {
    position: relative;
    padding: 5px 9px;
    overflow: hidden;

    text-align: left;
    word-wrap: break-word;
}

.qtip-titlebar {
    position: relative;
    padding: 5px 35px 5px 10px;
    overflow: hidden;

    border-width: 0 0 1px;
    font-weight: bold;
}

.qtip-titlebar+.qtip-content {
    border-top-width: 0 !important;
}

/* Default close button class */
.qtip-close {
    position: absolute;
    right: -9px;
    top: -9px;
    z-index: 11;
    /* Overlap .qtip-tip */

    cursor: pointer;
    outline: medium none;

    border: 1px solid transparent;
}

.qtip-titlebar .qtip-close {
    right: 4px;
    top: 50%;
    margin-top: -9px;
}

* html .qtip-titlebar .qtip-close {
    top: 16px;
}

/* IE fix */

.qtip-titlebar .ui-icon,
.qtip-icon .ui-icon {
    display: block;
    text-indent: -1000em;
    direction: ltr;
}

.qtip-icon,
.qtip-icon .ui-icon {
    -moz-border-radius: 3px;
    -webkit-border-radius: 3px;
    border-radius: 3px;
    text-decoration: none;
}

.qtip-icon .ui-icon {
    width: 18px;
    height: 14px;

    line-height: 14px;
    text-align: center;
    text-indent: 0;
    font: normal bold 10px/13px Tahoma, sans-serif;

    color: inherit;
    background: transparent none no-repeat -100em -100em;
}

/* Applied to 'focused' tooltips e.g. most recently displayed/interacted with */
.qtip-focus {}

/* Applied on hover of tooltips i.e. added/removed on mouseenter/mouseleave respectively */
.qtip-hover {}

/* Default tooltip style */
.qtip-default {
    border: 1px solid #F1D031;

    background-color: #FFFFA3;
    color: #555;
}

.qtip-default .qtip-titlebar {
    background-color: #FFEF93;
}

.qtip-default .qtip-icon {
    border-color: #CCC;
    background: #F1F1F1;
    color: #777;
}

.qtip-default .qtip-titlebar .qtip-close {
    border-color: #AAA;
    color: #111;
}


.qtip-shadow {
    -webkit-box-shadow: 1px 1px 3px 1px rgba(0, 0, 0, 0.15);
    -moz-box-shadow: 1px 1px 3px 1px rgba(0, 0, 0, 0.15);
    box-shadow: 1px 1px 3px 1px rgba(0, 0, 0, 0.15);
}

/* Add rounded corners to your tooltips in: FF3+, Chrome 2+, Opera 10.6+, IE9+, Safari 2+ */
.qtip-rounded,
.qtip-tipsy,
.qtip-bootstrap {
    -moz-border-radius: 5px;
    -webkit-border-radius: 5px;
    border-radius: 5px;
}

.qtip-rounded .qtip-titlebar {
    -moz-border-radius: 4px 4px 0 0;
    -webkit-border-radius: 4px 4px 0 0;
    border-radius: 4px 4px 0 0;
}

/* Youtube tooltip style */
.qtip-youtube {
    -moz-border-radius: 2px;
    -webkit-border-radius: 2px;
    border-radius: 2px;

    -webkit-box-shadow: 0 0 3px #333;
    -moz-box-shadow: 0 0 3px #333;
    box-shadow: 0 0 3px #333;

    color: white;
    border: 0 solid transparent;

    background: #4A4A4A;
    background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #4A4A4A), color-stop(100%, black));
    background-image: -webkit-linear-gradient(top, #4A4A4A 0, black 100%);
    background-image: -moz-linear-gradient(top, #4A4A4A 0, black 100%);
    background-image: -ms-linear-gradient(top, #4A4A4A 0, black 100%);
    background-image: -o-linear-gradient(top, #4A4A4A 0, black 100%);
}

.qtip-youtube .qtip-titlebar {
    background-color: #4A4A4A;
    background-color: rgba(0, 0, 0, 0);
}

.qtip-youtube .qtip-content {
    padding: .75em;
    font: 12px arial, sans-serif;

    filter: progid:DXImageTransform.Microsoft.Gradient(GradientType=0, StartColorStr=#4a4a4a, EndColorStr=#000000);
    -ms-filter: "progid:DXImageTransform.Microsoft.Gradient(GradientType=0,StartColorStr=#4a4a4a,EndColorStr=#000000);";
}

.qtip-youtube .qtip-icon {
    border-color: #222;
}

.qtip-youtube .qtip-titlebar .ui-state-hover {
    border-color: #303030;
}


/* jQuery TOOLS Tooltip style */
.qtip-jtools {
    background: #232323;
    background: rgba(0, 0, 0, 0.7);
    background-image: -webkit-gradient(linear, left top, left bottom, from(#717171), to(#232323));
    background-image: -moz-linear-gradient(top, #717171, #232323);
    background-image: -webkit-linear-gradient(top, #717171, #232323);
    background-image: -ms-linear-gradient(top, #717171, #232323);
    background-image: -o-linear-gradient(top, #717171, #232323);

    border: 2px solid #ddd;
    border: 2px solid rgba(241, 241, 241, 1);

    -moz-border-radius: 2px;
    -webkit-border-radius: 2px;
    border-radius: 2px;

    -webkit-box-shadow: 0 0 12px #333;
    -moz-box-shadow: 0 0 12px #333;
    box-shadow: 0 0 12px #333;
}

/* IE Specific */
.qtip-jtools .qtip-titlebar {
    background-color: transparent;
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171, endColorstr=#4A4A4A);
    -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#717171,endColorstr=#4A4A4A)";
}

.qtip-jtools .qtip-content {
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A, endColorstr=#232323);
    -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#4A4A4A,endColorstr=#232323)";
}

.qtip-jtools .qtip-titlebar,
.qtip-jtools .qtip-content {
    background: transparent;
    color: white;
    border: 0 dashed transparent;
}

.qtip-jtools .qtip-icon {
    border-color: #555;
}

.qtip-jtools .qtip-titlebar .ui-state-hover {
    border-color: #333;
}


/* Cluetip style */
.qtip-cluetip {
    -webkit-box-shadow: 4px 4px 5px rgba(0, 0, 0, 0.4);
    -moz-box-shadow: 4px 4px 5px rgba(0, 0, 0, 0.4);
    box-shadow: 4px 4px 5px rgba(0, 0, 0, 0.4);

    background-color: #D9D9C2;
    color: #111;
    border: 0 dashed transparent;
}

.qtip-cluetip .qtip-titlebar {
    background-color: #87876A;
    color: white;
    border: 0 dashed transparent;
}

.qtip-cluetip .qtip-icon {
    border-color: #808064;
}

.qtip-cluetip .qtip-titlebar .ui-state-hover {
    border-color: #696952;
    color: #696952;
}


/* Tipsy style */
.qtip-tipsy {
    background: black;
    background: rgba(0, 0, 0, .87);

    color: white;
    border: 0 solid transparent;

    font-size: 11px;
    font-family: 'Lucida Grande', sans-serif;
    font-weight: bold;
    line-height: 16px;
    text-shadow: 0 1px black;
}

.qtip-tipsy .qtip-titlebar {
    padding: 6px 35px 0 10px;
    background-color: transparent;
}

.qtip-tipsy .qtip-content {
    padding: 6px 10px;
}

.qtip-tipsy .qtip-icon {
    border-color: #222;
    text-shadow: none;
}

.qtip-tipsy .qtip-titlebar .ui-state-hover {
    border-color: #303030;
}


/* Tipped style */
.qtip-tipped {
    border: 3px solid #959FA9;

    -moz-border-radius: 3px;
    -webkit-border-radius: 3px;
    border-radius: 3px;

    background-color: #F9F9F9;
    color: #454545;

    font-weight: normal;
    font-family: serif;
}

.qtip-tipped .qtip-titlebar {
    border-bottom-width: 0;

    color: white;
    background: #3A79B8;
    background-image: -webkit-gradient(linear, left top, left bottom, from(#3A79B8), to(#2E629D));
    background-image: -webkit-linear-gradient(top, #3A79B8, #2E629D);
    background-image: -moz-linear-gradient(top, #3A79B8, #2E629D);
    background-image: -ms-linear-gradient(top, #3A79B8, #2E629D);
    background-image: -o-linear-gradient(top, #3A79B8, #2E629D);
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8, endColorstr=#2E629D);
    -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#3A79B8,endColorstr=#2E629D)";
}

.qtip-tipped .qtip-icon {
    border: 2px solid #285589;
    background: #285589;
}

.qtip-tipped .qtip-icon .ui-icon {
    background-color: #FBFBFB;
    color: #555;
}


/**
 * Twitter Bootstrap style.
 *
 * Tested with IE 8, IE 9, Chrome 18, Firefox 9, Opera 11.
 * Does not work with IE 7.
 */
.qtip-bootstrap {
    /** Taken from Bootstrap body */
    font-size: 14px;
    line-height: 20px;
    color: #333333;

    /** Taken from Bootstrap .popover */
    padding: 1px;
    background-color: #ffffff;
    border: 1px solid #ccc;
    border: 1px solid rgba(0, 0, 0, 0.2);
    -webkit-border-radius: 6px;
    -moz-border-radius: 6px;
    border-radius: 6px;
    -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
    -moz-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
    box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
    -webkit-background-clip: padding-box;
    -moz-background-clip: padding;
    background-clip: padding-box;
}

.qtip-bootstrap .qtip-titlebar {
    /** Taken from Bootstrap .popover-title */
    padding: 8px 14px;
    margin: 0;
    font-size: 14px;
    font-weight: normal;
    line-height: 18px;
    background-color: #f7f7f7;
    border-bottom: 1px solid #ebebeb;
    -webkit-border-radius: 5px 5px 0 0;
    -moz-border-radius: 5px 5px 0 0;
    border-radius: 5px 5px 0 0;
}

.qtip-bootstrap .qtip-titlebar .qtip-close {
    /**
     * Overrides qTip2:
     * .qtip-titlebar .qtip-close{
     *   [...]
     *   right: 4px;
     *   top: 50%;
     *   [...]
     *   border-style: solid;
     * }
     */
    right: 11px;
    top: 45%;
    border-style: none;
}

.qtip-bootstrap .qtip-content {
    /** Taken from Bootstrap .popover-content */
    padding: 9px 14px;
}

.qtip-bootstrap .qtip-icon {
    /**
     * Overrides qTip2:
     * .qtip-default .qtip-icon {
     *   border-color: #CCC;
     *   background: #F1F1F1;
     *   color: #777;
     * }
     */
    background: transparent;
}

.qtip-bootstrap .qtip-icon .ui-icon {
    /**
     * Overrides qTip2:
     * .qtip-icon .ui-icon{
     *   width: 18px;
     *   height: 14px;
     * }
     */
    width: auto;
    height: auto;

    /* Taken from Bootstrap .close */
    float: right;
    font-size: 20px;
    font-weight: bold;
    line-height: 18px;
    color: #000000;
    text-shadow: 0 1px 0 #ffffff;
    opacity: 0.2;
    filter: alpha(opacity=20);
}

.qtip-bootstrap .qtip-icon .ui-icon:hover {
    /* Taken from Bootstrap .close:hover */
    color: #000000;
    text-decoration: none;
    cursor: pointer;
    opacity: 0.4;
    filter: alpha(opacity=40);
}


/* IE9 fix - removes all filters */
.qtip:not(.ie9haxors) div.qtip-content,
.qtip:not(.ie9haxors) div.qtip-titlebar {
    filter: none;
    -ms-filter: none;
}

/* Global Spinner Transparent */
#page-loader.fade.in.transparent_spinner {
    background: #e6e8ec30;
    opacity: 0.8;
    z-index: 99999999;
}

/* Go back to blue */
.form-control:focus {
    border: 2px solid #66afe9;
}

.doc_content_row {
    padding-left: 20px;
    padding-right: 20px;
}
.cards-list > .dropdown-item {
    width: 180px;
    background-color: white;
    margin-right: 16px;
    border-radius: 8px;
}
li.dropdown-item>ul.menu-item {
    display: none;
    position: absolute;
    top: 0;
}

li.dropdown-item:hover>ul.menu-item {
    display: block;
    right: -103px;
    left: unset;
    text-align: right;
}

li.dropdown-toggle>ul.menu-item {
    display: none;
    position: absolute;
}

li.dropdown-toggle:hover>ul.menu-item {
    display: block;
}

ul.options-list {
    list-style: none;
    margin: 0;
    padding: 0;
}

@media screen and (max-width: 735px) {
    li.dropdown-item>i.fa-angle-left {
        display: inline;
    }

    li.dropdown-item>i.fa-angle-right {
        display: none;
    }

    li.dropdown-item:hover>ul.menu-item {
        right: unset;
        left: -103px;
    }
}

@media screen and (min-width: 621px) {
    li.dropdown-item>i.fa-angle-left {
        display: none;
    }

    li.dropdown-item>i.fa-angle-right {
        display: inline;
    }

    li.dropdown-item:hover>ul.menu-item {
        right: -103px;
        left: unset;
        text-align: left;
    }
}

.container-tabs {
    overflow-y: auto;
    max-height: 700px;
}

.container-tabs::-webkit-scrollbar {
    width: 5px; /* Largura da barra de rolagem personalizada */
}

.container-tabs::-webkit-scrollbar-thumb {
    background-color: transparent; /* Cor da alça da barra de rolagem */
}

.hide-y-bar::-webkit-scrollbar {
    display: none;
}

/* Hide scrollbar for IE and Edge */
.hide-y-bar {
    -ms-overflow-style: none;
}

/* Hide scrollbar for Firefox */
.hide-y-bar {
    scrollbar-width: none;
}

/* .show-scroll{
    overflow-y: scroll !important;
    scroll-behavior: smooth !important;
} */
.show-scroll::-webkit-scrollbar {
    width: 15px;
}

.show-scroll::-webkit-scrollbar-track {
    background: #f2f2f6;
}

.show-scroll::-webkit-scrollbar-thumb {
    border-radius: 10px;
    background-color: var(--color-neutral-dark);
    border: 3px solid #f2f2f6;
}

.scroll-arrow{
    color: var(--color-neutral-dark);
    font-size: 40px
}

/*
.docdet .link_menu.dropdown-menu {
    position: relative;
    margin: 32px 0 0 -162px;
} */

.qtip.hd_info {
    font-size: 10px;
}

.select2-container.select2-container--default.select2-container--open {
    z-index: inherit;
}

.search_oper {
    width: 18% !important;
    margin-top: -2px;
}

.search_field {
    width: 82% !important;
;
}

.icon-move {
    cursor: move;
}

.btn-bar-right {
    padding: 0;
}

.ac_docs.ac_results .panel-heading-btn {
    padding-left: 15px;
}

.ac_docs.ac_results .panel-heading {
    border-bottom: 1px solid #cccccc;
}

.aggreate_documents.panel-default>.panel-body {
    min-height: 0px !important;
}

.result_checkbox {
    padding-top: 8px !important;
}

.row.detail_search_row {
    border-left: 3px solid #797979;
}

.row .detail_search_item {
    text-align: left;
}

.proc_data .panel-heading {
    /* max-height: 40px; */
}

.proc_data .nav-tabs {
    background: #1db4c400;
    border-bottom: none;
}

.proc_data .panel-heading .nav-tabs {
    margin-top: 1px;
    margin-right: -15px;
}

.proc_data.panel-default>.panel-heading {
    background: #ffffff;
    border-bottom: 1px solid #00000000;
}

.proc_data .nav-tabs>li.active>a {
    border: solid 2px #0056B4;
    border-radius: 8px;
    color: #0056B4;
    background-color:  #E0EAFF;
    height: 100%;
}

.row .form_row {
    padding-bottom: 16px;
}

.select2-search__field {
    width: 100% !important;
}

/*.extend_search .form-group {width:24%;}*/
/*.extend_search .form-group:first-child {float:left;}*/
/*.extend_search .form-group input {width:100% !important;}*/
/*.extend_search .form-group .input-group input {width:121% !important;}*/
/*.extend_search .form-group select {width:100% !important;}*/
/*.extend_search .form-group .select2-container {width:100% !important;}*/
/*.extend_search .form-group.tags_container .select2-container {width:98% !important;}*/

.full-width {
    width: 100%;
}

.width30 {
    width: 30px;
}

.width40 {
    width: 40px;
}

.width50 {
    width: 50px;
}

@media (max-width: 500px) {
    .extend_search.theme-panel {
        width: 100%;
        right: -100%;
    }

    .extend_search.theme-panel.active {
        right: 0;
    }
}

@media (min-width: 501px) {
    .extend_search.theme-panel {
        width: 500px;
        right: -500px;
    }

    .extend_search.theme-panel.active {
        right: 0;
    }
}

.extend_search .input-group-addon {
    padding: 0;
    font-size: 14px;
    font-weight: 4;
    line-height: 1;
    color: #555;
    text-align: center;
    background-color: transparent;
    border: 0;
    border-radius: 0;
}

.extend_search .input-group-addon {
    width: 20%;
    white-space: nowrap;
    vertical-align: middle;
}

.extend_search .input-group {
    width: 100%;
}

.theme-panel.extend_search.active {
    overflow-y: scroll;
    max-height: 700px;
}

.elipsis {
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}

.theme-panel.extend_search.active {
    max-height: 500px;
    overflow-y: scroll;
}

.status-group,
.status-group-vertical {
    position: relative;
    display: inline-flex;
    vertical-align: middle;
    float: right;
}

.upload_icon {
    animation: spin 2s linear infinite;
}

@keyframes spin {
    0% {
        transform: rotate(0deg);
    }

    100% {
        transform: rotate(360deg);
    }
}

.modal_history .modal-dialog {
    width: 1000px;
}

.modal-open {
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    z-index: 1050;
    position: fixed;
    display: block;
    overflow: hidden;
    outline: 0;
}

.modal_history .history_timeline {
    margin-top: 10px;
}

.timeline>li+li {
    margin-top: 0;
}

.modal_history .group_table {
    border: #aaa 1px solid;
}

.modal_history .group_table .nav.nav-tabs {
    background: #c1ccd1;
    -webkit-border-radius: 0;
    -moz-border-radius: 0;
    border-radius: 0;
}



.pagination li a.active {
    background: #E0EAFF;
    color: #0056B4;
    border: 1px solid #0056B4;
    border-radius: 4px;
}


.theme-panel.extend_search.active .theme-collapse-btn {
    position: absolute;
    left: 215px;
    margin-top: -15px;
    width: 30px;
    height: 30px;
    line-height: 30px;
    font-size: 18px;
    color: #151414;
    /*background: #fff;*/
    border-radius: 4px 0 0 4px;
    text-align: center;
    box-shadow: 0 0 0 0;
    -webkit-box-shadow: 0 0 0 0;
    -moz-box-shadow: 0 0 0 0;
    z-index: 20;
    display: none;
}

.theme-panel.extend_search.active .theme-collapse-btn .btn-panel-text {
    display: none;
}

.theme-panel.extend_search .btn-panel {
    /*transform: rotate(-90deg);*/
    color: #fff;
    background-color: #a00000;
    border-radius: 50rem !important
}

.pnl_search .theme-panel.extend_search.active .btn-panel {
    color: #000000;
    border-radius: 50rem !important;
    background-color: white;
    margin-left: -3px;
    margin-top: 35px;
    margin-right: -50px;
}

.theme-panel.extend_search.active .btn-panel {
    color: #000000;
    border-radius: 50rem !important;
    background-color: white;
    margin-left: -3px;
    margin-top: 35px;
}

.theme-panel.extend_search.active .btn-panel-mobile {
    color: #000000;
    border-radius: 50rem !important;
    background-color: white;
    margin-left: 155px;
    margin-top: 45px;
}

/*
.theme-panel.extend_search.active .btn-panel {
    color: #000000;
    border-radius: 50rem!important;
    background-color: white;
    margin-left: 25px;
}
*/

/*.theme-panel.extend_search.active span {*/
/*    display: none;*/
/*}*/

.advanced-search .dismiss-btn {
    top: -60px;
}

.advanced-search .input-group-addon {
    background: #151414;
    padding: 0;
    border: none;
}

.advanced-search .search_filters .row {
    margin-left: 0;
}

.advanced-search .oper-select {
    width: 40px;
    padding: 0;
    color: #0c0c0c;
}

.advanced-search .advanced-select {
    padding: 0;
    color: #0c0c0c;
}

.advanced-search .search_filters .row {
    width: 99%;
}

.panel.proc_available .panel-heading {
    min-height: 55px;
}

.proc_available .panel-heading-btn .widget-control {
    border-radius: 15px;
    margin-top: -4px;
    color: #66afe9;
}

.proc_available .panel-heading-btn .widget-control:focus {
    border: 2px solid #9aa9b2;
    -webkit-box-shadow: none;
    box-shadow: none;
    outline: none;
    color: #0c0c0c;
}

.btn-group.process-toolbar {
    float: right;
    top: -20px;
}

.process-list .list-email>li.list-group-item {
    -webkit-border-radius: 0;
    -moz-border-radius: 0;
    border-radius: 0;
    border: none;
    padding: 15px 15px 0 20px;
    position: relative;
}


.list-email .email-time {
    float: right;
    font-size: 11px;
    color: #C8CCCF;
    margin-left: 10px;
    text-align: center;
}

.list-email .email-time {
    float: right;
    font-size: 11px;
    color: #797979;
    margin-left: 10px;
    text-align: center;
}

.panel-title .selected_docs {
    margin-top: -6px;
}

.panel-title .selected_docs .agg_title {
    font-weight: 600;
    font-size: 11px;
    padding-right: 5px;
}

.panel-title .selected_docs .widget-control.input-sm {
    width: 70px;
    font-weight: 300;
    font-size: 11px;
    color: black;
}

.box-search .panel-title .selected_docs .widget-control.input-sm {
    width: 170px;
    font-weight: 300;
    font-size: 11px;
    color: black;
}

.panel-title .selected_docs .label.label-warning {
    padding: 7px;
    margin-left: 10px;
}

.panel-title .allowAssignToBox {
    margin-left: 5px;
    margin-top: -1px;
}

.panel-title .warehouse_select {
    float: right;
    width: 300px;
    margin-top: -7px;
    margin-right: 10px;
}


.widget-control-mobile {
    border-radius: 30px;
    margin-left: 20px;
    color: #0c0c0c;
}

.widget-control-mobile:focus {
    border: 2px solid #66afe9;
    -webkit-box-shadow: none;
    box-shadow: none;
    outline: none;
    color: #0c0c0c;
}


.mobile-panel-heading-button {
    margin-left: 5px;
    margin-top: -1px;
}

.mobile-panel-heading-collapse {
    margin-top: 5px;
    margin-left: 7px;
    border-bottom: none;
    -webkit-box-shadow: none;
}

.mobile-panel-heading-button-font {
    font-size: 100%;
}

.mobile-panel-heading-icon {
    margin-right: 0 !important;
}

.no-display {
    display: none;
}

.adhoc-dropdown {
    min-width: 20px;
}

.adhoc-dropdown-section {
    left: 0 !important;
}

.adhoc-dropdown-font-color {
    color: #242a30;
}

.adhoc-dropdown-info {
    margin-right: 5px;
}

.adhoc-info-with-border {
    border-right: solid 1px black ;
    padding-right: 10px;
    padding-left: 10px;
}

.adhoc-info-without-border {
    padding-right: 10px;
    padding-left: 10px;
}

.adhoc-date-label {
    margin-left: 0;
    margin-bottom: 8px;
}

.modal_history .modal-dialog-mobile {
    width: initial;
}

#sidebar-right-container {
    width: 100vw;
    height: 100vh;
    position: fixed;
    top: 0;
    left: 0;
    margin-right: 220px;
    display: none;
    transition: all .2s ease-in-out;
    z-index: 1000;
}

.sidebar-btn {
    position: absolute;
    top: 55px;
    right: 20px;

    color: #2d353c;

    z-index: 1001;
    transition: all .2s ease-in-out;
    user-select: none;
}

.sidebar-btn:hover {
    color: #2d353f;
}

.sidebar-btn--white {
    color: white;
}

.sidebar-btn--white:hover {
    color: #eee;
}

.sidebar-right {
    width: var(--sidebar-width);
    height: 100%;
    position: absolute;
    right: 0;
    top: 0;
    bottom: 0;
    padding-top: 50px;

    background: #2d353c;

    z-index: 9;
    transition: transform 0.2s ease-in-out;
    transform: translateX(0px);
    -webkit-transform: translateX(0px);
    -moz-transform: translateX(0px);
    -o-transform: translateX(0px);
}

.sidebar-bg-right {
    width: var(--sidebar-width);
    position: fixed;
    background: #2d353c;
    top: 0;
    right: 0;
    bottom: 0;
    transition: transform 0.2s ease-in-out;
    transform: translateX(0px);
    -webkit-transform: translateX(0px);
    -moz-transform: translateX(0px);
    -o-transform: translateX(0px);
}

.btn-fixed {
    position: fixed;
    top: 13px;
}

.btn-round:hover {
    color: #fff;
    background: #0056B4;
    background-color: #0056b3;
    box-shadow: 0 4px 8px rgba(0, 0, 0, 0.2);
    transform: scale(1.1);
}

.btn-round {
    color: #fff;
    background: #0056B4;
    border-radius: 50%;
    width: 50px;
    height: 50px;
    display: flex;
    align-items: center;
    justify-content: center;
    border: none;
}

.sidebar-right--mobile {
    padding-top: 0px;
    z-index: 1001;
}

.sidebar-right--hidden {
    transform: translateX(var(--sidebar-width));
}

.without-scroll {
    /* overflow: hidden;
    position: fixed; */
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    display: block;
}

.docdet-player {
    margin-left: -14px;
}

.docsnew-player {
    margin-left: 10px;
}

.hist_canvas .history_toolbar {
    float: right;
    margin: 5px !important;
}

/*
Animated skeleton screen using CSS.
Create shapes using gradients that simulate solids.
Use `:empty` pseduo-class to show skeleton screen background only while container has no content (ex: for the "loading" state). When content is added to the container element, the pseudo-class selector won't match anymore and the skeleton screen will be removed automatically; no need to toggle a separate class on the container.
See: https://developer.mozilla.org/en-US/docs/Web/CSS/:empty
Animating one layer of the background which is a tilted linear gradient with white in the middle to achieve shine effect.
*/
.demo:empty {
    float: left;
    margin: auto;
    width: 500px;
    height: 300px;
    /* change height to see repeat-y behavior */

    background-image:
            radial-gradient(circle 50px at 50px 50px, lightgray 99%, transparent 0),
            linear-gradient(100deg, rgba(255, 255, 255, 0), rgba(255, 255, 255, 0.5) 50%, rgba(255, 255, 255, 0) 80%),
            linear-gradient(lightgray 20px, transparent 0),
            linear-gradient(lightgray 20px, transparent 0),
            linear-gradient(lightgray 20px, transparent 0),
            linear-gradient(lightgray 20px, transparent 0);

    background-repeat: repeat-y;

    background-size:
            100px 200px,
                /* circle */
            50px 200px,
                /* highlight */
            150px 200px,
            350px 200px,
            300px 200px,
            250px 200px;

    background-position:
            0 0,
                /* circle */
            0 0,
                /* highlight */
            120px 0,
            120px 40px,
            120px 80px,
            120px 120px;

    animation: shine 1s infinite;
}

@keyframes shine {
    to {
        background-position:
                10px 0,
                100% 0,
                    /* move highlight to right */
                120px 0,
                120px 40px,
                120px 80px,
                120px 120px;
    }
}

.table-qtyBox {
    border: none;
    margin-left: 5px;
}

.table-qtyBox-input {
    max-width: 280px;
}

/* line 63, /home/andrei/core-admin-release/core-admin/source/stylesheets/base.scss */
.padded {
    padding: 15px;
}

/* line 67, /home/andrei/core-admin-release/core-admin/source/stylesheets/base.scss */
.nopadding {
    padding: 0;
}

/* line 71, /home/andrei/core-admin-release/core-admin/source/stylesheets/base.scss */
.hpadded {
    padding-left: 15px;
    padding-right: 15px;
}

/* line 76, /home/andrei/core-admin-release/core-admin/source/stylesheets/base.scss */
.vpadded {
    padding-top: 15px;
    padding-bottom: 15px;
}

.hmargin-left {
    margin-left: 15px;
}

.vpadded-top {
    padding-top: 15px;
}

.vpadded-bottom {
    padding-bottom: 15px;
}

.loading_spinner {
    height: 20px;
    width: 20px;
    margin: 0px auto;
    position: absolute;
    top: 50%;
    left: 40%;
    margin: -10px 0 0 0;
    /*border: 2px solid #fff;*/
    /*border-top: 2px solid #24B498;*/
    /*border-radius: 100%;*/
}

/* kaushan-script-regular - latin */
@font-face {
    font-family: 'Kaushan Script';
    font-style: normal;
    font-weight: 4;
    src: url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.eot');
    /* IE9 Compat Modes */
    src: local(''),
    url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.eot?#iefix') format('embedded-opentype'),
        /* IE6-IE8 */
    url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.woff2') format('woff2'),
        /* Super Modern Browsers */
    url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.woff') format('woff'),
        /* Modern Browsers */
    url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.ttf') format('truetype'),
        /* Safari, Android, iOS */
    url('/resources/fonts/cursive/kaushan-script-v9-latin-regular.svg#KaushanScript') format('svg');
    /* Legacy iOS */
}

.kaushan {
    font-family: "Kaushan Script";
    font-weight: 4;
    font-style: normal;
    font-size: 30px;
}


/* allura-regular - latin */
@font-face {
    font-family: 'Allura';
    font-style: normal;
    font-weight: 4;
    src: url('/resources/fonts/cursive/allura-v9-latin-regular.eot');
    /* IE9 Compat Modes */
    src: local(''),
    url('/resources/fonts/cursive/allura-v9-latin-regular.eot?#iefix') format('embedded-opentype'),
        /* IE6-IE8 */
    url('/resources/fonts/cursive/allura-v9-latin-regular.woff2') format('woff2'),
        /* Super Modern Browsers */
    url('/resources/fonts/cursive/allura-v9-latin-regular.woff') format('woff'),
        /* Modern Browsers */
    url('/resources/fonts/cursive/allura-v9-latin-regular.ttf') format('truetype'),
        /* Safari, Android, iOS */
    url('/resources/fonts/cursive/allura-v9-latin-regular.svg#Allura') format('svg');
    /* Legacy iOS */
}

.allura {
    font-family: Allura;
    font-weight: 4;
    font-style: normal;
    font-size: 30px;
}

/* dancing-script-regular - latin */
@font-face {
    font-family: 'Dancing Script';
    font-style: normal;
    font-weight: 4;
    src: url('/resources/fonts/cursive/dancing-script-v16-latin-regular.eot');
    /* IE9 Compat Modes */
    src: local(''),
    url('/resources/fonts/cursive/dancing-script-v16-latin-regular.eot?#iefix') format('embedded-opentype'),
        /* IE6-IE8 */
    url('/resources/fonts/cursive/dancing-script-v16-latin-regular.woff2') format('woff2'),
        /* Super Modern Browsers */
    url('/resources/fonts/cursive/dancing-script-v16-latin-regular.woff') format('woff'),
        /* Modern Browsers */
    url('/resources/fonts/cursive/dancing-script-v16-latin-regular.ttf') format('truetype'),
        /* Safari, Android, iOS */
    url('/resources/fonts/cursive/dancing-script-v16-latin-regular.svg#DancingScript') format('svg');
    /* Legacy iOS */
}

.dancing {
    font-family: "Dancing Script";
    font-weight: 4;
    font-style: normal;
    font-size: 30px;
}

/* great-vibes-regular - latin */
@font-face {
    font-family: 'Great Vibes';
    font-style: normal;
    font-weight: 4;
    src: url('/resources/fonts/cursive/great-vibes-v8-latin-regular.eot');
    /* IE9 Compat Modes */
    src: local(''),
    url('/resources/fonts/cursive/great-vibes-v8-latin-regular.eot?#iefix') format('embedded-opentype'),
        /* IE6-IE8 */
    url('/resources/fonts/cursive/great-vibes-v8-latin-regular.woff2') format('woff2'),
        /* Super Modern Browsers */
    url('/resources/fonts/cursive/great-vibes-v8-latin-regular.woff') format('woff'),
        /* Modern Browsers */
    url('/resources/fonts/cursive/great-vibes-v8-latin-regular.ttf') format('truetype'),
        /* Safari, Android, iOS */
    url('/resources/fonts/cursive/great-vibes-v8-latin-regular.svg#GreatVibes') format('svg');
    /* Legacy iOS */
}

.sig_box {
    width: 500px;
    text-align: center;
    user-select: auto;
}

.vibes {
    font-family: "Great Vibes";
    font-weight: 4;
    font-style: normal;
    font-size: 30px;
}

/* tangerine-700 - latin */
@font-face {
    font-family: 'Tangerine';
    font-style: normal;
    font-weight: 700;
    src: url('/resources/fonts/cursive/tangerine-v12-latin-700.eot');
    /* IE9 Compat Modes */
    src: local(''),
    url('/resources/fonts/cursive/tangerine-v12-latin-700.eot?#iefix') format('embedded-opentype'),
        /* IE6-IE8 */
    url('/resources/fonts/cursive/tangerine-v12-latin-700.woff2') format('woff2'),
        /* Super Modern Browsers */
    url('/resources/fonts/cursive/tangerine-v12-latin-700.woff') format('woff'),
        /* Modern Browsers */
    url('/resources/fonts/cursive/tangerine-v12-latin-700.ttf') format('truetype'),
        /* Safari, Android, iOS */
    url('/resources/fonts/cursive/tangerine-v12-latin-700.svg#Tangerine') format('svg');
    /* Legacy iOS */
}

.tangerine {
    font-family: "Great Vibes";
    font-weight: 700;
    font-style: normal;
    font-size: 30px;
}

/*!
     * Datetimepicker for Bootstrap 3
     * version : 4.17.47
     * https://github.com/Eonasdan/bootstrap-datetimepicker/
     */
.bootstrap-datetimepicker-widget {
    list-style: none;
}

.bootstrap-datetimepicker-widget.dropdown-menu {
    display: block;
    margin: 2px 0;
    padding: 4px;
    width: 19em;
}

@media (min-width: 768px) {
    .bootstrap-datetimepicker-widget.dropdown-menu.timepicker-sbs {
        width: 38em;
    }
}

@media (min-width: 992px) {
    .bootstrap-datetimepicker-widget.dropdown-menu.timepicker-sbs {
        width: 38em;
    }
}

@media (min-width: 1200px) {
    .bootstrap-datetimepicker-widget.dropdown-menu.timepicker-sbs {
        width: 38em;
    }
}

.bootstrap-datetimepicker-widget.dropdown-menu:before,
.bootstrap-datetimepicker-widget.dropdown-menu:after {
    content: '';
    display: inline-block;
    position: absolute;
}

.bootstrap-datetimepicker-widget.dropdown-menu.bottom:before {
    border-left: 7px solid transparent;
    border-right: 7px solid transparent;
    border-bottom: 7px solid #ccc;
    border-bottom-color: rgba(0, 0, 0, 0.2);
    top: -7px;
    left: 7px;
}

.bootstrap-datetimepicker-widget.dropdown-menu.bottom:after {
    border-left: 6px solid transparent;
    border-right: 6px solid transparent;
    border-bottom: 6px solid white;
    top: -6px;
    left: 8px;
}

.bootstrap-datetimepicker-widget.dropdown-menu.top:before {
    border-left: 7px solid transparent;
    border-right: 7px solid transparent;
    border-top: 7px solid #ccc;
    border-top-color: rgba(0, 0, 0, 0.2);
    bottom: -7px;
    left: 6px;
}

.bootstrap-datetimepicker-widget.dropdown-menu.top:after {
    border-left: 6px solid transparent;
    border-right: 6px solid transparent;
    border-top: 6px solid white;
    bottom: -6px;
    left: 7px;
}

.bootstrap-datetimepicker-widget.dropdown-menu.pull-right:before {
    left: auto;
    right: 6px;
}

.bootstrap-datetimepicker-widget.dropdown-menu.pull-right:after {
    left: auto;
    right: 7px;
}

.bootstrap-datetimepicker-widget .list-unstyled {
    margin: 0;
}

.bootstrap-datetimepicker-widget a[data-action] {
    padding: 6px 0;
}

.bootstrap-datetimepicker-widget a[data-action]:active {
    box-shadow: none;
}

.bootstrap-datetimepicker-widget .timepicker-hour,
.bootstrap-datetimepicker-widget .timepicker-minute,
.bootstrap-datetimepicker-widget .timepicker-second {
    width: 54px;
    font-weight: bold;
    font-size: 1.2em;
    margin: 0;
}

.bootstrap-datetimepicker-widget button[data-action] {
    padding: 6px;
}

.bootstrap-datetimepicker-widget .btn[data-action="incrementHours"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Increment Hours";
}

.bootstrap-datetimepicker-widget .btn[data-action="incrementMinutes"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Increment Minutes";
}

.bootstrap-datetimepicker-widget .btn[data-action="decrementHours"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Decrement Hours";
}

.bootstrap-datetimepicker-widget .btn[data-action="decrementMinutes"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Decrement Minutes";
}

.bootstrap-datetimepicker-widget .btn[data-action="showHours"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Show Hours";
}

.bootstrap-datetimepicker-widget .btn[data-action="showMinutes"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Show Minutes";
}

.bootstrap-datetimepicker-widget .btn[data-action="togglePeriod"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Toggle AM/PM";
}

.bootstrap-datetimepicker-widget .btn[data-action="clear"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Clear the picker";
}

.bootstrap-datetimepicker-widget .btn[data-action="today"]::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Set the date to today";
}

.bootstrap-datetimepicker-widget .picker-switch {
    text-align: center;
}

.bootstrap-datetimepicker-widget .picker-switch::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Toggle Date and Time Screens";
}

.bootstrap-datetimepicker-widget .picker-switch td {
    padding: 0;
    margin: 0;
    height: auto;
    width: auto;
    line-height: inherit;
}

.bootstrap-datetimepicker-widget .picker-switch td span {
    line-height: 2.5;
    height: 2.5em;
    width: 100%;
}

.bootstrap-datetimepicker-widget table {
    width: 100%;
    margin: 0;
}

.bootstrap-datetimepicker-widget table td,
.bootstrap-datetimepicker-widget table th {
    text-align: center;
    border-radius: 4px;
}

.bootstrap-datetimepicker-widget table th {
    height: 20px;
    line-height: 20px;
    width: 20px;
}

.bootstrap-datetimepicker-widget table th.picker-switch {
    width: 145px;
}

.bootstrap-datetimepicker-widget table th.disabled,
.bootstrap-datetimepicker-widget table th.disabled:hover {
    background: none;
    color: #777777;
    cursor: not-allowed;
}

.bootstrap-datetimepicker-widget table th.prev::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Previous Month";
}

.bootstrap-datetimepicker-widget table th.next::after {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
    content: "Next Month";
}

.bootstrap-datetimepicker-widget table thead tr:first-child th {
    cursor: pointer;
}

.bootstrap-datetimepicker-widget table thead tr:first-child th:hover {
    background: #eeeeee;
}

.bootstrap-datetimepicker-widget table td {
    height: 54px;
    line-height: 54px;
    width: 54px;
}

.bootstrap-datetimepicker-widget table td.cw {
    font-size: .8em;
    height: 20px;
    line-height: 20px;
    color: #777777;
}

.bootstrap-datetimepicker-widget table td.day {
    height: 20px;
    line-height: 20px;
    width: 20px;
}

.bootstrap-datetimepicker-widget table td.day:hover,
.bootstrap-datetimepicker-widget table td.hour:hover,
.bootstrap-datetimepicker-widget table td.minute:hover,
.bootstrap-datetimepicker-widget table td.second:hover {
    background: #eeeeee;
    cursor: pointer;
}

.bootstrap-datetimepicker-widget table td.old,
.bootstrap-datetimepicker-widget table td.new {
    color: #777777;
}

.bootstrap-datetimepicker-widget table td.today {
    position: relative;
}

.bootstrap-datetimepicker-widget table td.today:before {
    content: '';
    display: inline-block;
    border: solid transparent;
    border-width: 0 0 7px 7px;
    border-bottom-color: #337ab7;
    border-top-color: rgba(0, 0, 0, 0.2);
    position: absolute;
    bottom: 4px;
    right: 4px;
}

.bootstrap-datetimepicker-widget table td.active,
.bootstrap-datetimepicker-widget table td.active:hover {
    background-color: #337ab7;
    color: #fff;
    text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
}

.bootstrap-datetimepicker-widget table td.active.today:before {
    border-bottom-color: #fff;
}

.bootstrap-datetimepicker-widget table td.disabled,
.bootstrap-datetimepicker-widget table td.disabled:hover {
    background: none;
    color: #777777;
    cursor: not-allowed;
}

.bootstrap-datetimepicker-widget table td span {
    display: inline-block;
    width: 54px;
    height: 54px;
    line-height: 54px;
    margin: 2px 1.5px;
    cursor: pointer;
    border-radius: 4px;
}

.bootstrap-datetimepicker-widget table td span:hover {
    background: #eeeeee;
}

.bootstrap-datetimepicker-widget table td span.active {
    background-color: #337ab7;
    color: #fff;
    text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
}

.bootstrap-datetimepicker-widget table td span.old {
    color: #777777;
}

.bootstrap-datetimepicker-widget table td span.disabled,
.bootstrap-datetimepicker-widget table td span.disabled:hover {
    background: none;
    color: #777777;
    cursor: not-allowed;
}

.bootstrap-datetimepicker-widget.usetwentyfour td.hour {
    height: 27px;
    line-height: 27px;
}

.bootstrap-datetimepicker-widget.wider {
    width: 21em;
}

.bootstrap-datetimepicker-widget .datepicker-decades .decade {
    line-height: 1.8em !important;
}

.input-group.date .input-group-addon {
    cursor: pointer;
}

.sr-only {
    position: absolute;
    width: 1px;
    height: 1px;
    margin: -1px;
    padding: 0;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    border: 0;
}

/* Grid */
.grid-container {
    /*display: flex;
    justify-content: space-between;*/
    /* grid-template-columns: repeat(auto-fill, minmax(150px, 1fr)); */
    /* grid-gap: 10px; */
}

/* Uploaded-card */
.card-container {
    position: relative;
    width: 44px;
    height: 64px;
    color: white;
    background-color: rgba(255, 255, 255, 0.7);
    filter: drop-shadow(0px 2px 8px rgba(0, 0, 0, 0.16));
    border-radius: 8px;
    overflow: hidden;


}

.card-container:hover>.card-image {
    /* Add the blur effect */
    /* filter: blur(4.5px);
    -webkit-filter: blur(4.5px); */
}

.card-container>.card-image {
    position: relative;
    width: 100%;
    height: 100%;

    background-image: url("");
    background-position: center;
    background-size: cover;
    background-repeat: no-repeat;

    transition: filter 0.2s ease-in-out;
}

.card-container>.card-header {
    position: absolute;
    width: 100%;
    height: 56px;
    padding: 14px;

    top: 0;
    left: 0;

    display: flex;
    justify-content: space-between;
}

.card-container>.card-header>span {
    height: 18px;
    padding: 2px;

    font-family: Arial, Helvetica, sans-serif;
    font-size: 0.9em;
    font-weight: bold;
    text-shadow: 0px 1px 3px rgba(0, 0, 0, 0.6);
    background-color: rgba(0, 0, 0, 0.3);
}

.card-container>.card-header>.card-actions {
    display: flex;
    flex-direction: column;
}

.card-actions>.card-action-button:first-child {
    margin-top: 0;
}

.card-actions>.card-action-button {
    min-width: 24px;
    min-height: 24px;
    margin-top: 8px;

    border-radius: 50%;
    box-shadow: 0 3px 4px 0 rgba(0, 0, 0, 0.5);
    background-color: white;

    font-size: 15px;
    text-align: center;

    transition-property: background-color, color;
    transition-duration: 0.2s;
    transition-timing-function: ease-in-out;
}

.card-actions>.card-action-button:hover {
    background-color: rgb(255, 255, 255);
}

.card-container>div.progress {
    --bar-height: 10px;

    position: absolute;
    width: calc(100% - 20px);
    top: calc(50% - (var(--bar-height) / 2));
    left: 0;
    height: var(--bar-height);
    margin-left: 10px;
}

.card-container>span.card-footer {
    /* position: absolute;
    width: 100%;
    height: 35px;
    bottom: 0;
    left: 0;
    padding: 8px;

    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;

    background-color: rgba(235, 237, 239, 0.5);

    text-align: center;

    font-family: Arial, Helvetica, sans-serif;
    font-size: 0.9em;
    font-weight: bold;
    text-shadow: 0px 1px 3px rgba(0, 0, 0, 0.6); */
}


.card-action-button.btn-text-red {
    color: #FF5B57;
    border: none;
}

.card-action-button.btn-text-red:hover {
    color: #ff7976;
}

.card-action-button.btn-text-inverse {
    color: #424242;
    border: none;
}

.card-action-button.btn-text-inverse:hover {
    color: #616161;
}


.card-btn-group {
    width: 100%;
    padding: 10px;
    overflow: hidden;

    display: flex;
    flex-direction: column;
}

div.card-btn-container {
    display: flex;
    flex-direction: column;
    justify-content: space-between;

    min-width: 120px;
    width: 120px;
    height: 100px;
    padding: 10px;

    border: 1px solid #808080;
    border-radius: 12px;
    background-color: white;

    cursor: pointer;
    user-select: none;
}

div.card-btn-container.desktop {
    height: unset;
    margin: 10px 0;
}

/* Header */
div.card-btn-container>.card-btn-header {
    display: flex;
    justify-content: space-between;
    align-items: center;
    font-size: 16px;
    color: #424242;
}

/* Footer */
div.card-btn-container>.card-btn-footer {
    display: flex;
    justify-content: space-between;
    align-items: flex-end;
    overflow: hidden;
}

/* Description Text */
div.card-btn-container>.card-btn-footer>span {
    font-size: 12px;
    color: #727272;
}

div.card-btn-container>.card-btn-footer>.card-btn-icon {
    display: flex;
    align-items: flex-end;
    margin-left: 10px;
}

.error-badge {
    min-width: 12px;
    min-height: 12px;
    border-radius: 50%;
    background-color: #FF5B57;
}


@media screen and (max-width: 425px) {
    div.card-btn-container {
        width: 100%;
        margin-bottom: 14px;
    }

    div#wizard {
        display: none;
    }
}

/* Grid layout */
@media screen and (min-width: 425px) {
    div.card-btn-container {
        width: 160px;
        margin-bottom: 0;
    }

    .card-btn-group {
        width: calc(167px * 2);
        margin: auto;
        padding: 0;
        padding-left: 2px;
        display: grid;
        grid-template-columns: repeat(2, 1fr);
        gap: 7px;
    }

    div#wizard {
        display: none;
    }
}

/* None */
@media screen and (min-width: 991px) {
    div.card-btn-container {
        width: 240px;
        margin-bottom: 0;
    }
    .card-btn-group {
        width: 100%;
        display: flex;
        flex-direction: row;
        flex-wrap: wrap;
    }

    div#wizard {
        display: flex;
        flex-direction: column;
    }
}

/* Dropzone */
.dropzone {
    /* sizing */
    max-width: 656px;
    height: 250px;
    margin: 0 auto;

    /* placement */
    display: flex;
    flex-direction: column;
    justify-content: center;
    align-items: center;

    /* style */
    border: 2px dashed rgba(0, 115, 229, 0.24);
    border-radius: 8px;
    align-content: center;

    background-color: #E6F1FF;
    color: rgb(95, 132, 177);
    transition: all 0.4s ease-in-out;
}

/* hovered state */
.dropzone-container.on.over {
    border: none;
    /* border-color: rgb(103, 152, 213); */
    color: rgb(103, 152, 213);
    box-shadow: 0px 0px 6px 2px rgb(103, 152, 213);
}

.dropzone-container.on {
    /* sizing */
    max-width: 550px;
    /*height: 180px;*/
    margin: 0 auto;

    /* style */
    /*border: 1px dashed rgb(95, 132, 177);*/
    /*border-radius: 6px;*/

    background-color: #FFFFFF;
    color: rgb(95, 132, 177);
    transition: all 0.4s ease-in-out;
}

.dropzone-container.danger {
    /* sizing */
    /* width: 550px; */
    /*height: 180px;*/
    /*margin: 0 auto;*/

    /* style */
    border: 1px solid rgb(255, 91, 87);
    border-radius: 6px;

    background-color: #ffdedd;
    color: rgb(255, 222, 221);
    transition: all 0.4s ease-in-out;
}

.dropzone>.icon {
    /* width: 15%; */
    height: fit-content;
    margin: 0 10px;
    text-align: center;

}

.dropzone>.icon>span {
    font-size: 40px;
    color: #0073E5;
}

.dropzone>.text {
    margin: 8px 0;
    text-align: center;
    font-family: 'General Sans', Arial;
    font-style: normal;
    font-weight: 550;
    font-size: 16px;
    color: #283245;
;
}

.dropzone>.text>span {
    margin: 8px 0;
}

.dropzone>.text>div {
    margin: 8px 0;
    color: #778090;
}

.dropzone>.button>a>input {
    font-family: 'General Sans', Arial;
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    border-radius: 4px;
    color: #FFFFFF;
    background-color: #0073E5;
}

.addFiles {
    display: grid;
    grid-template-columns: 1fr 2fr;
    align-items: center;
    margin-bottom: 8px;

}

.addFiles--button a input {
    color: #000000;
    background: #FFFFFF;
    border-color: #000000;
}

.addFiles--drag {
    font-family: 'General Sans', Arial;
    font-style: normal;
    font-weight: 400;
    font-size: 16px;
    color: #778090;
    margin-left: 16px;
}

.previewName {
    display: grid;
    grid-template-columns: 1fr 3fr 1fr;
    margin-bottom: 10px;
}

.backPreviewImg {
    display: flex;
    justify-content: center;
    align-items: center;
    width: 80px;
    height: 80px;
    border-radius: 8px;
    background-color: #F2F2F6;

}

.description {
    display: grid;
    align-content: space-between;
    font-family: 'General Sans', Arial;
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    max-width: 300px;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}

.checklist process-menu,
.checklist mobile-menu {
    padding-right: 4px;
}

@media(max-width: 991px){
    .fixed-toolbar > .sticky-text-hiden{
        display: none ;
    }
    .fixed-toolbar > div > span {
        display: none;
    }
    .description:hover {
        overflow: visible;
    }
    .fixed-toolbar {
        position: fixed;
        top: 4px;
        z-index: 11;
        display: flex !important;
        max-width: 1036px;
        right: 0;
        padding: 0 30px !important;
        justify-content: space-between;
    }
    .float-button-start-process {
        display: block;
    }
    .float-button-start-process-a {
        width: 45px !important;
        height: 45px !important;
        font-size: 20px !important;
        line-height: 45px !important;
    }
    .float-button-start-process-ul {
        position: fixed !important;
        bottom: 67px !important;
        right: 25px !important;
        z-index: 9 !important;
    }
    .button-start-process {
        display: none;
    }
}

.iframe-scroll-wrapper {
    -webkit-overflow-scrolling: touch !important;
}

.description--File {
    color: #283245;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}

.description--Person {
    color: #4F596B;
    font-size: 12px;
    display: flex;
}

.description--Person span {
    margin-right: 5px;
}

.loadingFile {
    display: grid;
    grid-template-rows: 1fr 1fr;
}

.loadingFile--description {
    display: grid;
    grid-template-columns: 87% 13%;
}

.email-info {
    border-bottom: 2px;
    width: 100%;
}

.document-percent-container {
    width: 200px;

    display: flex;
    flex-direction: column;
    justify-content: center;
}

.description__type--File {
    display: flex;
}

.description__type--File span {
    margin-right: 10px;
    padding: 4px 10px;
    color: #ffffff;
    background-color: #778090;
    border-radius: 54px;
}

.Action__button_document a:first-child {
    color: #778090;
    margin-right: 5px;
}

.Action__button_document a:nth-child(2) {
    color: #337ab7;
    margin-right: 5px;
}

.Action__button_document a:nth-child(3) {
    color: #C33232;
}


/* hovered state */
.dropzone.off.over {
    border: none;
    /* border-color: rgb(103, 152, 213); */
    color: rgb(103, 152, 213);
    box-shadow: 0px 0px 6px 2px rgb(103, 152, 213);
}

.dropzone.over>.icon {
    display: inline-block;
}

.dropzone.over>.text {
    display: none;
}

.expanded-item {
    overflow: hidden;
    border: 1px solid #0000001f;
    border-radius: 6px;
}

.expanded-item-handler {
    height: 30px;
    padding: 6px 12px;

    display: flex;
    align-items: center;
    justify-content: space-between;

    background: #fff;
    color: #424242;
    cursor: pointer;
    transition: background 0.2s ease-in-out;
    user-select: none;
}

.expanded-item-handler:hover {
    background: #f5f5f5;
}

.expanded-item-handler>i {
    font-size: 18px;
}

.expanded-item-handler>div {
    display: flex;
    flex-direction: column;
    align-items: center;
    justify-content: center;

    font-size: large;
}

.expanded-item-handler>div>.caption {
    font-size: small;
    color: #0000008a;
}

.expanded-item-content {
    padding: 10px;

    color: #424242;
    transition: height 0.2s ease-in-out;
}

.expanded-item-content.hidden {
    height: 0;
    transition: height 0.2s ease-in-out;
}

/* Custom scroll */

.custom-scroll::-webkit-scrollbar {
    width: 6px;
}

.custom-scroll::-webkit-scrollbar-thumb {
    background: #4ea0f2;
    border-radius: 20px;
}

/* Lista de signatarios*/
.list-email .email-title span {
    font-family: Inter, Arial;
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
}

.list-email-buttons {
    /*line-height: normal !important;*/
    color: #0073E5;
}

/* Email chips */
div.email-ids {
    float: left;
    margin: 0 5px 5px 0;
    padding: 3px 10px;

    display: flex;
    align-items: center;

    font-family: 'General Sans', Arial;
    font-style: normal;
    font-weight: 400;
    font-size: 16px;
    color: rgba(40, 50, 69, 1);
    background: #f5f5f5;
    border-radius: 50px;
}

span#email-remove {
    margin-left: 5px;
    cursor: pointer;
}

.autocomplete-field {
    padding: 6px 4px;

    border: 1px solid #ccc;
    border-radius: 8px;
}

.autocomplete-field input {
    border: none;
    outline: none;
}

.autocomplete-field input:focus {
    border: none;
    outline: none;
}

.signatory-item.readonly {
    border-bottom: 1px solid #00000011;
    display: flex;
    justify-content: space-between;
}

.signatory-item {
    border-bottom: 1px solid #00000011;
}

.signatory-item:last-child {
    border: none;
}

span.to-input {
    display: block;
    float: left;
    padding-right: 11px;
}

.user-email {
    padding: 16px;
    background: #FFF5E6;
    border-radius: 4px;
    text-align: center;
    box-sizing: border-box;
}

/*   quick-access-item      */
.img-not-has-proccess{
    display:flex;
    justify-content: center;
    margin-bottom: 5px;
}

.text-has-no-proccess{
    display:flex;
    justify-content: center;
    border-radius: nullpx;
    font-family: Inter;
    font-size: 18px;
    font-weight: 600;
    line-height: 36px;
    letter-spacing: 0em;
    text-align: center;
    flex-wrap: wrap;


}

.container-img{
    padding: 10px;
}

.quick-access-item-h4 {
    margin-left: 20px;
    margin-right: 24px;
    display: flex;
    justify-content: space-between;
    align-items: center;
    margin-top: 8px;


}

.process-panel {
    /* margin-top: -200px; */

}

.quick-access-item-title {

    font-size: 14px;
    font-weight: 600;
    line-height: 24px;
    text-align: left;

    display: flex;
    align-items: center;
}


.quick-access-item {
    background-color: #F2F2F6;
    /* border-radius: 5px;
    padding: 5px; */
    max-height: 102px;
    min-height: 102px;
}
.quick-access-item-tour {
    background-color: #F2F2F6;
    border-radius: 5px;
    padding: 5px;
    max-height: 102px;
    min-height: 102px;
}

.quick-access-item-badge {
    float: right;
}

.icon-wrapper {
    background-color: white;
    padding: 5px;
    width: 30px;
    height: 30px;
    border-radius: 2px;
    margin:5px;
}
.card-content {
    margin-top: -10px;
    color:#4F596B;
    margin-left: 20px;
    max-width: 350px;
    margin-left: 45px;
    font-weight: 600;
    margin-left: 60px;

}
.card-content-tour {
    color:#4F596B;
    margin-left: 20px;
    max-width: 300px;
    margin-left: 45px;
    font-weight: 600;
}

/* switch button */

.switch {
    position: relative;
    display: inline-block;
    width: 30px;
    height: 17px;
}

.switch input {
    opacity: 0;
    width: 0;
    height: 0;
}

.slider {
    position: absolute;
    cursor: pointer;
    top: 0;
    left: 0;
    right: 0;
    bottom: 0;
    background-color: #ccc;
    -webkit-transition: .2s;
    transition: .2s;
}

.slider:before {
    position: absolute;
    content: "";
    height: 13px;
    width: 13px;
    left: 2px;
    bottom: 2px;
    background-color: white;
    -webkit-transition: .2s;
    transition: .2s;
}

input:checked+.slider {
    background-color: #2196F3;
}

input:focus+.slider {
    box-shadow: 0 0 1px #2196F3;
}

input:checked+.slider:before {
    -webkit-transform: translateX(13px);
    -ms-transform: translateX(13px);
    transform: translateX(13px);
}


.signature-field-container {
    width: 100%;
    margin-top: 10px;
}

div.signature-field-container.desktop {
    margin: auto;
    width: 55%;
}

div.signature-field-container.mobile {
    width: 100%;
}



.hideButton {
    display: none;
}

.hideButton div {
    margin-bottom: 8px;
}

/* Rounded sliders */
.slider.round {
    border-radius: 34px;
}

.slider.round:before {
    border-radius: 50%;
}

.rowAlignSwitch {
    align-items: center;
    font-size: 19px;
}

.fontName {
    font-family: Inter, Arial;
    font-style: normal;
    font-weight: bold;
    font-size: 16px;
    color: #283245;
    margin-right: 8px;
}

.sign-user-badge {
    padding: 4px 8px;
    border-radius: 40px;

    font-family: Inter, Arial;
    text-align: center;
    font-weight: bold;
    font-size: 1.2em;

}

.ajustNameStatus {
    display: flex;
}

.ajustNameStatus>.status {
    margin-left: 16px;
}

.document-progress-bar-container {
    width: 100%;
    height: 7px;
    background: #F2F2F6;
    border-radius: 10px;
}

.signatory-info {
    margin: 5px 0 10px 0;

    color: #4F596B;

    font-size: 13px;
    font-weight: 600;
}

.fontRowNotice {
    margin-left: 8px;

    font-style: normal;
    font-weight: 600;
    font-size: 14px;
}

.dragSign {
    display: flex;
    flex-direction: column;
    justify-content: space-evenly;
    align-items: end;
    cursor: pointer;
    padding-right: 0px;
}

.clearBorder {
    padding: 10px 15px;
    border-right: 0px;
    border-left: 0px;
    border-top: 0px;
    border-bottom: 1px solid #f2f2f6;
}

img.empty-mails {
    height: 164px;
    width: 240px;
    margin: 32px 0;
}


/* final da pagina para ter scroll */
.footer5 {
    width: 100%;
    height: 45px;
}
/* final da pagina para ter scroll */



/* texto estilo */

.negrito_text{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 700;
    font-size: 16px;
    line-height: 150%;
}

.negrito_number{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 700;
    font-size: 14px;
    line-height: 150%;
}

.Titles_Standart {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 24px;
    line-height: 150%;
    color: #283245;
}
.Titles_Standart1 {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 24px;
    line-height: 150%;

}

.Paragraphs_Small {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 150%;
    color: #4F596B;
}
.Paragraphs_Small1 {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 150%;

}

.input_text {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    color: #CACFD7;
}
.input_text1 {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
}

.list_text_style {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
}

.helloTittle{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 32px;
    line-height: 150%;
    color: #283245;
}



/* navbar process dashboard */

.sizeBOX {
    min-height: 57px;
    margin-bottom: 32px;
}

.form1{
    width: 300px;
    position: relative;
    float: right;
}

.form1 .fa-search {
    position: absolute;
    top: 14px;
    left: 10px;
    color: #CACFD7;
}

.form-input1 {
    height: 40px;
    width: 300px;
    border-radius: 4px;
    border: 1px solid #778090;
    padding-left: 30px;
    padding-right: 5px;
    color: #283245;
    margin-right: 15px;
}

/* lista de processos e tags */
.buttomStyle {
    background: none;
    color: inherit;
    border: none;
    padding: 0;
    padding:10px;
    font: inherit;
    cursor: pointer;
    outline: inherit;
}

.size_list {
    width: 310px;
    height: 404px;
    overflow-y: auto;
    padding-right: 0px;
}

.list-group li {
    padding-left: 0px;
}

.list-group a {
    text-decoration: none;
}

.styleNumber {
    min-width: 22px;
    min-height: 24px;
    background: #F2F2F6;
    border-radius: 8px;
    padding: 0px 4px;
}

.size_box_process {
    max-height: 404px;
    overflow-y: auto;
}

.style_process {
    width: 373px;
    height: 68px;
    border: 1px solid #CACFD7;
    border-radius: 8px;
    margin-bottom: 20px;
    margin-left: 12px;
    margin-right: 12px;
}

.style_process2 {
    border: 1px solid #CACFD7;
    border-radius: 8px;
    /* padding-top: 24px;
    padding-bottom: 24px; */
    padding-left: 16px ;
    margin-bottom: 20px;
    height: 72px;

}

.paddingLeftProcess{
    padding: 0px;
    padding-left: 24px;
}

.marginStar{
    margin-top: -30px;
}

.h4margin {
    margin: 0px;
}

.h4ellipsis{
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
}

.size_box_process::-webkit-scrollbar{
    display: none;

}

.AllProcess {
    display: none;
}
.text_hidden{
    overflow: hidden;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
    padding-top: 8px;
}


/* boxtest responsivo pra voltar tirar o
pull right e comentar tudo abaixo */






#click:focus {
    background-color:#F2F2F6;
    height:20px;
    border-radius: 8px;
    color:#0056B4;
}

#favorite:focus {
    background-color:#F2F2F6;
    height:20px;
    border-radius: 8px;
    color:#0056B4;
}
#all:focus {
    background-color:#F2F2F6;
    height:"20px";
    border-radius: 8px;
    color:#0056B4;
}
.grid_repeat{
    display: grid;
    grid-template-columns: repeat(3,1fr) !important;
    gap: 12px;
    align-items: end;
}





@media (max-width: 1520px){
    .paddingLeftProcess{
        padding-left: 10px;
        padding-right: 0px;
    }
}

@media (max-width: 1500px ){
    .BoxWidth{
        flex: 0 0 auto;
        width: 60% ;
    }
}

@media (max-width: 1120px) {
    .quick-access-item {
        background-color: #F2F2F6;
        border-radius: 5px;
        padding: 10px;
        max-height: 165px;
        min-height: 165px;
        min-width: 120px;

    }
}

@media (max-width: 992px){
    .containerWidth{
        flex: 0 0 auto;
        width: 100% ;
    }
    .paddingLeftProcess{
        padding-right: 0px;
    }
    .sticky-progress > .hiden-helper {
        margin-top: 0;
        width: 100%;
        padding: 0px 15px;
    }
}

@media (max-width: 770px) {
    .card-content {
        margin-top: 5px;
        color:#4F596B;
        margin-left: 20px;
        max-width: 350px;
        margin-left: 45px;
        font-weight: 600;
        margin-left: 50px;

    }
    .grid_repeat{
        display: grid;
        grid-template-columns: 1fr 1fr !important;
        margin-left: 0px;
        margin-right: 0px;
    }

    .numberSmall{
        font-family: 'Inter';
        font-style: normal;
        font-weight: 500;
        font-size: 14px;
        line-height: 150%;
    }

    .quick-access-item-h4 {
        margin-left: 10px;
        margin-right: 10px;
        display: flex;
        justify-content: space-between;
        align-items: center;
        margin-top: -2px;



    }
}

@media (max-width: 991px) {
    .paddingLeftProcess{
        padding-left: 0px;
    }
    .BoxWidth{
        width: 100%;
    }
    .MobileWidth{
        width:328px
    }

    .style_process{
        float: none;
    }
    .quick-table-responsive{
        width: 100%;
        height:100%;
        overflow-y: hidden;
        /* -ms-overflow-style: -ms-autohiding-scrollbar; */
    }

    .responsive-row-mobile{
        display: flex;
        justify-content: center;
    }

    .search-history-resp{
        /* width:38%; */
        /* margin-right: 20px; */
    }

    .tour-resp{
        /* width:38%;
        margin-top: -1px; */
    }

    .quick-access-item {
        background-color: #F2F2F6;
        border-radius: 5px;
        padding: 5px;
        max-height: 140px;
        min-height: 140px;
        min-width: 130px;

    }

    .quick-access-item-tour {
        background-color: #F2F2F6;
        border-radius: 5px;
        padding: 5px;
        max-height: 120px;
        min-height: 120px;
        max-width: 500px;
    }
    .col-responsive{
        width:40%
    }
    .padded{
        padding: 0px;
        justify-content: center;
    }
    .process-panel {
        margin-top: 0px;

    }

    .size_list {
        display: none;
    }

    .responsivetittle {

        display: flex !important;
        flex-direction: column;
        /* padding-left: 40px; */
        justify-items: start;
        margin-bottom: 0px;
        max-width: 328px;
    }

    .form-input1 {
        height: 64px;
        width: 328px;
        margin-bottom: 36px;
    }

    .form1 {
        width: 328px;
        margin-right: 0px;
        float: unset;
    }

    .AllProcess {
        display: block;
        margin-bottom: 12px;
    }

    .MarginDiv {
        margin-bottom: 20px;
    }

    .style_process {
        max-width: 328px;
        max-height: 70px;
        margin-left: 0px;
        margin-right: 16px;

    }

    .form1 .fa-search {
        top: 25px;
        left: 16px;
    }

    .size_box_process {
        max-width: 328px;
        padding: 10px;
    }

    .process-panel {
        display: flex;
        flex-direction: column;
        align-items: center;

    }

    .DIVMArgin {
        margin: 0px;
    }

    .searchajust {
        padding-left: 0px;
        padding-right: 0px;
        max-width: 780px;
    }

    .MarginDiv {
        padding-left: 0px;
    }

    .buttomStylle {
        background: none;
        color: inherit;
        border: none;
        padding: 0;
        font: inherit;
        cursor: pointer;
        outline: inherit;
        width: 300px;
        border: 1px solid #778090;
        border-radius: 4px;
        width: 328px;
        height: 64px;
        justify-content: space-between;
        align-items: center
    }
    .form-input1 {
        padding-left: 56px;
    }
    .sticky{
        position: fixed;
        top: 50px;
        width: 100%;
        right: 0;
        z-index: 10;
        background-color: white !important;
        border-bottom: 1px solid #CACFD7 !important;
        box-sizing: border-box;
        padding: 15px 30px;
        justify-content: space-between;
    }
    .dropdown-margin-mobile {
        top:60px;
        margin-left: 30px;
        margin-right:70px;
        left: 0 !important;
    }
}

@media (max-width: 500px) {
    .quick-access-item-h4 {
        margin-left: 10px;
        margin-right: 10px;
        display: flex;
        justify-content: space-between;
        align-items: center;
        margin-top: -2px;



    }
    .icon-wrapper {
        background-color: white;
        padding: 5px;
        width: 30px;
        height: 30px;
        border-radius: 2px;
        margin:5px;
        margin-left: 0px;
    }
    .marginSpan{
        margin-left: 0px !important;
    }
    .span-responsive{
        white-space: normal;
        /* margin-left: 5px; */
        margin-left: 0px;
    }
    .badge-margin-task{
        margin-left:-20px;
    }

    .badge-margin{
        margin-left:-40px;
    }

    .col-responsive{
        width:50%
    }
    .quick-access-item-badge{
        user-select: auto;
        align-self: flex-start;
        margin-top: 5px;
    }
    .quick-access-item-title{
        display:inline;
        font-size: 12px;
        font-weight: 700;
    }

    .panel-default>.panel-body {
        max-height: 100%;
        padding: 0;
    }
    .quick-access-item {
        background-color: #F2F2F6;
        border-radius: 5px;
        padding: 10px;
        max-height: 210px !important;
        min-height: 210px !important;
        min-width: 120px;

    }

    .quick-access-item-tour {
        background-color: #F2F2F6;
        border-radius: 5px;
        padding: 5px;
        max-height: 140px;
        min-height: 140px;
    }
    .pnl_quicky.panel-default>.panel-body {
        height: fit-content;
        max-height: 100%;
        min-height: 100%;
        overflow-x: hidden;
        overflow-y: auto;
    }
    .card-content {
        margin-left: 10px !important;
        max-width: 130px;
    }
    .search-history-resp{
        /* width:50%;
        margin-right: 20px; */
    }

    .tour-resp{
        /* width:50%;
        margin-top: -1px; */
    }
    .quick-table-responsive{
        width: 100%;
        height:100%;
        overflow-y: hidden;
        -ms-overflow-style: -ms-autohiding-scrollbar;

    }
    .card-content-tour {

        max-width: 300px;
        margin-left: 10px;

    }
    .hiden-helper > .d-flex{
        padding-right: 0px !important;
    }
    .limited-text {
        max-width: 150px !important;
    }
}

@media (max-width: 440px) {
    .limited-text {
        max-width: 100px !important;
    }
}

@media (max-width: 390px) {
    .limited-text {
        max-width: 100px !important;
    }
    .paddingmobile-span {
        margin-left: 2px !important;
        margin-right: 2px !important;
    }
}
@media (max-width: 374px) {
    .limited-text {
        max-width: 80px !important;
    }
}



/* stylo tela de assinatura template */

/* fontes inicio */

.assignDOcs{
    /* font-family: 'General Sans' !important; */
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 121%;
    color: #03845D;
}

.assignDOcsP{
    /* font-family: 'General Sans' !important; */
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 140%;
    color: #4F596B;

}

.FontButtons{
    /* font-family: 'General Sans' !important; */
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 100%;
    color: #4F596B;
}

/* fim das fontes */

.styleButtonsSignature{
    border: solid 2px #348fe2 !important;
    color: #348fe2 !important;
    background-color: white !important;
}

.styleButtonsAssign{
    border: solid 2px #4F596B !important;
    color: #4F596B !important;
    background-color: white !important;
}

.boxAlert{
    background-color: white !important;
    border:none !important;
}

.doc-viewer-desktop {
    width: 100%;
    height: 95vh
}

.doc-viewer-mobile {
    width: 100%;
    height: 65vh
}

.img-padding-desktop {
    padding-top: 30px;
}

.docviewer-previous-next {
    width: 30px;
    height: 33px;
    padding-left: 4px;
    margin-left: 1rem;
}

/* inicio ajuste tela de assinatura*/

@media (max-width: 991px) {
    .addFiles--drag{
        display: none;
    }
    div.btn-group button.btn.btn-white.btn-xs.m-r-5{
        display: none;
    }
}

/* fim ajuste tela de assinatura*/

/* inicio ajuste multiselect*/

.removespace{
    margin-top: 0px !important;
    padding: 0px !important;
    padding-top: 5px !important;
    position: absolute;
    width: 100%;
    z-index: 1;
}

.newheight{
    height: 30px !important;
}

/* fim ajuste tela de assinatura*/

/* inicio ajuste mobile task*/
.paddingmobile{
    padding: 0px;
}

@media (max-width: 991px) {
    .task_list_item {
        padding: 8px 5px 8px 5px !important;
        margin: 5px 0px 5px 0px !important;

    }
    .paddingmobile{
        padding: 0px !important;
    }

    .buttomStylemobile {
        display: flex !important;
        flex-direction: column;
        margin-bottom: 0px;
    }
    .bordes_style_mobile{
        border: solid 1px #cdcdcd !important;
        border-top: 0px !important;
        border-left: 0px !important;
        border-right: 0px !important;
    }


}

.text-break-mobile{
    width: 65%; word-break: break-all;
}

.notused{
    display: none;
}

.buttongroup {
    display: flex;
}

.borderButton {
    display: inline-flex;
    background-color: white;
    border: solid 1px #A0A7B4;
    border-radius: 3px;

}

/* ajust mobile assinatura digital */

@media (max-width: 991px) {
    .paddingnone{
        padding-right: 0px;
        padding-left: 0px;
    }

    .bottombuttonmargin{
        margin-bottom: 10px;
    }
    .Ajust_columns{
        display: flex;

    }
    .roll{
        overflow:hidden;
    }
    .email_overflow{
        overflow-x: auto;
    }

    .marginzerada{
        margin-left: 0px !important;
    }

    .wrapMobile{
        flex-wrap: wrap;
    }

}

.scrollbaredit {
    overflow-x: auto;

}
.scrollbaredit::-webkit-scrollbar{
    height: 5px;
    width: 4px;
}

.scrollbaredit::-webkit-scrollbar-thumb {
    background: #888;
    border-radius: 10px;
    width: 10px;
}

.scrollbaredit::-webkit-scrollbar-thumb:hover {
    background: #555;
}

/* ajust resolução buscar documentos */
.newMargin{
    margin-top: 100px;
}

@media (max-width: 1300px) {
    .newMargin{
        margin-top: 0px;
    }
    .theme-panel.extend_search.active{
        max-height: 400px;
    }
}

/* ajuste email desconhecido mobile assinatura digital */

@media (max-width: 680px){
    .Ajust_columns_direction{
        flex-direction: column;
        text-overflow: ellipsis;   }

    .ajust_margins{
        margin-left: 5px;
    }
    .size_buttons {
        width: 98%;
        padding-left: 0px !important;
        margin-bottom: 5px;

    }
}

.limitetext{
    overflow: hidden;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
    white-space: break-spaces;
    max-width: 120px;
    text-align: initial;
}

.ajust-column{
    flex-wrap: wrap;
}

.progress-bar-checklist {
    background: #0056B4;
    border-radius: 4px;
    height: 10px;
}

.progress-bar-checklist-text {
    color: #778090;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 150%;
}

.tab-progress-text-checklist {
    color: #4F596B;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
}

.border_custom{
    text-align: center;
    margin-right: 0px !important;
    margin-bottom: 0px;
    border-radius: 0px;
    border-top: 0px;
    border-bottom: 0px;
    border-left: 0px;
    padding-top: 8px;
    padding-bottom: 8px;
    padding-right: 44px;
    padding-left: 44px;
}

@media(max-width: 991px){
    .description:hover {
        overflow: visible;
    }
    .sticky-progress {
        position: fixed;
        top: 50px;
        width: 100%;
        right: 0;
        z-index: 10;
        background-color: white !important;
        padding: 12px 0px;
        margin: 0px;
        border-top: 1px solid #CACFD7;
        box-sizing: border-box;
    }
    .sticky > select{
        border-radius: 0 !important;
        width: 90% !important;
        margin: auto;
        margin-bottom: 12px !important;
    }
    .dropdown > .btn-text-inverse{
        margin-top: 0 !important;
    }
    .hiden-helper > .d-flex {
        background-color: #FFF5E6;
        border: 1px solid #CE903A;
        border-radius: 4px;
        gap: 5px;
        box-sizing: border-box;
        padding: 7px 5px;
        text-decoration: none;
    }
    .progress-chevron {
        color: var(--color-warning-medium);
        font-size: 16px;
        margin-top: 1px;
    }

    .media-text-style-orange {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 12px !important;
        line-height: 150%;
        color: #CE903A;
    }
}

/* .sticky + .panel-body {
  padding-top: 10px !important;
} */

.show-logo-mobile {
    display: block;

}

.not-show-logo-mobile {
    display: none;
}



/* inicio novo cards de documentos */

.info_cards{
    padding-right: 190px;
}

.ajust_info_cars{
    display: flex;
    flex-direction: column;
}

.text-doc {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #1E2533;

}
.ac-container {
    width: 100%;
    text-align: left;
    display: block; }

.ac-container label {
    position: relative;
    /*  z-index: 20;*/
    display: block;
    cursor: pointer;
    font-style: normal; }

.ac-container input[type=checkbox] + label::after {
    border-style: solid;
    border-width: 0.15em 0.15em 0 0;
    content: '';
    display: inline-block;
    height: 0.50em;
    left: 0.15em;
    position: relative;
    top: 0.15em;
    transform: rotate(135deg);
    vertical-align: top;
    width: 0.50em;

}
.ac-container input[type=checkbox]:checked + label::after {
    transform: rotate(-45deg);
}




.ac-container input {
    display: none; }

.ac-container article {

    margin-top: -1px;
    overflow: hidden;
    height: 0px;
    position: relative;
    /* z-index: 10; */
    transition: height 0.3s ease-in-out,  box-shadow 0.6s linear; }

.ac-container input:checked ~ article {
    transition: height 0.5s ease-in-out; }

.ac-container, .list-l article p {
    font-style: italic;
    color: #777;
    line-height: 23px;
    font-size: 14px; }




.card-info-second input:checked ~ article.ac-small {
    height: auto;
}

.card-info-third input:checked ~ article.ac-small {
    height: auto; }

.card-info-fourth input:checked ~ article.ac-small {
    height: auto; }

.ac-container input:checked ~ article.ac-medium {
    max-height: 180px; }

.ac-container input:checked ~ article.ac-large {
    height: 350px; }

.ac-container input:checked ~ article.ac-ex-large {
    height: 1000px; }

.p2-legal {
    font-style: normal;
    color: white;
    line-height: 23px;
    font-size: 14px;
    padding: 20px !important; }



.title-name {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    letter-spacing: 0.02em;
    color: #778090;
}

.subtitle-card {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #283245;

}


.tag-font{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #4F596B

}

.options-font{
    padding: 5px 12px 5px 12px;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #0056B4
}

.noDocsSubtitle{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 20px;
    line-height: 150%;
    text-align: center;
    font-feature-settings: 'liga' off;
    color: #283245;
}

.btn-search-docs-font{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
    color: #FFFFFF;
    font-feature-settings: 'liga' off;
}

.btn-search-docs, .btn-search-docs:hover, .btn-search-docs:focus{
    max-width: 381px;
    color:#fff;
    background-color:#a00000;
    border-radius: 50rem!important;
    text-align: center;
}

.btn-see {
    background: #e0eaff;
    border-radius: 4px;
    transition: all 0.2s ease-in-out;
    height: 32px;
    border: 1px solid #0056B4;
}

.btn-see:hover {
    background: rgba(51, 181, 229, 0.2);
}

.card-center {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
}
.cards-item {
    width: 100%;
    display: block;
}

.cards-title.active .arrow-dwn{
    transform: rotate(-180deg);

}

.cards-content {
    max-height: 0;
    overflow: hidden;
    transition: max-height 0.3s ease-out;
}

.cards-content-inside {
    margin-bottom: 12px;
}

.icon-drag {
    color: #1E2533;
    height: 13.333333015441895px;
    width: 8.333333969116211px;
    left: 5.83349609375px;
    top: 3.33331298828125px;
    border-radius: 0px;

}

.add-title {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #1E2533;
    padding: 3px;
    margin-left: 50px;
}

/*.info-second{*/
/*    margin-top: 24px;*/
/*}*/

.button-style {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px 12px;
    gap: 12px;
    width: 48px;
    height: 32px;
    background: #E0EAFF;
    border: 1px solid #0056B4;
    border-radius: 4px;
}

.status-signature {
    border-radius: 63px;
    background-color: #fff5e6;
    padding: 0px 12px 0px 12px;
    height: 32px;
}

.text-first {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
    color: #778090;

}

.text-second {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #283245;
}

.icon-sig{
    padding-right: 2px;
    padding-top: 3px;
}

.text-icon {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    padding-top:5px;
    color: #ffc107;
}

.add-tags {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #4F596B

}
.tag-color {
    background-color: #F2F2F6;

}

.text-details {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    letter-spacing: 0.02em;
    font-feature-settings: 'liga' off;
    color: #778090;
}

.button-view {
    box-sizing: border-box;
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px 12px;
    gap: 12px;
    width: 48px;
    height: 32px;
    background: #E0EAFF;
    border: 1px solid #0056B4;
    border-radius: 4px;
}

.all-info {
    height: 32px;
    display: flex;
    flex-direction: row;
    align-items: center;
    padding: 0px 12px;
    gap: 8px;
    background: #FFF5E6;
    border-radius: 63px;

}

.style-icon {
    width: 14px;
    left: 3px;
    top: 2.5px;
    border-radius: 0px;
    color: #CE903A;

}

.text-signature {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    display: flex;
    align-items: center;
    font-feature-settings: 'liga' off;
    color: #CE903A;
}



.all-info-process {
    display: flex;
    flex-direction: row;
    align-items: center;
    padding: 0px 12px;
    gap: 8px;
    width: 200px;
    height: 32px;
    left: 2048px;
    top: 520.73px;
    background: #E6F9F1;
    border-radius: 63px;
}

.text-user {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    display: flex;
    align-items: center;
    font-feature-settings: 'liga' off;
    color: #03845D;
}

.icon-style-process {
    left: 13.55%;
    right: 13.55%;
    top: 12.5%;
    bottom: 12.5%;
    color: #03845D;
}

.additional-buttons {
    color: #0056B4;
}
.badge.rounded-pill{
    max-width: 550px;
}

.tag-style-desktop{
    padding: 5px 12px ; margin-right:8px; margin-bottom:12px; overflow: hidden; text-overflow: ellipsis;
}

.bordertop_cards{
    border-top: solid 1px #CACFD7;
}
.card-number {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 4px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #778090;
    border-radius: 5px;
}

.number {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #FFFFFF;

}

.docExtension {
    display: flex;
}

.docExtension span {
    margin-right: 10px;
    padding: 4px 8px 4px 8px;
    color: #ffffff;
    background-color: #778090;
    border-radius: 54px;
}
.selected-doc-card{
    padding: 0 !important;
}

@media (max-width: 1200px) {
    .docInfoData{
        max-width: 219px;
    }


    .docExtension span {
        margin-right: 10px;
        padding: 4px 8px 4px 8px;
        color: #ffffff;
        background-color: #778090;
        border-radius: 54px;
    }

    .optionsDetail{
        margin-left: 24px;
    }
}

.optionButtons{
    position: absolute;
    right: 0;
}

@media (min-width: 1050px) {
    .panel-top{
        margin-right: 30px;
    }

    .subtitle-card-selected {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 14px;
        line-height: 150%;
        font-feature-settings: 'liga' off;
        color: #283245;


    }
    .text-signature-selected {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 14px;
        line-height: 150%;
        display: flex;
        align-items: center;
        font-feature-settings: 'liga' off;
        color: #CE903A;
    }
}
@media (max-width: 1050px) {
    .panel-top{
        margin-left: 30px;
    }
    .optionButtons{
        position: absolute;
        top: 0;
        margin-top: 24px;
    }
    .docName{
        width: 100% !important;
    }
    .docInfoData{
        max-width: 162px;
    }
    .ac-container input:checked ~ article.ac-small {
        max-height: 180px; }

    .subtitle-card-selected {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 12px;
        line-height: 150%;
        font-feature-settings: 'liga' off;
        color: #283245;

    }
    .text-signature-selected {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 12px;
        line-height: 150%;
        display: flex;
        align-items: center;
        font-feature-settings: 'liga' off;
        color: #CE903A;
    }


    .docExtension span {
        margin-right: 10px;
        padding: 4px 8px 4px 8px;
        color: #ffffff;
        background-color: #778090;
        border-radius: 54px;
    }
    .docExtension{
        margin-left: 5px !important;
    }
    .doc-card-first-row{
        justify-content: space-between;
        display: flex;
        flex-wrap: wrap;
    }


    .name-doc{
        font-size: 12px;
    }
    .documentDetail{
        max-width: 100%;
        margin-top: 5px;
    }
    .optionsDetail{
        margin-left: 0px;
        width: 100%;
    }
}
@media (max-width: 600px) {

    .optionButtons{
        position: absolute;
        top: initial;
        margin-top: 0px;
    }

    .search_svg{
        width: 150px !important;
        height: 148px !important;
    }
    .docName{
        min-width: 100%;
    }
    .mobilemodel{
        width: 100%;
        flex-direction: column;
    }
    .docInfoData{
        max-width: 100% !important;
        width: 100% !important;
        margin-right: 0px !important;
    }
    .tag-style-mobile{
        padding: 5px 12px ; margin-right:8px; margin-bottom:12px; overflow: hidden; text-overflow: ellipsis; max-width: 200px;
    }
    .docExtension{
        margin-left: 0px !important;
    }
    .documentDetail{
        margin-left: 0px !important;
        margin-top: 5px;
    }

    .optionsDetail{
        width: 100%;
        margin-left: 0px;
        margin-top: 5px;
        order:2;

    }

    /*.aggregate{*/
    /*    padding-top: 20px;*/
    /*}*/
}


/* fim novo cards de documentos */
.new-format-error {
    background-color: #F2DEDE;
    border: 1px solid #ff5b57;
}

/* new process view */
.max-content-width{
    max-width: 1036px;
    margin: auto;
}

.process-menu-primary-button {
    background-color: #0056B4;
    color: white !important;
    border: none !important;
    border-radius: 4px !important;
}

.process-menu-secondary-button {
    color:#0056B4;
    border: none;
    background-color: transparent;
    padding-left:0px ;
    padding-right:0px ;
}

.ajust_cards{
    min-width: 190px;
    overflow-x: hidden;
    margin-bottom: 16px;
}

.title_huge_process {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 24px;
    line-height: 150%;
}

.Paragraphs_Caption{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    color: #4F596B;
    letter-spacing: 0.02em;
}

.Paragraphs_Caption_dark{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    color: #283245;
    letter-spacing: 0.02em;
}

.Titles_small_process{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
}

.paginationTittle{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    color: #A0A7B4;
}

.form-field-label{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
    color: #A0A7B4;
}

.form-field-optional-label{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    letter-spacing: 0.02em;
    color: #A0A7B4;
    margin-lef: 3px;
}

.form-field-answer{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    color: #283245;
}

.Paragraphs_Body{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 16px;
    line-height: 150%;
    letter-spacing: 0.02em;
}

.new-backgroud-color{
    background: #F2F2F6 !important;
}

.cards_background{
    background-color: white !important;
}


@media (min-width: 991px){
    .hiden_dropdown{
        display: none;
    }
    .limitTextButton{
        max-width: 250px;
        overflow: hidden;
        white-space: nowrap;
        display: block;
        text-overflow: ellipsis;
    }
    .fixed-progress{
        display: none !important;
    }
}

.transparent-button1{
    background-color: transparent;
    background-repeat: no-repeat;
    border: none;
    cursor: pointer;
    overflow: hidden;
    outline: none;
    /* margin-left: 5px;
    margin-right: 5px; */
}
.transparent-button2{
    background-color: transparent;
    background-repeat: no-repeat;
    border: none;
    cursor: pointer;
    width: 35px;
    outline: none;
}
.note_style{
    border: solid 1px #CACFD7;
    border-radius: 4px;
    min-height: 50px;
}

.anexarStyle{
    border: solid 1px #CACFD7;
    min-height: 50px;
    border-radius: 4px;
    align-items: center;
    padding-left: 20px;
    padding-right: 20px;

}
.resetmargin{
    margin-left: 0px;
    margin-right: 0px;
}

.media-text-style{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    color: #283245;
}

.media-label-style{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    color: #A0A7B4;
}

.media-protocol-text-style{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 14px;
    line-height: 150%;
    color: #283245;
}

.media-protocol-label-style{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 500;
    font-size: 12px;
    line-height: 150%;
    color: #A0A7B4;
}

.ajustNameAttach{
    overflow: hidden;
    display: -webkit-box;
    -webkit-line-clamp: 2;
    -webkit-box-orient: vertical;
    word-break: break-all;
}

@media (max-width: 991px){

    .hamburger-offset {
        margin-right: 42px;
    }

    .hiden{
        display: none !important;
    }

    .position-mobile{
        position: absolute;
        top: 330px;
        right: 35px;
    }

    .title_huge_process_mobile {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 16px;
        line-height: 150%;
    }

    .fixed-toolbar .title_huge_process_mobile {
        font-size: 24px;
    }

    .Ajustattach{
        flex-direction: column;
    }

    .ajustIcon{
        width: 100%;
        display: flex;
        justify-content: end;
        margin-top: 12px;
    }

    .ajustNameAttachMobile{
        overflow: hidden;
        display: -webkit-box;
        -webkit-line-clamp: 2;
        -webkit-box-orient: vertical;
        word-break: break-all;
    }
    .anexarStyleMobile{
        padding: 12px 16px 0px 16px
    }

    .anexarStyleMobile > div {
        width: 100%;
    }

    .AjustPrazo{
        padding: 0;
        /* margin-top: 10px; */

    }
    .Mobile_AjustMargin{
        width: 100%;
        justify-content: space-around !important;
    }
    .resetmarginMobile{
        margin-right: 0px !important;
    }

    .Titles_small_process_mobile{
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 14px;
        line-height: 150%;
    }

}

@media (min-width: 991px) and (max-width: 1200px) {
    .title_huge_process_mobile {
        font-family: 'Inter';
        font-style: normal;
        font-weight: 600;
        font-size: 16px;
        line-height: 150%;
    }

    .fixed-toolbar .title_huge_process_mobile {
        font-size: 24px;
    }
}

/* Refatoração do painel de caixas */
.adocSelecioneCaixa{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 20px;
    line-height: 150%;
    margin-bottom: 12px;
    color: #1E2533;
}

.adocMarginProcess{
    max-width: 1036px;
    margin: 0 auto;
    padding-left: 0px;
    padding-right: 0px;
    padding-bottom: 15px;
}

.adocTitleSearch{
    display: flex;
    justify-content: space-between;
}

.adocTitle{
    width: 50%;
    display: flex;
}

.adocSearch{
    width: 50%;
    display: flex;
    justify-content: end;
}

.inputSearchBox{
    color: #4F596B;
    height: 32px;
    width: 261px;
    left: 0px;
    top: 0px;
    border-radius: 4px;
    padding: 4px 16px 4px 16px;
    font-size: 14px;
    border: 1px solid #CACFD7

}

.inputSearchBox::-webkit-input-placeholder{
    color:#CACFD7;
    font-size: 14px;
}

.buttonSearchBox{
    height: 32px;
    width: 32px;
    left: 269px;
    top: 0px;
    border-radius: 4px;

    border: 1px solid #0056B4;
    margin-left: 8px;
    background-color: white;

}

.AdocBoxes{
    background-color: white;
    border-radius: 8px;
    padding: 24px;
    border: 1px solid #CACFD7;
}

.AdocTituloNome{
    display:grid;
    grid-template-columns:2fr 2fr 1fr;
    padding: 0 15px;
}

.AdocCaixa, .AdocNome {
    font-style: normal;
    font-weight: 500;
    font-size: 15px;
    line-height: 150%;
    color: #283245
}

.caixaDisponiveis, .caixaSelecionada{

    display: flex;
    justify-content: center;
    font-weight: 600;
    font-size: 14px;
    color: #778090;
    width: 200px;
}

.hrBoxes{
    width: 100%;
    border: 1px solid #77809050;
}

.boxBlue{
    padding: 10px 15px;
    margin: 5px 0px;
    cursor: pointer;
    display:grid;
    grid-template-columns:4fr 1fr;

}

.boxNameId{
    display: grid;
    grid-template-columns:1fr 1fr;

}

.boxBlueSelected{
    padding: 10px 15px;
    margin: 5px 0px;
    display:grid;
    grid-template-columns:4fr 1fr;
}



.boxId, .boxName{

    border-style: none;
    font-weight: 600;
    font-size: 15px;
    color: #4F596B;
    line-height: 21px;
}

.boxIdSelect, .boxNameSelect{

    border-style: none;
    font-weight: 600;
    font-size: 15px;
    color: #A0A7B4;
    line-height: 21px;
}

.iconBlue{
    display: none;
    justify-self: end;

}

.iconRed{
    justify-self: end;
}

/* .iconBlue:target{
    display: block;
} */

.boxBlue:hover {
    background: #E0EAFF;
    border: 1px solid #0056B4;
    border-radius: 4px;
}


.displayFlex {
    display: flex;

}

.corBackground{
    background: #E0EAFF;
    border: 1px solid #0056B4;
    border-radius: 4px;
}

.corNome{
    color: #0056B4;
}


@media (max-width: 1024px) {

    .AdocTituloNome{
        display: none;
    }

    .boxNameId{
        flex-direction: column;

    }
    .boxId, .boxName{
        width: 100%;

    }
    .boxIdSelect, .boxNameSelect{
        width: 100%;
    }
}

@media (max-width: 600px) {

    .caixaDisponiveis, .caixaSelecionada{
        font-size: 13px;
        width: 255px;
    }

    .adocTitleSearch{
        display: block;
    }

    .adocTitle{
        width: 100%;
    }

    .adocSearch{
        margin-bottom: 8px;
        width: 100%;

    }

    .inputSearchBox{
        width: 100%;
    }

    .boxNameId{
        grid-template-columns: 1fr;
        grid-template-rows:1fr 1fr;
    }

    .center{
        align-self: center;
    }



}

@media (max-width: 360px) {

    .caixaDisponiveis, .caixaSelecionada{
        font-size: 12px;
        width: 50%;
    }

    .hrBoxes{
        width: 50%;
    }

    .boxId{
        font-size: 13px;
        width: 100%;
        font-weight: 700;

    }

    .boxName{
        font-size: 12px;
        width: 100%;
        font-weight: 500;

    }

    .boxIdSelect{
        font-size: 13px;
        width: 100%;
        font-weight: 700;
    }

    .boxNameSelect{
        font-size: 12px;
        width: 100%;
        color: #A0A7B4;
        font-weight: 500;

    }

}


.background-gray{
    background-color: #F2F2F6;
    height: 100%;
}
.search-title{
    max-width: 1036px;
    margin: auto;
    background: #ffffff00;
    margin-top: 50px;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 30px;
    line-height: 150%;
}
.panel-search{
    display: flex;
}

.options-font-search{
    background-color: transparent;
    border: none;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #0056B4
}

.options-font-search-mobile{
    font-size: 11px ;
    background-color: transparent;
    border: none;
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    line-height: 150%;
    font-feature-settings: 'liga' off;
    color: #0056B4
}
a{text-decoration: none}

.AdocSelectedDocsTitle{
    max-width: 1036px;
    margin: 0 auto;

}

.AdocresultadoBusca{
    font-style: normal;
    font-weight: 600;
    font-size: 20px;
    line-height: 150%;
    margin-bottom: 12px;
    color: #1E2533;
}

.marginPagination{
    margin-left: 15px;
}

.pagination > li > a {
    background-color: transparent;
    border: none;

}

.evidencesValidationNoError {
    display: none;
}

.evidencesValidationError {
    display: block;
    padding: 0 !important;
    list-style-type: none !important;
    margin: 0 !important;
    color: #e5603b;
    font-size: 12px !important;
    line-height: inherit !important;
}

.btn-primary.active{
    background-color: #0056B4;

}

.btn-primary.active:focus{
    background-color: #c47d15;
    border-color: #c47d15;
}

.panel-padding{
    padding-top: 10px;
}

.form-help-icon{
    font-size: 2rem;
}

.form-help-button{
    padding: unset;
}

.form-help-dropdown{
    max-width: 300px;
    right: 4px;
    left: auto;
    white-space: unset;
    width: 300px;
}

.form-help-dropdown>li {
    word-wrap: break-word;
    white-space: normal;
}

@media (max-width: 1400px){
    /* .form-help-div{
        position: absolute;
        right: 0;
        margin-right: 3vw;
    } */
}

@media (min-width: 1400px){
    .form-help-div{
        position: absolute;
        margin-left: 962px;
    }
}

@media (max-width: 768px) {
    /* .form-help-div{
        position: absolute;
        right: 0;
        margin-right: 9vw;
    } */
}

.h1-example{

    width: 421px;
    height: 64px;

    /* Titles/Extra Huge Title */

    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 48px;
    line-height: 150%;
    /* or 72px */

    display: flex;
    align-items: center;
    font-feature-settings: 'liga' off;

    /* Neutral/dusk */

    color: #283245;
    font-variation-settings: 'slnt' 0;


    /* Inside auto layout */

    flex: none;
    order: 1;
    flex-grow: 1;

}

/* Start: Snackbar */
.js-snackbar-container {
    position: absolute;
    bottom: 0;
    right: 0;
    display: flex;
    flex-direction: column;
    align-items: flex-end;
    max-width: 100%;
    z-index: 999;
    overflow: hidden;
}

.js-snackbar-container--top-left {
    bottom: unset;
    right: unset;
    top: 0;
    left: 0;
}

.js-snackbar-container--top-center {
    top: 0;
    bottom: unset;
    left: 50%;
    right: unset;
    transform: translateX(-50%);
}

.js-snackbar-container--top-right {
    bottom: unset;
    right: 0;
    left: unset;
    top: 0;
}

.js-snackbar-container--bottom-left {
    bottom: 0;
    right: unset;
    left: 0;
    top: unset;
}

.js-snackbar-container--bottom-center {
    bottom: 0;
    right: unset;
    left: 50%;
    top: unset;
    transform: translateX(-50%);
}

.js-snackbar-container--fixed {
    position: fixed;
}

.js-snackbar-container * {
    box-sizing: border-box;
}

.js-snackbar__wrapper {
    overflow: hidden;
    height: auto !important;
    margin: 0;
    border-radius: 3px;
    display: flex;
    min-width: auto;
    transition-property: all;
    transition-timing-function: ease;
    transition-duration: 0.5s;
}

.js-snackbar {
    display: inline-flex;
    box-sizing: border-box;
    border-radius: 3px;
    color: #eee;
    font-size: 16px;
    background-color: #262626;
    vertical-align: bottom;
    box-shadow: 0 0 4px 0 black;
    margin: 0 10px;
    flex-grow: 1;
}

.js-snackbar__close,
.js-snackbar__status,
.js-snackbar__message-wrapper {
    position: relative;
}

.js-snackbar__message-wrapper {
    flex: 1;
    padding: 12px;
}

.js-snackbar__message {
    display: inline-block;
    word-break: break-word;
}

.js-snackbar__status {
    display: none;
    min-width: 15px;
    margin-right: 5px;
    border-radius: 3px 0 0 3px;
    background-color: transparent;
}

.js-snackbar__status.js-snackbar--success,
.js-snackbar__status.js-snackbar--warning,
.js-snackbar__status.js-snackbar--danger,
.js-snackbar__status.js-snackbar--info {
    display: flex;
    justify-content: center;
    align-items: center;
}

.js-snackbar__status.js-snackbar--success  {
    background-color: #4caf50;
}

.js-snackbar__status.js-snackbar--warning  {
    background-color: #ff9800;
}

.js-snackbar__status.js-snackbar--danger {
    background-color: #b90909;
}

.js-snackbar__status.js-snackbar--info {
    background-color: #2196f3;
}

.js-snackbar__icon {
    display: block;
    border: 2px solid white;
    font-weight: bold;
    border-radius: 20px;
    height: 20px;
    width: 20px;
    text-align: center;
    margin: 0 5px;
    font-family: monospace;
}

.js-snackbar__action {
    display: flex;
    align-items: center;
    padding: 0 10px;
    color: #fff;
    background-color: #99999938;
    cursor: pointer;
}

.js-snackbar__action:hover {
    background-color: #9999997a;
}

.js-snackbar__close {
    cursor: pointer;
    display: flex;
    align-items: center;
    padding: 0 10px;
    user-select: none;
    color: #BBB;
}

.js-snackbar__close:hover {
    background-color: #444;
}

/* End: Snackbar */

#webpushr-cookie-info { display: none  !important; }

/* Primary Light */

.btn-primary-light {
    background-color: #E0EAFF;
    background-image: -moz-linear-gradient(top, #e8effa, #E0EAFF);
    background-image: -ms-linear-gradient(top, #e8effa, #E0EAFF);
    background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#e8effa), to(#E0EAFF));
    background-image: -webkit-linear-gradient(top, #e8effa, #E0EAFF);
    background-image: -o-linear-gradient(top, #e8effa, #E0EAFF);
    background-image: linear-gradient(top, #e8effa, #E0EAFF);
    background-repeat: repeat-x;
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0088cc', endColorstr='#0044cc', GradientType=0);
    border: 1px solid #0056B4;
    border-radius: 0.5rem;
    filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
}
.btn-primary-light:hover,
.btn-primary-light:active,
.btn-primary-light.active,
.btn-primary-light.disabled,
.btn-primary-light[disabled] {
    background-color: #ddd;
}
.btn-primary-light:active, .btn-primary-light.active {
    background-color: #ddd \9;
}

.btn.btn-primary-light:hover {
    color: #0056B4;
    text-decoration: none;
}

.icon-primary-light {
    background: #DBF1FF;
    border: 1px solid #0056B4;
    border-radius: 4px;
    padding: 4px;
    gap: 10px;
    width: 32px;
    height: 32px;
}

.icon-primary-light.small {
    width: 16px;
    height: 16px;
    border: none;
    padding: 0;
}

.icon-primary-light.round {
    border-radius: 10px;
}

.icon-primary-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #DBF1FF;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-primary-float.icon {
    color: #3390D9;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

/* Warning Light */

.btn-warning-light {
    color: #CE903A;
    background-color: #fff;
    background-repeat: repeat-x;
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0088cc', endColorstr='#0044cc', GradientType=0);
    border: 1px solid #778090;
    border-radius: 0.5rem;
    filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
}
.btn-warning-light:hover,
.btn-warning-light:active,
.btn-warning-light.active,
.btn-warning-light.disabled,
.btn-warning-light[disabled] {
    background-color: #FFF5E6;
}
.btn-warning-light:active, .btn-primary-light.active {
    background-color: #fce3ce \9;
}

.btn.btn-warning-light:hover {
    color: #CE903A;
    text-decoration: none;
}

.btn.btn-warning-light.small {
    padding: 5px 12px;
}

.icon-warning-light {
    background: #FFF5E6;
    border: 1px solid #CE903A;
    border-radius: 4px;
    padding: 4px;
    gap: 10px;
    width: 32px;
    height: 32px;
}

.icon-warning-light.medium {
    width: 24px;
    height: 24px;
}

.icon-warning-light.small {
    width: 16px;
    height: 16px;
    border: none;
    padding: 0;
}

.icon-warning-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #FFF5E6;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-warning-float.icon {
    color: #CE903A;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

/* Success Light */
.btn-success-light {
    color: #03845D;
    background-color: #fff;
    background-repeat: repeat-x;
    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0088cc', endColorstr='#0044cc', GradientType=0);
    border: 1px solid #778090;
    border-radius: 0.5rem;
    filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
}
.btn-success-light:hover,
.btn-success-light:active,
.btn-success-light.active,
.btn-success-light.disabled,
.btn-success-light[disabled] {
    background-color: #f0faf4;
}
.btn-success-light:active, .btn-success-light.active {
    background-color: #f0faf4 \9;
}

.btn.btn-success-light:hover {
    color: #03845D;
    text-decoration: none;
}

.btn.btn-success-light.small {
    padding: 5px 12px;
}

.icon-success-light {
    background: #E6F9F1;
    border: 1px solid #03845D;
    border-radius: 4px;
    padding: 4px;
    gap: 10px;
    width: 32px;
    height: 32px;
}
.icon-success-light.medium {
    width: 24px;
    height: 24px;
}

.icon-success-light.small {
    width: 16px;
    height: 16px;
    border: none;
    padding: 0;
}

/* Icon Muted */

.icon-muted {
    background: #F2F2F6;
    color: #778090;
    border-radius: 8px;
    padding: 4px;
    gap: 10px;
    width: 32px;
    height: 32px;
}

/* icon-float */
.icon-gray-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #CACFD7;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-gray-float.icon {
    color: #1E2533;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-grass-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #F5FFDB;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-grass-float.icon {
    color: #98D21C;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-orange-light-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #FFE5DB;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-orange-light-float.icon {
    color: #E76935;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-teal-light-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: var(--color-teal-light);
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-teal-light-float.icon {
    color: var(--color-teal-medium);
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-success-float {
    display: flex;
    flex-direction: row;
    justify-content: center;
    align-items: center;
    padding: 0px;
    gap: 10px;
    width: 20px;
    height: 20px;
    background: #E6F9F1;
    border-radius: 10px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.icon-success-float.icon {
    color: #03845D;
    width: 16px;
    height: 16px;
    flex: none;
    order: 0;
    flex-grow: 0;
}

.text-primary-light {
    --bs-text-opacity: 1;
    color: #3390D9 !important;
}

.updates-border {
    height: 16px;
    border-bottom: 1px solid #CACFD7;
}

.drawer-news-content {
    overflow: auto !important;
    height: 100%;
}

.drawer-news-content .box {
    border-radius: 0.5rem;
}

.animation-scroll-out {
    height: 0px;
    transition: height 1s;
}

.checklist-notification-default{
    font-family:Inter;
    font-size:16px;
    font-weight:500;
    color:#4F596B;
}

.checklist-notification-blue-icon{
    font-size:14px !important;
    color:#15588C;
    background-color: #DBF1FF;
}

.checklist-notification-blue-title{
    font-size:14px;
    color:#15588C;
    letter-spacing: 0.02em;
}

.checklist-notification-protocol-badge {
    border: 1px solid #778090;
    background-color: #fff;
    padding-right: 0.6em;
    padding-left: 0.6em;
    border-radius: 10rem;
}

.checklist-notification-text-protocol-section {
    font-family:'Inter';
    font-size:12px;
    font-weight:500;
    letter-spacing: 0.02em;
    color:#4F596B;
}

/**
 * Minified by jsDelivr using clean-css v5.2.4.
 * Original file: /npm/@tarekraafat/autocomplete.js@10.2.7/dist/css/autoComplete.02.css
 *
 * Do NOT use SRI with dynamically generated files! More information: https://www.jsdelivr.com/using-sri-with-dynamic-files
 */
.autoComplete_wrapper {
    display: inline-block;
    position: relative
}

.autoComplete_wrapper > input {
    width: 150px;
    height: 34px;
    padding-left: 10px;
    font-size: 1.2rem;
    color: #757575;
    border-radius: 4px;
    border: 1px solid rgba(33, 33, 33, .2);
    outline: 0
}

.autoComplete_wrapper > input::placeholder {
    color: rgba(123, 123, 123, .5);
    transition: all .3s ease
}

.autoComplete_wrapper > ul {
    position: absolute;
    max-height: 226px;
    overflow-y: scroll;
    top: 100%;
    left: 0;
    right: 0;
    padding: 0;
    margin: .5rem 0 0 0;
    border-radius: 4px;
    background-color: #fff;
    border: 1px solid rgba(33, 33, 33, .1);
    z-index: 1000;
    outline: 0
}

.autoComplete_wrapper > ul > li {
    padding: 5px 10px;
    list-style: none;
    text-align: left;
    font-size: 12px;
    color: #212121;
    transition: all .1s ease-in-out;
    border-radius: 3px;
    background-color: #fff;
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    transition: all .2s ease
}

.autoComplete_wrapper > ul > li::selection {
    color: rgba(#fff, 0);
    background-color: rgba(#fff, 0)
}

.autoComplete_wrapper > ul > li:hover {
    cursor: pointer;
    background-color: rgba(123, 123, 123, .1)
}

.autoComplete_wrapper > ul > li mark {
    background-color: transparent;
    color: #ff7a7a;
    font-weight: 700
}

.autoComplete_wrapper > ul > li mark::selection {
    color: rgba(#fff, 0);
    background-color: rgba(#fff, 0)
}

.autoComplete_wrapper > ul > li[aria-selected=true] {
    background-color: rgba(123, 123, 123, .1)
}

@media only screen and (max-width: 600px) {
    .autoComplete_wrapper > input {
        width: 18rem
    }
}

.no_result {
    padding: 5px;
}

.dashboard-container {
    height: 80vh;
    width: 90vw;
    margin: auto;
    text-align: center;
}

.dashboard-container>div>iframe {
    background-color: white !important;
}

.dashboard-header {
    padding-left: 3vh !important;
}

.dashboard-select {
    padding-left: 1vh !important;
}

@media (max-width: 991px) {
    .dashboard-header {
        padding-left: 4vh !important;
    }

    .dashboard-select {
        padding-left: 2.3vh !important;
    }
}

.select-certificate-modal {
    z-index: 90000 !important;
}

/* https://fortifyapp.com/external/webcomponent/build/peculiar.css */
/*:root{--pv-color-dark-rgb:64, 72, 79;--pv-color-light-rgb:255, 255, 255;--pv-color-grey_1-rgb:250, 249, 249;--pv-color-grey_2-rgb:238, 244, 247;--pv-color-grey_3-rgb:225, 228, 230;--pv-color-grey_4-rgb:182, 195, 204;--pv-color-grey_5-rgb:109, 125, 135;--pv-color-secondary-rgb:10, 190, 101;--pv-color-primary-rgb:6, 128, 255;--pv-color-attention-rgb:247, 168, 49;--pv-color-footer-rgb:64, 72, 79;--pv-color-footer-text-rgb:255, 255, 255;--pv-font-size-h4:17px;--pv-font-size-h6:15px;--pv-font-size-h7:14px;--pv-font-size-b1:15px;--pv-font-size-b3:13px;--pv-font-size-c1:11px;--pv-font-family:"Open Sans", "Arial", sans-serif;--pv-letter-spacing-normal:0.03em;--pv-line-height-normal:1.4}*/

.modal-text-table-center{
    display: flex;
    justify-content: center;
    text-align: center;
    text-align-last: center;
}

.number-modal-background{
    background: #778090;
    padding: 5px;
    border-radius: 5px;
    color: white;
}

/* Progress bar on checklist*/
check-progress-icon{
    padding: 2px;
    border: 1px solid #CE903A;
    background: #FFF5E6;
    color: #CE903A;
    font-size: 20px;
    box-sizing: border-box;
    border-radius: 4px;
}

.check-progress-icon-checked{
    padding: 2px;
    border: 1px solid #14A948;
    background: #DDFEE3;
    color: #14A948;
    font-size: 20px;
    box-sizing: border-box;
    border-radius: 4px;
}

.btn-disabled {
    color: #A0A7B4 !important;
}

.btn-disabled-w-border{
    color: #A0A7B4 !important;
    border-color: #A0A7B4!important;
    border-radius: 4px;
}

.btn-disabled-next {
    color: #A0A7B4 !important;
    background-color: transparent !important;
    border-color: #A0A7B4 !important;
}
.sticky-tab {
    background-color: transparent !important;
    color: #000
}

.stick-Fields-Tab {
    position: fixed;
    top: 50px;
    z-index: 8;
    background-color: transparent !important;
    box-sizing: border-box;
    animation: fadeIn 1s;
    -moz-animation: fadeIn 1s;
    -o-animation: fadeIn 1s;
    -ms-animation: fadeIn 1  s;
}

.stick-Fields-Tab  div > ul > li > a {
    border: 1px solid #CACFD7;
    border-radius: 8px;
    box-sizing: border-box;
}
.stick-Fields-Tab  div > ul > li > a > div > div{
    flex-direction: row-reverse !important;
}

.stick-Fields-Tab  div > ul > li > a > div > div > span {
    padding-right: 8px;
}

.stick-Fields-Tab  div > ul > li > a > div > .limitetext{
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    width: 12ch;
    display: block !important;
}

.sticky-white {
    position: fixed;
    top: 50px;
    width: 100%;
    right: 0;
    z-index: 7;
    background-color: white !important;
    border-bottom: 1px solid #CACFD7 !important;
    box-sizing: border-box;
    height: 70px;
}

.style-box {
    background-color: #FFF5E6;
    border: 1px solid #CE903A;
    border-radius: 4px;
    gap: 5px;
    box-sizing: border-box;
    padding: 8px 5px;
}

.box-header{
    width: 100%;
}

.page-menu > .style-box {
    display: none !important;
}

.page-menu{
    padding: 0 15px;
}

@media (max-width: 1150px) {
    .stick-Fields-Tab > .margin-sticky {
        margin-right: 50px;
    }
    .fixed-toolbar{
        padding-right: 50px ;
    }
}

.progress-finish {
    background-color: #DDFEE3 !important;
    border: 1px solid #14A948 !important;
    border-radius: 4px !important;
}

.green-progress-text {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 16px;
    line-height: 150%;
    color: #14A948 !important;
}

.green-arrow {
    color: #14A948 !important;
}

.media-text-style-orange {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 150%;
    color: #CE903A;
}

.limited-text {
    white-space: nowrap;
    overflow: hidden;
    text-overflow: ellipsis;
    vertical-align: top;
    min-width: 0
}

.limited-text-acordeon {
    width: 100px;
    white-space: nowrap;
    display: inline-block;
    overflow: hidden;
    vertical-align: top;
    text-overflow: ellipsis;
}

.popup {
    display: none;
    position: fixed;
    z-index: 999;
    left: 0;
    top: 0;
    width: 100%;
    height: 100%;
    background-color: rgba(0,0,0,0.5);
}

.popup-desktop {
    position: fixed;
    z-index: 999;
    left: 0;
    top: 0;
    width: 100%;
    height: 100%;
}

.popup-content {
    background-color: white;
    border-radius: 5px;
    position: absolute;
    top: 50%;
    left: 50%;
    transform: translate(-50%,-50%);
    max-height: 400px;
    overflow-y: auto;
    width: 95%;
}

.desktop-content {
    background-color: white;
    position: absolute;
    max-height: 700px;
    overflow-y: auto;
    border-radius: 5px;
    left: 0 !important;
}

.close-button {
    display: block;
    margin: auto;
    margin-top: 20px;
    background-color: #333;
    color: white;
    border: none;
    border-radius: 5px;
    padding: 10px;
    cursor: pointer;
}

.acordeon .acordeon-content {
    display: none;
}

.acordeon.active .acordeon-content {
    display: block;

}

.acordeon-desktop .acordeon-content-desktop {
    display: none;
}

.acordeon-desktop.active .acordeon-content-desktop {
    display: block;
}

li.active {
    /* defina o estilo que deseja quando o acordeon estiver aberto */
    background-color: white;
    /* etc. */
}

.sticky > button {
    width: 90% !important;
    margin: auto !important;
    padding-bottom: 15px !important;
}

.sticky > ul {
    padding-right: 12px;
    padding-left: 12px;
}

.previous-button{
    color: #0056B4;
    padding: 6px 10px;
    text-decoration: none;
    border: none;
    background: transparent;
}

.next-button{
    border: solid 2px #0056B4;
    border-radius: 8px;
    color: #0056B4;
    background-color: #E0EAFF;
    padding: 6px 10px;
    text-decoration: none;
}

.section-one{
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 14px;
    line-height: 137%;
    color: #778090
}

.form-field-label-text{
    word-break: normal;
}

.button--style-dropdown-section{
    border: 1px solid #CACFD7;
    border-radius: 8px;
    width: 100%;
    text-align: start;
    display: flex;
    justify-content: space-between;
    background-color: white;
    padding: 9px 12px;
    align-items: center;
    white-space: nowrap;
}

.not-checklist-sticky > .button--style-dropdown-section {
    margin-bottom: 0;
}
.section_stylle_text{
    text-align: center;
    margin: 0px;
    white-space: nowrap;
    width: 180px;
    overflow: hidden;
    text-overflow: ellipsis;
}

.button-previous-w-border{
    color: #0056B4;
    padding: 4px 10px;
    text-decoration: none;
    background: transparent;
    border: 1px solid #0056B4;
    border-radius: 4px;

}

.button-previous-no-text{
    color: #0056B4;
    padding: 4px 10px;
    text-decoration: none;
    background: transparent;
    border: 1px solid #0056B4;
    border-radius: 4px;
}

.button-disabled-previous-no-text {
    color: #A0A7B4 !important;
    background-color: transparent !important;
    border-color: #A0A7B4 !important;
}

.button-previous{
    color: #0056B4;
    padding: 4px 0px;
    text-decoration: none;
    background: transparent;
    border: none;
}

.button-next {
    border: solid 1px #0056B4;
    border-radius: 4px;
    color: #0056B4;
    background-color: #E0EAFF;
    padding: 4px 10px;
    text-decoration: none;
}

.webkit-transform-scale {
    transform: scale(1.3);
}

.not-checklist-sticky {
    position: fixed;
    top: 50px;
    width: 100%;
    right: 0;
    z-index: 10;
    background-color: white !important;
    border-bottom: 1px solid #CACFD7 !important;
    box-sizing: border-box;
    padding: 12px 20px;
}

.not-checklist-sticky > ul {
    margin: 0 20px !important;
}

.sticky > a {
    margin-bottom: 0;
}

.sticky > ul {
    margin: 0 20px !important;
}

.cursor-default {
    cursor: default !important;
}
.my-2.paragraph-body-md {
    display: block;
}

.cursor-pointer {
    cursor: pointer;
}

.helperModal{
    position: fixed;
    top: 0;
    right: 0;
    left: 0;
    bottom: 0;
    background: rgba(0, 0, 0, .6);
    z-index: 10000;
    display: none;
}

.helperModal.show{
    display: block;
}

.helperModal .helperModalImg{
    object-fit: contain;
    width: 100%;
    height: 100%;
    background-repeat: no-repeat;
    background-position: center;
    position: relative;
    margin: auto;
    max-width: 1024px;
    z-index: 10001;
}

.dropdown-menu-helper-mobile{
    padding: 12px 12px 4px 12px;
}

.col-xs-12 > .fixed-toolbar {
    max-width: 890px;
    background: transparent;
}
.fixed-toolbar-old {
    position: fixed;
    top: 4px;
    right: 0;
    z-index: 10;
    /* 1050 */
    display: flex;
    justify-content: end;
    margin-right: 15px;
}


.aggregate-documents-title {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 600;
    font-size: 20px;
    line-height: 150%;
    color: #1e2533;
}

.aggregate-panel-background {
    background-color: #ffffff00
}

.aggregate-panel-header {
    width: 90%;
    justify-content: space-between;
}

.aggregate-panel-style {
    align-items: center;
    background-color: #ffffff00;
    max-width: 1036px;
    margin: 0 auto;
    justify-content: unset;
    padding-left: 0px;
    padding-right: 0px;
    gap: 10px;
    flex-wrap: wrap;
}


.aggregate-input {
    max-width: 100px;
    color: black;
}

.arrow-panel-title {
    color: black;
    font-size: 22px;
}

.fixed-toolbar.page-toolbar {
    height: 50px;
}

@media (max-width: 991px) {
    .fixed-toolbar .sticky-text-hiden {
        display: none !important;
    }

    .container-tabs {
        max-height: unset;
        margin-top: 80px
    }
    .display-none{
        display: none !important;
    }
}

#drawer-search .input-group-addon {
    font-size: 14px;
    font-weight: 400;
    line-height: 1;
    color: #555555;
    text-align: center;
    background-color: #eeeeee;
    border-radius: 4px;
    width: 70px;
    padding: 0 3px 0 0;
}

#divToScroll.ajust_cards {
    -ms-overflow-style: none;  /* Internet Explorer 10+ */
    scrollbar-width: none;  /* Firefox */
    overflow: scroll;
}

#divToScroll.ajust_cards::-webkit-scrollbar {
    display: none;  /* Safari and Chrome */
}

.hide-y-bar::-webkit-scrollbar {
    display: none;
}

/* Hide scrollbar for IE and Edge */
.hide-y-bar {
    -ms-overflow-style: none;
}

/* Hide scrollbar for Firefox */
.hide-y-bar {
    scrollbar-width: none;
}

.drawer__content.iframe-drawer {
    padding: 0 !important;
}

.drawer__content iframe {
    height: 100% !important;
    width: 100% !important;
    background-color: #eee;
}

@media screen and (max-width: 767px) {
    .table-responsive {
        border: unset !important;
        margin-top: 10px;
    }
}

.iframe.taskssearch,
.iframe.processsearch
{
    background-color: #fff;
}

.iframe.taskssearch,
.iframe.processsearch,
.iframe.orgstats
{
    overflow-x: hidden !important;
}

.iframe.adhoctramitar {
    overflow: hidden !important;
}

/*.iframe.adhoctramitar*/
/*{*/
/*    overflow-y: hidden !important;*/
/*}*/

.iframe.taskssearch .header,
.iframe.processsearch .header
{ display: none; }

.iframe.taskssearch .tasks-tools-views { display: none; }
.iframe.taskssearch .tasks-processes { display: none; }

.iframe.taskssearch .page-header,
.iframe.processsearch .page-header,
.iframe.orgstats .page-header
{
    margin-top: 0 !important;
}

.iframe.taskssearch.page-header-fixed,
.iframe.processsearch.page-header-fixed,
.iframe.orgstats.page-header-fixed
{
    padding-top: 0 !important;
}

.tasks-tools-add {
    margin-left: auto !important;
}

.iframe.taskssearch .tasks-tools-add {
    margin-bottom: 10px !important;
    margin-right: 15px !important;
}

.iframe.taskssearch .email-time {
    margin-top: 0px !important;
}

.execute-button {
    font-family: 'Inter';
    font-style: normal;
    font-weight: 400;
    font-size: 16px;
    line-height: 120%;
}

.iframe.taskssearch .execute-group{
    margin-top: -5px !important;
}

.iframe.taskssearch .pg_search {
    margin-left: 0px !important;
    padding: 0 !important;
}

.iframe.processsearch .pg_search {
    margin-left: 0px !important;
    padding: 0 !important;
    padding-right: 40px !important;
}

.iframe.orgstats .pg_search {
    margin-left: 0px !important;
}

.iframe.orgstats .dashboard-container {
    width: 94vw !important;
}

.iframe.orgstats .dashboard-header {
    padding-left: 20px !important;
}

.iframe.taskssearch .paddingmobile,
.iframe.processsearch .paddingmobile
{
    margin-left: 0px !important;
    padding: 0 !important;
}


@media (min-width: 992px) {
    .tasks-tools-add {
        margin-right: 20px !important;
    }
    .float-button-start-process {
        display: none;
    }
    .button-start-process {
        display: unset;
    }
    .button-start-process-ul {
        right: auto;
        margin-top: 10px;
    }
}

@media (max-width: 991px) {
    .iframe.processsearch {
        width: 98% !important;
    }

    .iframe.processsearch .pg_search {
        padding-right: 3px !important;
    }

    .iframe.processsearch .modal-dialog {
        width: initial !important;
    }

    .iframe.orgstats .dashboard-header {
        padding-left: 26px !important;
    }

    .iframe.orgstats .dashboard-select {
        padding-left: 10px !important;
    }
}

.iframe.taskssearch .task_list_item {
    margin-left: 0px !important;
}

.iframe-arrow-back {
    display: none;
}

.iframe.adhoctramitar .iframe-arrow-back {
    display: block;
}

#openbtn-sidebar {
    margin-top: 3.8rem;
    z-index: 5;
}

.iframe.processsearch .sidebar-btn {
    top: -25px !important;
    margin-top: 2.8rem !important;
}

@media (max-width: 1004px)  {
    .action-panel {
        height: 97vh !important;
        overflow: hidden !important;
    }
    .scrolling-format {
        /*max-height: none !important;*/
        height: 75vh !important;
    }
}

.panel-scroll {
    overflow: hidden !important;
}

.responsive-img {
    width: 100%;
    height: auto;
}

.landscape-process {
    margin-top: 60px !important;
    height: 98% !important;
}

.portrait-process {
    margin-top: 70px !important;
    height: 98% !important;
}

/* Slim Select 2.7.0 */
:root{--ss-primary-color: #5897fb;--ss-bg-color: #ffffff;--ss-font-color: #4d4d4d;--ss-font-placeholder-color: #8d8d8d;--ss-disabled-color: #dcdee2;--ss-border-color: #dcdee2;--ss-highlight-color: #fffb8c;--ss-success-color: #00b755;--ss-error-color: #dc3545;--ss-focus-color: #5897fb;--ss-main-height: 30px;--ss-content-height: 300px;--ss-spacing-l: 7px;--ss-spacing-m: 5px;--ss-spacing-s: 3px;--ss-animation-timing: 0.2s;--ss-border-radius: 4px}@keyframes ss-valueIn{0%{transform:scale(0);opacity:0}100%{transform:scale(1);opacity:1}}@keyframes ss-valueOut{0%{transform:scale(1);opacity:1}100%{transform:scale(0);opacity:0}}.ss-hide{display:none !important}.ss-main{display:flex;flex-direction:row;position:relative;user-select:none;color:var(--ss-font-color);min-height:var(--ss-main-height);width:100%;padding:var(--ss-spacing-s);cursor:pointer;border:1px solid var(--ss-border-color);border-radius:var(--ss-border-radius);background-color:var(--ss-bg-color);outline:0;box-sizing:border-box;transition:background-color var(--ss-animation-timing);overflow:hidden}.ss-main:focus{box-shadow:0 0 5px var(--ss-focus-color)}.ss-main.ss-disabled{background-color:var(--ss-disabled-color);cursor:not-allowed}.ss-main.ss-disabled .ss-values .ss-disabled{color:var(--ss-font-color)}.ss-main.ss-disabled .ss-values .ss-value .ss-value-delete{cursor:not-allowed}.ss-main.ss-open-above{border-top-left-radius:0px;border-top-right-radius:0px}.ss-main.ss-open-below{border-bottom-left-radius:0px;border-bottom-right-radius:0px}.ss-main .ss-values{display:inline-flex;flex-wrap:wrap;gap:var(--ss-spacing-m);flex:1 1 100%}.ss-main .ss-values .ss-placeholder{display:flex;padding:var(--ss-spacing-s) var(--ss-spacing-m) var(--ss-spacing-s) var(--ss-spacing-m);margin:auto 0px auto 0px;line-height:1em;align-items:center;width:100%;color:var(--ss-font-placeholder-color);overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.ss-main .ss-values .ss-max{display:flex;user-select:none;align-items:center;width:fit-content;font-size:12px;color:var(--ss-bg-color);line-height:1;padding:var(--ss-spacing-s) var(--ss-spacing-m);background-color:var(--ss-primary-color);border-radius:var(--ss-border-radius)}.ss-main .ss-values .ss-single{display:flex;margin:auto 0px auto var(--ss-spacing-s)}.ss-main .ss-values .ss-value{display:flex;user-select:none;align-items:center;width:fit-content;background-color:var(--ss-primary-color);border-radius:var(--ss-border-radius);animation-name:ss-valueIn;animation-duration:var(--ss-animation-timing);animation-timing-function:ease-out;animation-fill-mode:both}.ss-main .ss-values .ss-value.ss-value-out{animation-name:ss-valueOut;animation-duration:var(--ss-animation-timing);animation-timing-function:ease-out}.ss-main .ss-values .ss-value .ss-value-text{font-size:12px;color:var(--ss-bg-color);line-height:1;padding:var(--ss-spacing-s) var(--ss-spacing-m)}.ss-main .ss-values .ss-value .ss-value-delete{display:flex;align-items:center;height:var(--ss-spacing-l);width:var(--ss-spacing-l);padding:var(--ss-spacing-s) var(--ss-spacing-m);cursor:pointer;border-left:solid 1px var(--ss-bg-color);box-sizing:content-box}.ss-main .ss-values .ss-value .ss-value-delete svg{height:var(--ss-spacing-l);width:var(--ss-spacing-l)}.ss-main .ss-values .ss-value .ss-value-delete svg path{fill:none;stroke:var(--ss-bg-color);stroke-width:18;stroke-linecap:round;stroke-linejoin:round}.ss-main .ss-deselect{display:flex;align-self:center;justify-content:flex-end;flex:0 1 auto;width:8px;height:8px;margin:0 var(--ss-spacing-m) 0 var(--ss-spacing-m)}.ss-main .ss-deselect svg{width:8px;height:8px}.ss-main .ss-deselect svg path{fill:none;stroke:var(--ss-font-color);stroke-width:20;stroke-linecap:round;stroke-linejoin:round}.ss-main .ss-arrow{display:flex;align-items:center;justify-content:flex-end;flex:0 1 auto;width:12px;height:12px;margin:auto var(--ss-spacing-m) auto var(--ss-spacing-m)}.ss-main .ss-arrow path{fill:none;stroke:var(--ss-font-color);stroke-width:18;stroke-linecap:round;stroke-linejoin:round;transition-timing-function:ease-out;transition:var(--ss-animation-timing)}.ss-content{position:absolute;display:flex;height:auto;flex-direction:column;width:auto;max-height:var(--ss-content-height);box-sizing:border-box;border:solid 1px var(--ss-border-color);background-color:var(--ss-bg-color);transition:transform var(--ss-animation-timing),opacity var(--ss-animation-timing);opacity:0;transform:scaleY(0);transform-origin:center top;overflow:hidden;z-index:10000}.ss-content.ss-relative{position:relative;height:100%}.ss-content.ss-open-above{flex-direction:column-reverse;opacity:1;transform:scaleY(1);transform-origin:center bottom;border-top-left-radius:var(--ss-border-radius);border-top-right-radius:var(--ss-border-radius)}.ss-content.ss-open-below{opacity:1;transform:scaleY(1);transform-origin:center top;border-bottom-left-radius:var(--ss-border-radius);border-bottom-right-radius:var(--ss-border-radius)}.ss-content .ss-search{flex:0 1 auto;display:flex;flex-direction:row;padding:var(--ss-spacing-l) var(--ss-spacing-l) var(--ss-spacing-m) var(--ss-spacing-l)}.ss-content .ss-search input{display:inline-flex;font-size:inherit;line-height:inherit;flex:1 1 auto;width:100%;min-width:0px;padding:var(--ss-spacing-m) var(--ss-spacing-l);margin:0;border:1px solid var(--ss-border-color);border-radius:var(--ss-border-radius);background-color:var(--ss-bg-color);outline:0;text-align:left;box-sizing:border-box}.ss-content .ss-search input::placeholder{color:var(--ss-font-placeholder-color);vertical-align:middle}.ss-content .ss-search input:focus{box-shadow:0 0 5px var(--ss-focus-color)}.ss-content .ss-search .ss-addable{display:inline-flex;justify-content:center;align-items:center;cursor:pointer;flex:0 0 auto;height:auto;margin:0 0 0 var(--ss-spacing-m);border:1px solid var(--ss-border-color);border-radius:var(--ss-border-radius)}.ss-content .ss-search .ss-addable svg{display:flex;align-items:center;justify-content:flex-end;flex:0 1 auto;width:12px;height:12px;margin:auto var(--ss-spacing-m) auto var(--ss-spacing-m)}.ss-content .ss-search .ss-addable svg path{fill:none;stroke:var(--ss-font-color);stroke-width:18;stroke-linecap:round;stroke-linejoin:round}.ss-content .ss-list{flex:1 1 auto;height:auto;overflow-x:hidden;overflow-y:auto}.ss-content .ss-list .ss-error{color:var(--ss-error-color);padding:var(--ss-spacing-l)}.ss-content .ss-list .ss-searching{color:var(--ss-font-color);padding:var(--ss-spacing-l)}.ss-content .ss-list .ss-optgroup.ss-close .ss-option{display:none !important}.ss-content .ss-list .ss-optgroup .ss-optgroup-label{display:flex;flex-direction:row;align-items:center;justify-content:space-between;padding:var(--ss-spacing-m) var(--ss-spacing-l) var(--ss-spacing-m) var(--ss-spacing-l)}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-label-text{flex:1 1 auto;font-weight:bold;color:var(--ss-font-color)}.ss-content .ss-list .ss-optgroup .ss-optgroup-label:has(.ss-arrow){cursor:pointer}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions{flex:0 1 auto;display:flex;flex-direction:row;align-items:center;justify-content:center;gap:var(--ss-spacing-m)}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall{flex:0 0 auto;display:flex;flex-direction:row;cursor:pointer}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall:hover{opacity:.5}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall.ss-selected svg path{stroke:var(--ss-error-color)}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall span{flex:0 1 auto;display:flex;align-items:center;justify-content:center;font-size:60%;text-align:center;padding:0 var(--ss-spacing-s) 0 0}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall svg{flex:0 1 auto;width:13px;height:13px}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall svg path{fill:none;stroke:var(--ss-success-color);stroke-linecap:round;stroke-linejoin:round}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall svg:first-child{stroke-width:5}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-selectall svg:last-child{stroke-width:11}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-closable{flex:0 1 auto;display:flex;flex-direction:row;cursor:pointer}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-closable .ss-arrow{flex:1 1 auto;width:10px;height:10px}.ss-content .ss-list .ss-optgroup .ss-optgroup-label .ss-optgroup-actions .ss-closable .ss-arrow path{fill:none;stroke:var(--ss-font-color);stroke-width:18;stroke-linecap:round;stroke-linejoin:round;transition-timing-function:ease-out;transition:var(--ss-animation-timing)}.ss-content .ss-list .ss-optgroup .ss-option{padding:var(--ss-spacing-s) var(--ss-spacing-s) var(--ss-spacing-s) calc(var(--ss-spacing-l)*3)}.ss-content .ss-list .ss-option{display:flex;padding:var(--ss-spacing-m) var(--ss-spacing-l) var(--ss-spacing-m) var(--ss-spacing-l);color:var(--ss-font-color);cursor:pointer;user-select:none}.ss-content .ss-list .ss-option:hover{color:var(--ss-bg-color);background-color:var(--ss-primary-color)}.ss-content .ss-list .ss-option.ss-highlighted,.ss-content .ss-list .ss-option:not(.ss-disabled).ss-selected{color:var(--ss-bg-color);background-color:var(--ss-primary-color)}.ss-content .ss-list .ss-option.ss-disabled{cursor:not-allowed;background-color:var(--ss-disabled-color)}.ss-content .ss-list .ss-option.ss-disabled:hover{color:var(--ss-font-color)}.ss-content .ss-list .ss-option .ss-search-highlight{background-color:var(--ss-highlight-color)}